diff --git a/index.js b/index.js
new file mode 100755
index 00000000..72bc6a5f
--- /dev/null
+++ b/index.js
@@ -0,0 +1,28 @@
+
+var express = require('express');
+var app = express();
+var server = require('http').createServer(app);
+var io = require('socket.io')(server);
+var port = 3000;
+
+server.listen(port, function () {
+ console.log('Server listening at port %d', port);
+});
+
+
+io.on('connection', function(socket){
+ console.log('a user connected');
+ socket.on('disconnect', function()
+ {
+ io.emit("list_update", "update");
+ });
+ socket.on('chat message', function(msg){
+ console.log('message: ' + msg);
+ io.emit('chat message', msg);
+ });
+ socket.on('list', function(msg)
+ {
+ console.log('userlist: '+msg);
+ io.emit("list_update", "update");
+ });
+});
diff --git a/index.php b/index.php
index b9ca3e98..ee086be7 100755
--- a/index.php
+++ b/index.php
@@ -11,6 +11,14 @@
xmlns:fb="http://ogp.me/ns/fb#">
+
+
+
+
diff --git a/js/jazzscript.js b/js/jazzscript.js
old mode 100644
new mode 100755
diff --git a/js/list.js b/js/list.js
index c364c26c..34e62e0c 100755
--- a/js/list.js
+++ b/js/list.js
@@ -7,53 +7,64 @@ var showToggle =true;
var chan = $("#chan").html();
var hasadmin=0;
-function updateList()
+socket.on(guid, function(msg){
+ populate_list(msg);
+});
+
+socket.on("abc", function(){
+ alert("alert");
+});
+
+socket.on(chan.toLowerCase(), function(msg){
+ populate_list(msg);
+});
+
+function populate_list(msg)
{
- console.log("updating list");
- list = $.ajax({ type: "GET",
- url: "php/change.php",
- async: false
- }).responseText;
- list = $.parseJSON(list);
- conf = list.conf;
- if(conf.hasOwnProperty("addsongs") && conf.addsongs == "true") adminadd = 1;
- else adminadd = 0;
- if(conf.hasOwnProperty("allvideos") && conf.allvideos == "true") music = 1;
- else music = 0;
- if(conf.hasOwnProperty("longsongs") && conf.longsongs == "true") longS = 1;
- else longS = 0;
- if(conf.hasOwnProperty("vote") && conf.vote == "true") adminvote = 1;
- else adminvote = 0;
- if(conf.hasOwnProperty("adminpass") && conf.adminpass !== '') hasadmin = 1;
- else hasadmin = 0;
- /*list[0].shift();
- list[3].shift();
- list[2].shift();*/
-
- setTimeout(function()
+ console.log(msg);
+ for(obj in msg)
{
+ console.log(msg[obj]);
+ }
+ /*list = msg[0];
+ conf = list.conf;*/
- $("#wrapper").empty();
+ $("#wrapper").empty();
- $.each(list.songs, function(j, listeID){
- var video_title=listeID.title.replace(/\\\'/g, "'").replace(/"/g,"'").replace(/&/g,"&");
- var video_id = listeID.id;
- if(find && $.inArray(video_id, bright) == -1) brightness = "brightness";
- else if(find && $.inArray(video_id, bright) != -1) brightness = "brightness fullbrightness";
- else brightness = "";
- var video_thumb = "http://i.ytimg.com/vi/"+video_id+"/mqdefault.jpg";
- var odd = ""; if(j%2===0)odd=" oddlist";
- var delsong = ""; if(pass_corr=="correct")delsong="";
- var finalhtml=""+
- "

"+
- "
"+video_title+"
"+
- "
"+listeID.votes+
- "
+"+
- "
-"+
- delsong+
- "
"+
- "
";
- $("#wrapper").append(finalhtml);
+ $.each(msg, function(j, listeID){
+ if(listeID.hasOwnProperty('startTime'))
+ {
+ console.log("startTime");
+ if(listeID.hasOwnProperty("addsongs") && listeID.addsongs == "true") adminadd = 1;
+ else adminadd = 0;
+ if(listeID.hasOwnProperty("allvideos") && listeID.allvideos == "true") music = 1;
+ else music = 0;
+ if(listeID.hasOwnProperty("longsongs") && listeID.longsongs == "true") longS = 1;
+ else longS = 0;
+ if(listeID.hasOwnProperty("vote") && listeID.vote == "true") adminvote = 1;
+ else adminvote = 0;
+ if(listeID.hasOwnProperty("adminpass") && listeID.adminpass !== '') hasadmin = 1;
+ else hasadmin = 0;
+ }else if(!listeID.now_playing){
+ var video_title=listeID.title.replace(/\\\'/g, "'").replace(/"/g,"'").replace(/&/g,"&");
+ var video_id = listeID.id;
+ if(find && $.inArray(video_id, bright) == -1) brightness = "brightness";
+ else if(find && $.inArray(video_id, bright) != -1) brightness = "brightness fullbrightness";
+ else brightness = "";
+ var video_thumb = "http://i.ytimg.com/vi/"+video_id+"/mqdefault.jpg";
+ var odd = ""; if(j%2===0)odd=" oddlist";
+ var delsong = ""; if(pass_corr=="correct")delsong="";
+ var finalhtml=""+
+ "

"+
+ "
"+video_title+"
"+
+ "
"+listeID.votes+
+ "
+"+
+ "
-"+
+ delsong+
+ "
"+
+ "
";
+ $("#wrapper").append(finalhtml);
+ }
});
if($("#playlist").height() != $("#player").height() || (peis && $("#playlist").height() != $("#jplayer").height()))
{
@@ -104,17 +115,23 @@ function updateList()
$("#settings").css("visibility", "visible");
$("#settings").css("opacity", "0.7");
$("#wrapper").css("opacity", "1");
- }, 2500);
+}
+
+function updateList()
+{
+
}
function vote(id, vote){
+ socket.emit('vote', [chan, id, vote, guid]);
+
serverAns = ($.ajax({
type: "GET",
url: "php/change.php",
async: false,
data: "vote="+vote+"&id="+id+"&pass="+adminpass,
success: function() {
- console.log("voted "+vote+" on "+id);
+ //console.log("voted "+vote+" on "+id);
/*if(vote=="pos"){ $("#playlist").addClass("success");}
else{ $("#playlist").addClass("fadeerror");}
updateList();*/
@@ -139,13 +156,15 @@ function vote(id, vote){
}
function skip(){
+ socket.emit('skip', [chan, guid]);
+
voteRes = ($.ajax({
type: "GET",
url: "php/change.php",
async: false,
data: "skip",
success: function() {
- console.log("voted to skip song");
+ //console.log("voted to skip song");
//$("#search").addClass("success");
updateList();
},
diff --git a/js/playercontrols.js b/js/playercontrols.js
index 856d280a..fc3f89c9 100755
--- a/js/playercontrols.js
+++ b/js/playercontrols.js
@@ -101,6 +101,7 @@ function initSlider()
setVolume(ui.value);
}
});
+ ytplayer.mute();
$("#volume").slider("value", ytplayer.getVolume());
}
diff --git a/js/youtube.js b/js/youtube.js
index d3687bac..a3359e99 100755
--- a/js/youtube.js
+++ b/js/youtube.js
@@ -60,12 +60,12 @@ $(document).ready(function()
}).responseText;
//console.log(response);
response = $.parseJSON(response);
- console.log(response.nowPlaying.length);
+ //console.log(response.nowPlaying.length);
conf = response.conf;
- console.log(conf);
+ //console.log(conf);
try{
for(var first in response.nowPlaying) break;
- console.log(first);
+ //console.log(first);
response = first;
}catch(err){
response = "1";
@@ -131,18 +131,18 @@ function onYouTubeIframeAPIReady() {
}
function onPlayerStateChange(newState) {
- console.log("new state: "+newState.data);
- console.log("beginning: "+beginning);
+ //console.log("new state: "+newState.data);
+ //console.log("beginning: "+beginning);
//ytplayer.seekTo(15);
if((newState.data === 0 && checkEnd()) || (newState.data == 1 && checkEnd()))
{
- console.log("nummer 1");
+ //console.log("nummer 1");
startNextSong();
ytplayer.pauseVideo();
wasPaused = false;
}else if(newState.data == 1 && (wasPaused && !beginning))
{
- console.log("unpaused");
+ //console.log("unpaused");
beginning = false;
wasPaused = false;
if(!syncInterval)
@@ -158,7 +158,7 @@ function onPlayerStateChange(newState) {
if(newState.data == 1 || newState.data == 2)
{
activeButton = document.getElementById("playpause").className;
- console.log(activeButton);
+ //console.log(activeButton);
if((newState.data == 2 && activeButton == "pause") || (newState.data == 1 && activeButton == "play"))
{
$("#playpause").toggleClass("play");
@@ -168,9 +168,9 @@ function onPlayerStateChange(newState) {
if(newState.data === 0)
{
quickFixCountdown = setTimeout(function(){
- console.log("trying quickfix");
+ //console.log("trying quickfix");
if(ytplayer.getPlayerState() === 0){
- console.log("quickfixPlay");
+ //console.log("quickfixPlay");
startNextSong();
wasPaused = false;
}
@@ -180,7 +180,7 @@ function onPlayerStateChange(newState) {
function checkEnd()
{
- console.log("sjekker om brukeren spolte");
+ //console.log("sjekker om brukeren spolte");
$.ajax({
type: 'get',
url: 'php/timedifference.php',
@@ -211,12 +211,12 @@ function startNextSong()
data: "thisUrl="+response+"&act=save",
success: function() {
- console.log("saved song-switch - "+response);
+ //console.log("saved song-switch - "+response);
}
}).responseText;
arr = $.parseJSON(arr);
response = arr.id;
- console.log("next video: "+response);
+ //console.log("next video: "+response);
getTitle(response);
if(!window.mobilecheck())
{
@@ -235,7 +235,7 @@ function startNextSong()
if(!syncInterval)
syncInterval = setInterval(getTime, 5000);
interval = true;
- console.log("starter intervallen. Interval: " + interval);
+ //console.log("starter intervallen. Interval: " + interval);
}, 2500);
}
@@ -243,11 +243,11 @@ function startNextSong()
function getTime()
{
- console.log("utenfor if test" + wasPaused);
+ //console.log("utenfor if test" + wasPaused);
if(!window.mobilecheck() && ytplayer.getCurrentTime() > 2 && ytplayer.getPlayerState() == 1) wasPaused = false;
if(!wasPaused)
{
- console.log("sjekker om brukeren spolte");
+ //console.log("sjekker om brukeren spolte");
$.ajax({
type: 'get',
@@ -258,8 +258,8 @@ function getTime()
timeDifference = $.parseJSON(data);
}
});
- console.log("current song: "+response);
- console.log("song in database: "+timeDifference[1]);
+ //console.log("current song: "+response);
+ //console.log("song in database: "+timeDifference[1]);
if(!window.mobilecheck()){ //Added so the mobileversion will change banner
if(parseInt(timeDifference[2]) + 1> ytplayer.getCurrentTime() + parseInt(timeDifference[3]) && ytplayer.getPlayerState() === 0)
{
@@ -268,7 +268,7 @@ function getTime()
{
if(parseInt(timeDifference[0]) > ytplayer.getDuration())
{
- console.log("burde ikke søke, men hoppe til neste sang");
+ //console.log("burde ikke søke, men hoppe til neste sang");
}
ytplayer.seekTo(timeDifference[0]);
ytplayer.pauseVideo();
@@ -283,7 +283,7 @@ function getTime()
{
//clearInterval(syncInterval);
wasPaused = true;
- console.log("forskjellige videoer!!");
+ //console.log("forskjellige videoer!!");
if(!window.mobilecheck())
{
ytplayer.pauseVideo();
@@ -354,7 +354,7 @@ function errorHandler(newState)
data: "thisUrl="+response+"&act=empty",
success: function() {
- console.log("error! deleted video");
+ //console.log("error! deleted video");
}
}).responseText;
arr = $.parseJSON(arr);
@@ -410,7 +410,7 @@ function setBGimage(id){
var bg = new Image();
bg.src = "http://img.youtube.com/vi/"+id+"/0.jpg";
$("#bgimage").addClass("noopacity");
- console.log(bg);
+ //console.log(bg);
bg.addEventListener("load", function(){
setTimeout(function(){
$("#bgimage").css("background-image", "url("+bg.src+")");
diff --git a/nochan.php b/nochan.php
new file mode 100755
index 00000000..fdcd9122
--- /dev/null
+++ b/nochan.php
@@ -0,0 +1,150 @@
+ $to)
+ {
+ $file = file_get_contents($files);
+ $data = json_decode($file, TRUE);
+ $q = array_values($data["nowPlaying"]);
+ /*if($q[0]["id"] == "30H2Z8Lr-4c");
+ unlink("./lists/".$files);*/
+ }
+ if($time_lasted < $time){
+ $file = file_get_contents($files); //Checking if the channel has the setting for showing on the frontpage set to true.
+ $data = json_decode($file, TRUE);
+ if($i <= 12 && (!array_key_exists("frontpage", $data['conf']) || $data['conf']['frontpage'] == "true")){ //If it is true, the channelname will be shown on the frontpage
+ array_push($channels, ucfirst(str_replace(".json", "", $files)));
+ array_push($viewers, sizeof($data["conf"]["views"]));
+ }
+ }
+ $i++;
+ array_push($all_channels, ucfirst(str_replace(".json", "", $files)));
+ }
+}
+
+?>
+
+
+
+
+
+
+
+
+
+
+

+
Zöff
+
+
+
+
+ Active Channels
+ ".htmlspecialchars($channel).""; $v++;} ?>
+
+
+
+
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/server/index.html b/server/index.html
new file mode 100755
index 00000000..fb1c3e7a
--- /dev/null
+++ b/server/index.html
@@ -0,0 +1,36 @@
+
+
+
+ Socket.IO chat
+
+
+
+
+
+
+
+
+
+
\ No newline at end of file
diff --git a/server/index.js b/server/index.js
new file mode 100755
index 00000000..8570cbdc
--- /dev/null
+++ b/server/index.js
@@ -0,0 +1,135 @@
+
+var express = require('express');
+var app = express();
+var server = require('http').createServer(app);
+var io = require('socket.io')(server);
+
+//db
+var mongojs = require('mongojs');
+var db = mongojs.connect('mydb', ['kasper']);
+
+var port = 3000;
+var lists = [];
+
+server.listen(port, function () {
+ console.log('Server listening at port %d', port);
+});
+
+
+io.on('connection', function(socket){
+
+ var coll;
+ var guid;
+
+ socket.on('list', function(list)
+ {
+ list = list.split(',');
+ coll = list[0].toLowerCase();
+ guid = list[1];
+
+ console.log("user connected to list: " + list[0]);
+ if(lists[list[0]] == undefined)
+ {
+ lists[list[0]] = [];
+ lists[list[0]].push(socket);
+ }else lists[list[0]].push(socket);
+ console.log(lists[list[0]].length);
+
+ db.collection(coll).find({views:{$exists : true}}, function(err, docs){
+ if(!contains(docs[0]["views"], guid))
+ {
+ db.collection(coll).update({views:{$exists : true}}, {$push:{views:guid}}, function(err, docs){
+ db.collection(list[0]).find().sort({added:-1}, function(err, docs) {
+ console.log(docs);
+ socket.emit(list[1], docs);
+ });
+ });
+ }else
+ {
+ db.collection(list[0]).find().sort({added:-1}, function(err, docs) {
+ console.log(docs);
+ socket.emit(list[1], docs);
+ });
+ }
+ });
+
+ });
+
+ socket.on('vote', function(msg)
+ {
+ console.log("vote on list: " + msg[0].toLowerCase());
+ var id = msg[1];
+ guid = msg[3];
+
+ db.collection(coll).find({id:id}, function(err, docs){
+ if(contains(docs[0]["guids"], guid))
+ {
+ db.collection(coll).update({id:id}, {$inc:{votes:1}}, function(err, docs)
+ {
+ /*db.collection(coll).update({id:id}, {$push :{guids: guid}}, function(err, docs)
+ {
+ db.collection(coll).find().sort({votes:-1}, function(err, docs)
+ {
+ console.log(docs);
+ for(x in lists[coll])
+ {
+ lists[coll][x].emit(coll, docs);
+ }
+ });
+ });*/
+ db.collection(coll).find().sort({votes:-1}, function(err, docs)
+ {
+ console.log(docs);
+ for(x in lists[coll])
+ {
+ lists[coll][x].emit(coll, docs);
+ }
+ });
+ });
+ }
+ });
+
+ });
+
+ socket.on('skip', function(list)
+ {
+ console.log("skip on list: " + list);
+ var coll = list[0].toLowerCase();
+ db.collection(coll).find({skip: "true"}, function(err, docs){
+ if(docs.length == 1)
+ {
+ if(docs[0]["views"].length/2 <= docs[0]["skips"]+1)
+ {
+ //aggregationfunction to update now playing and the next boolean values
+ //Also flush skips array so its length = 0
+ }
+ }
+ });
+ });
+
+ socket.on('disconnect', function()
+ {
+ try
+ {
+ var index = lists[coll].indexOf(socket);
+ lists.splice(index, 1);
+ }catch(err){}
+ /*db.collection(coll).update({guids: guid},{$pull: {guids: guid}}, {multi: true}, function(err, docs)
+ {});
+ db.collection(coll).update({skips: guid},{$pull: {skips: guid}}, {multi: true}, function(err, docs)
+ {});*/
+ db.collection(coll).update({views: guid},{$pull: {views: guid}}, {multi: true}, function(err, docs)
+ {});
+ });
+
+});
+
+function contains(a, obj) {
+ var i = a.length;
+ while (i--) {
+ if (a[i] === obj) {
+ return true;
+ }
+ }
+ return false;
+}
\ No newline at end of file
diff --git a/server/node_modules/express/History.md b/server/node_modules/express/History.md
new file mode 100755
index 00000000..6c232529
--- /dev/null
+++ b/server/node_modules/express/History.md
@@ -0,0 +1,2466 @@
+4.10.2 / 2014-11-09
+===================
+
+ * Correctly invoke async router callback asynchronously
+ * deps: accepts@~1.1.3
+ - deps: mime-types@~2.0.3
+ * deps: type-is@~1.5.3
+ - deps: mime-types@~2.0.3
+
+4.10.1 / 2014-10-28
+===================
+
+ * Fix handling of URLs containing `://` in the path
+ * deps: qs@2.3.2
+ - Fix parsing of mixed objects and values
+
+4.10.0 / 2014-10-23
+===================
+
+ * Add support for `app.set('views', array)`
+ - Views are looked up in sequence in array of directories
+ * Fix `res.send(status)` to mention `res.sendStatus(status)`
+ * Fix handling of invalid empty URLs
+ * Use `content-disposition` module for `res.attachment`/`res.download`
+ - Sends standards-compliant `Content-Disposition` header
+ - Full Unicode support
+ * Use `path.resolve` in view lookup
+ * deps: debug@~2.1.0
+ - Implement `DEBUG_FD` env variable support
+ * deps: depd@~1.0.0
+ * deps: etag@~1.5.0
+ - Improve string performance
+ - Slightly improve speed for weak ETags over 1KB
+ * deps: finalhandler@0.3.2
+ - Terminate in progress response only on error
+ - Use `on-finished` to determine request status
+ - deps: debug@~2.1.0
+ - deps: on-finished@~2.1.1
+ * deps: on-finished@~2.1.1
+ - Fix handling of pipelined requests
+ * deps: qs@2.3.0
+ - Fix parsing of mixed implicit and explicit arrays
+ * deps: send@0.10.1
+ - deps: debug@~2.1.0
+ - deps: depd@~1.0.0
+ - deps: etag@~1.5.0
+ - deps: on-finished@~2.1.1
+ * deps: serve-static@~1.7.1
+ - deps: send@0.10.1
+
+4.9.8 / 2014-10-17
+==================
+
+ * Fix `res.redirect` body when redirect status specified
+ * deps: accepts@~1.1.2
+ - Fix error when media type has invalid parameter
+ - deps: negotiator@0.4.9
+
+4.9.7 / 2014-10-10
+==================
+
+ * Fix using same param name in array of paths
+
+4.9.6 / 2014-10-08
+==================
+
+ * deps: accepts@~1.1.1
+ - deps: mime-types@~2.0.2
+ - deps: negotiator@0.4.8
+ * deps: serve-static@~1.6.4
+ - Fix redirect loop when index file serving disabled
+ * deps: type-is@~1.5.2
+ - deps: mime-types@~2.0.2
+
+4.9.5 / 2014-09-24
+==================
+
+ * deps: etag@~1.4.0
+ * deps: proxy-addr@~1.0.3
+ - Use `forwarded` npm module
+ * deps: send@0.9.3
+ - deps: etag@~1.4.0
+ * deps: serve-static@~1.6.3
+ - deps: send@0.9.3
+
+4.9.4 / 2014-09-19
+==================
+
+ * deps: qs@2.2.4
+ - Fix issue with object keys starting with numbers truncated
+
+4.9.3 / 2014-09-18
+==================
+
+ * deps: proxy-addr@~1.0.2
+ - Fix a global leak when multiple subnets are trusted
+ - deps: ipaddr.js@0.1.3
+
+4.9.2 / 2014-09-17
+==================
+
+ * Fix regression for empty string `path` in `app.use`
+ * Fix `router.use` to accept array of middleware without path
+ * Improve error message for bad `app.use` arguments
+
+4.9.1 / 2014-09-16
+==================
+
+ * Fix `app.use` to accept array of middleware without path
+ * deps: depd@0.4.5
+ * deps: etag@~1.3.1
+ * deps: send@0.9.2
+ - deps: depd@0.4.5
+ - deps: etag@~1.3.1
+ - deps: range-parser@~1.0.2
+ * deps: serve-static@~1.6.2
+ - deps: send@0.9.2
+
+4.9.0 / 2014-09-08
+==================
+
+ * Add `res.sendStatus`
+ * Invoke callback for sendfile when client aborts
+ - Applies to `res.sendFile`, `res.sendfile`, and `res.download`
+ - `err` will be populated with request aborted error
+ * Support IP address host in `req.subdomains`
+ * Use `etag` to generate `ETag` headers
+ * deps: accepts@~1.1.0
+ - update `mime-types`
+ * deps: cookie-signature@1.0.5
+ * deps: debug@~2.0.0
+ * deps: finalhandler@0.2.0
+ - Set `X-Content-Type-Options: nosniff` header
+ - deps: debug@~2.0.0
+ * deps: fresh@0.2.4
+ * deps: media-typer@0.3.0
+ - Throw error when parameter format invalid on parse
+ * deps: qs@2.2.3
+ - Fix issue where first empty value in array is discarded
+ * deps: range-parser@~1.0.2
+ * deps: send@0.9.1
+ - Add `lastModified` option
+ - Use `etag` to generate `ETag` header
+ - deps: debug@~2.0.0
+ - deps: fresh@0.2.4
+ * deps: serve-static@~1.6.1
+ - Add `lastModified` option
+ - deps: send@0.9.1
+ * deps: type-is@~1.5.1
+ - fix `hasbody` to be true for `content-length: 0`
+ - deps: media-typer@0.3.0
+ - deps: mime-types@~2.0.1
+ * deps: vary@~1.0.0
+ - Accept valid `Vary` header string as `field`
+
+4.8.8 / 2014-09-04
+==================
+
+ * deps: send@0.8.5
+ - Fix a path traversal issue when using `root`
+ - Fix malicious path detection for empty string path
+ * deps: serve-static@~1.5.4
+ - deps: send@0.8.5
+
+4.8.7 / 2014-08-29
+==================
+
+ * deps: qs@2.2.2
+ - Remove unnecessary cloning
+
+4.8.6 / 2014-08-27
+==================
+
+ * deps: qs@2.2.0
+ - Array parsing fix
+ - Performance improvements
+
+4.8.5 / 2014-08-18
+==================
+
+ * deps: send@0.8.3
+ - deps: destroy@1.0.3
+ - deps: on-finished@2.1.0
+ * deps: serve-static@~1.5.3
+ - deps: send@0.8.3
+
+4.8.4 / 2014-08-14
+==================
+
+ * deps: qs@1.2.2
+ * deps: send@0.8.2
+ - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream`
+ * deps: serve-static@~1.5.2
+ - deps: send@0.8.2
+
+4.8.3 / 2014-08-10
+==================
+
+ * deps: parseurl@~1.3.0
+ * deps: qs@1.2.1
+ * deps: serve-static@~1.5.1
+ - Fix parsing of weird `req.originalUrl` values
+ - deps: parseurl@~1.3.0
+ - deps: utils-merge@1.0.0
+
+4.8.2 / 2014-08-07
+==================
+
+ * deps: qs@1.2.0
+ - Fix parsing array of objects
+
+4.8.1 / 2014-08-06
+==================
+
+ * fix incorrect deprecation warnings on `res.download`
+ * deps: qs@1.1.0
+ - Accept urlencoded square brackets
+ - Accept empty values in implicit array notation
+
+4.8.0 / 2014-08-05
+==================
+
+ * add `res.sendFile`
+ - accepts a file system path instead of a URL
+ - requires an absolute path or `root` option specified
+ * deprecate `res.sendfile` -- use `res.sendFile` instead
+ * support mounted app as any argument to `app.use()`
+ * deps: qs@1.0.2
+ - Complete rewrite
+ - Limits array length to 20
+ - Limits object depth to 5
+ - Limits parameters to 1,000
+ * deps: send@0.8.1
+ - Add `extensions` option
+ * deps: serve-static@~1.5.0
+ - Add `extensions` option
+ - deps: send@0.8.1
+
+4.7.4 / 2014-08-04
+==================
+
+ * fix `res.sendfile` regression for serving directory index files
+ * deps: send@0.7.4
+ - Fix incorrect 403 on Windows and Node.js 0.11
+ - Fix serving index files without root dir
+ * deps: serve-static@~1.4.4
+ - deps: send@0.7.4
+
+4.7.3 / 2014-08-04
+==================
+
+ * deps: send@0.7.3
+ - Fix incorrect 403 on Windows and Node.js 0.11
+ * deps: serve-static@~1.4.3
+ - Fix incorrect 403 on Windows and Node.js 0.11
+ - deps: send@0.7.3
+
+4.7.2 / 2014-07-27
+==================
+
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+ * deps: send@0.7.2
+ - deps: depd@0.4.4
+ * deps: serve-static@~1.4.2
+
+4.7.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+ * deps: send@0.7.1
+ - deps: depd@0.4.3
+ * deps: serve-static@~1.4.1
+
+4.7.0 / 2014-07-25
+==================
+
+ * fix `req.protocol` for proxy-direct connections
+ * configurable query parser with `app.set('query parser', parser)`
+ - `app.set('query parser', 'extended')` parse with "qs" module
+ - `app.set('query parser', 'simple')` parse with "querystring" core module
+ - `app.set('query parser', false)` disable query string parsing
+ - `app.set('query parser', true)` enable simple parsing
+ * deprecate `res.json(status, obj)` -- use `res.status(status).json(obj)` instead
+ * deprecate `res.jsonp(status, obj)` -- use `res.status(status).jsonp(obj)` instead
+ * deprecate `res.send(status, body)` -- use `res.status(status).send(body)` instead
+ * deps: debug@1.0.4
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+ * deps: finalhandler@0.1.0
+ - Respond after request fully read
+ - deps: debug@1.0.4
+ * deps: parseurl@~1.2.0
+ - Cache URLs based on original value
+ - Remove no-longer-needed URL mis-parse work-around
+ - Simplify the "fast-path" `RegExp`
+ * deps: send@0.7.0
+ - Add `dotfiles` option
+ - Cap `maxAge` value to 1 year
+ - deps: debug@1.0.4
+ - deps: depd@0.4.2
+ * deps: serve-static@~1.4.0
+ - deps: parseurl@~1.2.0
+ - deps: send@0.7.0
+ * perf: prevent multiple `Buffer` creation in `res.send`
+
+4.6.1 / 2014-07-12
+==================
+
+ * fix `subapp.mountpath` regression for `app.use(subapp)`
+
+4.6.0 / 2014-07-11
+==================
+
+ * accept multiple callbacks to `app.use()`
+ * add explicit "Rosetta Flash JSONP abuse" protection
+ - previous versions are not vulnerable; this is just explicit protection
+ * catch errors in multiple `req.param(name, fn)` handlers
+ * deprecate `res.redirect(url, status)` -- use `res.redirect(status, url)` instead
+ * fix `res.send(status, num)` to send `num` as json (not error)
+ * remove unnecessary escaping when `res.jsonp` returns JSON response
+ * support non-string `path` in `app.use(path, fn)`
+ - supports array of paths
+ - supports `RegExp`
+ * router: fix optimization on router exit
+ * router: refactor location of `try` blocks
+ * router: speed up standard `app.use(fn)`
+ * deps: debug@1.0.3
+ - Add support for multiple wildcards in namespaces
+ * deps: finalhandler@0.0.3
+ - deps: debug@1.0.3
+ * deps: methods@1.1.0
+ - add `CONNECT`
+ * deps: parseurl@~1.1.3
+ - faster parsing of href-only URLs
+ * deps: path-to-regexp@0.1.3
+ * deps: send@0.6.0
+ - deps: debug@1.0.3
+ * deps: serve-static@~1.3.2
+ - deps: parseurl@~1.1.3
+ - deps: send@0.6.0
+ * perf: fix arguments reassign deopt in some `res` methods
+
+4.5.1 / 2014-07-06
+==================
+
+ * fix routing regression when altering `req.method`
+
+4.5.0 / 2014-07-04
+==================
+
+ * add deprecation message to non-plural `req.accepts*`
+ * add deprecation message to `res.send(body, status)`
+ * add deprecation message to `res.vary()`
+ * add `headers` option to `res.sendfile`
+ - use to set headers on successful file transfer
+ * add `mergeParams` option to `Router`
+ - merges `req.params` from parent routes
+ * add `req.hostname` -- correct name for what `req.host` returns
+ * deprecate things with `depd` module
+ * deprecate `req.host` -- use `req.hostname` instead
+ * fix behavior when handling request without routes
+ * fix handling when `route.all` is only route
+ * invoke `router.param()` only when route matches
+ * restore `req.params` after invoking router
+ * use `finalhandler` for final response handling
+ * use `media-typer` to alter content-type charset
+ * deps: accepts@~1.0.7
+ * deps: send@0.5.0
+ - Accept string for `maxage` (converted by `ms`)
+ - Include link in default redirect response
+ * deps: serve-static@~1.3.0
+ - Accept string for `maxAge` (converted by `ms`)
+ - Add `setHeaders` option
+ - Include HTML link in redirect response
+ - deps: send@0.5.0
+ * deps: type-is@~1.3.2
+
+4.4.5 / 2014-06-26
+==================
+
+ * deps: cookie-signature@1.0.4
+ - fix for timing attacks
+
+4.4.4 / 2014-06-20
+==================
+
+ * fix `res.attachment` Unicode filenames in Safari
+ * fix "trim prefix" debug message in `express:router`
+ * deps: accepts@~1.0.5
+ * deps: buffer-crc32@0.2.3
+
+4.4.3 / 2014-06-11
+==================
+
+ * fix persistence of modified `req.params[name]` from `app.param()`
+ * deps: accepts@1.0.3
+ - deps: negotiator@0.4.6
+ * deps: debug@1.0.2
+ * deps: send@0.4.3
+ - Do not throw un-catchable error on file open race condition
+ - Use `escape-html` for HTML escaping
+ - deps: debug@1.0.2
+ - deps: finished@1.2.2
+ - deps: fresh@0.2.2
+ * deps: serve-static@1.2.3
+ - Do not throw un-catchable error on file open race condition
+ - deps: send@0.4.3
+
+4.4.2 / 2014-06-09
+==================
+
+ * fix catching errors from top-level handlers
+ * use `vary` module for `res.vary`
+ * deps: debug@1.0.1
+ * deps: proxy-addr@1.0.1
+ * deps: send@0.4.2
+ - fix "event emitter leak" warnings
+ - deps: debug@1.0.1
+ - deps: finished@1.2.1
+ * deps: serve-static@1.2.2
+ - fix "event emitter leak" warnings
+ - deps: send@0.4.2
+ * deps: type-is@1.2.1
+
+4.4.1 / 2014-06-02
+==================
+
+ * deps: methods@1.0.1
+ * deps: send@0.4.1
+ - Send `max-age` in `Cache-Control` in correct format
+ * deps: serve-static@1.2.1
+ - use `escape-html` for escaping
+ - deps: send@0.4.1
+
+4.4.0 / 2014-05-30
+==================
+
+ * custom etag control with `app.set('etag', val)`
+ - `app.set('etag', function(body, encoding){ return '"etag"' })` custom etag generation
+ - `app.set('etag', 'weak')` weak tag
+ - `app.set('etag', 'strong')` strong etag
+ - `app.set('etag', false)` turn off
+ - `app.set('etag', true)` standard etag
+ * mark `res.send` ETag as weak and reduce collisions
+ * update accepts to 1.0.2
+ - Fix interpretation when header not in request
+ * update send to 0.4.0
+ - Calculate ETag with md5 for reduced collisions
+ - Ignore stream errors after request ends
+ - deps: debug@0.8.1
+ * update serve-static to 1.2.0
+ - Calculate ETag with md5 for reduced collisions
+ - Ignore stream errors after request ends
+ - deps: send@0.4.0
+
+4.3.2 / 2014-05-28
+==================
+
+ * fix handling of errors from `router.param()` callbacks
+
+4.3.1 / 2014-05-23
+==================
+
+ * revert "fix behavior of multiple `app.VERB` for the same path"
+ - this caused a regression in the order of route execution
+
+4.3.0 / 2014-05-21
+==================
+
+ * add `req.baseUrl` to access the path stripped from `req.url` in routes
+ * fix behavior of multiple `app.VERB` for the same path
+ * fix issue routing requests among sub routers
+ * invoke `router.param()` only when necessary instead of every match
+ * proper proxy trust with `app.set('trust proxy', trust)`
+ - `app.set('trust proxy', 1)` trust first hop
+ - `app.set('trust proxy', 'loopback')` trust loopback addresses
+ - `app.set('trust proxy', '10.0.0.1')` trust single IP
+ - `app.set('trust proxy', '10.0.0.1/16')` trust subnet
+ - `app.set('trust proxy', '10.0.0.1, 10.0.0.2')` trust list
+ - `app.set('trust proxy', false)` turn off
+ - `app.set('trust proxy', true)` trust everything
+ * set proper `charset` in `Content-Type` for `res.send`
+ * update type-is to 1.2.0
+ - support suffix matching
+
+4.2.0 / 2014-05-11
+==================
+
+ * deprecate `app.del()` -- use `app.delete()` instead
+ * deprecate `res.json(obj, status)` -- use `res.json(status, obj)` instead
+ - the edge-case `res.json(status, num)` requires `res.status(status).json(num)`
+ * deprecate `res.jsonp(obj, status)` -- use `res.jsonp(status, obj)` instead
+ - the edge-case `res.jsonp(status, num)` requires `res.status(status).jsonp(num)`
+ * fix `req.next` when inside router instance
+ * include `ETag` header in `HEAD` requests
+ * keep previous `Content-Type` for `res.jsonp`
+ * support PURGE method
+ - add `app.purge`
+ - add `router.purge`
+ - include PURGE in `app.all`
+ * update debug to 0.8.0
+ - add `enable()` method
+ - change from stderr to stdout
+ * update methods to 1.0.0
+ - add PURGE
+
+4.1.2 / 2014-05-08
+==================
+
+ * fix `req.host` for IPv6 literals
+ * fix `res.jsonp` error if callback param is object
+
+4.1.1 / 2014-04-27
+==================
+
+ * fix package.json to reflect supported node version
+
+4.1.0 / 2014-04-24
+==================
+
+ * pass options from `res.sendfile` to `send`
+ * preserve casing of headers in `res.header` and `res.set`
+ * support unicode file names in `res.attachment` and `res.download`
+ * update accepts to 1.0.1
+ - deps: negotiator@0.4.0
+ * update cookie to 0.1.2
+ - Fix for maxAge == 0
+ - made compat with expires field
+ * update send to 0.3.0
+ - Accept API options in options object
+ - Coerce option types
+ - Control whether to generate etags
+ - Default directory access to 403 when index disabled
+ - Fix sending files with dots without root set
+ - Include file path in etag
+ - Make "Can't set headers after they are sent." catchable
+ - Send full entity-body for multi range requests
+ - Set etags to "weak"
+ - Support "If-Range" header
+ - Support multiple index paths
+ - deps: mime@1.2.11
+ * update serve-static to 1.1.0
+ - Accept options directly to `send` module
+ - Resolve relative paths at middleware setup
+ - Use parseurl to parse the URL from request
+ - deps: send@0.3.0
+ * update type-is to 1.1.0
+ - add non-array values support
+ - add `multipart` as a shorthand
+
+4.0.0 / 2014-04-09
+==================
+
+ * remove:
+ - node 0.8 support
+ - connect and connect's patches except for charset handling
+ - express(1) - moved to [express-generator](https://github.com/expressjs/generator)
+ - `express.createServer()` - it has been deprecated for a long time. Use `express()`
+ - `app.configure` - use logic in your own app code
+ - `app.router` - is removed
+ - `req.auth` - use `basic-auth` instead
+ - `req.accepted*` - use `req.accepts*()` instead
+ - `res.location` - relative URL resolution is removed
+ - `res.charset` - include the charset in the content type when using `res.set()`
+ - all bundled middleware except `static`
+ * change:
+ - `app.route` -> `app.mountpath` when mounting an express app in another express app
+ - `json spaces` no longer enabled by default in development
+ - `req.accepts*` -> `req.accepts*s` - i.e. `req.acceptsEncoding` -> `req.acceptsEncodings`
+ - `req.params` is now an object instead of an array
+ - `res.locals` is no longer a function. It is a plain js object. Treat it as such.
+ - `res.headerSent` -> `res.headersSent` to match node.js ServerResponse object
+ * refactor:
+ - `req.accepts*` with [accepts](https://github.com/expressjs/accepts)
+ - `req.is` with [type-is](https://github.com/expressjs/type-is)
+ - [path-to-regexp](https://github.com/component/path-to-regexp)
+ * add:
+ - `app.router()` - returns the app Router instance
+ - `app.route()` - Proxy to the app's `Router#route()` method to create a new route
+ - Router & Route - public API
+
+3.18.3 / 2014-11-09
+===================
+
+ * deps: connect@2.27.3
+ - Correctly invoke async callback asynchronously
+ - deps: csurf@~1.6.3
+
+3.18.2 / 2014-10-28
+===================
+
+ * deps: connect@2.27.2
+ - Fix handling of URLs containing `://` in the path
+ - deps: body-parser@~1.9.2
+ - deps: qs@2.3.2
+
+3.18.1 / 2014-10-22
+===================
+
+ * Fix internal `utils.merge` deprecation warnings
+ * deps: connect@2.27.1
+ - deps: body-parser@~1.9.1
+ - deps: express-session@~1.9.1
+ - deps: finalhandler@0.3.2
+ - deps: morgan@~1.4.1
+ - deps: qs@2.3.0
+ - deps: serve-static@~1.7.1
+ * deps: send@0.10.1
+ - deps: on-finished@~2.1.1
+
+3.18.0 / 2014-10-17
+===================
+
+ * Use `content-disposition` module for `res.attachment`/`res.download`
+ - Sends standards-compliant `Content-Disposition` header
+ - Full Unicode support
+ * Use `etag` module to generate `ETag` headers
+ * deps: connect@2.27.0
+ - Use `http-errors` module for creating errors
+ - Use `utils-merge` module for merging objects
+ - deps: body-parser@~1.9.0
+ - deps: compression@~1.2.0
+ - deps: connect-timeout@~1.4.0
+ - deps: debug@~2.1.0
+ - deps: depd@~1.0.0
+ - deps: express-session@~1.9.0
+ - deps: finalhandler@0.3.1
+ - deps: method-override@~2.3.0
+ - deps: morgan@~1.4.0
+ - deps: response-time@~2.2.0
+ - deps: serve-favicon@~2.1.6
+ - deps: serve-index@~1.5.0
+ - deps: serve-static@~1.7.0
+ * deps: debug@~2.1.0
+ - Implement `DEBUG_FD` env variable support
+ * deps: depd@~1.0.0
+ * deps: send@0.10.0
+ - deps: debug@~2.1.0
+ - deps: depd@~1.0.0
+ - deps: etag@~1.5.0
+
+3.17.8 / 2014-10-15
+===================
+
+ * deps: connect@2.26.6
+ - deps: compression@~1.1.2
+ - deps: csurf@~1.6.2
+ - deps: errorhandler@~1.2.2
+
+3.17.7 / 2014-10-08
+===================
+
+ * deps: connect@2.26.5
+ - Fix accepting non-object arguments to `logger`
+ - deps: serve-static@~1.6.4
+
+3.17.6 / 2014-10-02
+===================
+
+ * deps: connect@2.26.4
+ - deps: morgan@~1.3.2
+ - deps: type-is@~1.5.2
+
+3.17.5 / 2014-09-24
+===================
+
+ * deps: connect@2.26.3
+ - deps: body-parser@~1.8.4
+ - deps: serve-favicon@~2.1.5
+ - deps: serve-static@~1.6.3
+ * deps: proxy-addr@~1.0.3
+ - Use `forwarded` npm module
+ * deps: send@0.9.3
+ - deps: etag@~1.4.0
+
+3.17.4 / 2014-09-19
+===================
+
+ * deps: connect@2.26.2
+ - deps: body-parser@~1.8.3
+ - deps: qs@2.2.4
+
+3.17.3 / 2014-09-18
+===================
+
+ * deps: proxy-addr@~1.0.2
+ - Fix a global leak when multiple subnets are trusted
+ - deps: ipaddr.js@0.1.3
+
+3.17.2 / 2014-09-15
+===================
+
+ * Use `crc` instead of `buffer-crc32` for speed
+ * deps: connect@2.26.1
+ - deps: body-parser@~1.8.2
+ - deps: depd@0.4.5
+ - deps: express-session@~1.8.2
+ - deps: morgan@~1.3.1
+ - deps: serve-favicon@~2.1.3
+ - deps: serve-static@~1.6.2
+ * deps: depd@0.4.5
+ * deps: send@0.9.2
+ - deps: depd@0.4.5
+ - deps: etag@~1.3.1
+ - deps: range-parser@~1.0.2
+
+3.17.1 / 2014-09-08
+===================
+
+ * Fix error in `req.subdomains` on empty host
+
+3.17.0 / 2014-09-08
+===================
+
+ * Support `X-Forwarded-Host` in `req.subdomains`
+ * Support IP address host in `req.subdomains`
+ * deps: connect@2.26.0
+ - deps: body-parser@~1.8.1
+ - deps: compression@~1.1.0
+ - deps: connect-timeout@~1.3.0
+ - deps: cookie-parser@~1.3.3
+ - deps: cookie-signature@1.0.5
+ - deps: csurf@~1.6.1
+ - deps: debug@~2.0.0
+ - deps: errorhandler@~1.2.0
+ - deps: express-session@~1.8.1
+ - deps: finalhandler@0.2.0
+ - deps: fresh@0.2.4
+ - deps: media-typer@0.3.0
+ - deps: method-override@~2.2.0
+ - deps: morgan@~1.3.0
+ - deps: qs@2.2.3
+ - deps: serve-favicon@~2.1.3
+ - deps: serve-index@~1.2.1
+ - deps: serve-static@~1.6.1
+ - deps: type-is@~1.5.1
+ - deps: vhost@~3.0.0
+ * deps: cookie-signature@1.0.5
+ * deps: debug@~2.0.0
+ * deps: fresh@0.2.4
+ * deps: media-typer@0.3.0
+ - Throw error when parameter format invalid on parse
+ * deps: range-parser@~1.0.2
+ * deps: send@0.9.1
+ - Add `lastModified` option
+ - Use `etag` to generate `ETag` header
+ - deps: debug@~2.0.0
+ - deps: fresh@0.2.4
+ * deps: vary@~1.0.0
+ - Accept valid `Vary` header string as `field`
+
+3.16.10 / 2014-09-04
+====================
+
+ * deps: connect@2.25.10
+ - deps: serve-static@~1.5.4
+ * deps: send@0.8.5
+ - Fix a path traversal issue when using `root`
+ - Fix malicious path detection for empty string path
+
+3.16.9 / 2014-08-29
+===================
+
+ * deps: connect@2.25.9
+ - deps: body-parser@~1.6.7
+ - deps: qs@2.2.2
+
+3.16.8 / 2014-08-27
+===================
+
+ * deps: connect@2.25.8
+ - deps: body-parser@~1.6.6
+ - deps: csurf@~1.4.1
+ - deps: qs@2.2.0
+
+3.16.7 / 2014-08-18
+===================
+
+ * deps: connect@2.25.7
+ - deps: body-parser@~1.6.5
+ - deps: express-session@~1.7.6
+ - deps: morgan@~1.2.3
+ - deps: serve-static@~1.5.3
+ * deps: send@0.8.3
+ - deps: destroy@1.0.3
+ - deps: on-finished@2.1.0
+
+3.16.6 / 2014-08-14
+===================
+
+ * deps: connect@2.25.6
+ - deps: body-parser@~1.6.4
+ - deps: qs@1.2.2
+ - deps: serve-static@~1.5.2
+ * deps: send@0.8.2
+ - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream`
+
+3.16.5 / 2014-08-11
+===================
+
+ * deps: connect@2.25.5
+ - Fix backwards compatibility in `logger`
+
+3.16.4 / 2014-08-10
+===================
+
+ * Fix original URL parsing in `res.location`
+ * deps: connect@2.25.4
+ - Fix `query` middleware breaking with argument
+ - deps: body-parser@~1.6.3
+ - deps: compression@~1.0.11
+ - deps: connect-timeout@~1.2.2
+ - deps: express-session@~1.7.5
+ - deps: method-override@~2.1.3
+ - deps: on-headers@~1.0.0
+ - deps: parseurl@~1.3.0
+ - deps: qs@1.2.1
+ - deps: response-time@~2.0.1
+ - deps: serve-index@~1.1.6
+ - deps: serve-static@~1.5.1
+ * deps: parseurl@~1.3.0
+
+3.16.3 / 2014-08-07
+===================
+
+ * deps: connect@2.25.3
+ - deps: multiparty@3.3.2
+
+3.16.2 / 2014-08-07
+===================
+
+ * deps: connect@2.25.2
+ - deps: body-parser@~1.6.2
+ - deps: qs@1.2.0
+
+3.16.1 / 2014-08-06
+===================
+
+ * deps: connect@2.25.1
+ - deps: body-parser@~1.6.1
+ - deps: qs@1.1.0
+
+3.16.0 / 2014-08-05
+===================
+
+ * deps: connect@2.25.0
+ - deps: body-parser@~1.6.0
+ - deps: compression@~1.0.10
+ - deps: csurf@~1.4.0
+ - deps: express-session@~1.7.4
+ - deps: qs@1.0.2
+ - deps: serve-static@~1.5.0
+ * deps: send@0.8.1
+ - Add `extensions` option
+
+3.15.3 / 2014-08-04
+===================
+
+ * fix `res.sendfile` regression for serving directory index files
+ * deps: connect@2.24.3
+ - deps: serve-index@~1.1.5
+ - deps: serve-static@~1.4.4
+ * deps: send@0.7.4
+ - Fix incorrect 403 on Windows and Node.js 0.11
+ - Fix serving index files without root dir
+
+3.15.2 / 2014-07-27
+===================
+
+ * deps: connect@2.24.2
+ - deps: body-parser@~1.5.2
+ - deps: depd@0.4.4
+ - deps: express-session@~1.7.2
+ - deps: morgan@~1.2.2
+ - deps: serve-static@~1.4.2
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+ * deps: send@0.7.2
+ - deps: depd@0.4.4
+
+3.15.1 / 2014-07-26
+===================
+
+ * deps: connect@2.24.1
+ - deps: body-parser@~1.5.1
+ - deps: depd@0.4.3
+ - deps: express-session@~1.7.1
+ - deps: morgan@~1.2.1
+ - deps: serve-index@~1.1.4
+ - deps: serve-static@~1.4.1
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+ * deps: send@0.7.1
+ - deps: depd@0.4.3
+
+3.15.0 / 2014-07-22
+===================
+
+ * Fix `req.protocol` for proxy-direct connections
+ * Pass options from `res.sendfile` to `send`
+ * deps: connect@2.24.0
+ - deps: body-parser@~1.5.0
+ - deps: compression@~1.0.9
+ - deps: connect-timeout@~1.2.1
+ - deps: debug@1.0.4
+ - deps: depd@0.4.2
+ - deps: express-session@~1.7.0
+ - deps: finalhandler@0.1.0
+ - deps: method-override@~2.1.2
+ - deps: morgan@~1.2.0
+ - deps: multiparty@3.3.1
+ - deps: parseurl@~1.2.0
+ - deps: serve-static@~1.4.0
+ * deps: debug@1.0.4
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+ * deps: parseurl@~1.2.0
+ - Cache URLs based on original value
+ - Remove no-longer-needed URL mis-parse work-around
+ - Simplify the "fast-path" `RegExp`
+ * deps: send@0.7.0
+ - Add `dotfiles` option
+ - Cap `maxAge` value to 1 year
+ - deps: debug@1.0.4
+ - deps: depd@0.4.2
+
+3.14.0 / 2014-07-11
+===================
+
+ * add explicit "Rosetta Flash JSONP abuse" protection
+ - previous versions are not vulnerable; this is just explicit protection
+ * deprecate `res.redirect(url, status)` -- use `res.redirect(status, url)` instead
+ * fix `res.send(status, num)` to send `num` as json (not error)
+ * remove unnecessary escaping when `res.jsonp` returns JSON response
+ * deps: basic-auth@1.0.0
+ - support empty password
+ - support empty username
+ * deps: connect@2.23.0
+ - deps: debug@1.0.3
+ - deps: express-session@~1.6.4
+ - deps: method-override@~2.1.0
+ - deps: parseurl@~1.1.3
+ - deps: serve-static@~1.3.1
+ * deps: debug@1.0.3
+ - Add support for multiple wildcards in namespaces
+ * deps: methods@1.1.0
+ - add `CONNECT`
+ * deps: parseurl@~1.1.3
+ - faster parsing of href-only URLs
+
+3.13.0 / 2014-07-03
+===================
+
+ * add deprecation message to `app.configure`
+ * add deprecation message to `req.auth`
+ * use `basic-auth` to parse `Authorization` header
+ * deps: connect@2.22.0
+ - deps: csurf@~1.3.0
+ - deps: express-session@~1.6.1
+ - deps: multiparty@3.3.0
+ - deps: serve-static@~1.3.0
+ * deps: send@0.5.0
+ - Accept string for `maxage` (converted by `ms`)
+ - Include link in default redirect response
+
+3.12.1 / 2014-06-26
+===================
+
+ * deps: connect@2.21.1
+ - deps: cookie-parser@1.3.2
+ - deps: cookie-signature@1.0.4
+ - deps: express-session@~1.5.2
+ - deps: type-is@~1.3.2
+ * deps: cookie-signature@1.0.4
+ - fix for timing attacks
+
+3.12.0 / 2014-06-21
+===================
+
+ * use `media-typer` to alter content-type charset
+ * deps: connect@2.21.0
+ - deprecate `connect(middleware)` -- use `app.use(middleware)` instead
+ - deprecate `connect.createServer()` -- use `connect()` instead
+ - fix `res.setHeader()` patch to work with with get -> append -> set pattern
+ - deps: compression@~1.0.8
+ - deps: errorhandler@~1.1.1
+ - deps: express-session@~1.5.0
+ - deps: serve-index@~1.1.3
+
+3.11.0 / 2014-06-19
+===================
+
+ * deprecate things with `depd` module
+ * deps: buffer-crc32@0.2.3
+ * deps: connect@2.20.2
+ - deprecate `verify` option to `json` -- use `body-parser` npm module instead
+ - deprecate `verify` option to `urlencoded` -- use `body-parser` npm module instead
+ - deprecate things with `depd` module
+ - use `finalhandler` for final response handling
+ - use `media-typer` to parse `content-type` for charset
+ - deps: body-parser@1.4.3
+ - deps: connect-timeout@1.1.1
+ - deps: cookie-parser@1.3.1
+ - deps: csurf@1.2.2
+ - deps: errorhandler@1.1.0
+ - deps: express-session@1.4.0
+ - deps: multiparty@3.2.9
+ - deps: serve-index@1.1.2
+ - deps: type-is@1.3.1
+ - deps: vhost@2.0.0
+
+3.10.5 / 2014-06-11
+===================
+
+ * deps: connect@2.19.6
+ - deps: body-parser@1.3.1
+ - deps: compression@1.0.7
+ - deps: debug@1.0.2
+ - deps: serve-index@1.1.1
+ - deps: serve-static@1.2.3
+ * deps: debug@1.0.2
+ * deps: send@0.4.3
+ - Do not throw un-catchable error on file open race condition
+ - Use `escape-html` for HTML escaping
+ - deps: debug@1.0.2
+ - deps: finished@1.2.2
+ - deps: fresh@0.2.2
+
+3.10.4 / 2014-06-09
+===================
+
+ * deps: connect@2.19.5
+ - fix "event emitter leak" warnings
+ - deps: csurf@1.2.1
+ - deps: debug@1.0.1
+ - deps: serve-static@1.2.2
+ - deps: type-is@1.2.1
+ * deps: debug@1.0.1
+ * deps: send@0.4.2
+ - fix "event emitter leak" warnings
+ - deps: finished@1.2.1
+ - deps: debug@1.0.1
+
+3.10.3 / 2014-06-05
+===================
+
+ * use `vary` module for `res.vary`
+ * deps: connect@2.19.4
+ - deps: errorhandler@1.0.2
+ - deps: method-override@2.0.2
+ - deps: serve-favicon@2.0.1
+ * deps: debug@1.0.0
+
+3.10.2 / 2014-06-03
+===================
+
+ * deps: connect@2.19.3
+ - deps: compression@1.0.6
+
+3.10.1 / 2014-06-03
+===================
+
+ * deps: connect@2.19.2
+ - deps: compression@1.0.4
+ * deps: proxy-addr@1.0.1
+
+3.10.0 / 2014-06-02
+===================
+
+ * deps: connect@2.19.1
+ - deprecate `methodOverride()` -- use `method-override` npm module instead
+ - deps: body-parser@1.3.0
+ - deps: method-override@2.0.1
+ - deps: multiparty@3.2.8
+ - deps: response-time@2.0.0
+ - deps: serve-static@1.2.1
+ * deps: methods@1.0.1
+ * deps: send@0.4.1
+ - Send `max-age` in `Cache-Control` in correct format
+
+3.9.0 / 2014-05-30
+==================
+
+ * custom etag control with `app.set('etag', val)`
+ - `app.set('etag', function(body, encoding){ return '"etag"' })` custom etag generation
+ - `app.set('etag', 'weak')` weak tag
+ - `app.set('etag', 'strong')` strong etag
+ - `app.set('etag', false)` turn off
+ - `app.set('etag', true)` standard etag
+ * Include ETag in HEAD requests
+ * mark `res.send` ETag as weak and reduce collisions
+ * update connect to 2.18.0
+ - deps: compression@1.0.3
+ - deps: serve-index@1.1.0
+ - deps: serve-static@1.2.0
+ * update send to 0.4.0
+ - Calculate ETag with md5 for reduced collisions
+ - Ignore stream errors after request ends
+ - deps: debug@0.8.1
+
+3.8.1 / 2014-05-27
+==================
+
+ * update connect to 2.17.3
+ - deps: body-parser@1.2.2
+ - deps: express-session@1.2.1
+ - deps: method-override@1.0.2
+
+3.8.0 / 2014-05-21
+==================
+
+ * keep previous `Content-Type` for `res.jsonp`
+ * set proper `charset` in `Content-Type` for `res.send`
+ * update connect to 2.17.1
+ - fix `res.charset` appending charset when `content-type` has one
+ - deps: express-session@1.2.0
+ - deps: morgan@1.1.1
+ - deps: serve-index@1.0.3
+
+3.7.0 / 2014-05-18
+==================
+
+ * proper proxy trust with `app.set('trust proxy', trust)`
+ - `app.set('trust proxy', 1)` trust first hop
+ - `app.set('trust proxy', 'loopback')` trust loopback addresses
+ - `app.set('trust proxy', '10.0.0.1')` trust single IP
+ - `app.set('trust proxy', '10.0.0.1/16')` trust subnet
+ - `app.set('trust proxy', '10.0.0.1, 10.0.0.2')` trust list
+ - `app.set('trust proxy', false)` turn off
+ - `app.set('trust proxy', true)` trust everything
+ * update connect to 2.16.2
+ - deprecate `res.headerSent` -- use `res.headersSent`
+ - deprecate `res.on("header")` -- use on-headers module instead
+ - fix edge-case in `res.appendHeader` that would append in wrong order
+ - json: use body-parser
+ - urlencoded: use body-parser
+ - dep: bytes@1.0.0
+ - dep: cookie-parser@1.1.0
+ - dep: csurf@1.2.0
+ - dep: express-session@1.1.0
+ - dep: method-override@1.0.1
+
+3.6.0 / 2014-05-09
+==================
+
+ * deprecate `app.del()` -- use `app.delete()` instead
+ * deprecate `res.json(obj, status)` -- use `res.json(status, obj)` instead
+ - the edge-case `res.json(status, num)` requires `res.status(status).json(num)`
+ * deprecate `res.jsonp(obj, status)` -- use `res.jsonp(status, obj)` instead
+ - the edge-case `res.jsonp(status, num)` requires `res.status(status).jsonp(num)`
+ * support PURGE method
+ - add `app.purge`
+ - add `router.purge`
+ - include PURGE in `app.all`
+ * update connect to 2.15.0
+ * Add `res.appendHeader`
+ * Call error stack even when response has been sent
+ * Patch `res.headerSent` to return Boolean
+ * Patch `res.headersSent` for node.js 0.8
+ * Prevent default 404 handler after response sent
+ * dep: compression@1.0.2
+ * dep: connect-timeout@1.1.0
+ * dep: debug@^0.8.0
+ * dep: errorhandler@1.0.1
+ * dep: express-session@1.0.4
+ * dep: morgan@1.0.1
+ * dep: serve-favicon@2.0.0
+ * dep: serve-index@1.0.2
+ * update debug to 0.8.0
+ * add `enable()` method
+ * change from stderr to stdout
+ * update methods to 1.0.0
+ - add PURGE
+ * update mkdirp to 0.5.0
+
+3.5.3 / 2014-05-08
+==================
+
+ * fix `req.host` for IPv6 literals
+ * fix `res.jsonp` error if callback param is object
+
+3.5.2 / 2014-04-24
+==================
+
+ * update connect to 2.14.5
+ * update cookie to 0.1.2
+ * update mkdirp to 0.4.0
+ * update send to 0.3.0
+
+3.5.1 / 2014-03-25
+==================
+
+ * pin less-middleware in generated app
+
+3.5.0 / 2014-03-06
+==================
+
+ * bump deps
+
+3.4.8 / 2014-01-13
+==================
+
+ * prevent incorrect automatic OPTIONS responses #1868 @dpatti
+ * update binary and examples for jade 1.0 #1876 @yossi, #1877 @reqshark, #1892 @matheusazzi
+ * throw 400 in case of malformed paths @rlidwka
+
+3.4.7 / 2013-12-10
+==================
+
+ * update connect
+
+3.4.6 / 2013-12-01
+==================
+
+ * update connect (raw-body)
+
+3.4.5 / 2013-11-27
+==================
+
+ * update connect
+ * res.location: remove leading ./ #1802 @kapouer
+ * res.redirect: fix `res.redirect('toString') #1829 @michaelficarra
+ * res.send: always send ETag when content-length > 0
+ * router: add Router.all() method
+
+3.4.4 / 2013-10-29
+==================
+
+ * update connect
+ * update supertest
+ * update methods
+ * express(1): replace bodyParser() with urlencoded() and json() #1795 @chirag04
+
+3.4.3 / 2013-10-23
+==================
+
+ * update connect
+
+3.4.2 / 2013-10-18
+==================
+
+ * update connect
+ * downgrade commander
+
+3.4.1 / 2013-10-15
+==================
+
+ * update connect
+ * update commander
+ * jsonp: check if callback is a function
+ * router: wrap encodeURIComponent in a try/catch #1735 (@lxe)
+ * res.format: now includes chraset @1747 (@sorribas)
+ * res.links: allow multiple calls @1746 (@sorribas)
+
+3.4.0 / 2013-09-07
+==================
+
+ * add res.vary(). Closes #1682
+ * update connect
+
+3.3.8 / 2013-09-02
+==================
+
+ * update connect
+
+3.3.7 / 2013-08-28
+==================
+
+ * update connect
+
+3.3.6 / 2013-08-27
+==================
+
+ * Revert "remove charset from json responses. Closes #1631" (causes issues in some clients)
+ * add: req.accepts take an argument list
+
+3.3.4 / 2013-07-08
+==================
+
+ * update send and connect
+
+3.3.3 / 2013-07-04
+==================
+
+ * update connect
+
+3.3.2 / 2013-07-03
+==================
+
+ * update connect
+ * update send
+ * remove .version export
+
+3.3.1 / 2013-06-27
+==================
+
+ * update connect
+
+3.3.0 / 2013-06-26
+==================
+
+ * update connect
+ * add support for multiple X-Forwarded-Proto values. Closes #1646
+ * change: remove charset from json responses. Closes #1631
+ * change: return actual booleans from req.accept* functions
+ * fix jsonp callback array throw
+
+3.2.6 / 2013-06-02
+==================
+
+ * update connect
+
+3.2.5 / 2013-05-21
+==================
+
+ * update connect
+ * update node-cookie
+ * add: throw a meaningful error when there is no default engine
+ * change generation of ETags with res.send() to GET requests only. Closes #1619
+
+3.2.4 / 2013-05-09
+==================
+
+ * fix `req.subdomains` when no Host is present
+ * fix `req.host` when no Host is present, return undefined
+
+3.2.3 / 2013-05-07
+==================
+
+ * update connect / qs
+
+3.2.2 / 2013-05-03
+==================
+
+ * update qs
+
+3.2.1 / 2013-04-29
+==================
+
+ * add app.VERB() paths array deprecation warning
+ * update connect
+ * update qs and remove all ~ semver crap
+ * fix: accept number as value of Signed Cookie
+
+3.2.0 / 2013-04-15
+==================
+
+ * add "view" constructor setting to override view behaviour
+ * add req.acceptsEncoding(name)
+ * add req.acceptedEncodings
+ * revert cookie signature change causing session race conditions
+ * fix sorting of Accept values of the same quality
+
+3.1.2 / 2013-04-12
+==================
+
+ * add support for custom Accept parameters
+ * update cookie-signature
+
+3.1.1 / 2013-04-01
+==================
+
+ * add X-Forwarded-Host support to `req.host`
+ * fix relative redirects
+ * update mkdirp
+ * update buffer-crc32
+ * remove legacy app.configure() method from app template.
+
+3.1.0 / 2013-01-25
+==================
+
+ * add support for leading "." in "view engine" setting
+ * add array support to `res.set()`
+ * add node 0.8.x to travis.yml
+ * add "subdomain offset" setting for tweaking `req.subdomains`
+ * add `res.location(url)` implementing `res.redirect()`-like setting of Location
+ * use app.get() for x-powered-by setting for inheritance
+ * fix colons in passwords for `req.auth`
+
+3.0.6 / 2013-01-04
+==================
+
+ * add http verb methods to Router
+ * update connect
+ * fix mangling of the `res.cookie()` options object
+ * fix jsonp whitespace escape. Closes #1132
+
+3.0.5 / 2012-12-19
+==================
+
+ * add throwing when a non-function is passed to a route
+ * fix: explicitly remove Transfer-Encoding header from 204 and 304 responses
+ * revert "add 'etag' option"
+
+3.0.4 / 2012-12-05
+==================
+
+ * add 'etag' option to disable `res.send()` Etags
+ * add escaping of urls in text/plain in `res.redirect()`
+ for old browsers interpreting as html
+ * change crc32 module for a more liberal license
+ * update connect
+
+3.0.3 / 2012-11-13
+==================
+
+ * update connect
+ * update cookie module
+ * fix cookie max-age
+
+3.0.2 / 2012-11-08
+==================
+
+ * add OPTIONS to cors example. Closes #1398
+ * fix route chaining regression. Closes #1397
+
+3.0.1 / 2012-11-01
+==================
+
+ * update connect
+
+3.0.0 / 2012-10-23
+==================
+
+ * add `make clean`
+ * add "Basic" check to req.auth
+ * add `req.auth` test coverage
+ * add cb && cb(payload) to `res.jsonp()`. Closes #1374
+ * add backwards compat for `res.redirect()` status. Closes #1336
+ * add support for `res.json()` to retain previously defined Content-Types. Closes #1349
+ * update connect
+ * change `res.redirect()` to utilize a pathname-relative Location again. Closes #1382
+ * remove non-primitive string support for `res.send()`
+ * fix view-locals example. Closes #1370
+ * fix route-separation example
+
+3.0.0rc5 / 2012-09-18
+==================
+
+ * update connect
+ * add redis search example
+ * add static-files example
+ * add "x-powered-by" setting (`app.disable('x-powered-by')`)
+ * add "application/octet-stream" redirect Accept test case. Closes #1317
+
+3.0.0rc4 / 2012-08-30
+==================
+
+ * add `res.jsonp()`. Closes #1307
+ * add "verbose errors" option to error-pages example
+ * add another route example to express(1) so people are not so confused
+ * add redis online user activity tracking example
+ * update connect dep
+ * fix etag quoting. Closes #1310
+ * fix error-pages 404 status
+ * fix jsonp callback char restrictions
+ * remove old OPTIONS default response
+
+3.0.0rc3 / 2012-08-13
+==================
+
+ * update connect dep
+ * fix signed cookies to work with `connect.cookieParser()` ("s:" prefix was missing) [tnydwrds]
+ * fix `res.render()` clobbering of "locals"
+
+3.0.0rc2 / 2012-08-03
+==================
+
+ * add CORS example
+ * update connect dep
+ * deprecate `.createServer()` & remove old stale examples
+ * fix: escape `res.redirect()` link
+ * fix vhost example
+
+3.0.0rc1 / 2012-07-24
+==================
+
+ * add more examples to view-locals
+ * add scheme-relative redirects (`res.redirect("//foo.com")`) support
+ * update cookie dep
+ * update connect dep
+ * update send dep
+ * fix `express(1)` -h flag, use -H for hogan. Closes #1245
+ * fix `res.sendfile()` socket error handling regression
+
+3.0.0beta7 / 2012-07-16
+==================
+
+ * update connect dep for `send()` root normalization regression
+
+3.0.0beta6 / 2012-07-13
+==================
+
+ * add `err.view` property for view errors. Closes #1226
+ * add "jsonp callback name" setting
+ * add support for "/foo/:bar*" non-greedy matches
+ * change `res.sendfile()` to use `send()` module
+ * change `res.send` to use "response-send" module
+ * remove `app.locals.use` and `res.locals.use`, use regular middleware
+
+3.0.0beta5 / 2012-07-03
+==================
+
+ * add "make check" support
+ * add route-map example
+ * add `res.json(obj, status)` support back for BC
+ * add "methods" dep, remove internal methods module
+ * update connect dep
+ * update auth example to utilize cores pbkdf2
+ * updated tests to use "supertest"
+
+3.0.0beta4 / 2012-06-25
+==================
+
+ * Added `req.auth`
+ * Added `req.range(size)`
+ * Added `res.links(obj)`
+ * Added `res.send(body, status)` support back for backwards compat
+ * Added `.default()` support to `res.format()`
+ * Added 2xx / 304 check to `req.fresh`
+ * Revert "Added + support to the router"
+ * Fixed `res.send()` freshness check, respect res.statusCode
+
+3.0.0beta3 / 2012-06-15
+==================
+
+ * Added hogan `--hjs` to express(1) [nullfirm]
+ * Added another example to content-negotiation
+ * Added `fresh` dep
+ * Changed: `res.send()` always checks freshness
+ * Fixed: expose connects mime module. Cloases #1165
+
+3.0.0beta2 / 2012-06-06
+==================
+
+ * Added `+` support to the router
+ * Added `req.host`
+ * Changed `req.param()` to check route first
+ * Update connect dep
+
+3.0.0beta1 / 2012-06-01
+==================
+
+ * Added `res.format()` callback to override default 406 behaviour
+ * Fixed `res.redirect()` 406. Closes #1154
+
+3.0.0alpha5 / 2012-05-30
+==================
+
+ * Added `req.ip`
+ * Added `{ signed: true }` option to `res.cookie()`
+ * Removed `res.signedCookie()`
+ * Changed: dont reverse `req.ips`
+ * Fixed "trust proxy" setting check for `req.ips`
+
+3.0.0alpha4 / 2012-05-09
+==================
+
+ * Added: allow `[]` in jsonp callback. Closes #1128
+ * Added `PORT` env var support in generated template. Closes #1118 [benatkin]
+ * Updated: connect 2.2.2
+
+3.0.0alpha3 / 2012-05-04
+==================
+
+ * Added public `app.routes`. Closes #887
+ * Added _view-locals_ example
+ * Added _mvc_ example
+ * Added `res.locals.use()`. Closes #1120
+ * Added conditional-GET support to `res.send()`
+ * Added: coerce `res.set()` values to strings
+ * Changed: moved `static()` in generated apps below router
+ * Changed: `res.send()` only set ETag when not previously set
+ * Changed connect 2.2.1 dep
+ * Changed: `make test` now runs unit / acceptance tests
+ * Fixed req/res proto inheritance
+
+3.0.0alpha2 / 2012-04-26
+==================
+
+ * Added `make benchmark` back
+ * Added `res.send()` support for `String` objects
+ * Added client-side data exposing example
+ * Added `res.header()` and `req.header()` aliases for BC
+ * Added `express.createServer()` for BC
+ * Perf: memoize parsed urls
+ * Perf: connect 2.2.0 dep
+ * Changed: make `expressInit()` middleware self-aware
+ * Fixed: use app.get() for all core settings
+ * Fixed redis session example
+ * Fixed session example. Closes #1105
+ * Fixed generated express dep. Closes #1078
+
+3.0.0alpha1 / 2012-04-15
+==================
+
+ * Added `app.locals.use(callback)`
+ * Added `app.locals` object
+ * Added `app.locals(obj)`
+ * Added `res.locals` object
+ * Added `res.locals(obj)`
+ * Added `res.format()` for content-negotiation
+ * Added `app.engine()`
+ * Added `res.cookie()` JSON cookie support
+ * Added "trust proxy" setting
+ * Added `req.subdomains`
+ * Added `req.protocol`
+ * Added `req.secure`
+ * Added `req.path`
+ * Added `req.ips`
+ * Added `req.fresh`
+ * Added `req.stale`
+ * Added comma-delmited / array support for `req.accepts()`
+ * Added debug instrumentation
+ * Added `res.set(obj)`
+ * Added `res.set(field, value)`
+ * Added `res.get(field)`
+ * Added `app.get(setting)`. Closes #842
+ * Added `req.acceptsLanguage()`
+ * Added `req.acceptsCharset()`
+ * Added `req.accepted`
+ * Added `req.acceptedLanguages`
+ * Added `req.acceptedCharsets`
+ * Added "json replacer" setting
+ * Added "json spaces" setting
+ * Added X-Forwarded-Proto support to `res.redirect()`. Closes #92
+ * Added `--less` support to express(1)
+ * Added `express.response` prototype
+ * Added `express.request` prototype
+ * Added `express.application` prototype
+ * Added `app.path()`
+ * Added `app.render()`
+ * Added `res.type()` to replace `res.contentType()`
+ * Changed: `res.redirect()` to add relative support
+ * Changed: enable "jsonp callback" by default
+ * Changed: renamed "case sensitive routes" to "case sensitive routing"
+ * Rewrite of all tests with mocha
+ * Removed "root" setting
+ * Removed `res.redirect('home')` support
+ * Removed `req.notify()`
+ * Removed `app.register()`
+ * Removed `app.redirect()`
+ * Removed `app.is()`
+ * Removed `app.helpers()`
+ * Removed `app.dynamicHelpers()`
+ * Fixed `res.sendfile()` with non-GET. Closes #723
+ * Fixed express(1) public dir for windows. Closes #866
+
+2.5.9/ 2012-04-02
+==================
+
+ * Added support for PURGE request method [pbuyle]
+ * Fixed `express(1)` generated app `app.address()` before `listening` [mmalecki]
+
+2.5.8 / 2012-02-08
+==================
+
+ * Update mkdirp dep. Closes #991
+
+2.5.7 / 2012-02-06
+==================
+
+ * Fixed `app.all` duplicate DELETE requests [mscdex]
+
+2.5.6 / 2012-01-13
+==================
+
+ * Updated hamljs dev dep. Closes #953
+
+2.5.5 / 2012-01-08
+==================
+
+ * Fixed: set `filename` on cached templates [matthewleon]
+
+2.5.4 / 2012-01-02
+==================
+
+ * Fixed `express(1)` eol on 0.4.x. Closes #947
+
+2.5.3 / 2011-12-30
+==================
+
+ * Fixed `req.is()` when a charset is present
+
+2.5.2 / 2011-12-10
+==================
+
+ * Fixed: express(1) LF -> CRLF for windows
+
+2.5.1 / 2011-11-17
+==================
+
+ * Changed: updated connect to 1.8.x
+ * Removed sass.js support from express(1)
+
+2.5.0 / 2011-10-24
+==================
+
+ * Added ./routes dir for generated app by default
+ * Added npm install reminder to express(1) app gen
+ * Added 0.5.x support
+ * Removed `make test-cov` since it wont work with node 0.5.x
+ * Fixed express(1) public dir for windows. Closes #866
+
+2.4.7 / 2011-10-05
+==================
+
+ * Added mkdirp to express(1). Closes #795
+ * Added simple _json-config_ example
+ * Added shorthand for the parsed request's pathname via `req.path`
+ * Changed connect dep to 1.7.x to fix npm issue...
+ * Fixed `res.redirect()` __HEAD__ support. [reported by xerox]
+ * Fixed `req.flash()`, only escape args
+ * Fixed absolute path checking on windows. Closes #829 [reported by andrewpmckenzie]
+
+2.4.6 / 2011-08-22
+==================
+
+ * Fixed multiple param callback regression. Closes #824 [reported by TroyGoode]
+
+2.4.5 / 2011-08-19
+==================
+
+ * Added support for routes to handle errors. Closes #809
+ * Added `app.routes.all()`. Closes #803
+ * Added "basepath" setting to work in conjunction with reverse proxies etc.
+ * Refactored `Route` to use a single array of callbacks
+ * Added support for multiple callbacks for `app.param()`. Closes #801
+Closes #805
+ * Changed: removed .call(self) for route callbacks
+ * Dependency: `qs >= 0.3.1`
+ * Fixed `res.redirect()` on windows due to `join()` usage. Closes #808
+
+2.4.4 / 2011-08-05
+==================
+
+ * Fixed `res.header()` intention of a set, even when `undefined`
+ * Fixed `*`, value no longer required
+ * Fixed `res.send(204)` support. Closes #771
+
+2.4.3 / 2011-07-14
+==================
+
+ * Added docs for `status` option special-case. Closes #739
+ * Fixed `options.filename`, exposing the view path to template engines
+
+2.4.2. / 2011-07-06
+==================
+
+ * Revert "removed jsonp stripping" for XSS
+
+2.4.1 / 2011-07-06
+==================
+
+ * Added `res.json()` JSONP support. Closes #737
+ * Added _extending-templates_ example. Closes #730
+ * Added "strict routing" setting for trailing slashes
+ * Added support for multiple envs in `app.configure()` calls. Closes #735
+ * Changed: `res.send()` using `res.json()`
+ * Changed: when cookie `path === null` don't default it
+ * Changed; default cookie path to "home" setting. Closes #731
+ * Removed _pids/logs_ creation from express(1)
+
+2.4.0 / 2011-06-28
+==================
+
+ * Added chainable `res.status(code)`
+ * Added `res.json()`, an explicit version of `res.send(obj)`
+ * Added simple web-service example
+
+2.3.12 / 2011-06-22
+==================
+
+ * \#express is now on freenode! come join!
+ * Added `req.get(field, param)`
+ * Added links to Japanese documentation, thanks @hideyukisaito!
+ * Added; the `express(1)` generated app outputs the env
+ * Added `content-negotiation` example
+ * Dependency: connect >= 1.5.1 < 2.0.0
+ * Fixed view layout bug. Closes #720
+ * Fixed; ignore body on 304. Closes #701
+
+2.3.11 / 2011-06-04
+==================
+
+ * Added `npm test`
+ * Removed generation of dummy test file from `express(1)`
+ * Fixed; `express(1)` adds express as a dep
+ * Fixed; prune on `prepublish`
+
+2.3.10 / 2011-05-27
+==================
+
+ * Added `req.route`, exposing the current route
+ * Added _package.json_ generation support to `express(1)`
+ * Fixed call to `app.param()` function for optional params. Closes #682
+
+2.3.9 / 2011-05-25
+==================
+
+ * Fixed bug-ish with `../' in `res.partial()` calls
+
+2.3.8 / 2011-05-24
+==================
+
+ * Fixed `app.options()`
+
+2.3.7 / 2011-05-23
+==================
+
+ * Added route `Collection`, ex: `app.get('/user/:id').remove();`
+ * Added support for `app.param(fn)` to define param logic
+ * Removed `app.param()` support for callback with return value
+ * Removed module.parent check from express(1) generated app. Closes #670
+ * Refactored router. Closes #639
+
+2.3.6 / 2011-05-20
+==================
+
+ * Changed; using devDependencies instead of git submodules
+ * Fixed redis session example
+ * Fixed markdown example
+ * Fixed view caching, should not be enabled in development
+
+2.3.5 / 2011-05-20
+==================
+
+ * Added export `.view` as alias for `.View`
+
+2.3.4 / 2011-05-08
+==================
+
+ * Added `./examples/say`
+ * Fixed `res.sendfile()` bug preventing the transfer of files with spaces
+
+2.3.3 / 2011-05-03
+==================
+
+ * Added "case sensitive routes" option.
+ * Changed; split methods supported per rfc [slaskis]
+ * Fixed route-specific middleware when using the same callback function several times
+
+2.3.2 / 2011-04-27
+==================
+
+ * Fixed view hints
+
+2.3.1 / 2011-04-26
+==================
+
+ * Added `app.match()` as `app.match.all()`
+ * Added `app.lookup()` as `app.lookup.all()`
+ * Added `app.remove()` for `app.remove.all()`
+ * Added `app.remove.VERB()`
+ * Fixed template caching collision issue. Closes #644
+ * Moved router over from connect and started refactor
+
+2.3.0 / 2011-04-25
+==================
+
+ * Added options support to `res.clearCookie()`
+ * Added `res.helpers()` as alias of `res.locals()`
+ * Added; json defaults to UTF-8 with `res.send()`. Closes #632. [Daniel * Dependency `connect >= 1.4.0`
+ * Changed; auto set Content-Type in res.attachement [Aaron Heckmann]
+ * Renamed "cache views" to "view cache". Closes #628
+ * Fixed caching of views when using several apps. Closes #637
+ * Fixed gotcha invoking `app.param()` callbacks once per route middleware.
+Closes #638
+ * Fixed partial lookup precedence. Closes #631
+Shaw]
+
+2.2.2 / 2011-04-12
+==================
+
+ * Added second callback support for `res.download()` connection errors
+ * Fixed `filename` option passing to template engine
+
+2.2.1 / 2011-04-04
+==================
+
+ * Added `layout(path)` helper to change the layout within a view. Closes #610
+ * Fixed `partial()` collection object support.
+ Previously only anything with `.length` would work.
+ When `.length` is present one must still be aware of holes,
+ however now `{ collection: {foo: 'bar'}}` is valid, exposes
+ `keyInCollection` and `keysInCollection`.
+
+ * Performance improved with better view caching
+ * Removed `request` and `response` locals
+ * Changed; errorHandler page title is now `Express` instead of `Connect`
+
+2.2.0 / 2011-03-30
+==================
+
+ * Added `app.lookup.VERB()`, ex `app.lookup.put('/user/:id')`. Closes #606
+ * Added `app.match.VERB()`, ex `app.match.put('/user/12')`. Closes #606
+ * Added `app.VERB(path)` as alias of `app.lookup.VERB()`.
+ * Dependency `connect >= 1.2.0`
+
+2.1.1 / 2011-03-29
+==================
+
+ * Added; expose `err.view` object when failing to locate a view
+ * Fixed `res.partial()` call `next(err)` when no callback is given [reported by aheckmann]
+ * Fixed; `res.send(undefined)` responds with 204 [aheckmann]
+
+2.1.0 / 2011-03-24
+==================
+
+ * Added `/_?` partial lookup support. Closes #447
+ * Added `request`, `response`, and `app` local variables
+ * Added `settings` local variable, containing the app's settings
+ * Added `req.flash()` exception if `req.session` is not available
+ * Added `res.send(bool)` support (json response)
+ * Fixed stylus example for latest version
+ * Fixed; wrap try/catch around `res.render()`
+
+2.0.0 / 2011-03-17
+==================
+
+ * Fixed up index view path alternative.
+ * Changed; `res.locals()` without object returns the locals
+
+2.0.0rc3 / 2011-03-17
+==================
+
+ * Added `res.locals(obj)` to compliment `res.local(key, val)`
+ * Added `res.partial()` callback support
+ * Fixed recursive error reporting issue in `res.render()`
+
+2.0.0rc2 / 2011-03-17
+==================
+
+ * Changed; `partial()` "locals" are now optional
+ * Fixed `SlowBuffer` support. Closes #584 [reported by tyrda01]
+ * Fixed .filename view engine option [reported by drudge]
+ * Fixed blog example
+ * Fixed `{req,res}.app` reference when mounting [Ben Weaver]
+
+2.0.0rc / 2011-03-14
+==================
+
+ * Fixed; expose `HTTPSServer` constructor
+ * Fixed express(1) default test charset. Closes #579 [reported by secoif]
+ * Fixed; default charset to utf-8 instead of utf8 for lame IE [reported by NickP]
+
+2.0.0beta3 / 2011-03-09
+==================
+
+ * Added support for `res.contentType()` literal
+ The original `res.contentType('.json')`,
+ `res.contentType('application/json')`, and `res.contentType('json')`
+ will work now.
+ * Added `res.render()` status option support back
+ * Added charset option for `res.render()`
+ * Added `.charset` support (via connect 1.0.4)
+ * Added view resolution hints when in development and a lookup fails
+ * Added layout lookup support relative to the page view.
+ For example while rendering `./views/user/index.jade` if you create
+ `./views/user/layout.jade` it will be used in favour of the root layout.
+ * Fixed `res.redirect()`. RFC states absolute url [reported by unlink]
+ * Fixed; default `res.send()` string charset to utf8
+ * Removed `Partial` constructor (not currently used)
+
+2.0.0beta2 / 2011-03-07
+==================
+
+ * Added res.render() `.locals` support back to aid in migration process
+ * Fixed flash example
+
+2.0.0beta / 2011-03-03
+==================
+
+ * Added HTTPS support
+ * Added `res.cookie()` maxAge support
+ * Added `req.header()` _Referrer_ / _Referer_ special-case, either works
+ * Added mount support for `res.redirect()`, now respects the mount-point
+ * Added `union()` util, taking place of `merge(clone())` combo
+ * Added stylus support to express(1) generated app
+ * Added secret to session middleware used in examples and generated app
+ * Added `res.local(name, val)` for progressive view locals
+ * Added default param support to `req.param(name, default)`
+ * Added `app.disabled()` and `app.enabled()`
+ * Added `app.register()` support for omitting leading ".", either works
+ * Added `res.partial()`, using the same interface as `partial()` within a view. Closes #539
+ * Added `app.param()` to map route params to async/sync logic
+ * Added; aliased `app.helpers()` as `app.locals()`. Closes #481
+ * Added extname with no leading "." support to `res.contentType()`
+ * Added `cache views` setting, defaulting to enabled in "production" env
+ * Added index file partial resolution, eg: partial('user') may try _views/user/index.jade_.
+ * Added `req.accepts()` support for extensions
+ * Changed; `res.download()` and `res.sendfile()` now utilize Connect's
+ static file server `connect.static.send()`.
+ * Changed; replaced `connect.utils.mime()` with npm _mime_ module
+ * Changed; allow `req.query` to be pre-defined (via middleware or other parent
+ * Changed view partial resolution, now relative to parent view
+ * Changed view engine signature. no longer `engine.render(str, options, callback)`, now `engine.compile(str, options) -> Function`, the returned function accepts `fn(locals)`.
+ * Fixed `req.param()` bug returning Array.prototype methods. Closes #552
+ * Fixed; using `Stream#pipe()` instead of `sys.pump()` in `res.sendfile()`
+ * Fixed; using _qs_ module instead of _querystring_
+ * Fixed; strip unsafe chars from jsonp callbacks
+ * Removed "stream threshold" setting
+
+1.0.8 / 2011-03-01
+==================
+
+ * Allow `req.query` to be pre-defined (via middleware or other parent app)
+ * "connect": ">= 0.5.0 < 1.0.0". Closes #547
+ * Removed the long deprecated __EXPRESS_ENV__ support
+
+1.0.7 / 2011-02-07
+==================
+
+ * Fixed `render()` setting inheritance.
+ Mounted apps would not inherit "view engine"
+
+1.0.6 / 2011-02-07
+==================
+
+ * Fixed `view engine` setting bug when period is in dirname
+
+1.0.5 / 2011-02-05
+==================
+
+ * Added secret to generated app `session()` call
+
+1.0.4 / 2011-02-05
+==================
+
+ * Added `qs` dependency to _package.json_
+ * Fixed namespaced `require()`s for latest connect support
+
+1.0.3 / 2011-01-13
+==================
+
+ * Remove unsafe characters from JSONP callback names [Ryan Grove]
+
+1.0.2 / 2011-01-10
+==================
+
+ * Removed nested require, using `connect.router`
+
+1.0.1 / 2010-12-29
+==================
+
+ * Fixed for middleware stacked via `createServer()`
+ previously the `foo` middleware passed to `createServer(foo)`
+ would not have access to Express methods such as `res.send()`
+ or props like `req.query` etc.
+
+1.0.0 / 2010-11-16
+==================
+
+ * Added; deduce partial object names from the last segment.
+ For example by default `partial('forum/post', postObject)` will
+ give you the _post_ object, providing a meaningful default.
+ * Added http status code string representation to `res.redirect()` body
+ * Added; `res.redirect()` supporting _text/plain_ and _text/html_ via __Accept__.
+ * Added `req.is()` to aid in content negotiation
+ * Added partial local inheritance [suggested by masylum]. Closes #102
+ providing access to parent template locals.
+ * Added _-s, --session[s]_ flag to express(1) to add session related middleware
+ * Added _--template_ flag to express(1) to specify the
+ template engine to use.
+ * Added _--css_ flag to express(1) to specify the
+ stylesheet engine to use (or just plain css by default).
+ * Added `app.all()` support [thanks aheckmann]
+ * Added partial direct object support.
+ You may now `partial('user', user)` providing the "user" local,
+ vs previously `partial('user', { object: user })`.
+ * Added _route-separation_ example since many people question ways
+ to do this with CommonJS modules. Also view the _blog_ example for
+ an alternative.
+ * Performance; caching view path derived partial object names
+ * Fixed partial local inheritance precedence. [reported by Nick Poulden] Closes #454
+ * Fixed jsonp support; _text/javascript_ as per mailinglist discussion
+
+1.0.0rc4 / 2010-10-14
+==================
+
+ * Added _NODE_ENV_ support, _EXPRESS_ENV_ is deprecated and will be removed in 1.0.0
+ * Added route-middleware support (very helpful, see the [docs](http://expressjs.com/guide.html#Route-Middleware))
+ * Added _jsonp callback_ setting to enable/disable jsonp autowrapping [Dav Glass]
+ * Added callback query check on response.send to autowrap JSON objects for simple webservice implementations [Dav Glass]
+ * Added `partial()` support for array-like collections. Closes #434
+ * Added support for swappable querystring parsers
+ * Added session usage docs. Closes #443
+ * Added dynamic helper caching. Closes #439 [suggested by maritz]
+ * Added authentication example
+ * Added basic Range support to `res.sendfile()` (and `res.download()` etc)
+ * Changed; `express(1)` generated app using 2 spaces instead of 4
+ * Default env to "development" again [aheckmann]
+ * Removed _context_ option is no more, use "scope"
+ * Fixed; exposing _./support_ libs to examples so they can run without installs
+ * Fixed mvc example
+
+1.0.0rc3 / 2010-09-20
+==================
+
+ * Added confirmation for `express(1)` app generation. Closes #391
+ * Added extending of flash formatters via `app.flashFormatters`
+ * Added flash formatter support. Closes #411
+ * Added streaming support to `res.sendfile()` using `sys.pump()` when >= "stream threshold"
+ * Added _stream threshold_ setting for `res.sendfile()`
+ * Added `res.send()` __HEAD__ support
+ * Added `res.clearCookie()`
+ * Added `res.cookie()`
+ * Added `res.render()` headers option
+ * Added `res.redirect()` response bodies
+ * Added `res.render()` status option support. Closes #425 [thanks aheckmann]
+ * Fixed `res.sendfile()` responding with 403 on malicious path
+ * Fixed `res.download()` bug; when an error occurs remove _Content-Disposition_
+ * Fixed; mounted apps settings now inherit from parent app [aheckmann]
+ * Fixed; stripping Content-Length / Content-Type when 204
+ * Fixed `res.send()` 204. Closes #419
+ * Fixed multiple _Set-Cookie_ headers via `res.header()`. Closes #402
+ * Fixed bug messing with error handlers when `listenFD()` is called instead of `listen()`. [thanks guillermo]
+
+
+1.0.0rc2 / 2010-08-17
+==================
+
+ * Added `app.register()` for template engine mapping. Closes #390
+ * Added `res.render()` callback support as second argument (no options)
+ * Added callback support to `res.download()`
+ * Added callback support for `res.sendfile()`
+ * Added support for middleware access via `express.middlewareName()` vs `connect.middlewareName()`
+ * Added "partials" setting to docs
+ * Added default expresso tests to `express(1)` generated app. Closes #384
+ * Fixed `res.sendfile()` error handling, defer via `next()`
+ * Fixed `res.render()` callback when a layout is used [thanks guillermo]
+ * Fixed; `make install` creating ~/.node_libraries when not present
+ * Fixed issue preventing error handlers from being defined anywhere. Closes #387
+
+1.0.0rc / 2010-07-28
+==================
+
+ * Added mounted hook. Closes #369
+ * Added connect dependency to _package.json_
+
+ * Removed "reload views" setting and support code
+ development env never caches, production always caches.
+
+ * Removed _param_ in route callbacks, signature is now
+ simply (req, res, next), previously (req, res, params, next).
+ Use _req.params_ for path captures, _req.query_ for GET params.
+
+ * Fixed "home" setting
+ * Fixed middleware/router precedence issue. Closes #366
+ * Fixed; _configure()_ callbacks called immediately. Closes #368
+
+1.0.0beta2 / 2010-07-23
+==================
+
+ * Added more examples
+ * Added; exporting `Server` constructor
+ * Added `Server#helpers()` for view locals
+ * Added `Server#dynamicHelpers()` for dynamic view locals. Closes #349
+ * Added support for absolute view paths
+ * Added; _home_ setting defaults to `Server#route` for mounted apps. Closes #363
+ * Added Guillermo Rauch to the contributor list
+ * Added support for "as" for non-collection partials. Closes #341
+ * Fixed _install.sh_, ensuring _~/.node_libraries_ exists. Closes #362 [thanks jf]
+ * Fixed `res.render()` exceptions, now passed to `next()` when no callback is given [thanks guillermo]
+ * Fixed instanceof `Array` checks, now `Array.isArray()`
+ * Fixed express(1) expansion of public dirs. Closes #348
+ * Fixed middleware precedence. Closes #345
+ * Fixed view watcher, now async [thanks aheckmann]
+
+1.0.0beta / 2010-07-15
+==================
+
+ * Re-write
+ - much faster
+ - much lighter
+ - Check [ExpressJS.com](http://expressjs.com) for migration guide and updated docs
+
+0.14.0 / 2010-06-15
+==================
+
+ * Utilize relative requires
+ * Added Static bufferSize option [aheckmann]
+ * Fixed caching of view and partial subdirectories [aheckmann]
+ * Fixed mime.type() comments now that ".ext" is not supported
+ * Updated haml submodule
+ * Updated class submodule
+ * Removed bin/express
+
+0.13.0 / 2010-06-01
+==================
+
+ * Added node v0.1.97 compatibility
+ * Added support for deleting cookies via Request#cookie('key', null)
+ * Updated haml submodule
+ * Fixed not-found page, now using using charset utf-8
+ * Fixed show-exceptions page, now using using charset utf-8
+ * Fixed view support due to fs.readFile Buffers
+ * Changed; mime.type() no longer accepts ".type" due to node extname() changes
+
+0.12.0 / 2010-05-22
+==================
+
+ * Added node v0.1.96 compatibility
+ * Added view `helpers` export which act as additional local variables
+ * Updated haml submodule
+ * Changed ETag; removed inode, modified time only
+ * Fixed LF to CRLF for setting multiple cookies
+ * Fixed cookie complation; values are now urlencoded
+ * Fixed cookies parsing; accepts quoted values and url escaped cookies
+
+0.11.0 / 2010-05-06
+==================
+
+ * Added support for layouts using different engines
+ - this.render('page.html.haml', { layout: 'super-cool-layout.html.ejs' })
+ - this.render('page.html.haml', { layout: 'foo' }) // assumes 'foo.html.haml'
+ - this.render('page.html.haml', { layout: false }) // no layout
+ * Updated ext submodule
+ * Updated haml submodule
+ * Fixed EJS partial support by passing along the context. Issue #307
+
+0.10.1 / 2010-05-03
+==================
+
+ * Fixed binary uploads.
+
+0.10.0 / 2010-04-30
+==================
+
+ * Added charset support via Request#charset (automatically assigned to 'UTF-8' when respond()'s
+ encoding is set to 'utf8' or 'utf-8'.
+ * Added "encoding" option to Request#render(). Closes #299
+ * Added "dump exceptions" setting, which is enabled by default.
+ * Added simple ejs template engine support
+ * Added error response support for text/plain, application/json. Closes #297
+ * Added callback function param to Request#error()
+ * Added Request#sendHead()
+ * Added Request#stream()
+ * Added support for Request#respond(304, null) for empty response bodies
+ * Added ETag support to Request#sendfile()
+ * Added options to Request#sendfile(), passed to fs.createReadStream()
+ * Added filename arg to Request#download()
+ * Performance enhanced due to pre-reversing plugins so that plugins.reverse() is not called on each request
+ * Performance enhanced by preventing several calls to toLowerCase() in Router#match()
+ * Changed; Request#sendfile() now streams
+ * Changed; Renamed Request#halt() to Request#respond(). Closes #289
+ * Changed; Using sys.inspect() instead of JSON.encode() for error output
+ * Changed; run() returns the http.Server instance. Closes #298
+ * Changed; Defaulting Server#host to null (INADDR_ANY)
+ * Changed; Logger "common" format scale of 0.4f
+ * Removed Logger "request" format
+ * Fixed; Catching ENOENT in view caching, preventing error when "views/partials" is not found
+ * Fixed several issues with http client
+ * Fixed Logger Content-Length output
+ * Fixed bug preventing Opera from retaining the generated session id. Closes #292
+
+0.9.0 / 2010-04-14
+==================
+
+ * Added DSL level error() route support
+ * Added DSL level notFound() route support
+ * Added Request#error()
+ * Added Request#notFound()
+ * Added Request#render() callback function. Closes #258
+ * Added "max upload size" setting
+ * Added "magic" variables to collection partials (\_\_index\_\_, \_\_length\_\_, \_\_isFirst\_\_, \_\_isLast\_\_). Closes #254
+ * Added [haml.js](http://github.com/visionmedia/haml.js) submodule; removed haml-js
+ * Added callback function support to Request#halt() as 3rd/4th arg
+ * Added preprocessing of route param wildcards using param(). Closes #251
+ * Added view partial support (with collections etc)
+ * Fixed bug preventing falsey params (such as ?page=0). Closes #286
+ * Fixed setting of multiple cookies. Closes #199
+ * Changed; view naming convention is now NAME.TYPE.ENGINE (for example page.html.haml)
+ * Changed; session cookie is now httpOnly
+ * Changed; Request is no longer global
+ * Changed; Event is no longer global
+ * Changed; "sys" module is no longer global
+ * Changed; moved Request#download to Static plugin where it belongs
+ * Changed; Request instance created before body parsing. Closes #262
+ * Changed; Pre-caching views in memory when "cache view contents" is enabled. Closes #253
+ * Changed; Pre-caching view partials in memory when "cache view partials" is enabled
+ * Updated support to node --version 0.1.90
+ * Updated dependencies
+ * Removed set("session cookie") in favour of use(Session, { cookie: { ... }})
+ * Removed utils.mixin(); use Object#mergeDeep()
+
+0.8.0 / 2010-03-19
+==================
+
+ * Added coffeescript example app. Closes #242
+ * Changed; cache api now async friendly. Closes #240
+ * Removed deprecated 'express/static' support. Use 'express/plugins/static'
+
+0.7.6 / 2010-03-19
+==================
+
+ * Added Request#isXHR. Closes #229
+ * Added `make install` (for the executable)
+ * Added `express` executable for setting up simple app templates
+ * Added "GET /public/*" to Static plugin, defaulting to /public
+ * Added Static plugin
+ * Fixed; Request#render() only calls cache.get() once
+ * Fixed; Namespacing View caches with "view:"
+ * Fixed; Namespacing Static caches with "static:"
+ * Fixed; Both example apps now use the Static plugin
+ * Fixed set("views"). Closes #239
+ * Fixed missing space for combined log format
+ * Deprecated Request#sendfile() and 'express/static'
+ * Removed Server#running
+
+0.7.5 / 2010-03-16
+==================
+
+ * Added Request#flash() support without args, now returns all flashes
+ * Updated ext submodule
+
+0.7.4 / 2010-03-16
+==================
+
+ * Fixed session reaper
+ * Changed; class.js replacing js-oo Class implementation (quite a bit faster, no browser cruft)
+
+0.7.3 / 2010-03-16
+==================
+
+ * Added package.json
+ * Fixed requiring of haml / sass due to kiwi removal
+
+0.7.2 / 2010-03-16
+==================
+
+ * Fixed GIT submodules (HAH!)
+
+0.7.1 / 2010-03-16
+==================
+
+ * Changed; Express now using submodules again until a PM is adopted
+ * Changed; chat example using millisecond conversions from ext
+
+0.7.0 / 2010-03-15
+==================
+
+ * Added Request#pass() support (finds the next matching route, or the given path)
+ * Added Logger plugin (default "common" format replaces CommonLogger)
+ * Removed Profiler plugin
+ * Removed CommonLogger plugin
+
+0.6.0 / 2010-03-11
+==================
+
+ * Added seed.yml for kiwi package management support
+ * Added HTTP client query string support when method is GET. Closes #205
+
+ * Added support for arbitrary view engines.
+ For example "foo.engine.html" will now require('engine'),
+ the exports from this module are cached after the first require().
+
+ * Added async plugin support
+
+ * Removed usage of RESTful route funcs as http client
+ get() etc, use http.get() and friends
+
+ * Removed custom exceptions
+
+0.5.0 / 2010-03-10
+==================
+
+ * Added ext dependency (library of js extensions)
+ * Removed extname() / basename() utils. Use path module
+ * Removed toArray() util. Use arguments.values
+ * Removed escapeRegexp() util. Use RegExp.escape()
+ * Removed process.mixin() dependency. Use utils.mixin()
+ * Removed Collection
+ * Removed ElementCollection
+ * Shameless self promotion of ebook "Advanced JavaScript" (http://dev-mag.com) ;)
+
+0.4.0 / 2010-02-11
+==================
+
+ * Added flash() example to sample upload app
+ * Added high level restful http client module (express/http)
+ * Changed; RESTful route functions double as HTTP clients. Closes #69
+ * Changed; throwing error when routes are added at runtime
+ * Changed; defaulting render() context to the current Request. Closes #197
+ * Updated haml submodule
+
+0.3.0 / 2010-02-11
+==================
+
+ * Updated haml / sass submodules. Closes #200
+ * Added flash message support. Closes #64
+ * Added accepts() now allows multiple args. fixes #117
+ * Added support for plugins to halt. Closes #189
+ * Added alternate layout support. Closes #119
+ * Removed Route#run(). Closes #188
+ * Fixed broken specs due to use(Cookie) missing
+
+0.2.1 / 2010-02-05
+==================
+
+ * Added "plot" format option for Profiler (for gnuplot processing)
+ * Added request number to Profiler plugin
+ * Fixed binary encoding for multi-part file uploads, was previously defaulting to UTF8
+ * Fixed issue with routes not firing when not files are present. Closes #184
+ * Fixed process.Promise -> events.Promise
+
+0.2.0 / 2010-02-03
+==================
+
+ * Added parseParam() support for name[] etc. (allows for file inputs with "multiple" attr) Closes #180
+ * Added Both Cache and Session option "reapInterval" may be "reapEvery". Closes #174
+ * Added expiration support to cache api with reaper. Closes #133
+ * Added cache Store.Memory#reap()
+ * Added Cache; cache api now uses first class Cache instances
+ * Added abstract session Store. Closes #172
+ * Changed; cache Memory.Store#get() utilizing Collection
+ * Renamed MemoryStore -> Store.Memory
+ * Fixed use() of the same plugin several time will always use latest options. Closes #176
+
+0.1.0 / 2010-02-03
+==================
+
+ * Changed; Hooks (before / after) pass request as arg as well as evaluated in their context
+ * Updated node support to 0.1.27 Closes #169
+ * Updated dirname(__filename) -> __dirname
+ * Updated libxmljs support to v0.2.0
+ * Added session support with memory store / reaping
+ * Added quick uid() helper
+ * Added multi-part upload support
+ * Added Sass.js support / submodule
+ * Added production env caching view contents and static files
+ * Added static file caching. Closes #136
+ * Added cache plugin with memory stores
+ * Added support to StaticFile so that it works with non-textual files.
+ * Removed dirname() helper
+ * Removed several globals (now their modules must be required)
+
+0.0.2 / 2010-01-10
+==================
+
+ * Added view benchmarks; currently haml vs ejs
+ * Added Request#attachment() specs. Closes #116
+ * Added use of node's parseQuery() util. Closes #123
+ * Added `make init` for submodules
+ * Updated Haml
+ * Updated sample chat app to show messages on load
+ * Updated libxmljs parseString -> parseHtmlString
+ * Fixed `make init` to work with older versions of git
+ * Fixed specs can now run independent specs for those who cant build deps. Closes #127
+ * Fixed issues introduced by the node url module changes. Closes 126.
+ * Fixed two assertions failing due to Collection#keys() returning strings
+ * Fixed faulty Collection#toArray() spec due to keys() returning strings
+ * Fixed `make test` now builds libxmljs.node before testing
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/LICENSE b/server/node_modules/express/LICENSE
new file mode 100755
index 00000000..0f3c7678
--- /dev/null
+++ b/server/node_modules/express/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2009-2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/Readme.md b/server/node_modules/express/Readme.md
new file mode 100755
index 00000000..24bc5822
--- /dev/null
+++ b/server/node_modules/express/Readme.md
@@ -0,0 +1,135 @@
+[](http://expressjs.com/)
+
+ Fast, unopinionated, minimalist web framework for [node](http://nodejs.org).
+
+ [![NPM Version][npm-image]][npm-url]
+ [![NPM Downloads][downloads-image]][downloads-url]
+ [![Build Status][travis-image]][travis-url]
+ [![Test Coverage][coveralls-image]][coveralls-url]
+
+```js
+var express = require('express')
+var app = express()
+
+app.get('/', function (req, res) {
+ res.send('Hello World')
+})
+
+app.listen(3000)
+```
+
+### Installation
+
+```bash
+$ npm install express
+```
+
+## Features
+
+ * Robust routing
+ * Focus on high performance
+ * Super-high test coverage
+ * HTTP helpers (redirection, caching, etc)
+ * View system supporting 14+ template engines
+ * Content negotiation
+ * Executable for generating applications quickly
+
+## Docs & Community
+
+ * [Website and Documentation](http://expressjs.com/) - [[website repo](https://github.com/strongloop/expressjs.com)]
+ * [#express](https://webchat.freenode.net/?channels=express) on freenode IRC
+ * [Github Organization](https://github.com/expressjs) for Official Middleware & Modules
+ * Visit the [Wiki](https://github.com/strongloop/express/wiki)
+ * [Google Group](https://groups.google.com/group/express-js) for discussion
+ * [Русскоязычная документация](http://jsman.ru/express/)
+ * [한국어 문서](http://expressjs.kr) - [[website repo](https://github.com/Hanul/expressjs.kr)]
+
+**PROTIP** Be sure to read [Migrating from 3.x to 4.x](https://github.com/strongloop/express/wiki/Migrating-from-3.x-to-4.x) as well as [New features in 4.x](https://github.com/strongloop/express/wiki/New-features-in-4.x).
+
+## Quick Start
+
+ The quickest way to get started with express is to utilize the executable [`express(1)`](https://github.com/expressjs/generator) to generate an application as shown below:
+
+ Install the executable. The executable's major version will match Express's:
+
+```bash
+$ npm install -g express-generator@4
+```
+
+ Create the app:
+
+```bash
+$ express /tmp/foo && cd /tmp/foo
+```
+
+ Install dependencies:
+
+```bash
+$ npm install
+```
+
+ Start the server:
+
+```bash
+$ npm start
+```
+
+## Philosophy
+
+ The Express philosophy is to provide small, robust tooling for HTTP servers, making
+ it a great solution for single page applications, web sites, hybrids, or public
+ HTTP APIs.
+
+ Express does not force you to use any specific ORM or template engine. With support for over
+ 14 template engines via [Consolidate.js](https://github.com/tj/consolidate.js),
+ you can quickly craft your perfect framework.
+
+## Examples
+
+ To view the examples, clone the Express repo & install the dependancies:
+
+```bash
+$ git clone git://github.com/strongloop/express.git --depth 1
+$ cd express
+$ npm install
+```
+
+ Then run whichever example you want:
+
+```bash
+$ node examples/content-negotiation
+```
+
+## Tests
+
+ To run the test suite, first install the dependancies, then run `npm test`:
+
+```bash
+$ npm install
+$ npm test
+```
+
+### People
+
+The original author of Express is [TJ Holowaychuk](https://github.com/tj) [![TJ's Gratipay][gratipay-image-visionmedia]][gratipay-url-visionmedia]
+
+The current lead maintainer is [Douglas Christopher Wilson](https://github.com/dougwilson) [![Doug's Gratipay][gratipay-image-dougwilson]][gratipay-url-dougwilson]
+
+[List of all contributors](https://github.com/strongloop/express/graphs/contributors)
+
+### License
+
+ [MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/express.svg?style=flat
+[npm-url]: https://npmjs.org/package/express
+[downloads-image]: https://img.shields.io/npm/dm/express.svg?style=flat
+[downloads-url]: https://npmjs.org/package/express
+[travis-image]: https://img.shields.io/travis/strongloop/express.svg?style=flat
+[travis-url]: https://travis-ci.org/strongloop/express
+[coveralls-image]: https://img.shields.io/coveralls/strongloop/express.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/strongloop/express?branch=master
+[gratipay-image-visionmedia]: https://img.shields.io/gratipay/visionmedia.svg?style=flat
+[gratipay-url-visionmedia]: https://gratipay.com/visionmedia/
+[gratipay-image-dougwilson]: https://img.shields.io/gratipay/dougwilson.svg?style=flat
+[gratipay-url-dougwilson]: https://gratipay.com/dougwilson/
diff --git a/server/node_modules/express/index.js b/server/node_modules/express/index.js
new file mode 100755
index 00000000..3da33783
--- /dev/null
+++ b/server/node_modules/express/index.js
@@ -0,0 +1,2 @@
+
+module.exports = require('./lib/express');
diff --git a/server/node_modules/express/lib/application.js b/server/node_modules/express/lib/application.js
new file mode 100755
index 00000000..2fbb5503
--- /dev/null
+++ b/server/node_modules/express/lib/application.js
@@ -0,0 +1,571 @@
+/**
+ * Module dependencies.
+ */
+
+var finalhandler = require('finalhandler');
+var flatten = require('./utils').flatten;
+var Router = require('./router');
+var methods = require('methods');
+var middleware = require('./middleware/init');
+var query = require('./middleware/query');
+var debug = require('debug')('express:application');
+var View = require('./view');
+var http = require('http');
+var compileETag = require('./utils').compileETag;
+var compileQueryParser = require('./utils').compileQueryParser;
+var compileTrust = require('./utils').compileTrust;
+var deprecate = require('depd')('express');
+var merge = require('utils-merge');
+var resolve = require('path').resolve;
+var slice = Array.prototype.slice;
+
+/**
+ * Application prototype.
+ */
+
+var app = exports = module.exports = {};
+
+/**
+ * Initialize the server.
+ *
+ * - setup default configuration
+ * - setup default middleware
+ * - setup route reflection methods
+ *
+ * @api private
+ */
+
+app.init = function(){
+ this.cache = {};
+ this.settings = {};
+ this.engines = {};
+ this.defaultConfiguration();
+};
+
+/**
+ * Initialize application configuration.
+ *
+ * @api private
+ */
+
+app.defaultConfiguration = function(){
+ // default settings
+ this.enable('x-powered-by');
+ this.set('etag', 'weak');
+ var env = process.env.NODE_ENV || 'development';
+ this.set('env', env);
+ this.set('query parser', 'extended');
+ this.set('subdomain offset', 2);
+ this.set('trust proxy', false);
+
+ debug('booting in %s mode', env);
+
+ // inherit protos
+ this.on('mount', function(parent){
+ this.request.__proto__ = parent.request;
+ this.response.__proto__ = parent.response;
+ this.engines.__proto__ = parent.engines;
+ this.settings.__proto__ = parent.settings;
+ });
+
+ // setup locals
+ this.locals = Object.create(null);
+
+ // top-most app is mounted at /
+ this.mountpath = '/';
+
+ // default locals
+ this.locals.settings = this.settings;
+
+ // default configuration
+ this.set('view', View);
+ this.set('views', resolve('views'));
+ this.set('jsonp callback name', 'callback');
+
+ if (env === 'production') {
+ this.enable('view cache');
+ }
+
+ Object.defineProperty(this, 'router', {
+ get: function() {
+ throw new Error('\'app.router\' is deprecated!\nPlease see the 3.x to 4.x migration guide for details on how to update your app.');
+ }
+ });
+};
+
+/**
+ * lazily adds the base router if it has not yet been added.
+ *
+ * We cannot add the base router in the defaultConfiguration because
+ * it reads app settings which might be set after that has run.
+ *
+ * @api private
+ */
+app.lazyrouter = function() {
+ if (!this._router) {
+ this._router = new Router({
+ caseSensitive: this.enabled('case sensitive routing'),
+ strict: this.enabled('strict routing')
+ });
+
+ this._router.use(query(this.get('query parser fn')));
+ this._router.use(middleware.init(this));
+ }
+};
+
+/**
+ * Dispatch a req, res pair into the application. Starts pipeline processing.
+ *
+ * If no _done_ callback is provided, then default error handlers will respond
+ * in the event of an error bubbling through the stack.
+ *
+ * @api private
+ */
+
+app.handle = function(req, res, done) {
+ var router = this._router;
+
+ // final handler
+ done = done || finalhandler(req, res, {
+ env: this.get('env'),
+ onerror: logerror.bind(this)
+ });
+
+ // no routes
+ if (!router) {
+ debug('no routes defined on app');
+ done();
+ return;
+ }
+
+ router.handle(req, res, done);
+};
+
+/**
+ * Proxy `Router#use()` to add middleware to the app router.
+ * See Router#use() documentation for details.
+ *
+ * If the _fn_ parameter is an express app, then it will be
+ * mounted at the _route_ specified.
+ *
+ * @api public
+ */
+
+app.use = function use(fn) {
+ var offset = 0;
+ var path = '/';
+
+ // default path to '/'
+ // disambiguate app.use([fn])
+ if (typeof fn !== 'function') {
+ var arg = fn;
+
+ while (Array.isArray(arg) && arg.length !== 0) {
+ arg = arg[0];
+ }
+
+ // first arg is the path
+ if (typeof arg !== 'function') {
+ offset = 1;
+ path = fn;
+ }
+ }
+
+ var fns = flatten(slice.call(arguments, offset));
+
+ if (fns.length === 0) {
+ throw new TypeError('app.use() requires middleware functions');
+ }
+
+ // setup router
+ this.lazyrouter();
+ var router = this._router;
+
+ fns.forEach(function (fn) {
+ // non-express app
+ if (!fn || !fn.handle || !fn.set) {
+ return router.use(path, fn);
+ }
+
+ debug('.use app under %s', path);
+ fn.mountpath = path;
+ fn.parent = this;
+
+ // restore .app property on req and res
+ router.use(path, function mounted_app(req, res, next) {
+ var orig = req.app;
+ fn.handle(req, res, function (err) {
+ req.__proto__ = orig.request;
+ res.__proto__ = orig.response;
+ next(err);
+ });
+ });
+
+ // mounted an app
+ fn.emit('mount', this);
+ }, this);
+
+ return this;
+};
+
+/**
+ * Proxy to the app `Router#route()`
+ * Returns a new `Route` instance for the _path_.
+ *
+ * Routes are isolated middleware stacks for specific paths.
+ * See the Route api docs for details.
+ *
+ * @api public
+ */
+
+app.route = function(path){
+ this.lazyrouter();
+ return this._router.route(path);
+};
+
+/**
+ * Register the given template engine callback `fn`
+ * as `ext`.
+ *
+ * By default will `require()` the engine based on the
+ * file extension. For example if you try to render
+ * a "foo.jade" file Express will invoke the following internally:
+ *
+ * app.engine('jade', require('jade').__express);
+ *
+ * For engines that do not provide `.__express` out of the box,
+ * or if you wish to "map" a different extension to the template engine
+ * you may use this method. For example mapping the EJS template engine to
+ * ".html" files:
+ *
+ * app.engine('html', require('ejs').renderFile);
+ *
+ * In this case EJS provides a `.renderFile()` method with
+ * the same signature that Express expects: `(path, options, callback)`,
+ * though note that it aliases this method as `ejs.__express` internally
+ * so if you're using ".ejs" extensions you dont need to do anything.
+ *
+ * Some template engines do not follow this convention, the
+ * [Consolidate.js](https://github.com/tj/consolidate.js)
+ * library was created to map all of node's popular template
+ * engines to follow this convention, thus allowing them to
+ * work seamlessly within Express.
+ *
+ * @param {String} ext
+ * @param {Function} fn
+ * @return {app} for chaining
+ * @api public
+ */
+
+app.engine = function(ext, fn){
+ if ('function' != typeof fn) throw new Error('callback function required');
+ if ('.' != ext[0]) ext = '.' + ext;
+ this.engines[ext] = fn;
+ return this;
+};
+
+/**
+ * Proxy to `Router#param()` with one added api feature. The _name_ parameter
+ * can be an array of names.
+ *
+ * See the Router#param() docs for more details.
+ *
+ * @param {String|Array} name
+ * @param {Function} fn
+ * @return {app} for chaining
+ * @api public
+ */
+
+app.param = function(name, fn){
+ this.lazyrouter();
+
+ if (Array.isArray(name)) {
+ name.forEach(function(key) {
+ this.param(key, fn);
+ }, this);
+ return this;
+ }
+
+ this._router.param(name, fn);
+ return this;
+};
+
+/**
+ * Assign `setting` to `val`, or return `setting`'s value.
+ *
+ * app.set('foo', 'bar');
+ * app.get('foo');
+ * // => "bar"
+ *
+ * Mounted servers inherit their parent server's settings.
+ *
+ * @param {String} setting
+ * @param {*} [val]
+ * @return {Server} for chaining
+ * @api public
+ */
+
+app.set = function(setting, val){
+ if (arguments.length === 1) {
+ // app.get(setting)
+ return this.settings[setting];
+ }
+
+ // set value
+ this.settings[setting] = val;
+
+ // trigger matched settings
+ switch (setting) {
+ case 'etag':
+ debug('compile etag %s', val);
+ this.set('etag fn', compileETag(val));
+ break;
+ case 'query parser':
+ debug('compile query parser %s', val);
+ this.set('query parser fn', compileQueryParser(val));
+ break;
+ case 'trust proxy':
+ debug('compile trust proxy %s', val);
+ this.set('trust proxy fn', compileTrust(val));
+ break;
+ }
+
+ return this;
+};
+
+/**
+ * Return the app's absolute pathname
+ * based on the parent(s) that have
+ * mounted it.
+ *
+ * For example if the application was
+ * mounted as "/admin", which itself
+ * was mounted as "/blog" then the
+ * return value would be "/blog/admin".
+ *
+ * @return {String}
+ * @api private
+ */
+
+app.path = function(){
+ return this.parent
+ ? this.parent.path() + this.mountpath
+ : '';
+};
+
+/**
+ * Check if `setting` is enabled (truthy).
+ *
+ * app.enabled('foo')
+ * // => false
+ *
+ * app.enable('foo')
+ * app.enabled('foo')
+ * // => true
+ *
+ * @param {String} setting
+ * @return {Boolean}
+ * @api public
+ */
+
+app.enabled = function(setting){
+ return !!this.set(setting);
+};
+
+/**
+ * Check if `setting` is disabled.
+ *
+ * app.disabled('foo')
+ * // => true
+ *
+ * app.enable('foo')
+ * app.disabled('foo')
+ * // => false
+ *
+ * @param {String} setting
+ * @return {Boolean}
+ * @api public
+ */
+
+app.disabled = function(setting){
+ return !this.set(setting);
+};
+
+/**
+ * Enable `setting`.
+ *
+ * @param {String} setting
+ * @return {app} for chaining
+ * @api public
+ */
+
+app.enable = function(setting){
+ return this.set(setting, true);
+};
+
+/**
+ * Disable `setting`.
+ *
+ * @param {String} setting
+ * @return {app} for chaining
+ * @api public
+ */
+
+app.disable = function(setting){
+ return this.set(setting, false);
+};
+
+/**
+ * Delegate `.VERB(...)` calls to `router.VERB(...)`.
+ */
+
+methods.forEach(function(method){
+ app[method] = function(path){
+ if ('get' == method && 1 == arguments.length) return this.set(path);
+
+ this.lazyrouter();
+
+ var route = this._router.route(path);
+ route[method].apply(route, slice.call(arguments, 1));
+ return this;
+ };
+});
+
+/**
+ * Special-cased "all" method, applying the given route `path`,
+ * middleware, and callback to _every_ HTTP method.
+ *
+ * @param {String} path
+ * @param {Function} ...
+ * @return {app} for chaining
+ * @api public
+ */
+
+app.all = function(path){
+ this.lazyrouter();
+
+ var route = this._router.route(path);
+ var args = slice.call(arguments, 1);
+ methods.forEach(function(method){
+ route[method].apply(route, args);
+ });
+
+ return this;
+};
+
+// del -> delete alias
+
+app.del = deprecate.function(app.delete, 'app.del: Use app.delete instead');
+
+/**
+ * Render the given view `name` name with `options`
+ * and a callback accepting an error and the
+ * rendered template string.
+ *
+ * Example:
+ *
+ * app.render('email', { name: 'Tobi' }, function(err, html){
+ * // ...
+ * })
+ *
+ * @param {String} name
+ * @param {String|Function} options or fn
+ * @param {Function} fn
+ * @api public
+ */
+
+app.render = function(name, options, fn){
+ var opts = {};
+ var cache = this.cache;
+ var engines = this.engines;
+ var view;
+
+ // support callback function as second arg
+ if ('function' == typeof options) {
+ fn = options, options = {};
+ }
+
+ // merge app.locals
+ merge(opts, this.locals);
+
+ // merge options._locals
+ if (options._locals) {
+ merge(opts, options._locals);
+ }
+
+ // merge options
+ merge(opts, options);
+
+ // set .cache unless explicitly provided
+ opts.cache = null == opts.cache
+ ? this.enabled('view cache')
+ : opts.cache;
+
+ // primed cache
+ if (opts.cache) view = cache[name];
+
+ // view
+ if (!view) {
+ view = new (this.get('view'))(name, {
+ defaultEngine: this.get('view engine'),
+ root: this.get('views'),
+ engines: engines
+ });
+
+ if (!view.path) {
+ var dirs = Array.isArray(view.root) && view.root.length > 1
+ ? 'directories "' + view.root.slice(0, -1).join('", "') + '" or "' + view.root[view.root.length - 1] + '"'
+ : 'directory "' + view.root + '"'
+ var err = new Error('Failed to lookup view "' + name + '" in views ' + dirs);
+ err.view = view;
+ return fn(err);
+ }
+
+ // prime the cache
+ if (opts.cache) cache[name] = view;
+ }
+
+ // render
+ try {
+ view.render(opts, fn);
+ } catch (err) {
+ fn(err);
+ }
+};
+
+/**
+ * Listen for connections.
+ *
+ * A node `http.Server` is returned, with this
+ * application (which is a `Function`) as its
+ * callback. If you wish to create both an HTTP
+ * and HTTPS server you may do so with the "http"
+ * and "https" modules as shown here:
+ *
+ * var http = require('http')
+ * , https = require('https')
+ * , express = require('express')
+ * , app = express();
+ *
+ * http.createServer(app).listen(80);
+ * https.createServer({ ... }, app).listen(443);
+ *
+ * @return {http.Server}
+ * @api public
+ */
+
+app.listen = function(){
+ var server = http.createServer(this);
+ return server.listen.apply(server, arguments);
+};
+
+/**
+* Log error using console.error.
+*
+* @param {Error} err
+* @api public
+*/
+
+function logerror(err){
+ if (this.get('env') !== 'test') console.error(err.stack || err.toString());
+}
diff --git a/server/node_modules/express/lib/express.js b/server/node_modules/express/lib/express.js
new file mode 100755
index 00000000..8a6c2846
--- /dev/null
+++ b/server/node_modules/express/lib/express.js
@@ -0,0 +1,93 @@
+/**
+ * Module dependencies.
+ */
+
+var EventEmitter = require('events').EventEmitter;
+var mixin = require('merge-descriptors');
+var proto = require('./application');
+var Route = require('./router/route');
+var Router = require('./router');
+var req = require('./request');
+var res = require('./response');
+
+/**
+ * Expose `createApplication()`.
+ */
+
+exports = module.exports = createApplication;
+
+/**
+ * Create an express application.
+ *
+ * @return {Function}
+ * @api public
+ */
+
+function createApplication() {
+ var app = function(req, res, next) {
+ app.handle(req, res, next);
+ };
+
+ mixin(app, proto);
+ mixin(app, EventEmitter.prototype);
+
+ app.request = { __proto__: req, app: app };
+ app.response = { __proto__: res, app: app };
+ app.init();
+ return app;
+}
+
+/**
+ * Expose the prototypes.
+ */
+
+exports.application = proto;
+exports.request = req;
+exports.response = res;
+
+/**
+ * Expose constructors.
+ */
+
+exports.Route = Route;
+exports.Router = Router;
+
+/**
+ * Expose middleware
+ */
+
+exports.query = require('./middleware/query');
+exports.static = require('serve-static');
+
+/**
+ * Replace removed middleware with an appropriate error message.
+ */
+
+[
+ 'json',
+ 'urlencoded',
+ 'bodyParser',
+ 'compress',
+ 'cookieSession',
+ 'session',
+ 'logger',
+ 'cookieParser',
+ 'favicon',
+ 'responseTime',
+ 'errorHandler',
+ 'timeout',
+ 'methodOverride',
+ 'vhost',
+ 'csrf',
+ 'directory',
+ 'limit',
+ 'multipart',
+ 'staticCache',
+].forEach(function (name) {
+ Object.defineProperty(exports, name, {
+ get: function () {
+ throw new Error('Most middleware (like ' + name + ') is no longer bundled with Express and must be installed separately. Please see https://github.com/senchalabs/connect#middleware.');
+ },
+ configurable: true
+ });
+});
diff --git a/server/node_modules/express/lib/middleware/init.js b/server/node_modules/express/lib/middleware/init.js
new file mode 100755
index 00000000..c09cf0c6
--- /dev/null
+++ b/server/node_modules/express/lib/middleware/init.js
@@ -0,0 +1,26 @@
+/**
+ * Initialization middleware, exposing the
+ * request and response to eachother, as well
+ * as defaulting the X-Powered-By header field.
+ *
+ * @param {Function} app
+ * @return {Function}
+ * @api private
+ */
+
+exports.init = function(app){
+ return function expressInit(req, res, next){
+ if (app.enabled('x-powered-by')) res.setHeader('X-Powered-By', 'Express');
+ req.res = res;
+ res.req = req;
+ req.next = next;
+
+ req.__proto__ = app.request;
+ res.__proto__ = app.response;
+
+ res.locals = res.locals || Object.create(null);
+
+ next();
+ };
+};
+
diff --git a/server/node_modules/express/lib/middleware/query.js b/server/node_modules/express/lib/middleware/query.js
new file mode 100755
index 00000000..092bbd99
--- /dev/null
+++ b/server/node_modules/express/lib/middleware/query.js
@@ -0,0 +1,30 @@
+/**
+ * Module dependencies.
+ */
+
+var parseUrl = require('parseurl');
+var qs = require('qs');
+
+/**
+ * @param {Object} options
+ * @return {Function}
+ * @api public
+ */
+
+module.exports = function query(options) {
+ var queryparse = qs.parse;
+
+ if (typeof options === 'function') {
+ queryparse = options;
+ options = undefined;
+ }
+
+ return function query(req, res, next){
+ if (!req.query) {
+ var val = parseUrl(req).query;
+ req.query = queryparse(val, options);
+ }
+
+ next();
+ };
+};
diff --git a/server/node_modules/express/lib/request.js b/server/node_modules/express/lib/request.js
new file mode 100755
index 00000000..483ee1c1
--- /dev/null
+++ b/server/node_modules/express/lib/request.js
@@ -0,0 +1,460 @@
+/**
+ * Module dependencies.
+ */
+
+var accepts = require('accepts');
+var deprecate = require('depd')('express');
+var isIP = require('net').isIP;
+var typeis = require('type-is');
+var http = require('http');
+var fresh = require('fresh');
+var parseRange = require('range-parser');
+var parse = require('parseurl');
+var proxyaddr = require('proxy-addr');
+
+/**
+ * Request prototype.
+ */
+
+var req = exports = module.exports = {
+ __proto__: http.IncomingMessage.prototype
+};
+
+/**
+ * Return request header.
+ *
+ * The `Referrer` header field is special-cased,
+ * both `Referrer` and `Referer` are interchangeable.
+ *
+ * Examples:
+ *
+ * req.get('Content-Type');
+ * // => "text/plain"
+ *
+ * req.get('content-type');
+ * // => "text/plain"
+ *
+ * req.get('Something');
+ * // => undefined
+ *
+ * Aliased as `req.header()`.
+ *
+ * @param {String} name
+ * @return {String}
+ * @api public
+ */
+
+req.get =
+req.header = function(name){
+ switch (name = name.toLowerCase()) {
+ case 'referer':
+ case 'referrer':
+ return this.headers.referrer
+ || this.headers.referer;
+ default:
+ return this.headers[name];
+ }
+};
+
+/**
+ * To do: update docs.
+ *
+ * Check if the given `type(s)` is acceptable, returning
+ * the best match when true, otherwise `undefined`, in which
+ * case you should respond with 406 "Not Acceptable".
+ *
+ * The `type` value may be a single mime type string
+ * such as "application/json", the extension name
+ * such as "json", a comma-delimted list such as "json, html, text/plain",
+ * an argument list such as `"json", "html", "text/plain"`,
+ * or an array `["json", "html", "text/plain"]`. When a list
+ * or array is given the _best_ match, if any is returned.
+ *
+ * Examples:
+ *
+ * // Accept: text/html
+ * req.accepts('html');
+ * // => "html"
+ *
+ * // Accept: text/*, application/json
+ * req.accepts('html');
+ * // => "html"
+ * req.accepts('text/html');
+ * // => "text/html"
+ * req.accepts('json, text');
+ * // => "json"
+ * req.accepts('application/json');
+ * // => "application/json"
+ *
+ * // Accept: text/*, application/json
+ * req.accepts('image/png');
+ * req.accepts('png');
+ * // => undefined
+ *
+ * // Accept: text/*;q=.5, application/json
+ * req.accepts(['html', 'json']);
+ * req.accepts('html', 'json');
+ * req.accepts('html, json');
+ * // => "json"
+ *
+ * @param {String|Array} type(s)
+ * @return {String}
+ * @api public
+ */
+
+req.accepts = function(){
+ var accept = accepts(this);
+ return accept.types.apply(accept, arguments);
+};
+
+/**
+ * Check if the given `encoding`s are accepted.
+ *
+ * @param {String} ...encoding
+ * @return {Boolean}
+ * @api public
+ */
+
+req.acceptsEncodings = function(){
+ var accept = accepts(this);
+ return accept.encodings.apply(accept, arguments);
+};
+
+req.acceptsEncoding = deprecate.function(req.acceptsEncodings,
+ 'req.acceptsEncoding: Use acceptsEncodings instead');
+
+/**
+ * Check if the given `charset`s are acceptable,
+ * otherwise you should respond with 406 "Not Acceptable".
+ *
+ * @param {String} ...charset
+ * @return {Boolean}
+ * @api public
+ */
+
+req.acceptsCharsets = function(){
+ var accept = accepts(this);
+ return accept.charsets.apply(accept, arguments);
+};
+
+req.acceptsCharset = deprecate.function(req.acceptsCharsets,
+ 'req.acceptsCharset: Use acceptsCharsets instead');
+
+/**
+ * Check if the given `lang`s are acceptable,
+ * otherwise you should respond with 406 "Not Acceptable".
+ *
+ * @param {String} ...lang
+ * @return {Boolean}
+ * @api public
+ */
+
+req.acceptsLanguages = function(){
+ var accept = accepts(this);
+ return accept.languages.apply(accept, arguments);
+};
+
+req.acceptsLanguage = deprecate.function(req.acceptsLanguages,
+ 'req.acceptsLanguage: Use acceptsLanguages instead');
+
+/**
+ * Parse Range header field,
+ * capping to the given `size`.
+ *
+ * Unspecified ranges such as "0-" require
+ * knowledge of your resource length. In
+ * the case of a byte range this is of course
+ * the total number of bytes. If the Range
+ * header field is not given `null` is returned,
+ * `-1` when unsatisfiable, `-2` when syntactically invalid.
+ *
+ * NOTE: remember that ranges are inclusive, so
+ * for example "Range: users=0-3" should respond
+ * with 4 users when available, not 3.
+ *
+ * @param {Number} size
+ * @return {Array}
+ * @api public
+ */
+
+req.range = function(size){
+ var range = this.get('Range');
+ if (!range) return;
+ return parseRange(size, range);
+};
+
+/**
+ * Return the value of param `name` when present or `defaultValue`.
+ *
+ * - Checks route placeholders, ex: _/user/:id_
+ * - Checks body params, ex: id=12, {"id":12}
+ * - Checks query string params, ex: ?id=12
+ *
+ * To utilize request bodies, `req.body`
+ * should be an object. This can be done by using
+ * the `bodyParser()` middleware.
+ *
+ * @param {String} name
+ * @param {Mixed} [defaultValue]
+ * @return {String}
+ * @api public
+ */
+
+req.param = function(name, defaultValue){
+ var params = this.params || {};
+ var body = this.body || {};
+ var query = this.query || {};
+ if (null != params[name] && params.hasOwnProperty(name)) return params[name];
+ if (null != body[name]) return body[name];
+ if (null != query[name]) return query[name];
+ return defaultValue;
+};
+
+/**
+ * Check if the incoming request contains the "Content-Type"
+ * header field, and it contains the give mime `type`.
+ *
+ * Examples:
+ *
+ * // With Content-Type: text/html; charset=utf-8
+ * req.is('html');
+ * req.is('text/html');
+ * req.is('text/*');
+ * // => true
+ *
+ * // When Content-Type is application/json
+ * req.is('json');
+ * req.is('application/json');
+ * req.is('application/*');
+ * // => true
+ *
+ * req.is('html');
+ * // => false
+ *
+ * @param {String} type
+ * @return {Boolean}
+ * @api public
+ */
+
+req.is = function(types){
+ if (!Array.isArray(types)) types = [].slice.call(arguments);
+ return typeis(this, types);
+};
+
+/**
+ * Return the protocol string "http" or "https"
+ * when requested with TLS. When the "trust proxy"
+ * setting trusts the socket address, the
+ * "X-Forwarded-Proto" header field will be trusted
+ * and used if present.
+ *
+ * If you're running behind a reverse proxy that
+ * supplies https for you this may be enabled.
+ *
+ * @return {String}
+ * @api public
+ */
+
+defineGetter(req, 'protocol', function protocol(){
+ var proto = this.connection.encrypted
+ ? 'https'
+ : 'http';
+ var trust = this.app.get('trust proxy fn');
+
+ if (!trust(this.connection.remoteAddress)) {
+ return proto;
+ }
+
+ // Note: X-Forwarded-Proto is normally only ever a
+ // single value, but this is to be safe.
+ proto = this.get('X-Forwarded-Proto') || proto;
+ return proto.split(/\s*,\s*/)[0];
+});
+
+/**
+ * Short-hand for:
+ *
+ * req.protocol == 'https'
+ *
+ * @return {Boolean}
+ * @api public
+ */
+
+defineGetter(req, 'secure', function secure(){
+ return 'https' == this.protocol;
+});
+
+/**
+ * Return the remote address from the trusted proxy.
+ *
+ * The is the remote address on the socket unless
+ * "trust proxy" is set.
+ *
+ * @return {String}
+ * @api public
+ */
+
+defineGetter(req, 'ip', function ip(){
+ var trust = this.app.get('trust proxy fn');
+ return proxyaddr(this, trust);
+});
+
+/**
+ * When "trust proxy" is set, trusted proxy addresses + client.
+ *
+ * For example if the value were "client, proxy1, proxy2"
+ * you would receive the array `["client", "proxy1", "proxy2"]`
+ * where "proxy2" is the furthest down-stream and "proxy1" and
+ * "proxy2" were trusted.
+ *
+ * @return {Array}
+ * @api public
+ */
+
+defineGetter(req, 'ips', function ips() {
+ var trust = this.app.get('trust proxy fn');
+ var addrs = proxyaddr.all(this, trust);
+ return addrs.slice(1).reverse();
+});
+
+/**
+ * Return subdomains as an array.
+ *
+ * Subdomains are the dot-separated parts of the host before the main domain of
+ * the app. By default, the domain of the app is assumed to be the last two
+ * parts of the host. This can be changed by setting "subdomain offset".
+ *
+ * For example, if the domain is "tobi.ferrets.example.com":
+ * If "subdomain offset" is not set, req.subdomains is `["ferrets", "tobi"]`.
+ * If "subdomain offset" is 3, req.subdomains is `["tobi"]`.
+ *
+ * @return {Array}
+ * @api public
+ */
+
+defineGetter(req, 'subdomains', function subdomains() {
+ var hostname = this.hostname;
+
+ if (!hostname) return [];
+
+ var offset = this.app.get('subdomain offset');
+ var subdomains = !isIP(hostname)
+ ? hostname.split('.').reverse()
+ : [hostname];
+
+ return subdomains.slice(offset);
+});
+
+/**
+ * Short-hand for `url.parse(req.url).pathname`.
+ *
+ * @return {String}
+ * @api public
+ */
+
+defineGetter(req, 'path', function path() {
+ return parse(this).pathname;
+});
+
+/**
+ * Parse the "Host" header field to a hostname.
+ *
+ * When the "trust proxy" setting trusts the socket
+ * address, the "X-Forwarded-Host" header field will
+ * be trusted.
+ *
+ * @return {String}
+ * @api public
+ */
+
+defineGetter(req, 'hostname', function hostname(){
+ var trust = this.app.get('trust proxy fn');
+ var host = this.get('X-Forwarded-Host');
+
+ if (!host || !trust(this.connection.remoteAddress)) {
+ host = this.get('Host');
+ }
+
+ if (!host) return;
+
+ // IPv6 literal support
+ var offset = host[0] === '['
+ ? host.indexOf(']') + 1
+ : 0;
+ var index = host.indexOf(':', offset);
+
+ return ~index
+ ? host.substring(0, index)
+ : host;
+});
+
+// TODO: change req.host to return host in next major
+
+defineGetter(req, 'host', deprecate.function(function host(){
+ return this.hostname;
+}, 'req.host: Use req.hostname instead'));
+
+/**
+ * Check if the request is fresh, aka
+ * Last-Modified and/or the ETag
+ * still match.
+ *
+ * @return {Boolean}
+ * @api public
+ */
+
+defineGetter(req, 'fresh', function(){
+ var method = this.method;
+ var s = this.res.statusCode;
+
+ // GET or HEAD for weak freshness validation only
+ if ('GET' != method && 'HEAD' != method) return false;
+
+ // 2xx or 304 as per rfc2616 14.26
+ if ((s >= 200 && s < 300) || 304 == s) {
+ return fresh(this.headers, this.res._headers);
+ }
+
+ return false;
+});
+
+/**
+ * Check if the request is stale, aka
+ * "Last-Modified" and / or the "ETag" for the
+ * resource has changed.
+ *
+ * @return {Boolean}
+ * @api public
+ */
+
+defineGetter(req, 'stale', function stale(){
+ return !this.fresh;
+});
+
+/**
+ * Check if the request was an _XMLHttpRequest_.
+ *
+ * @return {Boolean}
+ * @api public
+ */
+
+defineGetter(req, 'xhr', function xhr(){
+ var val = this.get('X-Requested-With') || '';
+ return 'xmlhttprequest' == val.toLowerCase();
+});
+
+/**
+ * Helper function for creating a getter on an object.
+ *
+ * @param {Object} obj
+ * @param {String} name
+ * @param {Function} getter
+ * @api private
+ */
+function defineGetter(obj, name, getter) {
+ Object.defineProperty(obj, name, {
+ configurable: true,
+ enumerable: true,
+ get: getter
+ });
+};
diff --git a/server/node_modules/express/lib/response.js b/server/node_modules/express/lib/response.js
new file mode 100755
index 00000000..34e46ad7
--- /dev/null
+++ b/server/node_modules/express/lib/response.js
@@ -0,0 +1,971 @@
+/**
+ * Module dependencies.
+ */
+
+var contentDisposition = require('content-disposition');
+var deprecate = require('depd')('express');
+var escapeHtml = require('escape-html');
+var http = require('http');
+var isAbsolute = require('./utils').isAbsolute;
+var onFinished = require('on-finished');
+var path = require('path');
+var merge = require('utils-merge');
+var sign = require('cookie-signature').sign;
+var normalizeType = require('./utils').normalizeType;
+var normalizeTypes = require('./utils').normalizeTypes;
+var setCharset = require('./utils').setCharset;
+var statusCodes = http.STATUS_CODES;
+var cookie = require('cookie');
+var send = require('send');
+var extname = path.extname;
+var mime = send.mime;
+var resolve = path.resolve;
+var vary = require('vary');
+
+/**
+ * Response prototype.
+ */
+
+var res = module.exports = {
+ __proto__: http.ServerResponse.prototype
+};
+
+/**
+ * Set status `code`.
+ *
+ * @param {Number} code
+ * @return {ServerResponse}
+ * @api public
+ */
+
+res.status = function(code){
+ this.statusCode = code;
+ return this;
+};
+
+/**
+ * Set Link header field with the given `links`.
+ *
+ * Examples:
+ *
+ * res.links({
+ * next: 'http://api.example.com/users?page=2',
+ * last: 'http://api.example.com/users?page=5'
+ * });
+ *
+ * @param {Object} links
+ * @return {ServerResponse}
+ * @api public
+ */
+
+res.links = function(links){
+ var link = this.get('Link') || '';
+ if (link) link += ', ';
+ return this.set('Link', link + Object.keys(links).map(function(rel){
+ return '<' + links[rel] + '>; rel="' + rel + '"';
+ }).join(', '));
+};
+
+/**
+ * Send a response.
+ *
+ * Examples:
+ *
+ * res.send(new Buffer('wahoo'));
+ * res.send({ some: 'json' });
+ * res.send('some html
');
+ *
+ * @param {string|number|boolean|object|Buffer} body
+ * @api public
+ */
+
+res.send = function send(body) {
+ var chunk = body;
+ var encoding;
+ var len;
+ var req = this.req;
+ var type;
+
+ // settings
+ var app = this.app;
+
+ // allow status / body
+ if (arguments.length === 2) {
+ // res.send(body, status) backwards compat
+ if (typeof arguments[0] !== 'number' && typeof arguments[1] === 'number') {
+ deprecate('res.send(body, status): Use res.status(status).send(body) instead');
+ this.statusCode = arguments[1];
+ } else {
+ deprecate('res.send(status, body): Use res.status(status).send(body) instead');
+ this.statusCode = arguments[0];
+ chunk = arguments[1];
+ }
+ }
+
+ // disambiguate res.send(status) and res.send(status, num)
+ if (typeof chunk === 'number' && arguments.length === 1) {
+ // res.send(status) will set status message as text string
+ if (!this.get('Content-Type')) {
+ this.type('txt');
+ }
+
+ deprecate('res.send(status): Use res.sendStatus(status) instead');
+ this.statusCode = chunk;
+ chunk = http.STATUS_CODES[chunk];
+ }
+
+ switch (typeof chunk) {
+ // string defaulting to html
+ case 'string':
+ if (!this.get('Content-Type')) {
+ this.type('html');
+ }
+ break;
+ case 'boolean':
+ case 'number':
+ case 'object':
+ if (chunk === null) {
+ chunk = '';
+ } else if (Buffer.isBuffer(chunk)) {
+ if (!this.get('Content-Type')) {
+ this.type('bin');
+ }
+ } else {
+ return this.json(chunk);
+ }
+ break;
+ }
+
+ // write strings in utf-8
+ if (typeof chunk === 'string') {
+ encoding = 'utf8';
+ type = this.get('Content-Type');
+
+ // reflect this in content-type
+ if (typeof type === 'string') {
+ this.set('Content-Type', setCharset(type, 'utf-8'));
+ }
+ }
+
+ // populate Content-Length
+ if (chunk !== undefined) {
+ if (!Buffer.isBuffer(chunk)) {
+ // convert chunk to Buffer; saves later double conversions
+ chunk = new Buffer(chunk, encoding);
+ encoding = undefined;
+ }
+
+ len = chunk.length;
+ this.set('Content-Length', len);
+ }
+
+ // method check
+ var isHead = req.method === 'HEAD';
+
+ // ETag support
+ if (len !== undefined && (isHead || req.method === 'GET')) {
+ var etag = app.get('etag fn');
+ if (etag && !this.get('ETag')) {
+ etag = etag(chunk, encoding);
+ etag && this.set('ETag', etag);
+ }
+ }
+
+ // freshness
+ if (req.fresh) this.statusCode = 304;
+
+ // strip irrelevant headers
+ if (204 == this.statusCode || 304 == this.statusCode) {
+ this.removeHeader('Content-Type');
+ this.removeHeader('Content-Length');
+ this.removeHeader('Transfer-Encoding');
+ chunk = '';
+ }
+
+ // skip body for HEAD
+ if (isHead) {
+ this.end();
+ }
+
+ // respond
+ this.end(chunk, encoding);
+
+ return this;
+};
+
+/**
+ * Send JSON response.
+ *
+ * Examples:
+ *
+ * res.json(null);
+ * res.json({ user: 'tj' });
+ *
+ * @param {string|number|boolean|object} obj
+ * @api public
+ */
+
+res.json = function json(obj) {
+ var val = obj;
+
+ // allow status / body
+ if (arguments.length === 2) {
+ // res.json(body, status) backwards compat
+ if (typeof arguments[1] === 'number') {
+ deprecate('res.json(obj, status): Use res.status(status).json(obj) instead');
+ this.statusCode = arguments[1];
+ } else {
+ deprecate('res.json(status, obj): Use res.status(status).json(obj) instead');
+ this.statusCode = arguments[0];
+ val = arguments[1];
+ }
+ }
+
+ // settings
+ var app = this.app;
+ var replacer = app.get('json replacer');
+ var spaces = app.get('json spaces');
+ var body = JSON.stringify(val, replacer, spaces);
+
+ // content-type
+ if (!this.get('Content-Type')) {
+ this.set('Content-Type', 'application/json');
+ }
+
+ return this.send(body);
+};
+
+/**
+ * Send JSON response with JSONP callback support.
+ *
+ * Examples:
+ *
+ * res.jsonp(null);
+ * res.jsonp({ user: 'tj' });
+ *
+ * @param {string|number|boolean|object} obj
+ * @api public
+ */
+
+res.jsonp = function jsonp(obj) {
+ var val = obj;
+
+ // allow status / body
+ if (arguments.length === 2) {
+ // res.json(body, status) backwards compat
+ if (typeof arguments[1] === 'number') {
+ deprecate('res.jsonp(obj, status): Use res.status(status).json(obj) instead');
+ this.statusCode = arguments[1];
+ } else {
+ deprecate('res.jsonp(status, obj): Use res.status(status).jsonp(obj) instead');
+ this.statusCode = arguments[0];
+ val = arguments[1];
+ }
+ }
+
+ // settings
+ var app = this.app;
+ var replacer = app.get('json replacer');
+ var spaces = app.get('json spaces');
+ var body = JSON.stringify(val, replacer, spaces);
+ var callback = this.req.query[app.get('jsonp callback name')];
+
+ // content-type
+ if (!this.get('Content-Type')) {
+ this.set('X-Content-Type-Options', 'nosniff');
+ this.set('Content-Type', 'application/json');
+ }
+
+ // fixup callback
+ if (Array.isArray(callback)) {
+ callback = callback[0];
+ }
+
+ // jsonp
+ if (typeof callback === 'string' && callback.length !== 0) {
+ this.charset = 'utf-8';
+ this.set('X-Content-Type-Options', 'nosniff');
+ this.set('Content-Type', 'text/javascript');
+
+ // restrict callback charset
+ callback = callback.replace(/[^\[\]\w$.]/g, '');
+
+ // replace chars not allowed in JavaScript that are in JSON
+ body = body
+ .replace(/\u2028/g, '\\u2028')
+ .replace(/\u2029/g, '\\u2029');
+
+ // the /**/ is a specific security mitigation for "Rosetta Flash JSONP abuse"
+ // the typeof check is just to reduce client error noise
+ body = '/**/ typeof ' + callback + ' === \'function\' && ' + callback + '(' + body + ');';
+ }
+
+ return this.send(body);
+};
+
+/**
+ * Send given HTTP status code.
+ *
+ * Sets the response status to `statusCode` and the body of the
+ * response to the standard description from node's http.STATUS_CODES
+ * or the statusCode number if no description.
+ *
+ * Examples:
+ *
+ * res.sendStatus(200);
+ *
+ * @param {number} statusCode
+ * @api public
+ */
+
+res.sendStatus = function sendStatus(statusCode) {
+ var body = http.STATUS_CODES[statusCode] || String(statusCode);
+
+ this.statusCode = statusCode;
+ this.type('txt');
+
+ return this.send(body);
+};
+
+/**
+ * Transfer the file at the given `path`.
+ *
+ * Automatically sets the _Content-Type_ response header field.
+ * The callback `fn(err)` is invoked when the transfer is complete
+ * or when an error occurs. Be sure to check `res.sentHeader`
+ * if you wish to attempt responding, as the header and some data
+ * may have already been transferred.
+ *
+ * Options:
+ *
+ * - `maxAge` defaulting to 0 (can be string converted by `ms`)
+ * - `root` root directory for relative filenames
+ * - `headers` object of headers to serve with file
+ * - `dotfiles` serve dotfiles, defaulting to false; can be `"allow"` to send them
+ *
+ * Other options are passed along to `send`.
+ *
+ * Examples:
+ *
+ * The following example illustrates how `res.sendFile()` may
+ * be used as an alternative for the `static()` middleware for
+ * dynamic situations. The code backing `res.sendFile()` is actually
+ * the same code, so HTTP cache support etc is identical.
+ *
+ * app.get('/user/:uid/photos/:file', function(req, res){
+ * var uid = req.params.uid
+ * , file = req.params.file;
+ *
+ * req.user.mayViewFilesFrom(uid, function(yes){
+ * if (yes) {
+ * res.sendFile('/uploads/' + uid + '/' + file);
+ * } else {
+ * res.send(403, 'Sorry! you cant see that.');
+ * }
+ * });
+ * });
+ *
+ * @api public
+ */
+
+res.sendFile = function sendFile(path, options, fn) {
+ var req = this.req;
+ var res = this;
+ var next = req.next;
+
+ if (!path) {
+ throw new TypeError('path argument is required to res.sendFile');
+ }
+
+ // support function as second arg
+ if (typeof options === 'function') {
+ fn = options;
+ options = {};
+ }
+
+ options = options || {};
+
+ if (!options.root && !isAbsolute(path)) {
+ throw new TypeError('path must be absolute or specify root to res.sendFile');
+ }
+
+ // create file stream
+ var pathname = encodeURI(path);
+ var file = send(req, pathname, options);
+
+ // transfer
+ sendfile(res, file, options, function (err) {
+ if (fn) return fn(err);
+ if (err && err.code === 'EISDIR') return next();
+
+ // next() all but aborted errors
+ if (err && err.code !== 'ECONNABORT') {
+ next(err);
+ }
+ });
+};
+
+/**
+ * Transfer the file at the given `path`.
+ *
+ * Automatically sets the _Content-Type_ response header field.
+ * The callback `fn(err)` is invoked when the transfer is complete
+ * or when an error occurs. Be sure to check `res.sentHeader`
+ * if you wish to attempt responding, as the header and some data
+ * may have already been transferred.
+ *
+ * Options:
+ *
+ * - `maxAge` defaulting to 0 (can be string converted by `ms`)
+ * - `root` root directory for relative filenames
+ * - `headers` object of headers to serve with file
+ * - `dotfiles` serve dotfiles, defaulting to false; can be `"allow"` to send them
+ *
+ * Other options are passed along to `send`.
+ *
+ * Examples:
+ *
+ * The following example illustrates how `res.sendfile()` may
+ * be used as an alternative for the `static()` middleware for
+ * dynamic situations. The code backing `res.sendfile()` is actually
+ * the same code, so HTTP cache support etc is identical.
+ *
+ * app.get('/user/:uid/photos/:file', function(req, res){
+ * var uid = req.params.uid
+ * , file = req.params.file;
+ *
+ * req.user.mayViewFilesFrom(uid, function(yes){
+ * if (yes) {
+ * res.sendfile('/uploads/' + uid + '/' + file);
+ * } else {
+ * res.send(403, 'Sorry! you cant see that.');
+ * }
+ * });
+ * });
+ *
+ * @api public
+ */
+
+res.sendfile = function(path, options, fn){
+ var req = this.req;
+ var res = this;
+ var next = req.next;
+
+ // support function as second arg
+ if (typeof options === 'function') {
+ fn = options;
+ options = {};
+ }
+
+ options = options || {};
+
+ // create file stream
+ var file = send(req, path, options);
+
+ // transfer
+ sendfile(res, file, options, function (err) {
+ if (fn) return fn(err);
+ if (err && err.code === 'EISDIR') return next();
+
+ // next() all but aborted errors
+ if (err && err.code !== 'ECONNABORT') {
+ next(err);
+ }
+ });
+};
+
+res.sendfile = deprecate.function(res.sendfile,
+ 'res.sendfile: Use res.sendFile instead');
+
+/**
+ * Transfer the file at the given `path` as an attachment.
+ *
+ * Optionally providing an alternate attachment `filename`,
+ * and optional callback `fn(err)`. The callback is invoked
+ * when the data transfer is complete, or when an error has
+ * ocurred. Be sure to check `res.headersSent` if you plan to respond.
+ *
+ * This method uses `res.sendfile()`.
+ *
+ * @api public
+ */
+
+res.download = function download(path, filename, fn) {
+ // support function as second arg
+ if (typeof filename === 'function') {
+ fn = filename;
+ filename = null;
+ }
+
+ filename = filename || path;
+
+ // set Content-Disposition when file is sent
+ var headers = {
+ 'Content-Disposition': contentDisposition(filename)
+ };
+
+ // Resolve the full path for sendFile
+ var fullPath = resolve(path);
+
+ return this.sendFile(fullPath, { headers: headers }, fn);
+};
+
+/**
+ * Set _Content-Type_ response header with `type` through `mime.lookup()`
+ * when it does not contain "/", or set the Content-Type to `type` otherwise.
+ *
+ * Examples:
+ *
+ * res.type('.html');
+ * res.type('html');
+ * res.type('json');
+ * res.type('application/json');
+ * res.type('png');
+ *
+ * @param {String} type
+ * @return {ServerResponse} for chaining
+ * @api public
+ */
+
+res.contentType =
+res.type = function(type){
+ return this.set('Content-Type', ~type.indexOf('/')
+ ? type
+ : mime.lookup(type));
+};
+
+/**
+ * Respond to the Acceptable formats using an `obj`
+ * of mime-type callbacks.
+ *
+ * This method uses `req.accepted`, an array of
+ * acceptable types ordered by their quality values.
+ * When "Accept" is not present the _first_ callback
+ * is invoked, otherwise the first match is used. When
+ * no match is performed the server responds with
+ * 406 "Not Acceptable".
+ *
+ * Content-Type is set for you, however if you choose
+ * you may alter this within the callback using `res.type()`
+ * or `res.set('Content-Type', ...)`.
+ *
+ * res.format({
+ * 'text/plain': function(){
+ * res.send('hey');
+ * },
+ *
+ * 'text/html': function(){
+ * res.send('hey
');
+ * },
+ *
+ * 'appliation/json': function(){
+ * res.send({ message: 'hey' });
+ * }
+ * });
+ *
+ * In addition to canonicalized MIME types you may
+ * also use extnames mapped to these types:
+ *
+ * res.format({
+ * text: function(){
+ * res.send('hey');
+ * },
+ *
+ * html: function(){
+ * res.send('hey
');
+ * },
+ *
+ * json: function(){
+ * res.send({ message: 'hey' });
+ * }
+ * });
+ *
+ * By default Express passes an `Error`
+ * with a `.status` of 406 to `next(err)`
+ * if a match is not made. If you provide
+ * a `.default` callback it will be invoked
+ * instead.
+ *
+ * @param {Object} obj
+ * @return {ServerResponse} for chaining
+ * @api public
+ */
+
+res.format = function(obj){
+ var req = this.req;
+ var next = req.next;
+
+ var fn = obj.default;
+ if (fn) delete obj.default;
+ var keys = Object.keys(obj);
+
+ var key = req.accepts(keys);
+
+ this.vary("Accept");
+
+ if (key) {
+ this.set('Content-Type', normalizeType(key).value);
+ obj[key](req, this, next);
+ } else if (fn) {
+ fn();
+ } else {
+ var err = new Error('Not Acceptable');
+ err.status = 406;
+ err.types = normalizeTypes(keys).map(function(o){ return o.value });
+ next(err);
+ }
+
+ return this;
+};
+
+/**
+ * Set _Content-Disposition_ header to _attachment_ with optional `filename`.
+ *
+ * @param {String} filename
+ * @return {ServerResponse}
+ * @api public
+ */
+
+res.attachment = function attachment(filename) {
+ if (filename) {
+ this.type(extname(filename));
+ }
+
+ this.set('Content-Disposition', contentDisposition(filename));
+
+ return this;
+};
+
+/**
+ * Set header `field` to `val`, or pass
+ * an object of header fields.
+ *
+ * Examples:
+ *
+ * res.set('Foo', ['bar', 'baz']);
+ * res.set('Accept', 'application/json');
+ * res.set({ Accept: 'text/plain', 'X-API-Key': 'tobi' });
+ *
+ * Aliased as `res.header()`.
+ *
+ * @param {String|Object|Array} field
+ * @param {String} val
+ * @return {ServerResponse} for chaining
+ * @api public
+ */
+
+res.set =
+res.header = function header(field, val) {
+ if (arguments.length === 2) {
+ if (Array.isArray(val)) val = val.map(String);
+ else val = String(val);
+ if ('content-type' == field.toLowerCase() && !/;\s*charset\s*=/.test(val)) {
+ var charset = mime.charsets.lookup(val.split(';')[0]);
+ if (charset) val += '; charset=' + charset.toLowerCase();
+ }
+ this.setHeader(field, val);
+ } else {
+ for (var key in field) {
+ this.set(key, field[key]);
+ }
+ }
+ return this;
+};
+
+/**
+ * Get value for header `field`.
+ *
+ * @param {String} field
+ * @return {String}
+ * @api public
+ */
+
+res.get = function(field){
+ return this.getHeader(field);
+};
+
+/**
+ * Clear cookie `name`.
+ *
+ * @param {String} name
+ * @param {Object} options
+ * @return {ServerResponse} for chaining
+ * @api public
+ */
+
+res.clearCookie = function(name, options){
+ var opts = { expires: new Date(1), path: '/' };
+ return this.cookie(name, '', options
+ ? merge(opts, options)
+ : opts);
+};
+
+/**
+ * Set cookie `name` to `val`, with the given `options`.
+ *
+ * Options:
+ *
+ * - `maxAge` max-age in milliseconds, converted to `expires`
+ * - `signed` sign the cookie
+ * - `path` defaults to "/"
+ *
+ * Examples:
+ *
+ * // "Remember Me" for 15 minutes
+ * res.cookie('rememberme', '1', { expires: new Date(Date.now() + 900000), httpOnly: true });
+ *
+ * // save as above
+ * res.cookie('rememberme', '1', { maxAge: 900000, httpOnly: true })
+ *
+ * @param {String} name
+ * @param {String|Object} val
+ * @param {Options} options
+ * @return {ServerResponse} for chaining
+ * @api public
+ */
+
+res.cookie = function(name, val, options){
+ options = merge({}, options);
+ var secret = this.req.secret;
+ var signed = options.signed;
+ if (signed && !secret) throw new Error('cookieParser("secret") required for signed cookies');
+ if ('number' == typeof val) val = val.toString();
+ if ('object' == typeof val) val = 'j:' + JSON.stringify(val);
+ if (signed) val = 's:' + sign(val, secret);
+ if ('maxAge' in options) {
+ options.expires = new Date(Date.now() + options.maxAge);
+ options.maxAge /= 1000;
+ }
+ if (null == options.path) options.path = '/';
+ var headerVal = cookie.serialize(name, String(val), options);
+
+ // supports multiple 'res.cookie' calls by getting previous value
+ var prev = this.get('Set-Cookie');
+ if (prev) {
+ if (Array.isArray(prev)) {
+ headerVal = prev.concat(headerVal);
+ } else {
+ headerVal = [prev, headerVal];
+ }
+ }
+ this.set('Set-Cookie', headerVal);
+ return this;
+};
+
+
+/**
+ * Set the location header to `url`.
+ *
+ * The given `url` can also be "back", which redirects
+ * to the _Referrer_ or _Referer_ headers or "/".
+ *
+ * Examples:
+ *
+ * res.location('/foo/bar').;
+ * res.location('http://example.com');
+ * res.location('../login');
+ *
+ * @param {String} url
+ * @return {ServerResponse} for chaining
+ * @api public
+ */
+
+res.location = function(url){
+ var req = this.req;
+
+ // "back" is an alias for the referrer
+ if ('back' == url) url = req.get('Referrer') || '/';
+
+ // Respond
+ this.set('Location', url);
+ return this;
+};
+
+/**
+ * Redirect to the given `url` with optional response `status`
+ * defaulting to 302.
+ *
+ * The resulting `url` is determined by `res.location()`, so
+ * it will play nicely with mounted apps, relative paths,
+ * `"back"` etc.
+ *
+ * Examples:
+ *
+ * res.redirect('/foo/bar');
+ * res.redirect('http://example.com');
+ * res.redirect(301, 'http://example.com');
+ * res.redirect('../login'); // /blog/post/1 -> /blog/login
+ *
+ * @api public
+ */
+
+res.redirect = function redirect(url) {
+ var address = url;
+ var body;
+ var status = 302;
+
+ // allow status / url
+ if (arguments.length === 2) {
+ if (typeof arguments[0] === 'number') {
+ status = arguments[0];
+ address = arguments[1];
+ } else {
+ deprecate('res.redirect(url, status): Use res.redirect(status, url) instead');
+ status = arguments[1];
+ }
+ }
+
+ // Set location header
+ this.location(address);
+ address = this.get('Location');
+
+ // Support text/{plain,html} by default
+ this.format({
+ text: function(){
+ body = statusCodes[status] + '. Redirecting to ' + encodeURI(address);
+ },
+
+ html: function(){
+ var u = escapeHtml(address);
+ body = '' + statusCodes[status] + '. Redirecting to ' + u + '
';
+ },
+
+ default: function(){
+ body = '';
+ }
+ });
+
+ // Respond
+ this.statusCode = status;
+ this.set('Content-Length', Buffer.byteLength(body));
+
+ if (this.req.method === 'HEAD') {
+ this.end();
+ }
+
+ this.end(body);
+};
+
+/**
+ * Add `field` to Vary. If already present in the Vary set, then
+ * this call is simply ignored.
+ *
+ * @param {Array|String} field
+ * @return {ServerResponse} for chaining
+ * @api public
+ */
+
+res.vary = function(field){
+ // checks for back-compat
+ if (!field || (Array.isArray(field) && !field.length)) {
+ deprecate('res.vary(): Provide a field name');
+ return this;
+ }
+
+ vary(this, field);
+
+ return this;
+};
+
+/**
+ * Render `view` with the given `options` and optional callback `fn`.
+ * When a callback function is given a response will _not_ be made
+ * automatically, otherwise a response of _200_ and _text/html_ is given.
+ *
+ * Options:
+ *
+ * - `cache` boolean hinting to the engine it should cache
+ * - `filename` filename of the view being rendered
+ *
+ * @api public
+ */
+
+res.render = function(view, options, fn){
+ options = options || {};
+ var self = this;
+ var req = this.req;
+ var app = req.app;
+
+ // support callback function as second arg
+ if ('function' == typeof options) {
+ fn = options, options = {};
+ }
+
+ // merge res.locals
+ options._locals = self.locals;
+
+ // default callback to respond
+ fn = fn || function(err, str){
+ if (err) return req.next(err);
+ self.send(str);
+ };
+
+ // render
+ app.render(view, options, fn);
+};
+
+// pipe the send file stream
+function sendfile(res, file, options, callback) {
+ var done = false;
+
+ // directory
+ function ondirectory() {
+ if (done) return;
+ done = true;
+
+ var err = new Error('EISDIR, read');
+ err.code = 'EISDIR';
+ callback(err);
+ }
+
+ // errors
+ function onerror(err) {
+ if (done) return;
+ done = true;
+ callback(err);
+ }
+
+ // ended
+ function onend() {
+ if (done) return;
+ done = true;
+ callback();
+ }
+
+ // finished
+ function onfinish(err) {
+ if (err) return onerror(err);
+ if (done) return;
+
+ setImmediate(function () {
+ if (done) return;
+ done = true;
+
+ // response finished before end of file
+ var err = new Error('Request aborted');
+ err.code = 'ECONNABORT';
+ callback(err);
+ });
+ }
+
+ file.on('end', onend);
+ file.on('error', onerror);
+ file.on('directory', ondirectory);
+ onFinished(res, onfinish);
+
+ if (options.headers) {
+ // set headers on successful transfer
+ file.on('headers', function headers(res) {
+ var obj = options.headers;
+ var keys = Object.keys(obj);
+
+ for (var i = 0; i < keys.length; i++) {
+ var k = keys[i];
+ res.setHeader(k, obj[k]);
+ }
+ });
+ }
+
+ // pipe
+ file.pipe(res);
+}
diff --git a/server/node_modules/express/lib/router/index.js b/server/node_modules/express/lib/router/index.js
new file mode 100755
index 00000000..b3a42e29
--- /dev/null
+++ b/server/node_modules/express/lib/router/index.js
@@ -0,0 +1,576 @@
+
+/**
+ * Module dependencies.
+ */
+
+var Route = require('./route');
+var Layer = require('./layer');
+var methods = require('methods');
+var mixin = require('utils-merge');
+var debug = require('debug')('express:router');
+var parseUrl = require('parseurl');
+var utils = require('../utils');
+
+/**
+ * Module variables.
+ */
+
+var objectRegExp = /^\[object (\S+)\]$/;
+var slice = Array.prototype.slice;
+var toString = Object.prototype.toString;
+
+/**
+ * Initialize a new `Router` with the given `options`.
+ *
+ * @param {Object} options
+ * @return {Router} which is an callable function
+ * @api public
+ */
+
+var proto = module.exports = function(options) {
+ options = options || {};
+
+ function router(req, res, next) {
+ router.handle(req, res, next);
+ }
+
+ // mixin Router class functions
+ router.__proto__ = proto;
+
+ router.params = {};
+ router._params = [];
+ router.caseSensitive = options.caseSensitive;
+ router.mergeParams = options.mergeParams;
+ router.strict = options.strict;
+ router.stack = [];
+
+ return router;
+};
+
+/**
+ * Map the given param placeholder `name`(s) to the given callback.
+ *
+ * Parameter mapping is used to provide pre-conditions to routes
+ * which use normalized placeholders. For example a _:user_id_ parameter
+ * could automatically load a user's information from the database without
+ * any additional code,
+ *
+ * The callback uses the same signature as middleware, the only difference
+ * being that the value of the placeholder is passed, in this case the _id_
+ * of the user. Once the `next()` function is invoked, just like middleware
+ * it will continue on to execute the route, or subsequent parameter functions.
+ *
+ * Just like in middleware, you must either respond to the request or call next
+ * to avoid stalling the request.
+ *
+ * app.param('user_id', function(req, res, next, id){
+ * User.find(id, function(err, user){
+ * if (err) {
+ * return next(err);
+ * } else if (!user) {
+ * return next(new Error('failed to load user'));
+ * }
+ * req.user = user;
+ * next();
+ * });
+ * });
+ *
+ * @param {String} name
+ * @param {Function} fn
+ * @return {app} for chaining
+ * @api public
+ */
+
+proto.param = function(name, fn){
+ // param logic
+ if ('function' == typeof name) {
+ this._params.push(name);
+ return;
+ }
+
+ // apply param functions
+ var params = this._params;
+ var len = params.length;
+ var ret;
+
+ if (name[0] === ':') {
+ name = name.substr(1);
+ }
+
+ for (var i = 0; i < len; ++i) {
+ if (ret = params[i](name, fn)) {
+ fn = ret;
+ }
+ }
+
+ // ensure we end up with a
+ // middleware function
+ if ('function' != typeof fn) {
+ throw new Error('invalid param() call for ' + name + ', got ' + fn);
+ }
+
+ (this.params[name] = this.params[name] || []).push(fn);
+ return this;
+};
+
+/**
+ * Dispatch a req, res into the router.
+ *
+ * @api private
+ */
+
+proto.handle = function(req, res, done) {
+ var self = this;
+
+ debug('dispatching %s %s', req.method, req.url);
+
+ var search = 1 + req.url.indexOf('?');
+ var pathlength = search ? search - 1 : req.url.length;
+ var fqdn = req.url[0] !== '/' && 1 + req.url.substr(0, pathlength).indexOf('://');
+ var protohost = fqdn ? req.url.substr(0, req.url.indexOf('/', 2 + fqdn)) : '';
+ var idx = 0;
+ var removed = '';
+ var slashAdded = false;
+ var paramcalled = {};
+
+ // store options for OPTIONS request
+ // only used if OPTIONS request
+ var options = [];
+
+ // middleware and routes
+ var stack = self.stack;
+
+ // manage inter-router variables
+ var parentParams = req.params;
+ var parentUrl = req.baseUrl || '';
+ done = restore(done, req, 'baseUrl', 'next', 'params');
+
+ // setup next layer
+ req.next = next;
+
+ // for options requests, respond with a default if nothing else responds
+ if (req.method === 'OPTIONS') {
+ done = wrap(done, function(old, err) {
+ if (err || options.length === 0) return old(err);
+
+ var body = options.join(',');
+ return res.set('Allow', body).send(body);
+ });
+ }
+
+ // setup basic req values
+ req.baseUrl = parentUrl;
+ req.originalUrl = req.originalUrl || req.url;
+
+ next();
+
+ function next(err) {
+ var layerError = err === 'route'
+ ? null
+ : err;
+
+ var layer = stack[idx++];
+
+ if (slashAdded) {
+ req.url = req.url.substr(1);
+ slashAdded = false;
+ }
+
+ if (removed.length !== 0) {
+ req.baseUrl = parentUrl;
+ req.url = protohost + removed + req.url.substr(protohost.length);
+ removed = '';
+ }
+
+ if (!layer) {
+ setImmediate(done, layerError);
+ return;
+ }
+
+ self.match_layer(layer, req, res, function (err, path) {
+ if (err || path === undefined) {
+ return next(layerError || err);
+ }
+
+ // route object and not middleware
+ var route = layer.route;
+
+ // if final route, then we support options
+ if (route) {
+ // we don't run any routes with error first
+ if (layerError) {
+ return next(layerError);
+ }
+
+ var method = req.method;
+ var has_method = route._handles_method(method);
+
+ // build up automatic options response
+ if (!has_method && method === 'OPTIONS') {
+ options.push.apply(options, route._options());
+ }
+
+ // don't even bother
+ if (!has_method && method !== 'HEAD') {
+ return next();
+ }
+
+ // we can now dispatch to the route
+ req.route = route;
+ }
+
+ // Capture one-time layer values
+ req.params = self.mergeParams
+ ? mergeParams(layer.params, parentParams)
+ : layer.params;
+ var layerPath = layer.path;
+
+ // this should be done for the layer
+ self.process_params(layer, paramcalled, req, res, function (err) {
+ if (err) {
+ return next(layerError || err);
+ }
+
+ if (route) {
+ return layer.handle_request(req, res, next);
+ }
+
+ trim_prefix(layer, layerError, layerPath, path);
+ });
+ });
+ }
+
+ function trim_prefix(layer, layerError, layerPath, path) {
+ var c = path[layerPath.length];
+ if (c && '/' !== c && '.' !== c) return next(layerError);
+
+ // Trim off the part of the url that matches the route
+ // middleware (.use stuff) needs to have the path stripped
+ if (layerPath.length !== 0) {
+ debug('trim prefix (%s) from url %s', layerPath, req.url);
+ removed = layerPath;
+ req.url = protohost + req.url.substr(protohost.length + removed.length);
+
+ // Ensure leading slash
+ if (!fqdn && req.url[0] !== '/') {
+ req.url = '/' + req.url;
+ slashAdded = true;
+ }
+
+ // Setup base URL (no trailing slash)
+ req.baseUrl = parentUrl + (removed[removed.length - 1] === '/'
+ ? removed.substring(0, removed.length - 1)
+ : removed);
+ }
+
+ debug('%s %s : %s', layer.name, layerPath, req.originalUrl);
+
+ if (layerError) {
+ layer.handle_error(layerError, req, res, next);
+ } else {
+ layer.handle_request(req, res, next);
+ }
+ }
+};
+
+/**
+ * Match request to a layer.
+ *
+ * @api private
+ */
+
+proto.match_layer = function match_layer(layer, req, res, done) {
+ var error = null;
+ var path;
+
+ try {
+ path = parseUrl(req).pathname;
+
+ if (!layer.match(path)) {
+ path = undefined;
+ }
+ } catch (err) {
+ error = err;
+ }
+
+ done(error, path);
+};
+
+/**
+ * Process any parameters for the layer.
+ *
+ * @api private
+ */
+
+proto.process_params = function(layer, called, req, res, done) {
+ var params = this.params;
+
+ // captured parameters from the layer, keys and values
+ var keys = layer.keys;
+
+ // fast track
+ if (!keys || keys.length === 0) {
+ return done();
+ }
+
+ var i = 0;
+ var name;
+ var paramIndex = 0;
+ var key;
+ var paramVal;
+ var paramCallbacks;
+ var paramCalled;
+
+ // process params in order
+ // param callbacks can be async
+ function param(err) {
+ if (err) {
+ return done(err);
+ }
+
+ if (i >= keys.length ) {
+ return done();
+ }
+
+ paramIndex = 0;
+ key = keys[i++];
+
+ if (!key) {
+ return done();
+ }
+
+ name = key.name;
+ paramVal = req.params[name];
+ paramCallbacks = params[name];
+ paramCalled = called[name];
+
+ if (paramVal === undefined || !paramCallbacks) {
+ return param();
+ }
+
+ // param previously called with same value or error occurred
+ if (paramCalled && (paramCalled.error || paramCalled.match === paramVal)) {
+ // restore value
+ req.params[name] = paramCalled.value;
+
+ // next param
+ return param(paramCalled.error);
+ }
+
+ called[name] = paramCalled = {
+ error: null,
+ match: paramVal,
+ value: paramVal
+ };
+
+ paramCallback();
+ }
+
+ // single param callbacks
+ function paramCallback(err) {
+ var fn = paramCallbacks[paramIndex++];
+
+ // store updated value
+ paramCalled.value = req.params[key.name];
+
+ if (err) {
+ // store error
+ paramCalled.error = err;
+ param(err);
+ return;
+ }
+
+ if (!fn) return param();
+
+ try {
+ fn(req, res, paramCallback, paramVal, key.name);
+ } catch (e) {
+ paramCallback(e);
+ }
+ }
+
+ param();
+};
+
+/**
+ * Use the given middleware function, with optional path, defaulting to "/".
+ *
+ * Use (like `.all`) will run for any http METHOD, but it will not add
+ * handlers for those methods so OPTIONS requests will not consider `.use`
+ * functions even if they could respond.
+ *
+ * The other difference is that _route_ path is stripped and not visible
+ * to the handler function. The main effect of this feature is that mounted
+ * handlers can operate without any code changes regardless of the "prefix"
+ * pathname.
+ *
+ * @api public
+ */
+
+proto.use = function use(fn) {
+ var offset = 0;
+ var path = '/';
+
+ // default path to '/'
+ // disambiguate router.use([fn])
+ if (typeof fn !== 'function') {
+ var arg = fn;
+
+ while (Array.isArray(arg) && arg.length !== 0) {
+ arg = arg[0];
+ }
+
+ // first arg is the path
+ if (typeof arg !== 'function') {
+ offset = 1;
+ path = fn;
+ }
+ }
+
+ var callbacks = utils.flatten(slice.call(arguments, offset));
+
+ if (callbacks.length === 0) {
+ throw new TypeError('Router.use() requires middleware functions');
+ }
+
+ callbacks.forEach(function (fn) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('Router.use() requires middleware function but got a ' + gettype(fn));
+ }
+
+ // add the middleware
+ debug('use %s %s', path, fn.name || '');
+
+ var layer = new Layer(path, {
+ sensitive: this.caseSensitive,
+ strict: false,
+ end: false
+ }, fn);
+
+ layer.route = undefined;
+
+ this.stack.push(layer);
+ }, this);
+
+ return this;
+};
+
+/**
+ * Create a new Route for the given path.
+ *
+ * Each route contains a separate middleware stack and VERB handlers.
+ *
+ * See the Route api documentation for details on adding handlers
+ * and middleware to routes.
+ *
+ * @param {String} path
+ * @return {Route}
+ * @api public
+ */
+
+proto.route = function(path){
+ var route = new Route(path);
+
+ var layer = new Layer(path, {
+ sensitive: this.caseSensitive,
+ strict: this.strict,
+ end: true
+ }, route.dispatch.bind(route));
+
+ layer.route = route;
+
+ this.stack.push(layer);
+ return route;
+};
+
+// create Router#VERB functions
+methods.concat('all').forEach(function(method){
+ proto[method] = function(path){
+ var route = this.route(path)
+ route[method].apply(route, slice.call(arguments, 1));
+ return this;
+ };
+});
+
+// get type for error message
+function gettype(obj) {
+ var type = typeof obj;
+
+ if (type !== 'object') {
+ return type;
+ }
+
+ // inspect [[Class]] for objects
+ return toString.call(obj)
+ .replace(objectRegExp, '$1');
+}
+
+// merge params with parent params
+function mergeParams(params, parent) {
+ if (typeof parent !== 'object' || !parent) {
+ return params;
+ }
+
+ // make copy of parent for base
+ var obj = mixin({}, parent);
+
+ // simple non-numeric merging
+ if (!(0 in params) || !(0 in parent)) {
+ return mixin(obj, params);
+ }
+
+ var i = 0;
+ var o = 0;
+
+ // determine numeric gaps
+ while (i === o || o in parent) {
+ if (i in params) i++;
+ if (o in parent) o++;
+ }
+
+ // offset numeric indices in params before merge
+ for (i--; i >= 0; i--) {
+ params[i + o] = params[i];
+
+ // create holes for the merge when necessary
+ if (i < o) {
+ delete params[i];
+ }
+ }
+
+ return mixin(parent, params);
+}
+
+// restore obj props after function
+function restore(fn, obj) {
+ var props = new Array(arguments.length - 2);
+ var vals = new Array(arguments.length - 2);
+
+ for (var i = 0; i < props.length; i++) {
+ props[i] = arguments[i + 2];
+ vals[i] = obj[props[i]];
+ }
+
+ return function(err){
+ // restore vals
+ for (var i = 0; i < props.length; i++) {
+ obj[props[i]] = vals[i];
+ }
+
+ return fn.apply(this, arguments);
+ };
+}
+
+// wrap a function
+function wrap(old, fn) {
+ return function proxy() {
+ var args = new Array(arguments.length + 1);
+
+ args[0] = old;
+ for (var i = 0, len = arguments.length; i < len; i++) {
+ args[i + 1] = arguments[i];
+ }
+
+ fn.apply(this, args);
+ };
+}
diff --git a/server/node_modules/express/lib/router/layer.js b/server/node_modules/express/lib/router/layer.js
new file mode 100755
index 00000000..88ebd396
--- /dev/null
+++ b/server/node_modules/express/lib/router/layer.js
@@ -0,0 +1,166 @@
+/**
+ * Module dependencies.
+ */
+
+var pathRegexp = require('path-to-regexp');
+var debug = require('debug')('express:router:layer');
+
+/**
+ * Module variables.
+ */
+
+var hasOwnProperty = Object.prototype.hasOwnProperty;
+
+/**
+ * Expose `Layer`.
+ */
+
+module.exports = Layer;
+
+function Layer(path, options, fn) {
+ if (!(this instanceof Layer)) {
+ return new Layer(path, options, fn);
+ }
+
+ debug('new %s', path);
+ options = options || {};
+
+ this.handle = fn;
+ this.name = fn.name || '';
+ this.params = undefined;
+ this.path = undefined;
+ this.regexp = pathRegexp(path, this.keys = [], options);
+
+ if (path === '/' && options.end === false) {
+ this.regexp.fast_slash = true;
+ }
+}
+
+/**
+ * Handle the error for the layer.
+ *
+ * @param {Error} error
+ * @param {Request} req
+ * @param {Response} res
+ * @param {function} next
+ * @api private
+ */
+
+Layer.prototype.handle_error = function handle_error(error, req, res, next) {
+ var fn = this.handle;
+
+ if (fn.length !== 4) {
+ // not a standard error handler
+ return next(error);
+ }
+
+ try {
+ fn(error, req, res, next);
+ } catch (err) {
+ next(err);
+ }
+};
+
+/**
+ * Handle the request for the layer.
+ *
+ * @param {Request} req
+ * @param {Response} res
+ * @param {function} next
+ * @api private
+ */
+
+Layer.prototype.handle_request = function handle(req, res, next) {
+ var fn = this.handle;
+
+ if (fn.length > 3) {
+ // not a standard request handler
+ return next();
+ }
+
+ try {
+ fn(req, res, next);
+ } catch (err) {
+ next(err);
+ }
+};
+
+/**
+ * Check if this route matches `path`, if so
+ * populate `.params`.
+ *
+ * @param {String} path
+ * @return {Boolean}
+ * @api private
+ */
+
+Layer.prototype.match = function match(path) {
+ if (path == null) {
+ // no path, nothing matches
+ this.params = undefined;
+ this.path = undefined;
+ return false;
+ }
+
+ if (this.regexp.fast_slash) {
+ // fast path non-ending match for / (everything matches)
+ this.params = {};
+ this.path = '';
+ return true;
+ }
+
+ var m = this.regexp.exec(path);
+
+ if (!m) {
+ this.params = undefined;
+ this.path = undefined;
+ return false;
+ }
+
+ // store values
+ this.params = {};
+ this.path = m[0];
+
+ var keys = this.keys;
+ var params = this.params;
+ var prop;
+ var n = 0;
+ var key;
+ var val;
+
+ for (var i = 1, len = m.length; i < len; ++i) {
+ key = keys[i - 1];
+ prop = key
+ ? key.name
+ : n++;
+ val = decode_param(m[i]);
+
+ if (val !== undefined || !(hasOwnProperty.call(params, prop))) {
+ params[prop] = val;
+ }
+ }
+
+ return true;
+};
+
+/**
+ * Decode param value.
+ *
+ * @param {string} val
+ * @return {string}
+ * @api private
+ */
+
+function decode_param(val){
+ if (typeof val !== 'string') {
+ return val;
+ }
+
+ try {
+ return decodeURIComponent(val);
+ } catch (e) {
+ var err = new TypeError("Failed to decode param '" + val + "'");
+ err.status = 400;
+ throw err;
+ }
+}
diff --git a/server/node_modules/express/lib/router/route.js b/server/node_modules/express/lib/router/route.js
new file mode 100755
index 00000000..903d1a5e
--- /dev/null
+++ b/server/node_modules/express/lib/router/route.js
@@ -0,0 +1,173 @@
+/**
+ * Module dependencies.
+ */
+
+var debug = require('debug')('express:router:route');
+var Layer = require('./layer');
+var methods = require('methods');
+var utils = require('../utils');
+
+/**
+ * Expose `Route`.
+ */
+
+module.exports = Route;
+
+/**
+ * Initialize `Route` with the given `path`,
+ *
+ * @param {String} path
+ * @api private
+ */
+
+function Route(path) {
+ debug('new %s', path);
+ this.path = path;
+ this.stack = [];
+
+ // route handlers for various http methods
+ this.methods = {};
+}
+
+/**
+ * @api private
+ */
+
+Route.prototype._handles_method = function _handles_method(method) {
+ if (this.methods._all) {
+ return true;
+ }
+
+ method = method.toLowerCase();
+
+ if (method === 'head' && !this.methods['head']) {
+ method = 'get';
+ }
+
+ return Boolean(this.methods[method]);
+};
+
+/**
+ * @return {Array} supported HTTP methods
+ * @api private
+ */
+
+Route.prototype._options = function(){
+ return Object.keys(this.methods).map(function(method) {
+ return method.toUpperCase();
+ });
+};
+
+/**
+ * dispatch req, res into this route
+ *
+ * @api private
+ */
+
+Route.prototype.dispatch = function(req, res, done){
+ var idx = 0;
+ var stack = this.stack;
+ if (stack.length === 0) {
+ return done();
+ }
+
+ var method = req.method.toLowerCase();
+ if (method === 'head' && !this.methods['head']) {
+ method = 'get';
+ }
+
+ req.route = this;
+
+ next();
+
+ function next(err) {
+ if (err && err === 'route') {
+ return done();
+ }
+
+ var layer = stack[idx++];
+ if (!layer) {
+ return done(err);
+ }
+
+ if (layer.method && layer.method !== method) {
+ return next(err);
+ }
+
+ if (err) {
+ layer.handle_error(err, req, res, next);
+ } else {
+ layer.handle_request(req, res, next);
+ }
+ }
+};
+
+/**
+ * Add a handler for all HTTP verbs to this route.
+ *
+ * Behaves just like middleware and can respond or call `next`
+ * to continue processing.
+ *
+ * You can use multiple `.all` call to add multiple handlers.
+ *
+ * function check_something(req, res, next){
+ * next();
+ * };
+ *
+ * function validate_user(req, res, next){
+ * next();
+ * };
+ *
+ * route
+ * .all(validate_user)
+ * .all(check_something)
+ * .get(function(req, res, next){
+ * res.send('hello world');
+ * });
+ *
+ * @param {function} handler
+ * @return {Route} for chaining
+ * @api public
+ */
+
+Route.prototype.all = function(){
+ var callbacks = utils.flatten([].slice.call(arguments));
+ callbacks.forEach(function(fn) {
+ if (typeof fn !== 'function') {
+ var type = {}.toString.call(fn);
+ var msg = 'Route.all() requires callback functions but got a ' + type;
+ throw new Error(msg);
+ }
+
+ var layer = Layer('/', {}, fn);
+ layer.method = undefined;
+
+ this.methods._all = true;
+ this.stack.push(layer);
+ }, this);
+
+ return this;
+};
+
+methods.forEach(function(method){
+ Route.prototype[method] = function(){
+ var callbacks = utils.flatten([].slice.call(arguments));
+
+ callbacks.forEach(function(fn) {
+ if (typeof fn !== 'function') {
+ var type = {}.toString.call(fn);
+ var msg = 'Route.' + method + '() requires callback functions but got a ' + type;
+ throw new Error(msg);
+ }
+
+ debug('%s %s', method, this.path);
+
+ var layer = Layer('/', {}, fn);
+ layer.method = method;
+
+ this.methods[method] = true;
+ this.stack.push(layer);
+ }, this);
+ return this;
+ };
+});
diff --git a/server/node_modules/express/lib/utils.js b/server/node_modules/express/lib/utils.js
new file mode 100755
index 00000000..9814527c
--- /dev/null
+++ b/server/node_modules/express/lib/utils.js
@@ -0,0 +1,283 @@
+/**
+ * Module dependencies.
+ */
+
+var contentDisposition = require('content-disposition');
+var deprecate = require('depd')('express');
+var mime = require('send').mime;
+var basename = require('path').basename;
+var etag = require('etag');
+var proxyaddr = require('proxy-addr');
+var qs = require('qs');
+var querystring = require('querystring');
+var typer = require('media-typer');
+
+/**
+ * Return strong ETag for `body`.
+ *
+ * @param {String|Buffer} body
+ * @param {String} [encoding]
+ * @return {String}
+ * @api private
+ */
+
+exports.etag = function (body, encoding) {
+ var buf = !Buffer.isBuffer(body)
+ ? new Buffer(body, encoding)
+ : body;
+
+ return etag(buf, {weak: false});
+};
+
+/**
+ * Return weak ETag for `body`.
+ *
+ * @param {String|Buffer} body
+ * @param {String} [encoding]
+ * @return {String}
+ * @api private
+ */
+
+exports.wetag = function wetag(body, encoding){
+ var buf = !Buffer.isBuffer(body)
+ ? new Buffer(body, encoding)
+ : body;
+
+ return etag(buf, {weak: true});
+};
+
+/**
+ * Check if `path` looks absolute.
+ *
+ * @param {String} path
+ * @return {Boolean}
+ * @api private
+ */
+
+exports.isAbsolute = function(path){
+ if ('/' == path[0]) return true;
+ if (':' == path[1] && '\\' == path[2]) return true;
+ if ('\\\\' == path.substring(0, 2)) return true; // Microsoft Azure absolute path
+};
+
+/**
+ * Flatten the given `arr`.
+ *
+ * @param {Array} arr
+ * @return {Array}
+ * @api private
+ */
+
+exports.flatten = function(arr, ret){
+ ret = ret || [];
+ var len = arr.length;
+ for (var i = 0; i < len; ++i) {
+ if (Array.isArray(arr[i])) {
+ exports.flatten(arr[i], ret);
+ } else {
+ ret.push(arr[i]);
+ }
+ }
+ return ret;
+};
+
+/**
+ * Normalize the given `type`, for example "html" becomes "text/html".
+ *
+ * @param {String} type
+ * @return {Object}
+ * @api private
+ */
+
+exports.normalizeType = function(type){
+ return ~type.indexOf('/')
+ ? acceptParams(type)
+ : { value: mime.lookup(type), params: {} };
+};
+
+/**
+ * Normalize `types`, for example "html" becomes "text/html".
+ *
+ * @param {Array} types
+ * @return {Array}
+ * @api private
+ */
+
+exports.normalizeTypes = function(types){
+ var ret = [];
+
+ for (var i = 0; i < types.length; ++i) {
+ ret.push(exports.normalizeType(types[i]));
+ }
+
+ return ret;
+};
+
+/**
+ * Generate Content-Disposition header appropriate for the filename.
+ * non-ascii filenames are urlencoded and a filename* parameter is added
+ *
+ * @param {String} filename
+ * @return {String}
+ * @api private
+ */
+
+exports.contentDisposition = deprecate.function(contentDisposition,
+ 'utils.contentDisposition: use content-disposition npm module instead');
+
+/**
+ * Parse accept params `str` returning an
+ * object with `.value`, `.quality` and `.params`.
+ * also includes `.originalIndex` for stable sorting
+ *
+ * @param {String} str
+ * @return {Object}
+ * @api private
+ */
+
+function acceptParams(str, index) {
+ var parts = str.split(/ *; */);
+ var ret = { value: parts[0], quality: 1, params: {}, originalIndex: index };
+
+ for (var i = 1; i < parts.length; ++i) {
+ var pms = parts[i].split(/ *= */);
+ if ('q' == pms[0]) {
+ ret.quality = parseFloat(pms[1]);
+ } else {
+ ret.params[pms[0]] = pms[1];
+ }
+ }
+
+ return ret;
+}
+
+/**
+ * Compile "etag" value to function.
+ *
+ * @param {Boolean|String|Function} val
+ * @return {Function}
+ * @api private
+ */
+
+exports.compileETag = function(val) {
+ var fn;
+
+ if (typeof val === 'function') {
+ return val;
+ }
+
+ switch (val) {
+ case true:
+ fn = exports.wetag;
+ break;
+ case false:
+ break;
+ case 'strong':
+ fn = exports.etag;
+ break;
+ case 'weak':
+ fn = exports.wetag;
+ break;
+ default:
+ throw new TypeError('unknown value for etag function: ' + val);
+ }
+
+ return fn;
+}
+
+/**
+ * Compile "query parser" value to function.
+ *
+ * @param {String|Function} val
+ * @return {Function}
+ * @api private
+ */
+
+exports.compileQueryParser = function compileQueryParser(val) {
+ var fn;
+
+ if (typeof val === 'function') {
+ return val;
+ }
+
+ switch (val) {
+ case true:
+ fn = querystring.parse;
+ break;
+ case false:
+ fn = newObject;
+ break;
+ case 'extended':
+ fn = qs.parse;
+ break;
+ case 'simple':
+ fn = querystring.parse;
+ break;
+ default:
+ throw new TypeError('unknown value for query parser function: ' + val);
+ }
+
+ return fn;
+}
+
+/**
+ * Compile "proxy trust" value to function.
+ *
+ * @param {Boolean|String|Number|Array|Function} val
+ * @return {Function}
+ * @api private
+ */
+
+exports.compileTrust = function(val) {
+ if (typeof val === 'function') return val;
+
+ if (val === true) {
+ // Support plain true/false
+ return function(){ return true };
+ }
+
+ if (typeof val === 'number') {
+ // Support trusting hop count
+ return function(a, i){ return i < val };
+ }
+
+ if (typeof val === 'string') {
+ // Support comma-separated values
+ val = val.split(/ *, */);
+ }
+
+ return proxyaddr.compile(val || []);
+}
+
+/**
+ * Set the charset in a given Content-Type string.
+ *
+ * @param {String} type
+ * @param {String} charset
+ * @return {String}
+ * @api private
+ */
+
+exports.setCharset = function(type, charset){
+ if (!type || !charset) return type;
+
+ // parse type
+ var parsed = typer.parse(type);
+
+ // set charset
+ parsed.parameters.charset = charset;
+
+ // format type
+ return typer.format(parsed);
+};
+
+/**
+ * Return new empty objet.
+ *
+ * @return {Object}
+ * @api private
+ */
+
+function newObject() {
+ return {};
+}
diff --git a/server/node_modules/express/lib/view.js b/server/node_modules/express/lib/view.js
new file mode 100755
index 00000000..e0989b4d
--- /dev/null
+++ b/server/node_modules/express/lib/view.js
@@ -0,0 +1,142 @@
+/**
+ * Module dependencies.
+ */
+
+var debug = require('debug')('express:view');
+var path = require('path');
+var fs = require('fs');
+var utils = require('./utils');
+
+/**
+ * Module variables.
+ * @private
+ */
+
+var dirname = path.dirname;
+var basename = path.basename;
+var extname = path.extname;
+var join = path.join;
+var resolve = path.resolve;
+
+/**
+ * Expose `View`.
+ */
+
+module.exports = View;
+
+/**
+ * Initialize a new `View` with the given `name`.
+ *
+ * Options:
+ *
+ * - `defaultEngine` the default template engine name
+ * - `engines` template engine require() cache
+ * - `root` root path for view lookup
+ *
+ * @param {String} name
+ * @param {Object} options
+ * @api private
+ */
+
+function View(name, options) {
+ options = options || {};
+ this.name = name;
+ this.root = options.root;
+ var engines = options.engines;
+ this.defaultEngine = options.defaultEngine;
+ var ext = this.ext = extname(name);
+ if (!ext && !this.defaultEngine) throw new Error('No default engine was specified and no extension was provided.');
+ if (!ext) name += (ext = this.ext = ('.' != this.defaultEngine[0] ? '.' : '') + this.defaultEngine);
+ this.engine = engines[ext] || (engines[ext] = require(ext.slice(1)).__express);
+ this.path = this.lookup(name);
+}
+
+/**
+ * Lookup view by the given `name`
+ *
+ * @param {String} name
+ * @return {String}
+ * @api private
+ */
+
+View.prototype.lookup = function lookup(name) {
+ var path;
+ var roots = [].concat(this.root);
+
+ debug('lookup "%s"', name);
+
+ for (var i = 0; i < roots.length && !path; i++) {
+ var root = roots[i];
+
+ // resolve the path
+ var loc = resolve(root, name);
+ var dir = dirname(loc);
+ var file = basename(loc);
+
+ // resolve the file
+ path = this.resolve(dir, file);
+ }
+
+ return path;
+};
+
+/**
+ * Render with the given `options` and callback `fn(err, str)`.
+ *
+ * @param {Object} options
+ * @param {Function} fn
+ * @api private
+ */
+
+View.prototype.render = function render(options, fn) {
+ debug('render "%s"', this.path);
+ this.engine(this.path, options, fn);
+};
+
+/**
+ * Resolve the file within the given directory.
+ *
+ * @param {string} dir
+ * @param {string} file
+ * @private
+ */
+
+View.prototype.resolve = function resolve(dir, file) {
+ var ext = this.ext;
+ var path;
+ var stat;
+
+ // .
+ path = join(dir, file);
+ stat = tryStat(path);
+
+ if (stat && stat.isFile()) {
+ return path;
+ }
+
+ // /index.
+ path = join(dir, basename(file, ext), 'index' + ext);
+ stat = tryStat(path);
+
+ if (stat && stat.isFile()) {
+ return path;
+ }
+};
+
+/**
+ * Return a stat, maybe.
+ *
+ * @param {string} path
+ * @return {fs.Stats}
+ * @private
+ */
+
+function tryStat(path) {
+ debug('stat "%s"', path);
+
+ try {
+ return fs.statSync(path);
+ } catch (e) {
+ return undefined;
+ }
+}
diff --git a/server/node_modules/express/node_modules/accepts/HISTORY.md b/server/node_modules/express/node_modules/accepts/HISTORY.md
new file mode 100755
index 00000000..05084815
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/HISTORY.md
@@ -0,0 +1,74 @@
+1.1.4 / 2014-12-10
+==================
+
+ * deps: mime-types@~2.0.4
+ - deps: mime-db@~1.3.0
+
+1.1.3 / 2014-11-09
+==================
+
+ * deps: mime-types@~2.0.3
+ - deps: mime-db@~1.2.0
+
+1.1.2 / 2014-10-14
+==================
+
+ * deps: negotiator@0.4.9
+ - Fix error when media type has invalid parameter
+
+1.1.1 / 2014-09-28
+==================
+
+ * deps: mime-types@~2.0.2
+ - deps: mime-db@~1.1.0
+ * deps: negotiator@0.4.8
+ - Fix all negotiations to be case-insensitive
+ - Stable sort preferences of same quality according to client order
+
+1.1.0 / 2014-09-02
+==================
+
+ * update `mime-types`
+
+1.0.7 / 2014-07-04
+==================
+
+ * Fix wrong type returned from `type` when match after unknown extension
+
+1.0.6 / 2014-06-24
+==================
+
+ * deps: negotiator@0.4.7
+
+1.0.5 / 2014-06-20
+==================
+
+ * fix crash when unknown extension given
+
+1.0.4 / 2014-06-19
+==================
+
+ * use `mime-types`
+
+1.0.3 / 2014-06-11
+==================
+
+ * deps: negotiator@0.4.6
+ - Order by specificity when quality is the same
+
+1.0.2 / 2014-05-29
+==================
+
+ * Fix interpretation when header not in request
+ * deps: pin negotiator@0.4.5
+
+1.0.1 / 2014-01-18
+==================
+
+ * Identity encoding isn't always acceptable
+ * deps: negotiator@~0.4.0
+
+1.0.0 / 2013-12-27
+==================
+
+ * Genesis
diff --git a/server/node_modules/express/node_modules/accepts/LICENSE b/server/node_modules/express/node_modules/accepts/LICENSE
new file mode 100755
index 00000000..f23dca8d
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/accepts/README.md b/server/node_modules/express/node_modules/accepts/README.md
new file mode 100755
index 00000000..a9bc28af
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/README.md
@@ -0,0 +1,94 @@
+# accepts
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Higher level content negotation based on [negotiator](https://github.com/federomero/negotiator). Extracted from [koa](https://github.com/koajs/koa) for general use.
+
+In addition to negotatior, it allows:
+
+- Allows types as an array or arguments list, ie `(['text/html', 'application/json'])` as well as `('text/html', 'application/json')`.
+- Allows type shorthands such as `json`.
+- Returns `false` when no types match
+- Treats non-existent headers as `*`
+
+## API
+
+### var accept = new Accepts(req)
+
+```js
+var accepts = require('accepts')
+
+http.createServer(function (req, res) {
+ var accept = accepts(req)
+})
+```
+
+### accept\[property\]\(\)
+
+Returns all the explicitly accepted content property as an array in descending priority.
+
+- `accept.types()`
+- `accept.encodings()`
+- `accept.charsets()`
+- `accept.languages()`
+
+They are also aliased in singular form such as `accept.type()`. `accept.languages()` is also aliased as `accept.langs()`, etc.
+
+Note: you should almost never do this in a real app as it defeats the purpose of content negotiation.
+
+Example:
+
+```js
+// in Google Chrome
+var encodings = accept.encodings() // -> ['sdch', 'gzip', 'deflate']
+```
+
+Since you probably don't support `sdch`, you should just supply the encodings you support:
+
+```js
+var encoding = accept.encodings('gzip', 'deflate') // -> 'gzip', probably
+```
+
+### accept\[property\]\(values, ...\)
+
+You can either have `values` be an array or have an argument list of values.
+
+If the client does not accept any `values`, `false` will be returned.
+If the client accepts any `values`, the preferred `value` will be return.
+
+For `accept.types()`, shorthand mime types are allowed.
+
+Example:
+
+```js
+// req.headers.accept = 'application/json'
+
+accept.types('json') // -> 'json'
+accept.types('html', 'json') // -> 'json'
+accept.types('html') // -> false
+
+// req.headers.accept = ''
+// which is equivalent to `*`
+
+accept.types() // -> [], no explicit types
+accept.types('text/html', 'text/json') // -> 'text/html', since it was first
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/accepts.svg?style=flat
+[npm-url]: https://npmjs.org/package/accepts
+[node-version-image]: https://img.shields.io/node/v/accepts.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/accepts.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/accepts
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/accepts.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/accepts
+[downloads-image]: https://img.shields.io/npm/dm/accepts.svg?style=flat
+[downloads-url]: https://npmjs.org/package/accepts
diff --git a/server/node_modules/express/node_modules/accepts/index.js b/server/node_modules/express/node_modules/accepts/index.js
new file mode 100755
index 00000000..805e33ab
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/index.js
@@ -0,0 +1,160 @@
+var Negotiator = require('negotiator')
+var mime = require('mime-types')
+
+var slice = [].slice
+
+module.exports = Accepts
+
+function Accepts(req) {
+ if (!(this instanceof Accepts))
+ return new Accepts(req)
+
+ this.headers = req.headers
+ this.negotiator = Negotiator(req)
+}
+
+/**
+ * Check if the given `type(s)` is acceptable, returning
+ * the best match when true, otherwise `undefined`, in which
+ * case you should respond with 406 "Not Acceptable".
+ *
+ * The `type` value may be a single mime type string
+ * such as "application/json", the extension name
+ * such as "json" or an array `["json", "html", "text/plain"]`. When a list
+ * or array is given the _best_ match, if any is returned.
+ *
+ * Examples:
+ *
+ * // Accept: text/html
+ * this.types('html');
+ * // => "html"
+ *
+ * // Accept: text/*, application/json
+ * this.types('html');
+ * // => "html"
+ * this.types('text/html');
+ * // => "text/html"
+ * this.types('json', 'text');
+ * // => "json"
+ * this.types('application/json');
+ * // => "application/json"
+ *
+ * // Accept: text/*, application/json
+ * this.types('image/png');
+ * this.types('png');
+ * // => undefined
+ *
+ * // Accept: text/*;q=.5, application/json
+ * this.types(['html', 'json']);
+ * this.types('html', 'json');
+ * // => "json"
+ *
+ * @param {String|Array} type(s)...
+ * @return {String|Array|Boolean}
+ * @api public
+ */
+
+Accepts.prototype.type =
+Accepts.prototype.types = function (types) {
+ if (!Array.isArray(types)) types = slice.call(arguments);
+ var n = this.negotiator;
+ if (!types.length) return n.mediaTypes();
+ if (!this.headers.accept) return types[0];
+ var mimes = types.map(extToMime);
+ var accepts = n.mediaTypes(mimes.filter(validMime));
+ var first = accepts[0];
+ if (!first) return false;
+ return types[mimes.indexOf(first)];
+}
+
+/**
+ * Return accepted encodings or best fit based on `encodings`.
+ *
+ * Given `Accept-Encoding: gzip, deflate`
+ * an array sorted by quality is returned:
+ *
+ * ['gzip', 'deflate']
+ *
+ * @param {String|Array} encoding(s)...
+ * @return {String|Array}
+ * @api public
+ */
+
+Accepts.prototype.encoding =
+Accepts.prototype.encodings = function (encodings) {
+ if (!Array.isArray(encodings)) encodings = slice.call(arguments);
+ var n = this.negotiator;
+ if (!encodings.length) return n.encodings();
+ return n.encodings(encodings)[0] || false;
+}
+
+/**
+ * Return accepted charsets or best fit based on `charsets`.
+ *
+ * Given `Accept-Charset: utf-8, iso-8859-1;q=0.2, utf-7;q=0.5`
+ * an array sorted by quality is returned:
+ *
+ * ['utf-8', 'utf-7', 'iso-8859-1']
+ *
+ * @param {String|Array} charset(s)...
+ * @return {String|Array}
+ * @api public
+ */
+
+Accepts.prototype.charset =
+Accepts.prototype.charsets = function (charsets) {
+ if (!Array.isArray(charsets)) charsets = [].slice.call(arguments);
+ var n = this.negotiator;
+ if (!charsets.length) return n.charsets();
+ if (!this.headers['accept-charset']) return charsets[0];
+ return n.charsets(charsets)[0] || false;
+}
+
+/**
+ * Return accepted languages or best fit based on `langs`.
+ *
+ * Given `Accept-Language: en;q=0.8, es, pt`
+ * an array sorted by quality is returned:
+ *
+ * ['es', 'pt', 'en']
+ *
+ * @param {String|Array} lang(s)...
+ * @return {Array|String}
+ * @api public
+ */
+
+Accepts.prototype.lang =
+Accepts.prototype.langs =
+Accepts.prototype.language =
+Accepts.prototype.languages = function (langs) {
+ if (!Array.isArray(langs)) langs = slice.call(arguments);
+ var n = this.negotiator;
+ if (!langs.length) return n.languages();
+ if (!this.headers['accept-language']) return langs[0];
+ return n.languages(langs)[0] || false;
+}
+
+/**
+ * Convert extnames to mime.
+ *
+ * @param {String} type
+ * @return {String}
+ * @api private
+ */
+
+function extToMime(type) {
+ if (~type.indexOf('/')) return type;
+ return mime.lookup(type);
+}
+
+/**
+ * Check if mime is valid.
+ *
+ * @param {String} type
+ * @return {String}
+ * @api private
+ */
+
+function validMime(type) {
+ return typeof type === 'string';
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/HISTORY.md b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/HISTORY.md
new file mode 100755
index 00000000..aa7cdf16
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/HISTORY.md
@@ -0,0 +1,91 @@
+2.0.10 / 2015-03-13
+===================
+
+ * deps: mime-db@~1.8.0
+ - Add new mime types
+
+2.0.9 / 2015-02-09
+==================
+
+ * deps: mime-db@~1.7.0
+ - Add new mime types
+ - Community extensions ownership transferred from `node-mime`
+
+2.0.8 / 2015-01-29
+==================
+
+ * deps: mime-db@~1.6.0
+ - Add new mime types
+
+2.0.7 / 2014-12-30
+==================
+
+ * deps: mime-db@~1.5.0
+ - Add new mime types
+ - Fix various invalid MIME type entries
+
+2.0.6 / 2014-12-30
+==================
+
+ * deps: mime-db@~1.4.0
+ - Add new mime types
+ - Fix various invalid MIME type entries
+ - Remove example template MIME types
+
+2.0.5 / 2014-12-29
+==================
+
+ * deps: mime-db@~1.3.1
+ - Fix missing extensions
+
+2.0.4 / 2014-12-10
+==================
+
+ * deps: mime-db@~1.3.0
+ - Add new mime types
+
+2.0.3 / 2014-11-09
+==================
+
+ * deps: mime-db@~1.2.0
+ - Add new mime types
+
+2.0.2 / 2014-09-28
+==================
+
+ * deps: mime-db@~1.1.0
+ - Add new mime types
+ - Add additional compressible
+ - Update charsets
+
+2.0.1 / 2014-09-07
+==================
+
+ * Support Node.js 0.6
+
+2.0.0 / 2014-09-02
+==================
+
+ * Use `mime-db`
+ * Remove `.define()`
+
+1.0.2 / 2014-08-04
+==================
+
+ * Set charset=utf-8 for `text/javascript`
+
+1.0.1 / 2014-06-24
+==================
+
+ * Add `text/jsx` type
+
+1.0.0 / 2014-05-12
+==================
+
+ * Return `false` for unknown types
+ * Set charset=utf-8 for `application/json`
+
+0.1.0 / 2014-05-02
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/LICENSE b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/LICENSE
new file mode 100755
index 00000000..a7ae8ee9
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/README.md b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/README.md
new file mode 100755
index 00000000..8fea7ff4
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/README.md
@@ -0,0 +1,102 @@
+# mime-types
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+The ultimate javascript content-type utility.
+
+Similar to [node-mime](https://github.com/broofa/node-mime), except:
+
+- __No fallbacks.__ Instead of naively returning the first available type, `mime-types` simply returns `false`,
+ so do `var type = mime.lookup('unrecognized') || 'application/octet-stream'`.
+- No `new Mime()` business, so you could do `var lookup = require('mime-types').lookup`.
+- Additional mime types are added such as jade and stylus via [mime-db](https://github.com/jshttp/mime-db)
+- No `.define()` functionality
+
+Otherwise, the API is compatible.
+
+## Install
+
+```sh
+$ npm install mime-types
+```
+
+## Adding Types
+
+All mime types are based on [mime-db](https://github.com/jshttp/mime-db),
+so open a PR there if you'd like to add mime types.
+
+## API
+
+```js
+var mime = require('mime-types')
+```
+
+All functions return `false` if input is invalid or not found.
+
+### mime.lookup(path)
+
+Lookup the content-type associated with a file.
+
+```js
+mime.lookup('json') // 'application/json'
+mime.lookup('.md') // 'text/x-markdown'
+mime.lookup('file.html') // 'text/html'
+mime.lookup('folder/file.js') // 'application/javascript'
+
+mime.lookup('cats') // false
+```
+
+### mime.contentType(type)
+
+Create a full content-type header given a content-type or extension.
+
+```js
+mime.contentType('markdown') // 'text/x-markdown; charset=utf-8'
+mime.contentType('file.json') // 'application/json; charset=utf-8'
+
+// from a full path
+mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8'
+```
+
+### mime.extension(type)
+
+Get the default extension for a content-type.
+
+```js
+mime.extension('application/octet-stream') // 'bin'
+```
+
+### mime.charset(type)
+
+Lookup the implied default charset of a content-type.
+
+```js
+mime.charset('text/x-markdown') // 'UTF-8'
+```
+
+### var type = mime.types[extension]
+
+A map of content-types by extension.
+
+### [extensions...] = mime.extensions[type]
+
+A map of extensions by content-type.
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/mime-types.svg?style=flat
+[npm-url]: https://npmjs.org/package/mime-types
+[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/mime-types.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/mime-types
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-types.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/mime-types
+[downloads-image]: https://img.shields.io/npm/dm/mime-types.svg?style=flat
+[downloads-url]: https://npmjs.org/package/mime-types
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/index.js b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/index.js
new file mode 100755
index 00000000..b46a202f
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/index.js
@@ -0,0 +1,63 @@
+
+var db = require('mime-db')
+
+// types[extension] = type
+exports.types = Object.create(null)
+// extensions[type] = [extensions]
+exports.extensions = Object.create(null)
+
+Object.keys(db).forEach(function (name) {
+ var mime = db[name]
+ var exts = mime.extensions
+ if (!exts || !exts.length) return
+ exports.extensions[name] = exts
+ exts.forEach(function (ext) {
+ exports.types[ext] = name
+ })
+})
+
+exports.lookup = function (string) {
+ if (!string || typeof string !== "string") return false
+ // remove any leading paths, though we should just use path.basename
+ string = string.replace(/.*[\.\/\\]/, '').toLowerCase()
+ if (!string) return false
+ return exports.types[string] || false
+}
+
+exports.extension = function (type) {
+ if (!type || typeof type !== "string") return false
+ // to do: use media-typer
+ type = type.match(/^\s*([^;\s]*)(?:;|\s|$)/)
+ if (!type) return false
+ var exts = exports.extensions[type[1].toLowerCase()]
+ if (!exts || !exts.length) return false
+ return exts[0]
+}
+
+// type has to be an exact mime type
+exports.charset = function (type) {
+ var mime = db[type]
+ if (mime && mime.charset) return mime.charset
+
+ // default text/* to utf-8
+ if (/^text\//.test(type)) return 'UTF-8'
+
+ return false
+}
+
+// backwards compatibility
+exports.charsets = {
+ lookup: exports.charset
+}
+
+// to do: maybe use set-type module or something
+exports.contentType = function (type) {
+ if (!type || typeof type !== "string") return false
+ if (!~type.indexOf('/')) type = exports.lookup(type)
+ if (!type) return false
+ if (!~type.indexOf('charset')) {
+ var charset = exports.charset(type)
+ if (charset) type += '; charset=' + charset.toLowerCase()
+ }
+ return type
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/HISTORY.md b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/HISTORY.md
new file mode 100755
index 00000000..3c667481
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/HISTORY.md
@@ -0,0 +1,174 @@
+1.8.0 / 2015-03-13
+==================
+
+ * Add `application/vnd.citationstyles.style+xml`
+ * Add `application/vnd.fastcopy-disk-image`
+ * Add `application/vnd.gov.sk.xmldatacontainer+xml`
+ * Add extension `.jsonld` to `application/ld+json`
+
+1.7.0 / 2015-02-08
+==================
+
+ * Add `application/vnd.gerber`
+ * Add `application/vnd.msa-disk-image`
+
+1.6.1 / 2015-02-05
+==================
+
+ * Community extensions ownership transferred from `node-mime`
+
+1.6.0 / 2015-01-29
+==================
+
+ * Add `application/jose`
+ * Add `application/jose+json`
+ * Add `application/json-seq`
+ * Add `application/jwk+json`
+ * Add `application/jwk-set+json`
+ * Add `application/jwt`
+ * Add `application/rdap+json`
+ * Add `application/vnd.gov.sk.e-form+xml`
+ * Add `application/vnd.ims.imsccv1p3`
+
+1.5.0 / 2014-12-30
+==================
+
+ * Add `application/vnd.oracle.resource+json`
+ * Fix various invalid MIME type entries
+ - `application/mbox+xml`
+ - `application/oscp-response`
+ - `application/vwg-multiplexed`
+ - `audio/g721`
+
+1.4.0 / 2014-12-21
+==================
+
+ * Add `application/vnd.ims.imsccv1p2`
+ * Fix various invalid MIME type entries
+ - `application/vnd-acucobol`
+ - `application/vnd-curl`
+ - `application/vnd-dart`
+ - `application/vnd-dxr`
+ - `application/vnd-fdf`
+ - `application/vnd-mif`
+ - `application/vnd-sema`
+ - `application/vnd-wap-wmlc`
+ - `application/vnd.adobe.flash-movie`
+ - `application/vnd.dece-zip`
+ - `application/vnd.dvb_service`
+ - `application/vnd.micrografx-igx`
+ - `application/vnd.sealed-doc`
+ - `application/vnd.sealed-eml`
+ - `application/vnd.sealed-mht`
+ - `application/vnd.sealed-ppt`
+ - `application/vnd.sealed-tiff`
+ - `application/vnd.sealed-xls`
+ - `application/vnd.sealedmedia.softseal-html`
+ - `application/vnd.sealedmedia.softseal-pdf`
+ - `application/vnd.wap-slc`
+ - `application/vnd.wap-wbxml`
+ - `audio/vnd.sealedmedia.softseal-mpeg`
+ - `image/vnd-djvu`
+ - `image/vnd-svf`
+ - `image/vnd-wap-wbmp`
+ - `image/vnd.sealed-png`
+ - `image/vnd.sealedmedia.softseal-gif`
+ - `image/vnd.sealedmedia.softseal-jpg`
+ - `model/vnd-dwf`
+ - `model/vnd.parasolid.transmit-binary`
+ - `model/vnd.parasolid.transmit-text`
+ - `text/vnd-a`
+ - `text/vnd-curl`
+ - `text/vnd.wap-wml`
+ * Remove example template MIME types
+ - `application/example`
+ - `audio/example`
+ - `image/example`
+ - `message/example`
+ - `model/example`
+ - `multipart/example`
+ - `text/example`
+ - `video/example`
+
+1.3.1 / 2014-12-16
+==================
+
+ * Fix missing extensions
+ - `application/json5`
+ - `text/hjson`
+
+1.3.0 / 2014-12-07
+==================
+
+ * Add `application/a2l`
+ * Add `application/aml`
+ * Add `application/atfx`
+ * Add `application/atxml`
+ * Add `application/cdfx+xml`
+ * Add `application/dii`
+ * Add `application/json5`
+ * Add `application/lxf`
+ * Add `application/mf4`
+ * Add `application/vnd.apache.thrift.compact`
+ * Add `application/vnd.apache.thrift.json`
+ * Add `application/vnd.coffeescript`
+ * Add `application/vnd.enphase.envoy`
+ * Add `application/vnd.ims.imsccv1p1`
+ * Add `text/csv-schema`
+ * Add `text/hjson`
+ * Add `text/markdown`
+ * Add `text/yaml`
+
+1.2.0 / 2014-11-09
+==================
+
+ * Add `application/cea`
+ * Add `application/dit`
+ * Add `application/vnd.gov.sk.e-form+zip`
+ * Add `application/vnd.tmd.mediaflex.api+xml`
+ * Type `application/epub+zip` is now IANA-registered
+
+1.1.2 / 2014-10-23
+==================
+
+ * Rebuild database for `application/x-www-form-urlencoded` change
+
+1.1.1 / 2014-10-20
+==================
+
+ * Mark `application/x-www-form-urlencoded` as compressible.
+
+1.1.0 / 2014-09-28
+==================
+
+ * Add `application/font-woff2`
+
+1.0.3 / 2014-09-25
+==================
+
+ * Fix engine requirement in package
+
+1.0.2 / 2014-09-25
+==================
+
+ * Add `application/coap-group+json`
+ * Add `application/dcd`
+ * Add `application/vnd.apache.thrift.binary`
+ * Add `image/vnd.tencent.tap`
+ * Mark all JSON-derived types as compressible
+ * Update `text/vtt` data
+
+1.0.1 / 2014-08-30
+==================
+
+ * Fix extension ordering
+
+1.0.0 / 2014-08-30
+==================
+
+ * Add `application/atf`
+ * Add `application/merge-patch+json`
+ * Add `multipart/x-mixed-replace`
+ * Add `source: 'apache'` metadata
+ * Add `source: 'iana'` metadata
+ * Remove badly-assumed charset data
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/LICENSE b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/LICENSE
new file mode 100755
index 00000000..a7ae8ee9
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/README.md b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/README.md
new file mode 100755
index 00000000..1dde2349
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/README.md
@@ -0,0 +1,76 @@
+# mime-db
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][travis-image]][travis-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+This is a database of all mime types.
+It consists of a single, public JSON file and does not include any logic,
+allowing it to remain as un-opinionated as possible with an API.
+It aggregates data from the following sources:
+
+- http://www.iana.org/assignments/media-types/media-types.xhtml
+- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types
+
+## Installation
+
+```bash
+npm install mime-db
+```
+
+If you're crazy enough to use this in the browser,
+you can just grab the JSON file:
+
+```
+https://cdn.rawgit.com/jshttp/mime-db/master/db.json
+```
+
+## Usage
+
+```js
+var db = require('mime-db');
+
+// grab data on .js files
+var data = db['application/javascript'];
+```
+
+## Data Structure
+
+The JSON file is a map lookup for lowercased mime types.
+Each mime type has the following properties:
+
+- `.source` - where the mime type is defined.
+ If not set, it's probably a custom media type.
+ - `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types)
+ - `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml)
+- `.extensions[]` - known extensions associated with this mime type.
+- `.compressible` - whether a file of this type is can be gzipped.
+- `.charset` - the default charset associated with this type, if any.
+
+If unknown, every property could be `undefined`.
+
+## Contributing
+
+To edit the database, only make PRs against `src/custom.json` or
+`src/custom-suffix.json`.
+
+To update the build, run `npm run update`.
+
+## Adding Custom Media Types
+
+The best way to get new media types included in this library is to register
+them with the IANA. The community registration procedure is outlined in
+[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types
+registered with the IANA are automatically pulled into this library.
+
+[npm-version-image]: https://img.shields.io/npm/v/mime-db.svg?style=flat
+[npm-downloads-image]: https://img.shields.io/npm/dm/mime-db.svg?style=flat
+[npm-url]: https://npmjs.org/package/mime-db
+[travis-image]: https://img.shields.io/travis/jshttp/mime-db.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/mime-db
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-db.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master
+[node-image]: https://img.shields.io/node/v/mime-db.svg?style=flat
+[node-url]: http://nodejs.org/download/
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/db.json b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/db.json
new file mode 100755
index 00000000..f9f3515b
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/db.json
@@ -0,0 +1,6309 @@
+{
+ "application/1d-interleaved-parityfec": {
+ "source": "iana"
+ },
+ "application/3gpdash-qoe-report+xml": {
+ "source": "iana"
+ },
+ "application/3gpp-ims+xml": {
+ "source": "iana"
+ },
+ "application/a2l": {
+ "source": "iana"
+ },
+ "application/activemessage": {
+ "source": "iana"
+ },
+ "application/alto-costmap+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-costmapfilter+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-directory+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-endpointcost+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-endpointcostparams+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-endpointprop+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-endpointpropparams+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-error+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-networkmap+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-networkmapfilter+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/aml": {
+ "source": "iana"
+ },
+ "application/andrew-inset": {
+ "source": "iana",
+ "extensions": ["ez"]
+ },
+ "application/applefile": {
+ "source": "iana"
+ },
+ "application/applixware": {
+ "source": "apache",
+ "extensions": ["aw"]
+ },
+ "application/atf": {
+ "source": "iana"
+ },
+ "application/atfx": {
+ "source": "iana"
+ },
+ "application/atom+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["atom"]
+ },
+ "application/atomcat+xml": {
+ "source": "iana",
+ "extensions": ["atomcat"]
+ },
+ "application/atomdeleted+xml": {
+ "source": "iana"
+ },
+ "application/atomicmail": {
+ "source": "iana"
+ },
+ "application/atomsvc+xml": {
+ "source": "iana",
+ "extensions": ["atomsvc"]
+ },
+ "application/atxml": {
+ "source": "iana"
+ },
+ "application/auth-policy+xml": {
+ "source": "iana"
+ },
+ "application/bacnet-xdd+zip": {
+ "source": "iana"
+ },
+ "application/batch-smtp": {
+ "source": "iana"
+ },
+ "application/beep+xml": {
+ "source": "iana"
+ },
+ "application/calendar+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/calendar+xml": {
+ "source": "iana"
+ },
+ "application/call-completion": {
+ "source": "iana"
+ },
+ "application/cals-1840": {
+ "source": "iana"
+ },
+ "application/cbor": {
+ "source": "iana"
+ },
+ "application/ccmp+xml": {
+ "source": "iana"
+ },
+ "application/ccxml+xml": {
+ "source": "iana",
+ "extensions": ["ccxml"]
+ },
+ "application/cdfx+xml": {
+ "source": "iana"
+ },
+ "application/cdmi-capability": {
+ "source": "iana",
+ "extensions": ["cdmia"]
+ },
+ "application/cdmi-container": {
+ "source": "iana",
+ "extensions": ["cdmic"]
+ },
+ "application/cdmi-domain": {
+ "source": "iana",
+ "extensions": ["cdmid"]
+ },
+ "application/cdmi-object": {
+ "source": "iana",
+ "extensions": ["cdmio"]
+ },
+ "application/cdmi-queue": {
+ "source": "iana",
+ "extensions": ["cdmiq"]
+ },
+ "application/cea": {
+ "source": "iana"
+ },
+ "application/cea-2018+xml": {
+ "source": "iana"
+ },
+ "application/cellml+xml": {
+ "source": "iana"
+ },
+ "application/cfw": {
+ "source": "iana"
+ },
+ "application/cms": {
+ "source": "iana"
+ },
+ "application/cnrp+xml": {
+ "source": "iana"
+ },
+ "application/coap-group+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/commonground": {
+ "source": "iana"
+ },
+ "application/conference-info+xml": {
+ "source": "iana"
+ },
+ "application/cpl+xml": {
+ "source": "iana"
+ },
+ "application/csrattrs": {
+ "source": "iana"
+ },
+ "application/csta+xml": {
+ "source": "iana"
+ },
+ "application/cstadata+xml": {
+ "source": "iana"
+ },
+ "application/cu-seeme": {
+ "source": "apache",
+ "extensions": ["cu"]
+ },
+ "application/cybercash": {
+ "source": "iana"
+ },
+ "application/dart": {
+ "compressible": true
+ },
+ "application/dash+xml": {
+ "source": "iana",
+ "extensions": ["mdp"]
+ },
+ "application/dashdelta": {
+ "source": "iana"
+ },
+ "application/davmount+xml": {
+ "source": "iana",
+ "extensions": ["davmount"]
+ },
+ "application/dca-rft": {
+ "source": "iana"
+ },
+ "application/dcd": {
+ "source": "iana"
+ },
+ "application/dec-dx": {
+ "source": "iana"
+ },
+ "application/dialog-info+xml": {
+ "source": "iana"
+ },
+ "application/dicom": {
+ "source": "iana"
+ },
+ "application/dii": {
+ "source": "iana"
+ },
+ "application/dit": {
+ "source": "iana"
+ },
+ "application/dns": {
+ "source": "iana"
+ },
+ "application/docbook+xml": {
+ "source": "apache",
+ "extensions": ["dbk"]
+ },
+ "application/dskpp+xml": {
+ "source": "iana"
+ },
+ "application/dssc+der": {
+ "source": "iana",
+ "extensions": ["dssc"]
+ },
+ "application/dssc+xml": {
+ "source": "iana",
+ "extensions": ["xdssc"]
+ },
+ "application/dvcs": {
+ "source": "iana"
+ },
+ "application/ecmascript": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["ecma"]
+ },
+ "application/edi-consent": {
+ "source": "iana"
+ },
+ "application/edi-x12": {
+ "source": "iana",
+ "compressible": false
+ },
+ "application/edifact": {
+ "source": "iana",
+ "compressible": false
+ },
+ "application/emma+xml": {
+ "source": "iana",
+ "extensions": ["emma"]
+ },
+ "application/emotionml+xml": {
+ "source": "iana"
+ },
+ "application/encaprtp": {
+ "source": "iana"
+ },
+ "application/epp+xml": {
+ "source": "iana"
+ },
+ "application/epub+zip": {
+ "source": "iana",
+ "extensions": ["epub"]
+ },
+ "application/eshop": {
+ "source": "iana"
+ },
+ "application/exi": {
+ "source": "iana",
+ "extensions": ["exi"]
+ },
+ "application/fastinfoset": {
+ "source": "iana"
+ },
+ "application/fastsoap": {
+ "source": "iana"
+ },
+ "application/fdt+xml": {
+ "source": "iana"
+ },
+ "application/fits": {
+ "source": "iana"
+ },
+ "application/font-sfnt": {
+ "source": "iana"
+ },
+ "application/font-tdpfr": {
+ "source": "iana",
+ "extensions": ["pfr"]
+ },
+ "application/font-woff": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["woff"]
+ },
+ "application/font-woff2": {
+ "compressible": false,
+ "extensions": ["woff2"]
+ },
+ "application/framework-attributes+xml": {
+ "source": "iana"
+ },
+ "application/gml+xml": {
+ "source": "apache",
+ "extensions": ["gml"]
+ },
+ "application/gpx+xml": {
+ "source": "apache",
+ "extensions": ["gpx"]
+ },
+ "application/gxf": {
+ "source": "apache",
+ "extensions": ["gxf"]
+ },
+ "application/gzip": {
+ "source": "iana",
+ "compressible": false
+ },
+ "application/h224": {
+ "source": "iana"
+ },
+ "application/held+xml": {
+ "source": "iana"
+ },
+ "application/http": {
+ "source": "iana"
+ },
+ "application/hyperstudio": {
+ "source": "iana",
+ "extensions": ["stk"]
+ },
+ "application/ibe-key-request+xml": {
+ "source": "iana"
+ },
+ "application/ibe-pkg-reply+xml": {
+ "source": "iana"
+ },
+ "application/ibe-pp-data": {
+ "source": "iana"
+ },
+ "application/iges": {
+ "source": "iana"
+ },
+ "application/im-iscomposing+xml": {
+ "source": "iana"
+ },
+ "application/index": {
+ "source": "iana"
+ },
+ "application/index.cmd": {
+ "source": "iana"
+ },
+ "application/index.obj": {
+ "source": "iana"
+ },
+ "application/index.response": {
+ "source": "iana"
+ },
+ "application/index.vnd": {
+ "source": "iana"
+ },
+ "application/inkml+xml": {
+ "source": "iana",
+ "extensions": ["ink","inkml"]
+ },
+ "application/iotp": {
+ "source": "iana"
+ },
+ "application/ipfix": {
+ "source": "iana",
+ "extensions": ["ipfix"]
+ },
+ "application/ipp": {
+ "source": "iana"
+ },
+ "application/isup": {
+ "source": "iana"
+ },
+ "application/its+xml": {
+ "source": "iana"
+ },
+ "application/java-archive": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["jar"]
+ },
+ "application/java-serialized-object": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["ser"]
+ },
+ "application/java-vm": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["class"]
+ },
+ "application/javascript": {
+ "source": "iana",
+ "charset": "UTF-8",
+ "compressible": true,
+ "extensions": ["js"]
+ },
+ "application/jose": {
+ "source": "iana"
+ },
+ "application/jose+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/jrd+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/json": {
+ "source": "iana",
+ "charset": "UTF-8",
+ "compressible": true,
+ "extensions": ["json","map"]
+ },
+ "application/json-patch+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/json-seq": {
+ "source": "iana"
+ },
+ "application/json5": {
+ "extensions": ["json5"]
+ },
+ "application/jsonml+json": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["jsonml"]
+ },
+ "application/jwk+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/jwk-set+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/jwt": {
+ "source": "iana"
+ },
+ "application/kpml-request+xml": {
+ "source": "iana"
+ },
+ "application/kpml-response+xml": {
+ "source": "iana"
+ },
+ "application/ld+json": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["jsonld"]
+ },
+ "application/link-format": {
+ "source": "iana"
+ },
+ "application/load-control+xml": {
+ "source": "iana"
+ },
+ "application/lost+xml": {
+ "source": "iana",
+ "extensions": ["lostxml"]
+ },
+ "application/lostsync+xml": {
+ "source": "iana"
+ },
+ "application/lxf": {
+ "source": "iana"
+ },
+ "application/mac-binhex40": {
+ "source": "iana",
+ "extensions": ["hqx"]
+ },
+ "application/mac-compactpro": {
+ "source": "apache",
+ "extensions": ["cpt"]
+ },
+ "application/macwriteii": {
+ "source": "iana"
+ },
+ "application/mads+xml": {
+ "source": "iana",
+ "extensions": ["mads"]
+ },
+ "application/marc": {
+ "source": "iana",
+ "extensions": ["mrc"]
+ },
+ "application/marcxml+xml": {
+ "source": "iana",
+ "extensions": ["mrcx"]
+ },
+ "application/mathematica": {
+ "source": "iana",
+ "extensions": ["ma","nb","mb"]
+ },
+ "application/mathml+xml": {
+ "source": "iana",
+ "extensions": ["mathml"]
+ },
+ "application/mathml-content+xml": {
+ "source": "iana"
+ },
+ "application/mathml-presentation+xml": {
+ "source": "iana"
+ },
+ "application/mbms-associated-procedure-description+xml": {
+ "source": "iana"
+ },
+ "application/mbms-deregister+xml": {
+ "source": "iana"
+ },
+ "application/mbms-envelope+xml": {
+ "source": "iana"
+ },
+ "application/mbms-msk+xml": {
+ "source": "iana"
+ },
+ "application/mbms-msk-response+xml": {
+ "source": "iana"
+ },
+ "application/mbms-protection-description+xml": {
+ "source": "iana"
+ },
+ "application/mbms-reception-report+xml": {
+ "source": "iana"
+ },
+ "application/mbms-register+xml": {
+ "source": "iana"
+ },
+ "application/mbms-register-response+xml": {
+ "source": "iana"
+ },
+ "application/mbms-schedule+xml": {
+ "source": "iana"
+ },
+ "application/mbms-user-service-description+xml": {
+ "source": "iana"
+ },
+ "application/mbox": {
+ "source": "iana",
+ "extensions": ["mbox"]
+ },
+ "application/media-policy-dataset+xml": {
+ "source": "iana"
+ },
+ "application/media_control+xml": {
+ "source": "iana"
+ },
+ "application/mediaservercontrol+xml": {
+ "source": "iana",
+ "extensions": ["mscml"]
+ },
+ "application/merge-patch+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/metalink+xml": {
+ "source": "apache",
+ "extensions": ["metalink"]
+ },
+ "application/metalink4+xml": {
+ "source": "iana",
+ "extensions": ["meta4"]
+ },
+ "application/mets+xml": {
+ "source": "iana",
+ "extensions": ["mets"]
+ },
+ "application/mf4": {
+ "source": "iana"
+ },
+ "application/mikey": {
+ "source": "iana"
+ },
+ "application/mods+xml": {
+ "source": "iana",
+ "extensions": ["mods"]
+ },
+ "application/moss-keys": {
+ "source": "iana"
+ },
+ "application/moss-signature": {
+ "source": "iana"
+ },
+ "application/mosskey-data": {
+ "source": "iana"
+ },
+ "application/mosskey-request": {
+ "source": "iana"
+ },
+ "application/mp21": {
+ "source": "iana",
+ "extensions": ["m21","mp21"]
+ },
+ "application/mp4": {
+ "source": "iana",
+ "extensions": ["mp4s","m4p"]
+ },
+ "application/mpeg4-generic": {
+ "source": "iana"
+ },
+ "application/mpeg4-iod": {
+ "source": "iana"
+ },
+ "application/mpeg4-iod-xmt": {
+ "source": "iana"
+ },
+ "application/mrb-consumer+xml": {
+ "source": "iana"
+ },
+ "application/mrb-publish+xml": {
+ "source": "iana"
+ },
+ "application/msc-ivr+xml": {
+ "source": "iana"
+ },
+ "application/msc-mixer+xml": {
+ "source": "iana"
+ },
+ "application/msword": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["doc","dot"]
+ },
+ "application/mxf": {
+ "source": "iana",
+ "extensions": ["mxf"]
+ },
+ "application/nasdata": {
+ "source": "iana"
+ },
+ "application/news-checkgroups": {
+ "source": "iana"
+ },
+ "application/news-groupinfo": {
+ "source": "iana"
+ },
+ "application/news-transmission": {
+ "source": "iana"
+ },
+ "application/nlsml+xml": {
+ "source": "iana"
+ },
+ "application/nss": {
+ "source": "iana"
+ },
+ "application/ocsp-request": {
+ "source": "iana"
+ },
+ "application/ocsp-response": {
+ "source": "iana"
+ },
+ "application/octet-stream": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","buffer"]
+ },
+ "application/oda": {
+ "source": "iana",
+ "extensions": ["oda"]
+ },
+ "application/odx": {
+ "source": "iana"
+ },
+ "application/oebps-package+xml": {
+ "source": "iana",
+ "extensions": ["opf"]
+ },
+ "application/ogg": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["ogx"]
+ },
+ "application/omdoc+xml": {
+ "source": "apache",
+ "extensions": ["omdoc"]
+ },
+ "application/onenote": {
+ "source": "apache",
+ "extensions": ["onetoc","onetoc2","onetmp","onepkg"]
+ },
+ "application/oxps": {
+ "source": "iana",
+ "extensions": ["oxps"]
+ },
+ "application/p2p-overlay+xml": {
+ "source": "iana"
+ },
+ "application/parityfec": {
+ "source": "iana"
+ },
+ "application/patch-ops-error+xml": {
+ "source": "iana",
+ "extensions": ["xer"]
+ },
+ "application/pdf": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["pdf"]
+ },
+ "application/pdx": {
+ "source": "iana"
+ },
+ "application/pgp-encrypted": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["pgp"]
+ },
+ "application/pgp-keys": {
+ "source": "iana"
+ },
+ "application/pgp-signature": {
+ "source": "iana",
+ "extensions": ["asc","sig"]
+ },
+ "application/pics-rules": {
+ "source": "apache",
+ "extensions": ["prf"]
+ },
+ "application/pidf+xml": {
+ "source": "iana"
+ },
+ "application/pidf-diff+xml": {
+ "source": "iana"
+ },
+ "application/pkcs10": {
+ "source": "iana",
+ "extensions": ["p10"]
+ },
+ "application/pkcs7-mime": {
+ "source": "iana",
+ "extensions": ["p7m","p7c"]
+ },
+ "application/pkcs7-signature": {
+ "source": "iana",
+ "extensions": ["p7s"]
+ },
+ "application/pkcs8": {
+ "source": "iana",
+ "extensions": ["p8"]
+ },
+ "application/pkix-attr-cert": {
+ "source": "iana",
+ "extensions": ["ac"]
+ },
+ "application/pkix-cert": {
+ "source": "iana",
+ "extensions": ["cer"]
+ },
+ "application/pkix-crl": {
+ "source": "iana",
+ "extensions": ["crl"]
+ },
+ "application/pkix-pkipath": {
+ "source": "iana",
+ "extensions": ["pkipath"]
+ },
+ "application/pkixcmp": {
+ "source": "iana",
+ "extensions": ["pki"]
+ },
+ "application/pls+xml": {
+ "source": "iana",
+ "extensions": ["pls"]
+ },
+ "application/poc-settings+xml": {
+ "source": "iana"
+ },
+ "application/postscript": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["ai","eps","ps"]
+ },
+ "application/provenance+xml": {
+ "source": "iana"
+ },
+ "application/prs.alvestrand.titrax-sheet": {
+ "source": "iana"
+ },
+ "application/prs.cww": {
+ "source": "iana",
+ "extensions": ["cww"]
+ },
+ "application/prs.hpub+zip": {
+ "source": "iana"
+ },
+ "application/prs.nprend": {
+ "source": "iana"
+ },
+ "application/prs.plucker": {
+ "source": "iana"
+ },
+ "application/prs.rdf-xml-crypt": {
+ "source": "iana"
+ },
+ "application/prs.xsf+xml": {
+ "source": "iana"
+ },
+ "application/pskc+xml": {
+ "source": "iana",
+ "extensions": ["pskcxml"]
+ },
+ "application/qsig": {
+ "source": "iana"
+ },
+ "application/raptorfec": {
+ "source": "iana"
+ },
+ "application/rdap+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/rdf+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["rdf"]
+ },
+ "application/reginfo+xml": {
+ "source": "iana",
+ "extensions": ["rif"]
+ },
+ "application/relax-ng-compact-syntax": {
+ "source": "iana",
+ "extensions": ["rnc"]
+ },
+ "application/remote-printing": {
+ "source": "iana"
+ },
+ "application/reputon+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/resource-lists+xml": {
+ "source": "iana",
+ "extensions": ["rl"]
+ },
+ "application/resource-lists-diff+xml": {
+ "source": "iana",
+ "extensions": ["rld"]
+ },
+ "application/riscos": {
+ "source": "iana"
+ },
+ "application/rlmi+xml": {
+ "source": "iana"
+ },
+ "application/rls-services+xml": {
+ "source": "iana",
+ "extensions": ["rs"]
+ },
+ "application/rpki-ghostbusters": {
+ "source": "iana",
+ "extensions": ["gbr"]
+ },
+ "application/rpki-manifest": {
+ "source": "iana",
+ "extensions": ["mft"]
+ },
+ "application/rpki-roa": {
+ "source": "iana",
+ "extensions": ["roa"]
+ },
+ "application/rpki-updown": {
+ "source": "iana"
+ },
+ "application/rsd+xml": {
+ "source": "apache",
+ "extensions": ["rsd"]
+ },
+ "application/rss+xml": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["rss"]
+ },
+ "application/rtf": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["rtf"]
+ },
+ "application/rtploopback": {
+ "source": "iana"
+ },
+ "application/rtx": {
+ "source": "iana"
+ },
+ "application/samlassertion+xml": {
+ "source": "iana"
+ },
+ "application/samlmetadata+xml": {
+ "source": "iana"
+ },
+ "application/sbml+xml": {
+ "source": "iana",
+ "extensions": ["sbml"]
+ },
+ "application/scaip+xml": {
+ "source": "iana"
+ },
+ "application/scvp-cv-request": {
+ "source": "iana",
+ "extensions": ["scq"]
+ },
+ "application/scvp-cv-response": {
+ "source": "iana",
+ "extensions": ["scs"]
+ },
+ "application/scvp-vp-request": {
+ "source": "iana",
+ "extensions": ["spq"]
+ },
+ "application/scvp-vp-response": {
+ "source": "iana",
+ "extensions": ["spp"]
+ },
+ "application/sdp": {
+ "source": "iana",
+ "extensions": ["sdp"]
+ },
+ "application/sep+xml": {
+ "source": "iana"
+ },
+ "application/sep-exi": {
+ "source": "iana"
+ },
+ "application/session-info": {
+ "source": "iana"
+ },
+ "application/set-payment": {
+ "source": "iana"
+ },
+ "application/set-payment-initiation": {
+ "source": "iana",
+ "extensions": ["setpay"]
+ },
+ "application/set-registration": {
+ "source": "iana"
+ },
+ "application/set-registration-initiation": {
+ "source": "iana",
+ "extensions": ["setreg"]
+ },
+ "application/sgml": {
+ "source": "iana"
+ },
+ "application/sgml-open-catalog": {
+ "source": "iana"
+ },
+ "application/shf+xml": {
+ "source": "iana",
+ "extensions": ["shf"]
+ },
+ "application/sieve": {
+ "source": "iana"
+ },
+ "application/simple-filter+xml": {
+ "source": "iana"
+ },
+ "application/simple-message-summary": {
+ "source": "iana"
+ },
+ "application/simplesymbolcontainer": {
+ "source": "iana"
+ },
+ "application/slate": {
+ "source": "iana"
+ },
+ "application/smil": {
+ "source": "iana"
+ },
+ "application/smil+xml": {
+ "source": "iana",
+ "extensions": ["smi","smil"]
+ },
+ "application/smpte336m": {
+ "source": "iana"
+ },
+ "application/soap+fastinfoset": {
+ "source": "iana"
+ },
+ "application/soap+xml": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/sparql-query": {
+ "source": "iana",
+ "extensions": ["rq"]
+ },
+ "application/sparql-results+xml": {
+ "source": "iana",
+ "extensions": ["srx"]
+ },
+ "application/spirits-event+xml": {
+ "source": "iana"
+ },
+ "application/sql": {
+ "source": "iana"
+ },
+ "application/srgs": {
+ "source": "iana",
+ "extensions": ["gram"]
+ },
+ "application/srgs+xml": {
+ "source": "iana",
+ "extensions": ["grxml"]
+ },
+ "application/sru+xml": {
+ "source": "iana",
+ "extensions": ["sru"]
+ },
+ "application/ssdl+xml": {
+ "source": "apache",
+ "extensions": ["ssdl"]
+ },
+ "application/ssml+xml": {
+ "source": "iana",
+ "extensions": ["ssml"]
+ },
+ "application/tamp-apex-update": {
+ "source": "iana"
+ },
+ "application/tamp-apex-update-confirm": {
+ "source": "iana"
+ },
+ "application/tamp-community-update": {
+ "source": "iana"
+ },
+ "application/tamp-community-update-confirm": {
+ "source": "iana"
+ },
+ "application/tamp-error": {
+ "source": "iana"
+ },
+ "application/tamp-sequence-adjust": {
+ "source": "iana"
+ },
+ "application/tamp-sequence-adjust-confirm": {
+ "source": "iana"
+ },
+ "application/tamp-status-query": {
+ "source": "iana"
+ },
+ "application/tamp-status-response": {
+ "source": "iana"
+ },
+ "application/tamp-update": {
+ "source": "iana"
+ },
+ "application/tamp-update-confirm": {
+ "source": "iana"
+ },
+ "application/tar": {
+ "compressible": true
+ },
+ "application/tei+xml": {
+ "source": "iana",
+ "extensions": ["tei","teicorpus"]
+ },
+ "application/thraud+xml": {
+ "source": "iana",
+ "extensions": ["tfi"]
+ },
+ "application/timestamp-query": {
+ "source": "iana"
+ },
+ "application/timestamp-reply": {
+ "source": "iana"
+ },
+ "application/timestamped-data": {
+ "source": "iana",
+ "extensions": ["tsd"]
+ },
+ "application/ttml+xml": {
+ "source": "iana"
+ },
+ "application/tve-trigger": {
+ "source": "iana"
+ },
+ "application/ulpfec": {
+ "source": "iana"
+ },
+ "application/urc-grpsheet+xml": {
+ "source": "iana"
+ },
+ "application/urc-ressheet+xml": {
+ "source": "iana"
+ },
+ "application/urc-targetdesc+xml": {
+ "source": "iana"
+ },
+ "application/urc-uisocketdesc+xml": {
+ "source": "iana"
+ },
+ "application/vcard+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vcard+xml": {
+ "source": "iana"
+ },
+ "application/vemmi": {
+ "source": "iana"
+ },
+ "application/vividence.scriptfile": {
+ "source": "apache"
+ },
+ "application/vnd.3gpp.bsf+xml": {
+ "source": "iana"
+ },
+ "application/vnd.3gpp.pic-bw-large": {
+ "source": "iana",
+ "extensions": ["plb"]
+ },
+ "application/vnd.3gpp.pic-bw-small": {
+ "source": "iana",
+ "extensions": ["psb"]
+ },
+ "application/vnd.3gpp.pic-bw-var": {
+ "source": "iana",
+ "extensions": ["pvb"]
+ },
+ "application/vnd.3gpp.sms": {
+ "source": "iana"
+ },
+ "application/vnd.3gpp2.bcmcsinfo+xml": {
+ "source": "iana"
+ },
+ "application/vnd.3gpp2.sms": {
+ "source": "iana"
+ },
+ "application/vnd.3gpp2.tcap": {
+ "source": "iana",
+ "extensions": ["tcap"]
+ },
+ "application/vnd.3m.post-it-notes": {
+ "source": "iana",
+ "extensions": ["pwn"]
+ },
+ "application/vnd.accpac.simply.aso": {
+ "source": "iana",
+ "extensions": ["aso"]
+ },
+ "application/vnd.accpac.simply.imp": {
+ "source": "iana",
+ "extensions": ["imp"]
+ },
+ "application/vnd.acucobol": {
+ "source": "iana",
+ "extensions": ["acu"]
+ },
+ "application/vnd.acucorp": {
+ "source": "iana",
+ "extensions": ["atc","acutc"]
+ },
+ "application/vnd.adobe.air-application-installer-package+zip": {
+ "source": "apache",
+ "extensions": ["air"]
+ },
+ "application/vnd.adobe.flash.movie": {
+ "source": "iana"
+ },
+ "application/vnd.adobe.formscentral.fcdt": {
+ "source": "iana",
+ "extensions": ["fcdt"]
+ },
+ "application/vnd.adobe.fxp": {
+ "source": "iana",
+ "extensions": ["fxp","fxpl"]
+ },
+ "application/vnd.adobe.partial-upload": {
+ "source": "iana"
+ },
+ "application/vnd.adobe.xdp+xml": {
+ "source": "iana",
+ "extensions": ["xdp"]
+ },
+ "application/vnd.adobe.xfdf": {
+ "source": "iana",
+ "extensions": ["xfdf"]
+ },
+ "application/vnd.aether.imp": {
+ "source": "iana"
+ },
+ "application/vnd.ah-barcode": {
+ "source": "iana"
+ },
+ "application/vnd.ahead.space": {
+ "source": "iana",
+ "extensions": ["ahead"]
+ },
+ "application/vnd.airzip.filesecure.azf": {
+ "source": "iana",
+ "extensions": ["azf"]
+ },
+ "application/vnd.airzip.filesecure.azs": {
+ "source": "iana",
+ "extensions": ["azs"]
+ },
+ "application/vnd.amazon.ebook": {
+ "source": "apache",
+ "extensions": ["azw"]
+ },
+ "application/vnd.americandynamics.acc": {
+ "source": "iana",
+ "extensions": ["acc"]
+ },
+ "application/vnd.amiga.ami": {
+ "source": "iana",
+ "extensions": ["ami"]
+ },
+ "application/vnd.amundsen.maze+xml": {
+ "source": "iana"
+ },
+ "application/vnd.android.package-archive": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["apk"]
+ },
+ "application/vnd.anser-web-certificate-issue-initiation": {
+ "source": "iana",
+ "extensions": ["cii"]
+ },
+ "application/vnd.anser-web-funds-transfer-initiation": {
+ "source": "apache",
+ "extensions": ["fti"]
+ },
+ "application/vnd.antix.game-component": {
+ "source": "iana",
+ "extensions": ["atx"]
+ },
+ "application/vnd.apache.thrift.binary": {
+ "source": "iana"
+ },
+ "application/vnd.apache.thrift.compact": {
+ "source": "iana"
+ },
+ "application/vnd.apache.thrift.json": {
+ "source": "iana"
+ },
+ "application/vnd.api+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.apple.installer+xml": {
+ "source": "iana",
+ "extensions": ["mpkg"]
+ },
+ "application/vnd.apple.mpegurl": {
+ "source": "iana",
+ "extensions": ["m3u8"]
+ },
+ "application/vnd.arastra.swi": {
+ "source": "iana"
+ },
+ "application/vnd.aristanetworks.swi": {
+ "source": "iana",
+ "extensions": ["swi"]
+ },
+ "application/vnd.artsquare": {
+ "source": "iana"
+ },
+ "application/vnd.astraea-software.iota": {
+ "source": "iana",
+ "extensions": ["iota"]
+ },
+ "application/vnd.audiograph": {
+ "source": "iana",
+ "extensions": ["aep"]
+ },
+ "application/vnd.autopackage": {
+ "source": "iana"
+ },
+ "application/vnd.avistar+xml": {
+ "source": "iana"
+ },
+ "application/vnd.balsamiq.bmml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.bekitzur-stech+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.blueice.multipass": {
+ "source": "iana",
+ "extensions": ["mpm"]
+ },
+ "application/vnd.bluetooth.ep.oob": {
+ "source": "iana"
+ },
+ "application/vnd.bluetooth.le.oob": {
+ "source": "iana"
+ },
+ "application/vnd.bmi": {
+ "source": "iana",
+ "extensions": ["bmi"]
+ },
+ "application/vnd.businessobjects": {
+ "source": "iana",
+ "extensions": ["rep"]
+ },
+ "application/vnd.cab-jscript": {
+ "source": "iana"
+ },
+ "application/vnd.canon-cpdl": {
+ "source": "iana"
+ },
+ "application/vnd.canon-lips": {
+ "source": "iana"
+ },
+ "application/vnd.cendio.thinlinc.clientconf": {
+ "source": "iana"
+ },
+ "application/vnd.century-systems.tcp_stream": {
+ "source": "iana"
+ },
+ "application/vnd.chemdraw+xml": {
+ "source": "iana",
+ "extensions": ["cdxml"]
+ },
+ "application/vnd.chipnuts.karaoke-mmd": {
+ "source": "iana",
+ "extensions": ["mmd"]
+ },
+ "application/vnd.cinderella": {
+ "source": "iana",
+ "extensions": ["cdy"]
+ },
+ "application/vnd.cirpack.isdn-ext": {
+ "source": "iana"
+ },
+ "application/vnd.citationstyles.style+xml": {
+ "source": "iana"
+ },
+ "application/vnd.claymore": {
+ "source": "iana",
+ "extensions": ["cla"]
+ },
+ "application/vnd.cloanto.rp9": {
+ "source": "iana",
+ "extensions": ["rp9"]
+ },
+ "application/vnd.clonk.c4group": {
+ "source": "iana",
+ "extensions": ["c4g","c4d","c4f","c4p","c4u"]
+ },
+ "application/vnd.cluetrust.cartomobile-config": {
+ "source": "iana",
+ "extensions": ["c11amc"]
+ },
+ "application/vnd.cluetrust.cartomobile-config-pkg": {
+ "source": "iana",
+ "extensions": ["c11amz"]
+ },
+ "application/vnd.coffeescript": {
+ "source": "iana"
+ },
+ "application/vnd.collection+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.collection.doc+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.collection.next+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.commerce-battelle": {
+ "source": "iana"
+ },
+ "application/vnd.commonspace": {
+ "source": "iana",
+ "extensions": ["csp"]
+ },
+ "application/vnd.contact.cmsg": {
+ "source": "iana",
+ "extensions": ["cdbcmsg"]
+ },
+ "application/vnd.cosmocaller": {
+ "source": "iana",
+ "extensions": ["cmc"]
+ },
+ "application/vnd.crick.clicker": {
+ "source": "iana",
+ "extensions": ["clkx"]
+ },
+ "application/vnd.crick.clicker.keyboard": {
+ "source": "iana",
+ "extensions": ["clkk"]
+ },
+ "application/vnd.crick.clicker.palette": {
+ "source": "iana",
+ "extensions": ["clkp"]
+ },
+ "application/vnd.crick.clicker.template": {
+ "source": "iana",
+ "extensions": ["clkt"]
+ },
+ "application/vnd.crick.clicker.wordbank": {
+ "source": "iana",
+ "extensions": ["clkw"]
+ },
+ "application/vnd.criticaltools.wbs+xml": {
+ "source": "iana",
+ "extensions": ["wbs"]
+ },
+ "application/vnd.ctc-posml": {
+ "source": "iana",
+ "extensions": ["pml"]
+ },
+ "application/vnd.ctct.ws+xml": {
+ "source": "iana"
+ },
+ "application/vnd.cups-pdf": {
+ "source": "iana"
+ },
+ "application/vnd.cups-postscript": {
+ "source": "iana"
+ },
+ "application/vnd.cups-ppd": {
+ "source": "iana",
+ "extensions": ["ppd"]
+ },
+ "application/vnd.cups-raster": {
+ "source": "iana"
+ },
+ "application/vnd.cups-raw": {
+ "source": "iana"
+ },
+ "application/vnd.curl": {
+ "source": "iana"
+ },
+ "application/vnd.curl.car": {
+ "source": "apache",
+ "extensions": ["car"]
+ },
+ "application/vnd.curl.pcurl": {
+ "source": "apache",
+ "extensions": ["pcurl"]
+ },
+ "application/vnd.cyan.dean.root+xml": {
+ "source": "iana"
+ },
+ "application/vnd.cybank": {
+ "source": "iana"
+ },
+ "application/vnd.dart": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["dart"]
+ },
+ "application/vnd.data-vision.rdz": {
+ "source": "iana",
+ "extensions": ["rdz"]
+ },
+ "application/vnd.debian.binary-package": {
+ "source": "iana"
+ },
+ "application/vnd.dece.data": {
+ "source": "iana",
+ "extensions": ["uvf","uvvf","uvd","uvvd"]
+ },
+ "application/vnd.dece.ttml+xml": {
+ "source": "iana",
+ "extensions": ["uvt","uvvt"]
+ },
+ "application/vnd.dece.unspecified": {
+ "source": "iana",
+ "extensions": ["uvx","uvvx"]
+ },
+ "application/vnd.dece.zip": {
+ "source": "iana",
+ "extensions": ["uvz","uvvz"]
+ },
+ "application/vnd.denovo.fcselayout-link": {
+ "source": "iana",
+ "extensions": ["fe_launch"]
+ },
+ "application/vnd.desmume-movie": {
+ "source": "iana"
+ },
+ "application/vnd.dir-bi.plate-dl-nosuffix": {
+ "source": "iana"
+ },
+ "application/vnd.dm.delegation+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dna": {
+ "source": "iana",
+ "extensions": ["dna"]
+ },
+ "application/vnd.document+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.dolby.mlp": {
+ "source": "apache",
+ "extensions": ["mlp"]
+ },
+ "application/vnd.dolby.mobile.1": {
+ "source": "iana"
+ },
+ "application/vnd.dolby.mobile.2": {
+ "source": "iana"
+ },
+ "application/vnd.doremir.scorecloud-binary-document": {
+ "source": "iana"
+ },
+ "application/vnd.dpgraph": {
+ "source": "iana",
+ "extensions": ["dpg"]
+ },
+ "application/vnd.dreamfactory": {
+ "source": "iana",
+ "extensions": ["dfac"]
+ },
+ "application/vnd.ds-keypoint": {
+ "source": "apache",
+ "extensions": ["kpxx"]
+ },
+ "application/vnd.dtg.local": {
+ "source": "iana"
+ },
+ "application/vnd.dtg.local.flash": {
+ "source": "iana"
+ },
+ "application/vnd.dtg.local.html": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ait": {
+ "source": "iana",
+ "extensions": ["ait"]
+ },
+ "application/vnd.dvb.dvbj": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.esgcontainer": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcdftnotifaccess": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcesgaccess": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcesgaccess2": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcesgpdd": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcroaming": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.iptv.alfec-base": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.iptv.alfec-enhancement": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-aggregate-root+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-container+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-generic+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-ia-msglist+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-ia-registration-request+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-ia-registration-response+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-init+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.pfr": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.service": {
+ "source": "iana",
+ "extensions": ["svc"]
+ },
+ "application/vnd.dxr": {
+ "source": "iana"
+ },
+ "application/vnd.dynageo": {
+ "source": "iana",
+ "extensions": ["geo"]
+ },
+ "application/vnd.dzr": {
+ "source": "iana"
+ },
+ "application/vnd.easykaraoke.cdgdownload": {
+ "source": "iana"
+ },
+ "application/vnd.ecdis-update": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.chart": {
+ "source": "iana",
+ "extensions": ["mag"]
+ },
+ "application/vnd.ecowin.filerequest": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.fileupdate": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.series": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.seriesrequest": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.seriesupdate": {
+ "source": "iana"
+ },
+ "application/vnd.emclient.accessrequest+xml": {
+ "source": "iana"
+ },
+ "application/vnd.enliven": {
+ "source": "iana",
+ "extensions": ["nml"]
+ },
+ "application/vnd.enphase.envoy": {
+ "source": "iana"
+ },
+ "application/vnd.eprints.data+xml": {
+ "source": "iana"
+ },
+ "application/vnd.epson.esf": {
+ "source": "iana",
+ "extensions": ["esf"]
+ },
+ "application/vnd.epson.msf": {
+ "source": "iana",
+ "extensions": ["msf"]
+ },
+ "application/vnd.epson.quickanime": {
+ "source": "iana",
+ "extensions": ["qam"]
+ },
+ "application/vnd.epson.salt": {
+ "source": "iana",
+ "extensions": ["slt"]
+ },
+ "application/vnd.epson.ssf": {
+ "source": "iana",
+ "extensions": ["ssf"]
+ },
+ "application/vnd.ericsson.quickcall": {
+ "source": "iana"
+ },
+ "application/vnd.eszigno3+xml": {
+ "source": "iana",
+ "extensions": ["es3","et3"]
+ },
+ "application/vnd.etsi.aoc+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.asic-e+zip": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.asic-s+zip": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.cug+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvcommand+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvdiscovery+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvprofile+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvsad-bc+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvsad-cod+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvsad-npvr+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvservice+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvsync+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvueprofile+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.mcid+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.mheg5": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.overload-control-policy-dataset+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.pstn+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.sci+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.simservs+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.timestamp-token": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.tsl+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.tsl.der": {
+ "source": "iana"
+ },
+ "application/vnd.eudora.data": {
+ "source": "iana"
+ },
+ "application/vnd.ezpix-album": {
+ "source": "iana",
+ "extensions": ["ez2"]
+ },
+ "application/vnd.ezpix-package": {
+ "source": "iana",
+ "extensions": ["ez3"]
+ },
+ "application/vnd.f-secure.mobile": {
+ "source": "iana"
+ },
+ "application/vnd.fastcopy-disk-image": {
+ "source": "iana"
+ },
+ "application/vnd.fdf": {
+ "source": "iana",
+ "extensions": ["fdf"]
+ },
+ "application/vnd.fdsn.mseed": {
+ "source": "iana",
+ "extensions": ["mseed"]
+ },
+ "application/vnd.fdsn.seed": {
+ "source": "iana",
+ "extensions": ["seed","dataless"]
+ },
+ "application/vnd.ffsns": {
+ "source": "iana"
+ },
+ "application/vnd.fints": {
+ "source": "iana"
+ },
+ "application/vnd.flographit": {
+ "source": "iana",
+ "extensions": ["gph"]
+ },
+ "application/vnd.fluxtime.clip": {
+ "source": "iana",
+ "extensions": ["ftc"]
+ },
+ "application/vnd.font-fontforge-sfd": {
+ "source": "iana"
+ },
+ "application/vnd.framemaker": {
+ "source": "iana",
+ "extensions": ["fm","frame","maker","book"]
+ },
+ "application/vnd.frogans.fnc": {
+ "source": "iana",
+ "extensions": ["fnc"]
+ },
+ "application/vnd.frogans.ltf": {
+ "source": "iana",
+ "extensions": ["ltf"]
+ },
+ "application/vnd.fsc.weblaunch": {
+ "source": "iana",
+ "extensions": ["fsc"]
+ },
+ "application/vnd.fujitsu.oasys": {
+ "source": "iana",
+ "extensions": ["oas"]
+ },
+ "application/vnd.fujitsu.oasys2": {
+ "source": "iana",
+ "extensions": ["oa2"]
+ },
+ "application/vnd.fujitsu.oasys3": {
+ "source": "iana",
+ "extensions": ["oa3"]
+ },
+ "application/vnd.fujitsu.oasysgp": {
+ "source": "iana",
+ "extensions": ["fg5"]
+ },
+ "application/vnd.fujitsu.oasysprs": {
+ "source": "iana",
+ "extensions": ["bh2"]
+ },
+ "application/vnd.fujixerox.art-ex": {
+ "source": "iana"
+ },
+ "application/vnd.fujixerox.art4": {
+ "source": "iana"
+ },
+ "application/vnd.fujixerox.ddd": {
+ "source": "iana",
+ "extensions": ["ddd"]
+ },
+ "application/vnd.fujixerox.docuworks": {
+ "source": "iana",
+ "extensions": ["xdw"]
+ },
+ "application/vnd.fujixerox.docuworks.binder": {
+ "source": "iana",
+ "extensions": ["xbd"]
+ },
+ "application/vnd.fujixerox.docuworks.container": {
+ "source": "iana"
+ },
+ "application/vnd.fujixerox.hbpl": {
+ "source": "iana"
+ },
+ "application/vnd.fut-misnet": {
+ "source": "iana"
+ },
+ "application/vnd.fuzzysheet": {
+ "source": "iana",
+ "extensions": ["fzs"]
+ },
+ "application/vnd.genomatix.tuxedo": {
+ "source": "iana",
+ "extensions": ["txd"]
+ },
+ "application/vnd.geo+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.geocube+xml": {
+ "source": "iana"
+ },
+ "application/vnd.geogebra.file": {
+ "source": "iana",
+ "extensions": ["ggb"]
+ },
+ "application/vnd.geogebra.tool": {
+ "source": "iana",
+ "extensions": ["ggt"]
+ },
+ "application/vnd.geometry-explorer": {
+ "source": "iana",
+ "extensions": ["gex","gre"]
+ },
+ "application/vnd.geonext": {
+ "source": "iana",
+ "extensions": ["gxt"]
+ },
+ "application/vnd.geoplan": {
+ "source": "iana",
+ "extensions": ["g2w"]
+ },
+ "application/vnd.geospace": {
+ "source": "iana",
+ "extensions": ["g3w"]
+ },
+ "application/vnd.gerber": {
+ "source": "iana"
+ },
+ "application/vnd.globalplatform.card-content-mgt": {
+ "source": "iana"
+ },
+ "application/vnd.globalplatform.card-content-mgt-response": {
+ "source": "iana"
+ },
+ "application/vnd.gmx": {
+ "source": "iana",
+ "extensions": ["gmx"]
+ },
+ "application/vnd.google-earth.kml+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["kml"]
+ },
+ "application/vnd.google-earth.kmz": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["kmz"]
+ },
+ "application/vnd.gov.sk.e-form+xml": {
+ "source": "iana"
+ },
+ "application/vnd.gov.sk.e-form+zip": {
+ "source": "iana"
+ },
+ "application/vnd.gov.sk.xmldatacontainer+xml": {
+ "source": "iana"
+ },
+ "application/vnd.grafeq": {
+ "source": "iana",
+ "extensions": ["gqf","gqs"]
+ },
+ "application/vnd.gridmp": {
+ "source": "iana"
+ },
+ "application/vnd.groove-account": {
+ "source": "iana",
+ "extensions": ["gac"]
+ },
+ "application/vnd.groove-help": {
+ "source": "iana",
+ "extensions": ["ghf"]
+ },
+ "application/vnd.groove-identity-message": {
+ "source": "iana",
+ "extensions": ["gim"]
+ },
+ "application/vnd.groove-injector": {
+ "source": "iana",
+ "extensions": ["grv"]
+ },
+ "application/vnd.groove-tool-message": {
+ "source": "iana",
+ "extensions": ["gtm"]
+ },
+ "application/vnd.groove-tool-template": {
+ "source": "iana",
+ "extensions": ["tpl"]
+ },
+ "application/vnd.groove-vcard": {
+ "source": "iana",
+ "extensions": ["vcg"]
+ },
+ "application/vnd.hal+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.hal+xml": {
+ "source": "iana",
+ "extensions": ["hal"]
+ },
+ "application/vnd.handheld-entertainment+xml": {
+ "source": "iana",
+ "extensions": ["zmm"]
+ },
+ "application/vnd.hbci": {
+ "source": "iana",
+ "extensions": ["hbci"]
+ },
+ "application/vnd.hcl-bireports": {
+ "source": "iana"
+ },
+ "application/vnd.heroku+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.hhe.lesson-player": {
+ "source": "iana",
+ "extensions": ["les"]
+ },
+ "application/vnd.hp-hpgl": {
+ "source": "iana",
+ "extensions": ["hpgl"]
+ },
+ "application/vnd.hp-hpid": {
+ "source": "iana",
+ "extensions": ["hpid"]
+ },
+ "application/vnd.hp-hps": {
+ "source": "iana",
+ "extensions": ["hps"]
+ },
+ "application/vnd.hp-jlyt": {
+ "source": "iana",
+ "extensions": ["jlt"]
+ },
+ "application/vnd.hp-pcl": {
+ "source": "iana",
+ "extensions": ["pcl"]
+ },
+ "application/vnd.hp-pclxl": {
+ "source": "iana",
+ "extensions": ["pclxl"]
+ },
+ "application/vnd.httphone": {
+ "source": "iana"
+ },
+ "application/vnd.hydrostatix.sof-data": {
+ "source": "iana"
+ },
+ "application/vnd.hzn-3d-crossword": {
+ "source": "iana"
+ },
+ "application/vnd.ibm.afplinedata": {
+ "source": "iana"
+ },
+ "application/vnd.ibm.electronic-media": {
+ "source": "iana"
+ },
+ "application/vnd.ibm.minipay": {
+ "source": "iana",
+ "extensions": ["mpy"]
+ },
+ "application/vnd.ibm.modcap": {
+ "source": "iana",
+ "extensions": ["afp","listafp","list3820"]
+ },
+ "application/vnd.ibm.rights-management": {
+ "source": "iana",
+ "extensions": ["irm"]
+ },
+ "application/vnd.ibm.secure-container": {
+ "source": "iana",
+ "extensions": ["sc"]
+ },
+ "application/vnd.iccprofile": {
+ "source": "iana",
+ "extensions": ["icc","icm"]
+ },
+ "application/vnd.ieee.1905": {
+ "source": "iana"
+ },
+ "application/vnd.igloader": {
+ "source": "iana",
+ "extensions": ["igl"]
+ },
+ "application/vnd.immervision-ivp": {
+ "source": "iana",
+ "extensions": ["ivp"]
+ },
+ "application/vnd.immervision-ivu": {
+ "source": "iana",
+ "extensions": ["ivu"]
+ },
+ "application/vnd.ims.imsccv1p1": {
+ "source": "iana"
+ },
+ "application/vnd.ims.imsccv1p2": {
+ "source": "iana"
+ },
+ "application/vnd.ims.imsccv1p3": {
+ "source": "iana"
+ },
+ "application/vnd.ims.lis.v2.result+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolconsumerprofile+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolproxy+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolproxy.id+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolsettings+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolsettings.simple+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.informedcontrol.rms+xml": {
+ "source": "iana"
+ },
+ "application/vnd.informix-visionary": {
+ "source": "iana"
+ },
+ "application/vnd.infotech.project": {
+ "source": "iana"
+ },
+ "application/vnd.infotech.project+xml": {
+ "source": "iana"
+ },
+ "application/vnd.innopath.wamp.notification": {
+ "source": "iana"
+ },
+ "application/vnd.insors.igm": {
+ "source": "iana",
+ "extensions": ["igm"]
+ },
+ "application/vnd.intercon.formnet": {
+ "source": "iana",
+ "extensions": ["xpw","xpx"]
+ },
+ "application/vnd.intergeo": {
+ "source": "iana",
+ "extensions": ["i2g"]
+ },
+ "application/vnd.intertrust.digibox": {
+ "source": "iana"
+ },
+ "application/vnd.intertrust.nncp": {
+ "source": "iana"
+ },
+ "application/vnd.intu.qbo": {
+ "source": "iana",
+ "extensions": ["qbo"]
+ },
+ "application/vnd.intu.qfx": {
+ "source": "iana",
+ "extensions": ["qfx"]
+ },
+ "application/vnd.iptc.g2.catalogitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.conceptitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.knowledgeitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.newsitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.newsmessage+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.packageitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.planningitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.ipunplugged.rcprofile": {
+ "source": "iana",
+ "extensions": ["rcprofile"]
+ },
+ "application/vnd.irepository.package+xml": {
+ "source": "iana",
+ "extensions": ["irp"]
+ },
+ "application/vnd.is-xpr": {
+ "source": "iana",
+ "extensions": ["xpr"]
+ },
+ "application/vnd.isac.fcs": {
+ "source": "iana",
+ "extensions": ["fcs"]
+ },
+ "application/vnd.jam": {
+ "source": "iana",
+ "extensions": ["jam"]
+ },
+ "application/vnd.japannet-directory-service": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-jpnstore-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-payment-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-registration": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-registration-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-setstore-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-verification": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-verification-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.jcp.javame.midlet-rms": {
+ "source": "iana",
+ "extensions": ["rms"]
+ },
+ "application/vnd.jisp": {
+ "source": "iana",
+ "extensions": ["jisp"]
+ },
+ "application/vnd.joost.joda-archive": {
+ "source": "iana",
+ "extensions": ["joda"]
+ },
+ "application/vnd.jsk.isdn-ngn": {
+ "source": "iana"
+ },
+ "application/vnd.kahootz": {
+ "source": "iana",
+ "extensions": ["ktz","ktr"]
+ },
+ "application/vnd.kde.karbon": {
+ "source": "iana",
+ "extensions": ["karbon"]
+ },
+ "application/vnd.kde.kchart": {
+ "source": "iana",
+ "extensions": ["chrt"]
+ },
+ "application/vnd.kde.kformula": {
+ "source": "iana",
+ "extensions": ["kfo"]
+ },
+ "application/vnd.kde.kivio": {
+ "source": "iana",
+ "extensions": ["flw"]
+ },
+ "application/vnd.kde.kontour": {
+ "source": "iana",
+ "extensions": ["kon"]
+ },
+ "application/vnd.kde.kpresenter": {
+ "source": "iana",
+ "extensions": ["kpr","kpt"]
+ },
+ "application/vnd.kde.kspread": {
+ "source": "iana",
+ "extensions": ["ksp"]
+ },
+ "application/vnd.kde.kword": {
+ "source": "iana",
+ "extensions": ["kwd","kwt"]
+ },
+ "application/vnd.kenameaapp": {
+ "source": "iana",
+ "extensions": ["htke"]
+ },
+ "application/vnd.kidspiration": {
+ "source": "iana",
+ "extensions": ["kia"]
+ },
+ "application/vnd.kinar": {
+ "source": "iana",
+ "extensions": ["kne","knp"]
+ },
+ "application/vnd.koan": {
+ "source": "iana",
+ "extensions": ["skp","skd","skt","skm"]
+ },
+ "application/vnd.kodak-descriptor": {
+ "source": "iana",
+ "extensions": ["sse"]
+ },
+ "application/vnd.las.las+xml": {
+ "source": "iana",
+ "extensions": ["lasxml"]
+ },
+ "application/vnd.liberty-request+xml": {
+ "source": "iana"
+ },
+ "application/vnd.llamagraphics.life-balance.desktop": {
+ "source": "iana",
+ "extensions": ["lbd"]
+ },
+ "application/vnd.llamagraphics.life-balance.exchange+xml": {
+ "source": "iana",
+ "extensions": ["lbe"]
+ },
+ "application/vnd.lotus-1-2-3": {
+ "source": "iana",
+ "extensions": ["123"]
+ },
+ "application/vnd.lotus-approach": {
+ "source": "iana",
+ "extensions": ["apr"]
+ },
+ "application/vnd.lotus-freelance": {
+ "source": "iana",
+ "extensions": ["pre"]
+ },
+ "application/vnd.lotus-notes": {
+ "source": "iana",
+ "extensions": ["nsf"]
+ },
+ "application/vnd.lotus-organizer": {
+ "source": "iana",
+ "extensions": ["org"]
+ },
+ "application/vnd.lotus-screencam": {
+ "source": "iana",
+ "extensions": ["scm"]
+ },
+ "application/vnd.lotus-wordpro": {
+ "source": "iana",
+ "extensions": ["lwp"]
+ },
+ "application/vnd.macports.portpkg": {
+ "source": "iana",
+ "extensions": ["portpkg"]
+ },
+ "application/vnd.marlin.drm.actiontoken+xml": {
+ "source": "iana"
+ },
+ "application/vnd.marlin.drm.conftoken+xml": {
+ "source": "iana"
+ },
+ "application/vnd.marlin.drm.license+xml": {
+ "source": "iana"
+ },
+ "application/vnd.marlin.drm.mdcf": {
+ "source": "iana"
+ },
+ "application/vnd.mason+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.maxmind.maxmind-db": {
+ "source": "iana"
+ },
+ "application/vnd.mcd": {
+ "source": "iana",
+ "extensions": ["mcd"]
+ },
+ "application/vnd.medcalcdata": {
+ "source": "iana",
+ "extensions": ["mc1"]
+ },
+ "application/vnd.mediastation.cdkey": {
+ "source": "iana",
+ "extensions": ["cdkey"]
+ },
+ "application/vnd.meridian-slingshot": {
+ "source": "iana"
+ },
+ "application/vnd.mfer": {
+ "source": "iana",
+ "extensions": ["mwf"]
+ },
+ "application/vnd.mfmp": {
+ "source": "iana",
+ "extensions": ["mfm"]
+ },
+ "application/vnd.micrografx.flo": {
+ "source": "iana",
+ "extensions": ["flo"]
+ },
+ "application/vnd.micrografx.igx": {
+ "source": "iana",
+ "extensions": ["igx"]
+ },
+ "application/vnd.miele+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.mif": {
+ "source": "iana",
+ "extensions": ["mif"]
+ },
+ "application/vnd.minisoft-hp3000-save": {
+ "source": "iana"
+ },
+ "application/vnd.mitsubishi.misty-guard.trustweb": {
+ "source": "iana"
+ },
+ "application/vnd.mobius.daf": {
+ "source": "iana",
+ "extensions": ["daf"]
+ },
+ "application/vnd.mobius.dis": {
+ "source": "iana",
+ "extensions": ["dis"]
+ },
+ "application/vnd.mobius.mbk": {
+ "source": "iana",
+ "extensions": ["mbk"]
+ },
+ "application/vnd.mobius.mqy": {
+ "source": "iana",
+ "extensions": ["mqy"]
+ },
+ "application/vnd.mobius.msl": {
+ "source": "iana",
+ "extensions": ["msl"]
+ },
+ "application/vnd.mobius.plc": {
+ "source": "iana",
+ "extensions": ["plc"]
+ },
+ "application/vnd.mobius.txf": {
+ "source": "iana",
+ "extensions": ["txf"]
+ },
+ "application/vnd.mophun.application": {
+ "source": "iana",
+ "extensions": ["mpn"]
+ },
+ "application/vnd.mophun.certificate": {
+ "source": "iana",
+ "extensions": ["mpc"]
+ },
+ "application/vnd.motorola.flexsuite": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.adsi": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.fis": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.gotap": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.kmr": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.ttc": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.wem": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.iprm": {
+ "source": "iana"
+ },
+ "application/vnd.mozilla.xul+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["xul"]
+ },
+ "application/vnd.ms-3mfdocument": {
+ "source": "iana"
+ },
+ "application/vnd.ms-artgalry": {
+ "source": "iana",
+ "extensions": ["cil"]
+ },
+ "application/vnd.ms-asf": {
+ "source": "iana"
+ },
+ "application/vnd.ms-cab-compressed": {
+ "source": "iana",
+ "extensions": ["cab"]
+ },
+ "application/vnd.ms-color.iccprofile": {
+ "source": "apache"
+ },
+ "application/vnd.ms-excel": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["xls","xlm","xla","xlc","xlt","xlw"]
+ },
+ "application/vnd.ms-excel.addin.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["xlam"]
+ },
+ "application/vnd.ms-excel.sheet.binary.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["xlsb"]
+ },
+ "application/vnd.ms-excel.sheet.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["xlsm"]
+ },
+ "application/vnd.ms-excel.template.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["xltm"]
+ },
+ "application/vnd.ms-fontobject": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["eot"]
+ },
+ "application/vnd.ms-htmlhelp": {
+ "source": "iana",
+ "extensions": ["chm"]
+ },
+ "application/vnd.ms-ims": {
+ "source": "iana",
+ "extensions": ["ims"]
+ },
+ "application/vnd.ms-lrm": {
+ "source": "iana",
+ "extensions": ["lrm"]
+ },
+ "application/vnd.ms-office.activex+xml": {
+ "source": "iana"
+ },
+ "application/vnd.ms-officetheme": {
+ "source": "iana",
+ "extensions": ["thmx"]
+ },
+ "application/vnd.ms-opentype": {
+ "source": "apache",
+ "compressible": true
+ },
+ "application/vnd.ms-package.obfuscated-opentype": {
+ "source": "apache"
+ },
+ "application/vnd.ms-pki.seccat": {
+ "source": "apache",
+ "extensions": ["cat"]
+ },
+ "application/vnd.ms-pki.stl": {
+ "source": "apache",
+ "extensions": ["stl"]
+ },
+ "application/vnd.ms-playready.initiator+xml": {
+ "source": "iana"
+ },
+ "application/vnd.ms-powerpoint": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["ppt","pps","pot"]
+ },
+ "application/vnd.ms-powerpoint.addin.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["ppam"]
+ },
+ "application/vnd.ms-powerpoint.presentation.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["pptm"]
+ },
+ "application/vnd.ms-powerpoint.slide.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["sldm"]
+ },
+ "application/vnd.ms-powerpoint.slideshow.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["ppsm"]
+ },
+ "application/vnd.ms-powerpoint.template.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["potm"]
+ },
+ "application/vnd.ms-printing.printticket+xml": {
+ "source": "apache"
+ },
+ "application/vnd.ms-project": {
+ "source": "iana",
+ "extensions": ["mpp","mpt"]
+ },
+ "application/vnd.ms-tnef": {
+ "source": "iana"
+ },
+ "application/vnd.ms-windows.printerpairing": {
+ "source": "iana"
+ },
+ "application/vnd.ms-wmdrm.lic-chlg-req": {
+ "source": "iana"
+ },
+ "application/vnd.ms-wmdrm.lic-resp": {
+ "source": "iana"
+ },
+ "application/vnd.ms-wmdrm.meter-chlg-req": {
+ "source": "iana"
+ },
+ "application/vnd.ms-wmdrm.meter-resp": {
+ "source": "iana"
+ },
+ "application/vnd.ms-word.document.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["docm"]
+ },
+ "application/vnd.ms-word.template.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["dotm"]
+ },
+ "application/vnd.ms-works": {
+ "source": "iana",
+ "extensions": ["wps","wks","wcm","wdb"]
+ },
+ "application/vnd.ms-wpl": {
+ "source": "iana",
+ "extensions": ["wpl"]
+ },
+ "application/vnd.ms-xpsdocument": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["xps"]
+ },
+ "application/vnd.msa-disk-image": {
+ "source": "iana"
+ },
+ "application/vnd.mseq": {
+ "source": "iana",
+ "extensions": ["mseq"]
+ },
+ "application/vnd.msign": {
+ "source": "iana"
+ },
+ "application/vnd.multiad.creator": {
+ "source": "iana"
+ },
+ "application/vnd.multiad.creator.cif": {
+ "source": "iana"
+ },
+ "application/vnd.music-niff": {
+ "source": "iana"
+ },
+ "application/vnd.musician": {
+ "source": "iana",
+ "extensions": ["mus"]
+ },
+ "application/vnd.muvee.style": {
+ "source": "iana",
+ "extensions": ["msty"]
+ },
+ "application/vnd.mynfc": {
+ "source": "iana",
+ "extensions": ["taglet"]
+ },
+ "application/vnd.ncd.control": {
+ "source": "iana"
+ },
+ "application/vnd.ncd.reference": {
+ "source": "iana"
+ },
+ "application/vnd.nervana": {
+ "source": "iana"
+ },
+ "application/vnd.netfpx": {
+ "source": "iana"
+ },
+ "application/vnd.neurolanguage.nlu": {
+ "source": "iana",
+ "extensions": ["nlu"]
+ },
+ "application/vnd.nintendo.nitro.rom": {
+ "source": "iana"
+ },
+ "application/vnd.nintendo.snes.rom": {
+ "source": "iana"
+ },
+ "application/vnd.nitf": {
+ "source": "iana",
+ "extensions": ["ntf","nitf"]
+ },
+ "application/vnd.noblenet-directory": {
+ "source": "iana",
+ "extensions": ["nnd"]
+ },
+ "application/vnd.noblenet-sealer": {
+ "source": "iana",
+ "extensions": ["nns"]
+ },
+ "application/vnd.noblenet-web": {
+ "source": "iana",
+ "extensions": ["nnw"]
+ },
+ "application/vnd.nokia.catalogs": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.conml+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.conml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.iptv.config+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.isds-radio-presets": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.landmark+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.landmark+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.landmarkcollection+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.n-gage.ac+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.n-gage.data": {
+ "source": "iana",
+ "extensions": ["ngdat"]
+ },
+ "application/vnd.nokia.n-gage.symbian.install": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.ncd": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.pcd+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.pcd+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.radio-preset": {
+ "source": "iana",
+ "extensions": ["rpst"]
+ },
+ "application/vnd.nokia.radio-presets": {
+ "source": "iana",
+ "extensions": ["rpss"]
+ },
+ "application/vnd.novadigm.edm": {
+ "source": "iana",
+ "extensions": ["edm"]
+ },
+ "application/vnd.novadigm.edx": {
+ "source": "iana",
+ "extensions": ["edx"]
+ },
+ "application/vnd.novadigm.ext": {
+ "source": "iana",
+ "extensions": ["ext"]
+ },
+ "application/vnd.ntt-local.content-share": {
+ "source": "iana"
+ },
+ "application/vnd.ntt-local.file-transfer": {
+ "source": "iana"
+ },
+ "application/vnd.ntt-local.ogw_remote-access": {
+ "source": "iana"
+ },
+ "application/vnd.ntt-local.sip-ta_remote": {
+ "source": "iana"
+ },
+ "application/vnd.ntt-local.sip-ta_tcp_stream": {
+ "source": "iana"
+ },
+ "application/vnd.oasis.opendocument.chart": {
+ "source": "iana",
+ "extensions": ["odc"]
+ },
+ "application/vnd.oasis.opendocument.chart-template": {
+ "source": "iana",
+ "extensions": ["otc"]
+ },
+ "application/vnd.oasis.opendocument.database": {
+ "source": "iana",
+ "extensions": ["odb"]
+ },
+ "application/vnd.oasis.opendocument.formula": {
+ "source": "iana",
+ "extensions": ["odf"]
+ },
+ "application/vnd.oasis.opendocument.formula-template": {
+ "source": "iana",
+ "extensions": ["odft"]
+ },
+ "application/vnd.oasis.opendocument.graphics": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["odg"]
+ },
+ "application/vnd.oasis.opendocument.graphics-template": {
+ "source": "iana",
+ "extensions": ["otg"]
+ },
+ "application/vnd.oasis.opendocument.image": {
+ "source": "iana",
+ "extensions": ["odi"]
+ },
+ "application/vnd.oasis.opendocument.image-template": {
+ "source": "iana",
+ "extensions": ["oti"]
+ },
+ "application/vnd.oasis.opendocument.presentation": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["odp"]
+ },
+ "application/vnd.oasis.opendocument.presentation-template": {
+ "source": "iana",
+ "extensions": ["otp"]
+ },
+ "application/vnd.oasis.opendocument.spreadsheet": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["ods"]
+ },
+ "application/vnd.oasis.opendocument.spreadsheet-template": {
+ "source": "iana",
+ "extensions": ["ots"]
+ },
+ "application/vnd.oasis.opendocument.text": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["odt"]
+ },
+ "application/vnd.oasis.opendocument.text-master": {
+ "source": "iana",
+ "extensions": ["odm"]
+ },
+ "application/vnd.oasis.opendocument.text-template": {
+ "source": "iana",
+ "extensions": ["ott"]
+ },
+ "application/vnd.oasis.opendocument.text-web": {
+ "source": "iana",
+ "extensions": ["oth"]
+ },
+ "application/vnd.obn": {
+ "source": "iana"
+ },
+ "application/vnd.oftn.l10n+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.oipf.contentaccessdownload+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.contentaccessstreaming+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.cspg-hexbinary": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.dae.svg+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.dae.xhtml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.mippvcontrolmessage+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.pae.gem": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.spdiscovery+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.spdlist+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.ueprofile+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.userprofile+xml": {
+ "source": "iana"
+ },
+ "application/vnd.olpc-sugar": {
+ "source": "iana",
+ "extensions": ["xo"]
+ },
+ "application/vnd.oma-scws-config": {
+ "source": "iana"
+ },
+ "application/vnd.oma-scws-http-request": {
+ "source": "iana"
+ },
+ "application/vnd.oma-scws-http-response": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.associated-procedure-parameter+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.drm-trigger+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.imd+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.ltkm": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.notification+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.provisioningtrigger": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.sgboot": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.sgdd+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.sgdu": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.simple-symbol-container": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.smartcard-trigger+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.sprov+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.stkm": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-address-book+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-feature-handler+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-pcc+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-subs-invite+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-user-prefs+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.dcd": {
+ "source": "iana"
+ },
+ "application/vnd.oma.dcdc": {
+ "source": "iana"
+ },
+ "application/vnd.oma.dd2+xml": {
+ "source": "iana",
+ "extensions": ["dd2"]
+ },
+ "application/vnd.oma.drm.risd+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.group-usage-list+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.pal+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.detailed-progress-report+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.final-report+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.groups+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.invocation-descriptor+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.optimized-progress-report+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.push": {
+ "source": "iana"
+ },
+ "application/vnd.oma.scidm.messages+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.xcap-directory+xml": {
+ "source": "iana"
+ },
+ "application/vnd.omads-email+xml": {
+ "source": "iana"
+ },
+ "application/vnd.omads-file+xml": {
+ "source": "iana"
+ },
+ "application/vnd.omads-folder+xml": {
+ "source": "iana"
+ },
+ "application/vnd.omaloc-supl-init": {
+ "source": "iana"
+ },
+ "application/vnd.openeye.oeb": {
+ "source": "iana"
+ },
+ "application/vnd.openofficeorg.extension": {
+ "source": "apache",
+ "extensions": ["oxt"]
+ },
+ "application/vnd.openxmlformats-officedocument.custom-properties+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawing+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.extended-properties+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml-template": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.presentation": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["pptx"]
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slide": {
+ "source": "iana",
+ "extensions": ["sldx"]
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slideshow": {
+ "source": "iana",
+ "extensions": ["ppsx"]
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.template": {
+ "source": "apache",
+ "extensions": ["potx"]
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml-template": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["xlsx"]
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.template": {
+ "source": "apache",
+ "extensions": ["xltx"]
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.theme+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.themeoverride+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.vmldrawing": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml-template": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.document": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["docx"]
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.template": {
+ "source": "apache",
+ "extensions": ["dotx"]
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-package.core-properties+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-package.relationships+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oracle.resource+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.orange.indata": {
+ "source": "iana"
+ },
+ "application/vnd.osa.netdeploy": {
+ "source": "iana"
+ },
+ "application/vnd.osgeo.mapguide.package": {
+ "source": "iana",
+ "extensions": ["mgp"]
+ },
+ "application/vnd.osgi.bundle": {
+ "source": "iana"
+ },
+ "application/vnd.osgi.dp": {
+ "source": "iana",
+ "extensions": ["dp"]
+ },
+ "application/vnd.osgi.subsystem": {
+ "source": "iana",
+ "extensions": ["esa"]
+ },
+ "application/vnd.otps.ct-kip+xml": {
+ "source": "iana"
+ },
+ "application/vnd.palm": {
+ "source": "iana",
+ "extensions": ["pdb","pqa","oprc"]
+ },
+ "application/vnd.panoply": {
+ "source": "iana"
+ },
+ "application/vnd.paos+xml": {
+ "source": "iana"
+ },
+ "application/vnd.paos.xml": {
+ "source": "apache"
+ },
+ "application/vnd.pawaafile": {
+ "source": "iana",
+ "extensions": ["paw"]
+ },
+ "application/vnd.pcos": {
+ "source": "iana"
+ },
+ "application/vnd.pg.format": {
+ "source": "iana",
+ "extensions": ["str"]
+ },
+ "application/vnd.pg.osasli": {
+ "source": "iana",
+ "extensions": ["ei6"]
+ },
+ "application/vnd.piaccess.application-licence": {
+ "source": "iana"
+ },
+ "application/vnd.picsel": {
+ "source": "iana",
+ "extensions": ["efif"]
+ },
+ "application/vnd.pmi.widget": {
+ "source": "iana",
+ "extensions": ["wg"]
+ },
+ "application/vnd.poc.group-advertisement+xml": {
+ "source": "iana"
+ },
+ "application/vnd.pocketlearn": {
+ "source": "iana",
+ "extensions": ["plf"]
+ },
+ "application/vnd.powerbuilder6": {
+ "source": "iana",
+ "extensions": ["pbd"]
+ },
+ "application/vnd.powerbuilder6-s": {
+ "source": "iana"
+ },
+ "application/vnd.powerbuilder7": {
+ "source": "iana"
+ },
+ "application/vnd.powerbuilder7-s": {
+ "source": "iana"
+ },
+ "application/vnd.powerbuilder75": {
+ "source": "iana"
+ },
+ "application/vnd.powerbuilder75-s": {
+ "source": "iana"
+ },
+ "application/vnd.preminet": {
+ "source": "iana"
+ },
+ "application/vnd.previewsystems.box": {
+ "source": "iana",
+ "extensions": ["box"]
+ },
+ "application/vnd.proteus.magazine": {
+ "source": "iana",
+ "extensions": ["mgz"]
+ },
+ "application/vnd.publishare-delta-tree": {
+ "source": "iana",
+ "extensions": ["qps"]
+ },
+ "application/vnd.pvi.ptid1": {
+ "source": "iana",
+ "extensions": ["ptid"]
+ },
+ "application/vnd.pwg-multiplexed": {
+ "source": "iana"
+ },
+ "application/vnd.pwg-xhtml-print+xml": {
+ "source": "iana"
+ },
+ "application/vnd.qualcomm.brew-app-res": {
+ "source": "iana"
+ },
+ "application/vnd.quark.quarkxpress": {
+ "source": "iana",
+ "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"]
+ },
+ "application/vnd.quobject-quoxdocument": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.moml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit-conf+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit-conn+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit-dialog+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit-stream+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-conf+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-base+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-fax-detect+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-group+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-speech+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-transform+xml": {
+ "source": "iana"
+ },
+ "application/vnd.rainstor.data": {
+ "source": "iana"
+ },
+ "application/vnd.rapid": {
+ "source": "iana"
+ },
+ "application/vnd.realvnc.bed": {
+ "source": "iana",
+ "extensions": ["bed"]
+ },
+ "application/vnd.recordare.musicxml": {
+ "source": "iana",
+ "extensions": ["mxl"]
+ },
+ "application/vnd.recordare.musicxml+xml": {
+ "source": "iana",
+ "extensions": ["musicxml"]
+ },
+ "application/vnd.renlearn.rlprint": {
+ "source": "iana"
+ },
+ "application/vnd.rig.cryptonote": {
+ "source": "iana",
+ "extensions": ["cryptonote"]
+ },
+ "application/vnd.rim.cod": {
+ "source": "apache",
+ "extensions": ["cod"]
+ },
+ "application/vnd.rn-realmedia": {
+ "source": "apache",
+ "extensions": ["rm"]
+ },
+ "application/vnd.rn-realmedia-vbr": {
+ "source": "apache",
+ "extensions": ["rmvb"]
+ },
+ "application/vnd.route66.link66+xml": {
+ "source": "iana",
+ "extensions": ["link66"]
+ },
+ "application/vnd.rs-274x": {
+ "source": "iana"
+ },
+ "application/vnd.ruckus.download": {
+ "source": "iana"
+ },
+ "application/vnd.s3sms": {
+ "source": "iana"
+ },
+ "application/vnd.sailingtracker.track": {
+ "source": "iana",
+ "extensions": ["st"]
+ },
+ "application/vnd.sbm.cid": {
+ "source": "iana"
+ },
+ "application/vnd.sbm.mid2": {
+ "source": "iana"
+ },
+ "application/vnd.scribus": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.3df": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.csf": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.doc": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.eml": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.mht": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.net": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.ppt": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.tiff": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.xls": {
+ "source": "iana"
+ },
+ "application/vnd.sealedmedia.softseal.html": {
+ "source": "iana"
+ },
+ "application/vnd.sealedmedia.softseal.pdf": {
+ "source": "iana"
+ },
+ "application/vnd.seemail": {
+ "source": "iana",
+ "extensions": ["see"]
+ },
+ "application/vnd.sema": {
+ "source": "iana",
+ "extensions": ["sema"]
+ },
+ "application/vnd.semd": {
+ "source": "iana",
+ "extensions": ["semd"]
+ },
+ "application/vnd.semf": {
+ "source": "iana",
+ "extensions": ["semf"]
+ },
+ "application/vnd.shana.informed.formdata": {
+ "source": "iana",
+ "extensions": ["ifm"]
+ },
+ "application/vnd.shana.informed.formtemplate": {
+ "source": "iana",
+ "extensions": ["itp"]
+ },
+ "application/vnd.shana.informed.interchange": {
+ "source": "iana",
+ "extensions": ["iif"]
+ },
+ "application/vnd.shana.informed.package": {
+ "source": "iana",
+ "extensions": ["ipk"]
+ },
+ "application/vnd.simtech-mindmapper": {
+ "source": "iana",
+ "extensions": ["twd","twds"]
+ },
+ "application/vnd.siren+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.smaf": {
+ "source": "iana",
+ "extensions": ["mmf"]
+ },
+ "application/vnd.smart.notebook": {
+ "source": "iana"
+ },
+ "application/vnd.smart.teacher": {
+ "source": "iana",
+ "extensions": ["teacher"]
+ },
+ "application/vnd.software602.filler.form+xml": {
+ "source": "iana"
+ },
+ "application/vnd.software602.filler.form-xml-zip": {
+ "source": "iana"
+ },
+ "application/vnd.solent.sdkm+xml": {
+ "source": "iana",
+ "extensions": ["sdkm","sdkd"]
+ },
+ "application/vnd.spotfire.dxp": {
+ "source": "iana",
+ "extensions": ["dxp"]
+ },
+ "application/vnd.spotfire.sfs": {
+ "source": "iana",
+ "extensions": ["sfs"]
+ },
+ "application/vnd.sss-cod": {
+ "source": "iana"
+ },
+ "application/vnd.sss-dtf": {
+ "source": "iana"
+ },
+ "application/vnd.sss-ntf": {
+ "source": "iana"
+ },
+ "application/vnd.stardivision.calc": {
+ "source": "apache",
+ "extensions": ["sdc"]
+ },
+ "application/vnd.stardivision.draw": {
+ "source": "apache",
+ "extensions": ["sda"]
+ },
+ "application/vnd.stardivision.impress": {
+ "source": "apache",
+ "extensions": ["sdd"]
+ },
+ "application/vnd.stardivision.math": {
+ "source": "apache",
+ "extensions": ["smf"]
+ },
+ "application/vnd.stardivision.writer": {
+ "source": "apache",
+ "extensions": ["sdw","vor"]
+ },
+ "application/vnd.stardivision.writer-global": {
+ "source": "apache",
+ "extensions": ["sgl"]
+ },
+ "application/vnd.stepmania.package": {
+ "source": "iana",
+ "extensions": ["smzip"]
+ },
+ "application/vnd.stepmania.stepchart": {
+ "source": "iana",
+ "extensions": ["sm"]
+ },
+ "application/vnd.street-stream": {
+ "source": "iana"
+ },
+ "application/vnd.sun.wadl+xml": {
+ "source": "iana"
+ },
+ "application/vnd.sun.xml.calc": {
+ "source": "apache",
+ "extensions": ["sxc"]
+ },
+ "application/vnd.sun.xml.calc.template": {
+ "source": "apache",
+ "extensions": ["stc"]
+ },
+ "application/vnd.sun.xml.draw": {
+ "source": "apache",
+ "extensions": ["sxd"]
+ },
+ "application/vnd.sun.xml.draw.template": {
+ "source": "apache",
+ "extensions": ["std"]
+ },
+ "application/vnd.sun.xml.impress": {
+ "source": "apache",
+ "extensions": ["sxi"]
+ },
+ "application/vnd.sun.xml.impress.template": {
+ "source": "apache",
+ "extensions": ["sti"]
+ },
+ "application/vnd.sun.xml.math": {
+ "source": "apache",
+ "extensions": ["sxm"]
+ },
+ "application/vnd.sun.xml.writer": {
+ "source": "apache",
+ "extensions": ["sxw"]
+ },
+ "application/vnd.sun.xml.writer.global": {
+ "source": "apache",
+ "extensions": ["sxg"]
+ },
+ "application/vnd.sun.xml.writer.template": {
+ "source": "apache",
+ "extensions": ["stw"]
+ },
+ "application/vnd.sus-calendar": {
+ "source": "iana",
+ "extensions": ["sus","susp"]
+ },
+ "application/vnd.svd": {
+ "source": "iana",
+ "extensions": ["svd"]
+ },
+ "application/vnd.swiftview-ics": {
+ "source": "iana"
+ },
+ "application/vnd.symbian.install": {
+ "source": "apache",
+ "extensions": ["sis","sisx"]
+ },
+ "application/vnd.syncml+xml": {
+ "source": "iana",
+ "extensions": ["xsm"]
+ },
+ "application/vnd.syncml.dm+wbxml": {
+ "source": "iana",
+ "extensions": ["bdm"]
+ },
+ "application/vnd.syncml.dm+xml": {
+ "source": "iana",
+ "extensions": ["xdm"]
+ },
+ "application/vnd.syncml.dm.notification": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.dmddf+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.dmddf+xml": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.dmtnds+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.dmtnds+xml": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.ds.notification": {
+ "source": "iana"
+ },
+ "application/vnd.tao.intent-module-archive": {
+ "source": "iana",
+ "extensions": ["tao"]
+ },
+ "application/vnd.tcpdump.pcap": {
+ "source": "iana",
+ "extensions": ["pcap","cap","dmp"]
+ },
+ "application/vnd.tmd.mediaflex.api+xml": {
+ "source": "iana"
+ },
+ "application/vnd.tmobile-livetv": {
+ "source": "iana",
+ "extensions": ["tmo"]
+ },
+ "application/vnd.trid.tpt": {
+ "source": "iana",
+ "extensions": ["tpt"]
+ },
+ "application/vnd.triscape.mxs": {
+ "source": "iana",
+ "extensions": ["mxs"]
+ },
+ "application/vnd.trueapp": {
+ "source": "iana",
+ "extensions": ["tra"]
+ },
+ "application/vnd.truedoc": {
+ "source": "iana"
+ },
+ "application/vnd.ubisoft.webplayer": {
+ "source": "iana"
+ },
+ "application/vnd.ufdl": {
+ "source": "iana",
+ "extensions": ["ufd","ufdl"]
+ },
+ "application/vnd.uiq.theme": {
+ "source": "iana",
+ "extensions": ["utz"]
+ },
+ "application/vnd.umajin": {
+ "source": "iana",
+ "extensions": ["umj"]
+ },
+ "application/vnd.unity": {
+ "source": "iana",
+ "extensions": ["unityweb"]
+ },
+ "application/vnd.uoml+xml": {
+ "source": "iana",
+ "extensions": ["uoml"]
+ },
+ "application/vnd.uplanet.alert": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.alert-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.bearer-choice": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.bearer-choice-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.cacheop": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.cacheop-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.channel": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.channel-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.list": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.list-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.listcmd": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.listcmd-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.signal": {
+ "source": "iana"
+ },
+ "application/vnd.valve.source.material": {
+ "source": "iana"
+ },
+ "application/vnd.vcx": {
+ "source": "iana",
+ "extensions": ["vcx"]
+ },
+ "application/vnd.vd-study": {
+ "source": "iana"
+ },
+ "application/vnd.vectorworks": {
+ "source": "iana"
+ },
+ "application/vnd.verimatrix.vcas": {
+ "source": "iana"
+ },
+ "application/vnd.vidsoft.vidconference": {
+ "source": "iana"
+ },
+ "application/vnd.visio": {
+ "source": "iana",
+ "extensions": ["vsd","vst","vss","vsw"]
+ },
+ "application/vnd.visionary": {
+ "source": "iana",
+ "extensions": ["vis"]
+ },
+ "application/vnd.vividence.scriptfile": {
+ "source": "iana"
+ },
+ "application/vnd.vsf": {
+ "source": "iana",
+ "extensions": ["vsf"]
+ },
+ "application/vnd.wap.sic": {
+ "source": "iana"
+ },
+ "application/vnd.wap.slc": {
+ "source": "iana"
+ },
+ "application/vnd.wap.wbxml": {
+ "source": "iana",
+ "extensions": ["wbxml"]
+ },
+ "application/vnd.wap.wmlc": {
+ "source": "iana",
+ "extensions": ["wmlc"]
+ },
+ "application/vnd.wap.wmlscriptc": {
+ "source": "iana",
+ "extensions": ["wmlsc"]
+ },
+ "application/vnd.webturbo": {
+ "source": "iana",
+ "extensions": ["wtb"]
+ },
+ "application/vnd.wfa.p2p": {
+ "source": "iana"
+ },
+ "application/vnd.wfa.wsc": {
+ "source": "iana"
+ },
+ "application/vnd.windows.devicepairing": {
+ "source": "iana"
+ },
+ "application/vnd.wmc": {
+ "source": "iana"
+ },
+ "application/vnd.wmf.bootstrap": {
+ "source": "iana"
+ },
+ "application/vnd.wolfram.mathematica": {
+ "source": "iana"
+ },
+ "application/vnd.wolfram.mathematica.package": {
+ "source": "iana"
+ },
+ "application/vnd.wolfram.player": {
+ "source": "iana",
+ "extensions": ["nbp"]
+ },
+ "application/vnd.wordperfect": {
+ "source": "iana",
+ "extensions": ["wpd"]
+ },
+ "application/vnd.wqd": {
+ "source": "iana",
+ "extensions": ["wqd"]
+ },
+ "application/vnd.wrq-hp3000-labelled": {
+ "source": "iana"
+ },
+ "application/vnd.wt.stf": {
+ "source": "iana",
+ "extensions": ["stf"]
+ },
+ "application/vnd.wv.csp+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.wv.csp+xml": {
+ "source": "iana"
+ },
+ "application/vnd.wv.ssp+xml": {
+ "source": "iana"
+ },
+ "application/vnd.xacml+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.xara": {
+ "source": "iana",
+ "extensions": ["xar"]
+ },
+ "application/vnd.xfdl": {
+ "source": "iana",
+ "extensions": ["xfdl"]
+ },
+ "application/vnd.xfdl.webform": {
+ "source": "iana"
+ },
+ "application/vnd.xmi+xml": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.cpkg": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.dpkg": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.plan": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.ppkg": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.xlim": {
+ "source": "iana"
+ },
+ "application/vnd.yamaha.hv-dic": {
+ "source": "iana",
+ "extensions": ["hvd"]
+ },
+ "application/vnd.yamaha.hv-script": {
+ "source": "iana",
+ "extensions": ["hvs"]
+ },
+ "application/vnd.yamaha.hv-voice": {
+ "source": "iana",
+ "extensions": ["hvp"]
+ },
+ "application/vnd.yamaha.openscoreformat": {
+ "source": "iana",
+ "extensions": ["osf"]
+ },
+ "application/vnd.yamaha.openscoreformat.osfpvg+xml": {
+ "source": "iana",
+ "extensions": ["osfpvg"]
+ },
+ "application/vnd.yamaha.remote-setup": {
+ "source": "iana"
+ },
+ "application/vnd.yamaha.smaf-audio": {
+ "source": "iana",
+ "extensions": ["saf"]
+ },
+ "application/vnd.yamaha.smaf-phrase": {
+ "source": "iana",
+ "extensions": ["spf"]
+ },
+ "application/vnd.yamaha.through-ngn": {
+ "source": "iana"
+ },
+ "application/vnd.yamaha.tunnel-udpencap": {
+ "source": "iana"
+ },
+ "application/vnd.yaoweme": {
+ "source": "iana"
+ },
+ "application/vnd.yellowriver-custom-menu": {
+ "source": "iana",
+ "extensions": ["cmp"]
+ },
+ "application/vnd.zul": {
+ "source": "iana",
+ "extensions": ["zir","zirz"]
+ },
+ "application/vnd.zzazz.deck+xml": {
+ "source": "iana",
+ "extensions": ["zaz"]
+ },
+ "application/voicexml+xml": {
+ "source": "iana",
+ "extensions": ["vxml"]
+ },
+ "application/vq-rtcpxr": {
+ "source": "iana"
+ },
+ "application/watcherinfo+xml": {
+ "source": "iana"
+ },
+ "application/whoispp-query": {
+ "source": "iana"
+ },
+ "application/whoispp-response": {
+ "source": "iana"
+ },
+ "application/widget": {
+ "source": "iana",
+ "extensions": ["wgt"]
+ },
+ "application/winhlp": {
+ "source": "apache",
+ "extensions": ["hlp"]
+ },
+ "application/wita": {
+ "source": "iana"
+ },
+ "application/wordperfect5.1": {
+ "source": "iana"
+ },
+ "application/wsdl+xml": {
+ "source": "iana",
+ "extensions": ["wsdl"]
+ },
+ "application/wspolicy+xml": {
+ "source": "iana",
+ "extensions": ["wspolicy"]
+ },
+ "application/x-7z-compressed": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["7z"]
+ },
+ "application/x-abiword": {
+ "source": "apache",
+ "extensions": ["abw"]
+ },
+ "application/x-ace-compressed": {
+ "source": "apache",
+ "extensions": ["ace"]
+ },
+ "application/x-amf": {
+ "source": "apache"
+ },
+ "application/x-apple-diskimage": {
+ "source": "apache",
+ "extensions": ["dmg"]
+ },
+ "application/x-authorware-bin": {
+ "source": "apache",
+ "extensions": ["aab","x32","u32","vox"]
+ },
+ "application/x-authorware-map": {
+ "source": "apache",
+ "extensions": ["aam"]
+ },
+ "application/x-authorware-seg": {
+ "source": "apache",
+ "extensions": ["aas"]
+ },
+ "application/x-bcpio": {
+ "source": "apache",
+ "extensions": ["bcpio"]
+ },
+ "application/x-bittorrent": {
+ "source": "apache",
+ "extensions": ["torrent"]
+ },
+ "application/x-blorb": {
+ "source": "apache",
+ "extensions": ["blb","blorb"]
+ },
+ "application/x-bzip": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["bz"]
+ },
+ "application/x-bzip2": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["bz2","boz"]
+ },
+ "application/x-cbr": {
+ "source": "apache",
+ "extensions": ["cbr","cba","cbt","cbz","cb7"]
+ },
+ "application/x-cdlink": {
+ "source": "apache",
+ "extensions": ["vcd"]
+ },
+ "application/x-cfs-compressed": {
+ "source": "apache",
+ "extensions": ["cfs"]
+ },
+ "application/x-chat": {
+ "source": "apache",
+ "extensions": ["chat"]
+ },
+ "application/x-chess-pgn": {
+ "source": "apache",
+ "extensions": ["pgn"]
+ },
+ "application/x-chrome-extension": {
+ "extensions": ["crx"]
+ },
+ "application/x-compress": {
+ "source": "apache"
+ },
+ "application/x-conference": {
+ "source": "apache",
+ "extensions": ["nsc"]
+ },
+ "application/x-cpio": {
+ "source": "apache",
+ "extensions": ["cpio"]
+ },
+ "application/x-csh": {
+ "source": "apache",
+ "extensions": ["csh"]
+ },
+ "application/x-deb": {
+ "compressible": false
+ },
+ "application/x-debian-package": {
+ "source": "apache",
+ "extensions": ["deb","udeb"]
+ },
+ "application/x-dgc-compressed": {
+ "source": "apache",
+ "extensions": ["dgc"]
+ },
+ "application/x-director": {
+ "source": "apache",
+ "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"]
+ },
+ "application/x-doom": {
+ "source": "apache",
+ "extensions": ["wad"]
+ },
+ "application/x-dtbncx+xml": {
+ "source": "apache",
+ "extensions": ["ncx"]
+ },
+ "application/x-dtbook+xml": {
+ "source": "apache",
+ "extensions": ["dtb"]
+ },
+ "application/x-dtbresource+xml": {
+ "source": "apache",
+ "extensions": ["res"]
+ },
+ "application/x-dvi": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["dvi"]
+ },
+ "application/x-envoy": {
+ "source": "apache",
+ "extensions": ["evy"]
+ },
+ "application/x-eva": {
+ "source": "apache",
+ "extensions": ["eva"]
+ },
+ "application/x-font-bdf": {
+ "source": "apache",
+ "extensions": ["bdf"]
+ },
+ "application/x-font-dos": {
+ "source": "apache"
+ },
+ "application/x-font-framemaker": {
+ "source": "apache"
+ },
+ "application/x-font-ghostscript": {
+ "source": "apache",
+ "extensions": ["gsf"]
+ },
+ "application/x-font-libgrx": {
+ "source": "apache"
+ },
+ "application/x-font-linux-psf": {
+ "source": "apache",
+ "extensions": ["psf"]
+ },
+ "application/x-font-otf": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["otf"]
+ },
+ "application/x-font-pcf": {
+ "source": "apache",
+ "extensions": ["pcf"]
+ },
+ "application/x-font-snf": {
+ "source": "apache",
+ "extensions": ["snf"]
+ },
+ "application/x-font-speedo": {
+ "source": "apache"
+ },
+ "application/x-font-sunos-news": {
+ "source": "apache"
+ },
+ "application/x-font-ttf": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["ttf","ttc"]
+ },
+ "application/x-font-type1": {
+ "source": "apache",
+ "extensions": ["pfa","pfb","pfm","afm"]
+ },
+ "application/x-font-vfont": {
+ "source": "apache"
+ },
+ "application/x-freearc": {
+ "source": "apache",
+ "extensions": ["arc"]
+ },
+ "application/x-futuresplash": {
+ "source": "apache",
+ "extensions": ["spl"]
+ },
+ "application/x-gca-compressed": {
+ "source": "apache",
+ "extensions": ["gca"]
+ },
+ "application/x-glulx": {
+ "source": "apache",
+ "extensions": ["ulx"]
+ },
+ "application/x-gnumeric": {
+ "source": "apache",
+ "extensions": ["gnumeric"]
+ },
+ "application/x-gramps-xml": {
+ "source": "apache",
+ "extensions": ["gramps"]
+ },
+ "application/x-gtar": {
+ "source": "apache",
+ "extensions": ["gtar"]
+ },
+ "application/x-gzip": {
+ "source": "apache"
+ },
+ "application/x-hdf": {
+ "source": "apache",
+ "extensions": ["hdf"]
+ },
+ "application/x-install-instructions": {
+ "source": "apache",
+ "extensions": ["install"]
+ },
+ "application/x-iso9660-image": {
+ "source": "apache",
+ "extensions": ["iso"]
+ },
+ "application/x-java-jnlp-file": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["jnlp"]
+ },
+ "application/x-javascript": {
+ "compressible": true
+ },
+ "application/x-latex": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["latex"]
+ },
+ "application/x-lua-bytecode": {
+ "extensions": ["luac"]
+ },
+ "application/x-lzh-compressed": {
+ "source": "apache",
+ "extensions": ["lzh","lha"]
+ },
+ "application/x-mie": {
+ "source": "apache",
+ "extensions": ["mie"]
+ },
+ "application/x-mobipocket-ebook": {
+ "source": "apache",
+ "extensions": ["prc","mobi"]
+ },
+ "application/x-mpegurl": {
+ "compressible": false
+ },
+ "application/x-ms-application": {
+ "source": "apache",
+ "extensions": ["application"]
+ },
+ "application/x-ms-shortcut": {
+ "source": "apache",
+ "extensions": ["lnk"]
+ },
+ "application/x-ms-wmd": {
+ "source": "apache",
+ "extensions": ["wmd"]
+ },
+ "application/x-ms-wmz": {
+ "source": "apache",
+ "extensions": ["wmz"]
+ },
+ "application/x-ms-xbap": {
+ "source": "apache",
+ "extensions": ["xbap"]
+ },
+ "application/x-msaccess": {
+ "source": "apache",
+ "extensions": ["mdb"]
+ },
+ "application/x-msbinder": {
+ "source": "apache",
+ "extensions": ["obd"]
+ },
+ "application/x-mscardfile": {
+ "source": "apache",
+ "extensions": ["crd"]
+ },
+ "application/x-msclip": {
+ "source": "apache",
+ "extensions": ["clp"]
+ },
+ "application/x-msdownload": {
+ "source": "apache",
+ "extensions": ["exe","dll","com","bat","msi"]
+ },
+ "application/x-msmediaview": {
+ "source": "apache",
+ "extensions": ["mvb","m13","m14"]
+ },
+ "application/x-msmetafile": {
+ "source": "apache",
+ "extensions": ["wmf","wmz","emf","emz"]
+ },
+ "application/x-msmoney": {
+ "source": "apache",
+ "extensions": ["mny"]
+ },
+ "application/x-mspublisher": {
+ "source": "apache",
+ "extensions": ["pub"]
+ },
+ "application/x-msschedule": {
+ "source": "apache",
+ "extensions": ["scd"]
+ },
+ "application/x-msterminal": {
+ "source": "apache",
+ "extensions": ["trm"]
+ },
+ "application/x-mswrite": {
+ "source": "apache",
+ "extensions": ["wri"]
+ },
+ "application/x-netcdf": {
+ "source": "apache",
+ "extensions": ["nc","cdf"]
+ },
+ "application/x-nzb": {
+ "source": "apache",
+ "extensions": ["nzb"]
+ },
+ "application/x-pkcs12": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["p12","pfx"]
+ },
+ "application/x-pkcs7-certificates": {
+ "source": "apache",
+ "extensions": ["p7b","spc"]
+ },
+ "application/x-pkcs7-certreqresp": {
+ "source": "apache",
+ "extensions": ["p7r"]
+ },
+ "application/x-rar-compressed": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["rar"]
+ },
+ "application/x-research-info-systems": {
+ "source": "apache",
+ "extensions": ["ris"]
+ },
+ "application/x-sh": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["sh"]
+ },
+ "application/x-shar": {
+ "source": "apache",
+ "extensions": ["shar"]
+ },
+ "application/x-shockwave-flash": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["swf"]
+ },
+ "application/x-silverlight-app": {
+ "source": "apache",
+ "extensions": ["xap"]
+ },
+ "application/x-sql": {
+ "source": "apache",
+ "extensions": ["sql"]
+ },
+ "application/x-stuffit": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["sit"]
+ },
+ "application/x-stuffitx": {
+ "source": "apache",
+ "extensions": ["sitx"]
+ },
+ "application/x-subrip": {
+ "source": "apache",
+ "extensions": ["srt"]
+ },
+ "application/x-sv4cpio": {
+ "source": "apache",
+ "extensions": ["sv4cpio"]
+ },
+ "application/x-sv4crc": {
+ "source": "apache",
+ "extensions": ["sv4crc"]
+ },
+ "application/x-t3vm-image": {
+ "source": "apache",
+ "extensions": ["t3"]
+ },
+ "application/x-tads": {
+ "source": "apache",
+ "extensions": ["gam"]
+ },
+ "application/x-tar": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["tar"]
+ },
+ "application/x-tcl": {
+ "source": "apache",
+ "extensions": ["tcl"]
+ },
+ "application/x-tex": {
+ "source": "apache",
+ "extensions": ["tex"]
+ },
+ "application/x-tex-tfm": {
+ "source": "apache",
+ "extensions": ["tfm"]
+ },
+ "application/x-texinfo": {
+ "source": "apache",
+ "extensions": ["texinfo","texi"]
+ },
+ "application/x-tgif": {
+ "source": "apache",
+ "extensions": ["obj"]
+ },
+ "application/x-ustar": {
+ "source": "apache",
+ "extensions": ["ustar"]
+ },
+ "application/x-wais-source": {
+ "source": "apache",
+ "extensions": ["src"]
+ },
+ "application/x-web-app-manifest+json": {
+ "compressible": true,
+ "extensions": ["webapp"]
+ },
+ "application/x-www-form-urlencoded": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/x-x509-ca-cert": {
+ "source": "apache",
+ "extensions": ["der","crt"]
+ },
+ "application/x-xfig": {
+ "source": "apache",
+ "extensions": ["fig"]
+ },
+ "application/x-xliff+xml": {
+ "source": "apache",
+ "extensions": ["xlf"]
+ },
+ "application/x-xpinstall": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["xpi"]
+ },
+ "application/x-xz": {
+ "source": "apache",
+ "extensions": ["xz"]
+ },
+ "application/x-zmachine": {
+ "source": "apache",
+ "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"]
+ },
+ "application/x400-bp": {
+ "source": "iana"
+ },
+ "application/xacml+xml": {
+ "source": "iana"
+ },
+ "application/xaml+xml": {
+ "source": "apache",
+ "extensions": ["xaml"]
+ },
+ "application/xcap-att+xml": {
+ "source": "iana"
+ },
+ "application/xcap-caps+xml": {
+ "source": "iana"
+ },
+ "application/xcap-diff+xml": {
+ "source": "iana",
+ "extensions": ["xdf"]
+ },
+ "application/xcap-el+xml": {
+ "source": "iana"
+ },
+ "application/xcap-error+xml": {
+ "source": "iana"
+ },
+ "application/xcap-ns+xml": {
+ "source": "iana"
+ },
+ "application/xcon-conference-info+xml": {
+ "source": "iana"
+ },
+ "application/xcon-conference-info-diff+xml": {
+ "source": "iana"
+ },
+ "application/xenc+xml": {
+ "source": "iana",
+ "extensions": ["xenc"]
+ },
+ "application/xhtml+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["xhtml","xht"]
+ },
+ "application/xhtml-voice+xml": {
+ "source": "iana"
+ },
+ "application/xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["xml","xsl","xsd"]
+ },
+ "application/xml-dtd": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["dtd"]
+ },
+ "application/xml-external-parsed-entity": {
+ "source": "iana"
+ },
+ "application/xml-patch+xml": {
+ "source": "iana"
+ },
+ "application/xmpp+xml": {
+ "source": "iana"
+ },
+ "application/xop+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["xop"]
+ },
+ "application/xproc+xml": {
+ "source": "apache",
+ "extensions": ["xpl"]
+ },
+ "application/xslt+xml": {
+ "source": "iana",
+ "extensions": ["xslt"]
+ },
+ "application/xspf+xml": {
+ "source": "apache",
+ "extensions": ["xspf"]
+ },
+ "application/xv+xml": {
+ "source": "iana",
+ "extensions": ["mxml","xhvml","xvml","xvm"]
+ },
+ "application/yang": {
+ "source": "iana",
+ "extensions": ["yang"]
+ },
+ "application/yin+xml": {
+ "source": "iana",
+ "extensions": ["yin"]
+ },
+ "application/zip": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["zip"]
+ },
+ "application/zlib": {
+ "source": "iana"
+ },
+ "audio/1d-interleaved-parityfec": {
+ "source": "iana"
+ },
+ "audio/32kadpcm": {
+ "source": "iana"
+ },
+ "audio/3gpp": {
+ "source": "iana"
+ },
+ "audio/3gpp2": {
+ "source": "iana"
+ },
+ "audio/ac3": {
+ "source": "iana"
+ },
+ "audio/adpcm": {
+ "source": "apache",
+ "extensions": ["adp"]
+ },
+ "audio/amr": {
+ "source": "iana"
+ },
+ "audio/amr-wb": {
+ "source": "iana"
+ },
+ "audio/amr-wb+": {
+ "source": "iana"
+ },
+ "audio/aptx": {
+ "source": "iana"
+ },
+ "audio/asc": {
+ "source": "iana"
+ },
+ "audio/atrac-advanced-lossless": {
+ "source": "iana"
+ },
+ "audio/atrac-x": {
+ "source": "iana"
+ },
+ "audio/atrac3": {
+ "source": "iana"
+ },
+ "audio/basic": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["au","snd"]
+ },
+ "audio/bv16": {
+ "source": "iana"
+ },
+ "audio/bv32": {
+ "source": "iana"
+ },
+ "audio/clearmode": {
+ "source": "iana"
+ },
+ "audio/cn": {
+ "source": "iana"
+ },
+ "audio/dat12": {
+ "source": "iana"
+ },
+ "audio/dls": {
+ "source": "iana"
+ },
+ "audio/dsr-es201108": {
+ "source": "iana"
+ },
+ "audio/dsr-es202050": {
+ "source": "iana"
+ },
+ "audio/dsr-es202211": {
+ "source": "iana"
+ },
+ "audio/dsr-es202212": {
+ "source": "iana"
+ },
+ "audio/dv": {
+ "source": "iana"
+ },
+ "audio/dvi4": {
+ "source": "iana"
+ },
+ "audio/eac3": {
+ "source": "iana"
+ },
+ "audio/encaprtp": {
+ "source": "iana"
+ },
+ "audio/evrc": {
+ "source": "iana"
+ },
+ "audio/evrc-qcp": {
+ "source": "iana"
+ },
+ "audio/evrc0": {
+ "source": "iana"
+ },
+ "audio/evrc1": {
+ "source": "iana"
+ },
+ "audio/evrcb": {
+ "source": "iana"
+ },
+ "audio/evrcb0": {
+ "source": "iana"
+ },
+ "audio/evrcb1": {
+ "source": "iana"
+ },
+ "audio/evrcnw": {
+ "source": "iana"
+ },
+ "audio/evrcnw0": {
+ "source": "iana"
+ },
+ "audio/evrcnw1": {
+ "source": "iana"
+ },
+ "audio/evrcwb": {
+ "source": "iana"
+ },
+ "audio/evrcwb0": {
+ "source": "iana"
+ },
+ "audio/evrcwb1": {
+ "source": "iana"
+ },
+ "audio/fwdred": {
+ "source": "iana"
+ },
+ "audio/g719": {
+ "source": "iana"
+ },
+ "audio/g722": {
+ "source": "iana"
+ },
+ "audio/g7221": {
+ "source": "iana"
+ },
+ "audio/g723": {
+ "source": "iana"
+ },
+ "audio/g726-16": {
+ "source": "iana"
+ },
+ "audio/g726-24": {
+ "source": "iana"
+ },
+ "audio/g726-32": {
+ "source": "iana"
+ },
+ "audio/g726-40": {
+ "source": "iana"
+ },
+ "audio/g728": {
+ "source": "iana"
+ },
+ "audio/g729": {
+ "source": "iana"
+ },
+ "audio/g7291": {
+ "source": "iana"
+ },
+ "audio/g729d": {
+ "source": "iana"
+ },
+ "audio/g729e": {
+ "source": "iana"
+ },
+ "audio/gsm": {
+ "source": "iana"
+ },
+ "audio/gsm-efr": {
+ "source": "iana"
+ },
+ "audio/gsm-hr-08": {
+ "source": "iana"
+ },
+ "audio/ilbc": {
+ "source": "iana"
+ },
+ "audio/ip-mr_v2.5": {
+ "source": "iana"
+ },
+ "audio/isac": {
+ "source": "apache"
+ },
+ "audio/l16": {
+ "source": "iana"
+ },
+ "audio/l20": {
+ "source": "iana"
+ },
+ "audio/l24": {
+ "source": "iana",
+ "compressible": false
+ },
+ "audio/l8": {
+ "source": "iana"
+ },
+ "audio/lpc": {
+ "source": "iana"
+ },
+ "audio/midi": {
+ "source": "apache",
+ "extensions": ["mid","midi","kar","rmi"]
+ },
+ "audio/mobile-xmf": {
+ "source": "iana"
+ },
+ "audio/mp4": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["mp4a","m4a"]
+ },
+ "audio/mp4a-latm": {
+ "source": "iana"
+ },
+ "audio/mpa": {
+ "source": "iana"
+ },
+ "audio/mpa-robust": {
+ "source": "iana"
+ },
+ "audio/mpeg": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"]
+ },
+ "audio/mpeg4-generic": {
+ "source": "iana"
+ },
+ "audio/musepack": {
+ "source": "apache"
+ },
+ "audio/ogg": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["oga","ogg","spx"]
+ },
+ "audio/opus": {
+ "source": "apache"
+ },
+ "audio/parityfec": {
+ "source": "iana"
+ },
+ "audio/pcma": {
+ "source": "iana"
+ },
+ "audio/pcma-wb": {
+ "source": "iana"
+ },
+ "audio/pcmu": {
+ "source": "iana"
+ },
+ "audio/pcmu-wb": {
+ "source": "iana"
+ },
+ "audio/prs.sid": {
+ "source": "iana"
+ },
+ "audio/qcelp": {
+ "source": "iana"
+ },
+ "audio/raptorfec": {
+ "source": "iana"
+ },
+ "audio/red": {
+ "source": "iana"
+ },
+ "audio/rtp-enc-aescm128": {
+ "source": "iana"
+ },
+ "audio/rtp-midi": {
+ "source": "iana"
+ },
+ "audio/rtploopback": {
+ "source": "iana"
+ },
+ "audio/rtx": {
+ "source": "iana"
+ },
+ "audio/s3m": {
+ "source": "apache",
+ "extensions": ["s3m"]
+ },
+ "audio/silk": {
+ "source": "apache",
+ "extensions": ["sil"]
+ },
+ "audio/smv": {
+ "source": "iana"
+ },
+ "audio/smv-qcp": {
+ "source": "iana"
+ },
+ "audio/smv0": {
+ "source": "iana"
+ },
+ "audio/sp-midi": {
+ "source": "iana"
+ },
+ "audio/speex": {
+ "source": "iana"
+ },
+ "audio/t140c": {
+ "source": "iana"
+ },
+ "audio/t38": {
+ "source": "iana"
+ },
+ "audio/telephone-event": {
+ "source": "iana"
+ },
+ "audio/tone": {
+ "source": "iana"
+ },
+ "audio/uemclip": {
+ "source": "iana"
+ },
+ "audio/ulpfec": {
+ "source": "iana"
+ },
+ "audio/vdvi": {
+ "source": "iana"
+ },
+ "audio/vmr-wb": {
+ "source": "iana"
+ },
+ "audio/vnd.3gpp.iufp": {
+ "source": "iana"
+ },
+ "audio/vnd.4sb": {
+ "source": "iana"
+ },
+ "audio/vnd.audiokoz": {
+ "source": "iana"
+ },
+ "audio/vnd.celp": {
+ "source": "iana"
+ },
+ "audio/vnd.cisco.nse": {
+ "source": "iana"
+ },
+ "audio/vnd.cmles.radio-events": {
+ "source": "iana"
+ },
+ "audio/vnd.cns.anp1": {
+ "source": "iana"
+ },
+ "audio/vnd.cns.inf1": {
+ "source": "iana"
+ },
+ "audio/vnd.dece.audio": {
+ "source": "iana",
+ "extensions": ["uva","uvva"]
+ },
+ "audio/vnd.digital-winds": {
+ "source": "iana",
+ "extensions": ["eol"]
+ },
+ "audio/vnd.dlna.adts": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.heaac.1": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.heaac.2": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.mlp": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.mps": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.pl2": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.pl2x": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.pl2z": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.pulse.1": {
+ "source": "iana"
+ },
+ "audio/vnd.dra": {
+ "source": "iana",
+ "extensions": ["dra"]
+ },
+ "audio/vnd.dts": {
+ "source": "iana",
+ "extensions": ["dts"]
+ },
+ "audio/vnd.dts.hd": {
+ "source": "iana",
+ "extensions": ["dtshd"]
+ },
+ "audio/vnd.dvb.file": {
+ "source": "iana"
+ },
+ "audio/vnd.everad.plj": {
+ "source": "iana"
+ },
+ "audio/vnd.hns.audio": {
+ "source": "iana"
+ },
+ "audio/vnd.lucent.voice": {
+ "source": "iana",
+ "extensions": ["lvp"]
+ },
+ "audio/vnd.ms-playready.media.pya": {
+ "source": "iana",
+ "extensions": ["pya"]
+ },
+ "audio/vnd.nokia.mobile-xmf": {
+ "source": "iana"
+ },
+ "audio/vnd.nortel.vbk": {
+ "source": "iana"
+ },
+ "audio/vnd.nuera.ecelp4800": {
+ "source": "iana",
+ "extensions": ["ecelp4800"]
+ },
+ "audio/vnd.nuera.ecelp7470": {
+ "source": "iana",
+ "extensions": ["ecelp7470"]
+ },
+ "audio/vnd.nuera.ecelp9600": {
+ "source": "iana",
+ "extensions": ["ecelp9600"]
+ },
+ "audio/vnd.octel.sbc": {
+ "source": "iana"
+ },
+ "audio/vnd.qcelp": {
+ "source": "iana"
+ },
+ "audio/vnd.rhetorex.32kadpcm": {
+ "source": "iana"
+ },
+ "audio/vnd.rip": {
+ "source": "iana",
+ "extensions": ["rip"]
+ },
+ "audio/vnd.rn-realaudio": {
+ "compressible": false
+ },
+ "audio/vnd.sealedmedia.softseal.mpeg": {
+ "source": "iana"
+ },
+ "audio/vnd.vmx.cvsd": {
+ "source": "iana"
+ },
+ "audio/vnd.wave": {
+ "compressible": false
+ },
+ "audio/vorbis": {
+ "source": "iana",
+ "compressible": false
+ },
+ "audio/vorbis-config": {
+ "source": "iana"
+ },
+ "audio/webm": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["weba"]
+ },
+ "audio/x-aac": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["aac"]
+ },
+ "audio/x-aiff": {
+ "source": "apache",
+ "extensions": ["aif","aiff","aifc"]
+ },
+ "audio/x-caf": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["caf"]
+ },
+ "audio/x-flac": {
+ "source": "apache",
+ "extensions": ["flac"]
+ },
+ "audio/x-matroska": {
+ "source": "apache",
+ "extensions": ["mka"]
+ },
+ "audio/x-mpegurl": {
+ "source": "apache",
+ "extensions": ["m3u"]
+ },
+ "audio/x-ms-wax": {
+ "source": "apache",
+ "extensions": ["wax"]
+ },
+ "audio/x-ms-wma": {
+ "source": "apache",
+ "extensions": ["wma"]
+ },
+ "audio/x-pn-realaudio": {
+ "source": "apache",
+ "extensions": ["ram","ra"]
+ },
+ "audio/x-pn-realaudio-plugin": {
+ "source": "apache",
+ "extensions": ["rmp"]
+ },
+ "audio/x-tta": {
+ "source": "apache"
+ },
+ "audio/x-wav": {
+ "source": "apache",
+ "extensions": ["wav"]
+ },
+ "audio/xm": {
+ "source": "apache",
+ "extensions": ["xm"]
+ },
+ "chemical/x-cdx": {
+ "source": "apache",
+ "extensions": ["cdx"]
+ },
+ "chemical/x-cif": {
+ "source": "apache",
+ "extensions": ["cif"]
+ },
+ "chemical/x-cmdf": {
+ "source": "apache",
+ "extensions": ["cmdf"]
+ },
+ "chemical/x-cml": {
+ "source": "apache",
+ "extensions": ["cml"]
+ },
+ "chemical/x-csml": {
+ "source": "apache",
+ "extensions": ["csml"]
+ },
+ "chemical/x-pdb": {
+ "source": "apache"
+ },
+ "chemical/x-xyz": {
+ "source": "apache",
+ "extensions": ["xyz"]
+ },
+ "font/opentype": {
+ "compressible": true,
+ "extensions": ["otf"]
+ },
+ "image/bmp": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["bmp"]
+ },
+ "image/cgm": {
+ "source": "iana",
+ "extensions": ["cgm"]
+ },
+ "image/fits": {
+ "source": "iana"
+ },
+ "image/g3fax": {
+ "source": "iana",
+ "extensions": ["g3"]
+ },
+ "image/gif": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["gif"]
+ },
+ "image/ief": {
+ "source": "iana",
+ "extensions": ["ief"]
+ },
+ "image/jp2": {
+ "source": "iana"
+ },
+ "image/jpeg": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["jpeg","jpg","jpe"]
+ },
+ "image/jpm": {
+ "source": "iana"
+ },
+ "image/jpx": {
+ "source": "iana"
+ },
+ "image/ktx": {
+ "source": "iana",
+ "extensions": ["ktx"]
+ },
+ "image/naplps": {
+ "source": "iana"
+ },
+ "image/pjpeg": {
+ "compressible": false
+ },
+ "image/png": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["png"]
+ },
+ "image/prs.btif": {
+ "source": "iana",
+ "extensions": ["btif"]
+ },
+ "image/prs.pti": {
+ "source": "iana"
+ },
+ "image/pwg-raster": {
+ "source": "iana"
+ },
+ "image/sgi": {
+ "source": "apache",
+ "extensions": ["sgi"]
+ },
+ "image/svg+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["svg","svgz"]
+ },
+ "image/t38": {
+ "source": "iana"
+ },
+ "image/tiff": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["tiff","tif"]
+ },
+ "image/tiff-fx": {
+ "source": "iana"
+ },
+ "image/vnd.adobe.photoshop": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["psd"]
+ },
+ "image/vnd.airzip.accelerator.azv": {
+ "source": "iana"
+ },
+ "image/vnd.cns.inf2": {
+ "source": "iana"
+ },
+ "image/vnd.dece.graphic": {
+ "source": "iana",
+ "extensions": ["uvi","uvvi","uvg","uvvg"]
+ },
+ "image/vnd.djvu": {
+ "source": "iana",
+ "extensions": ["djvu","djv"]
+ },
+ "image/vnd.dvb.subtitle": {
+ "source": "iana",
+ "extensions": ["sub"]
+ },
+ "image/vnd.dwg": {
+ "source": "iana",
+ "extensions": ["dwg"]
+ },
+ "image/vnd.dxf": {
+ "source": "iana",
+ "extensions": ["dxf"]
+ },
+ "image/vnd.fastbidsheet": {
+ "source": "iana",
+ "extensions": ["fbs"]
+ },
+ "image/vnd.fpx": {
+ "source": "iana",
+ "extensions": ["fpx"]
+ },
+ "image/vnd.fst": {
+ "source": "iana",
+ "extensions": ["fst"]
+ },
+ "image/vnd.fujixerox.edmics-mmr": {
+ "source": "iana",
+ "extensions": ["mmr"]
+ },
+ "image/vnd.fujixerox.edmics-rlc": {
+ "source": "iana",
+ "extensions": ["rlc"]
+ },
+ "image/vnd.globalgraphics.pgb": {
+ "source": "iana"
+ },
+ "image/vnd.microsoft.icon": {
+ "source": "iana"
+ },
+ "image/vnd.mix": {
+ "source": "iana"
+ },
+ "image/vnd.ms-modi": {
+ "source": "iana",
+ "extensions": ["mdi"]
+ },
+ "image/vnd.ms-photo": {
+ "source": "apache",
+ "extensions": ["wdp"]
+ },
+ "image/vnd.net-fpx": {
+ "source": "iana",
+ "extensions": ["npx"]
+ },
+ "image/vnd.radiance": {
+ "source": "iana"
+ },
+ "image/vnd.sealed.png": {
+ "source": "iana"
+ },
+ "image/vnd.sealedmedia.softseal.gif": {
+ "source": "iana"
+ },
+ "image/vnd.sealedmedia.softseal.jpg": {
+ "source": "iana"
+ },
+ "image/vnd.svf": {
+ "source": "iana"
+ },
+ "image/vnd.tencent.tap": {
+ "source": "iana"
+ },
+ "image/vnd.valve.source.texture": {
+ "source": "iana"
+ },
+ "image/vnd.wap.wbmp": {
+ "source": "iana",
+ "extensions": ["wbmp"]
+ },
+ "image/vnd.xiff": {
+ "source": "iana",
+ "extensions": ["xif"]
+ },
+ "image/webp": {
+ "source": "apache",
+ "extensions": ["webp"]
+ },
+ "image/x-3ds": {
+ "source": "apache",
+ "extensions": ["3ds"]
+ },
+ "image/x-cmu-raster": {
+ "source": "apache",
+ "extensions": ["ras"]
+ },
+ "image/x-cmx": {
+ "source": "apache",
+ "extensions": ["cmx"]
+ },
+ "image/x-freehand": {
+ "source": "apache",
+ "extensions": ["fh","fhc","fh4","fh5","fh7"]
+ },
+ "image/x-icon": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["ico"]
+ },
+ "image/x-mrsid-image": {
+ "source": "apache",
+ "extensions": ["sid"]
+ },
+ "image/x-pcx": {
+ "source": "apache",
+ "extensions": ["pcx"]
+ },
+ "image/x-pict": {
+ "source": "apache",
+ "extensions": ["pic","pct"]
+ },
+ "image/x-portable-anymap": {
+ "source": "apache",
+ "extensions": ["pnm"]
+ },
+ "image/x-portable-bitmap": {
+ "source": "apache",
+ "extensions": ["pbm"]
+ },
+ "image/x-portable-graymap": {
+ "source": "apache",
+ "extensions": ["pgm"]
+ },
+ "image/x-portable-pixmap": {
+ "source": "apache",
+ "extensions": ["ppm"]
+ },
+ "image/x-rgb": {
+ "source": "apache",
+ "extensions": ["rgb"]
+ },
+ "image/x-tga": {
+ "source": "apache",
+ "extensions": ["tga"]
+ },
+ "image/x-xbitmap": {
+ "source": "apache",
+ "extensions": ["xbm"]
+ },
+ "image/x-xcf": {
+ "compressible": false
+ },
+ "image/x-xpixmap": {
+ "source": "apache",
+ "extensions": ["xpm"]
+ },
+ "image/x-xwindowdump": {
+ "source": "apache",
+ "extensions": ["xwd"]
+ },
+ "message/cpim": {
+ "source": "iana"
+ },
+ "message/delivery-status": {
+ "source": "iana"
+ },
+ "message/disposition-notification": {
+ "source": "iana"
+ },
+ "message/external-body": {
+ "source": "iana"
+ },
+ "message/feedback-report": {
+ "source": "iana"
+ },
+ "message/global": {
+ "source": "iana"
+ },
+ "message/global-delivery-status": {
+ "source": "iana"
+ },
+ "message/global-disposition-notification": {
+ "source": "iana"
+ },
+ "message/global-headers": {
+ "source": "iana"
+ },
+ "message/http": {
+ "source": "iana",
+ "compressible": false
+ },
+ "message/imdn+xml": {
+ "source": "iana",
+ "compressible": true
+ },
+ "message/news": {
+ "source": "iana"
+ },
+ "message/partial": {
+ "source": "iana",
+ "compressible": false
+ },
+ "message/rfc822": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["eml","mime"]
+ },
+ "message/s-http": {
+ "source": "iana"
+ },
+ "message/sip": {
+ "source": "iana"
+ },
+ "message/sipfrag": {
+ "source": "iana"
+ },
+ "message/tracking-status": {
+ "source": "iana"
+ },
+ "message/vnd.si.simp": {
+ "source": "iana"
+ },
+ "message/vnd.wfa.wsc": {
+ "source": "iana"
+ },
+ "model/iges": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["igs","iges"]
+ },
+ "model/mesh": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["msh","mesh","silo"]
+ },
+ "model/vnd.collada+xml": {
+ "source": "iana",
+ "extensions": ["dae"]
+ },
+ "model/vnd.dwf": {
+ "source": "iana",
+ "extensions": ["dwf"]
+ },
+ "model/vnd.flatland.3dml": {
+ "source": "iana"
+ },
+ "model/vnd.gdl": {
+ "source": "iana",
+ "extensions": ["gdl"]
+ },
+ "model/vnd.gs-gdl": {
+ "source": "apache"
+ },
+ "model/vnd.gs.gdl": {
+ "source": "iana"
+ },
+ "model/vnd.gtw": {
+ "source": "iana",
+ "extensions": ["gtw"]
+ },
+ "model/vnd.moml+xml": {
+ "source": "iana"
+ },
+ "model/vnd.mts": {
+ "source": "iana",
+ "extensions": ["mts"]
+ },
+ "model/vnd.opengex": {
+ "source": "iana"
+ },
+ "model/vnd.parasolid.transmit.binary": {
+ "source": "iana"
+ },
+ "model/vnd.parasolid.transmit.text": {
+ "source": "iana"
+ },
+ "model/vnd.valve.source.compiled-map": {
+ "source": "iana"
+ },
+ "model/vnd.vtu": {
+ "source": "iana",
+ "extensions": ["vtu"]
+ },
+ "model/vrml": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["wrl","vrml"]
+ },
+ "model/x3d+binary": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["x3db","x3dbz"]
+ },
+ "model/x3d+fastinfoset": {
+ "source": "iana"
+ },
+ "model/x3d+vrml": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["x3dv","x3dvz"]
+ },
+ "model/x3d+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["x3d","x3dz"]
+ },
+ "model/x3d-vrml": {
+ "source": "iana"
+ },
+ "multipart/alternative": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/appledouble": {
+ "source": "iana"
+ },
+ "multipart/byteranges": {
+ "source": "iana"
+ },
+ "multipart/digest": {
+ "source": "iana"
+ },
+ "multipart/encrypted": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/form-data": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/header-set": {
+ "source": "iana"
+ },
+ "multipart/mixed": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/parallel": {
+ "source": "iana"
+ },
+ "multipart/related": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/report": {
+ "source": "iana"
+ },
+ "multipart/signed": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/voice-message": {
+ "source": "iana"
+ },
+ "multipart/x-mixed-replace": {
+ "source": "iana"
+ },
+ "text/1d-interleaved-parityfec": {
+ "source": "iana"
+ },
+ "text/cache-manifest": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["appcache","manifest"]
+ },
+ "text/calendar": {
+ "source": "iana",
+ "extensions": ["ics","ifb"]
+ },
+ "text/calender": {
+ "compressible": true
+ },
+ "text/cmd": {
+ "compressible": true
+ },
+ "text/coffeescript": {
+ "extensions": ["coffee"]
+ },
+ "text/css": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["css"]
+ },
+ "text/csv": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["csv"]
+ },
+ "text/csv-schema": {
+ "source": "iana"
+ },
+ "text/directory": {
+ "source": "iana"
+ },
+ "text/dns": {
+ "source": "iana"
+ },
+ "text/ecmascript": {
+ "source": "iana"
+ },
+ "text/encaprtp": {
+ "source": "iana"
+ },
+ "text/enriched": {
+ "source": "iana"
+ },
+ "text/fwdred": {
+ "source": "iana"
+ },
+ "text/grammar-ref-list": {
+ "source": "iana"
+ },
+ "text/hjson": {
+ "extensions": ["hjson"]
+ },
+ "text/html": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["html","htm"]
+ },
+ "text/jade": {
+ "extensions": ["jade"]
+ },
+ "text/javascript": {
+ "source": "iana",
+ "compressible": true
+ },
+ "text/jcr-cnd": {
+ "source": "iana"
+ },
+ "text/jsx": {
+ "compressible": true,
+ "extensions": ["jsx"]
+ },
+ "text/less": {
+ "extensions": ["less"]
+ },
+ "text/markdown": {
+ "source": "iana"
+ },
+ "text/mizar": {
+ "source": "iana"
+ },
+ "text/n3": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["n3"]
+ },
+ "text/parameters": {
+ "source": "iana"
+ },
+ "text/parityfec": {
+ "source": "iana"
+ },
+ "text/plain": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["txt","text","conf","def","list","log","in","ini"]
+ },
+ "text/provenance-notation": {
+ "source": "iana"
+ },
+ "text/prs.fallenstein.rst": {
+ "source": "iana"
+ },
+ "text/prs.lines.tag": {
+ "source": "iana",
+ "extensions": ["dsc"]
+ },
+ "text/raptorfec": {
+ "source": "iana"
+ },
+ "text/red": {
+ "source": "iana"
+ },
+ "text/rfc822-headers": {
+ "source": "iana"
+ },
+ "text/richtext": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["rtx"]
+ },
+ "text/rtf": {
+ "source": "iana"
+ },
+ "text/rtp-enc-aescm128": {
+ "source": "iana"
+ },
+ "text/rtploopback": {
+ "source": "iana"
+ },
+ "text/rtx": {
+ "source": "iana"
+ },
+ "text/sgml": {
+ "source": "iana",
+ "extensions": ["sgml","sgm"]
+ },
+ "text/stylus": {
+ "extensions": ["stylus","styl"]
+ },
+ "text/t140": {
+ "source": "iana"
+ },
+ "text/tab-separated-values": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["tsv"]
+ },
+ "text/troff": {
+ "source": "iana",
+ "extensions": ["t","tr","roff","man","me","ms"]
+ },
+ "text/turtle": {
+ "source": "iana",
+ "extensions": ["ttl"]
+ },
+ "text/ulpfec": {
+ "source": "iana"
+ },
+ "text/uri-list": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["uri","uris","urls"]
+ },
+ "text/vcard": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["vcard"]
+ },
+ "text/vnd.a": {
+ "source": "iana"
+ },
+ "text/vnd.abc": {
+ "source": "iana"
+ },
+ "text/vnd.curl": {
+ "source": "iana",
+ "extensions": ["curl"]
+ },
+ "text/vnd.curl.dcurl": {
+ "source": "apache",
+ "extensions": ["dcurl"]
+ },
+ "text/vnd.curl.mcurl": {
+ "source": "apache",
+ "extensions": ["mcurl"]
+ },
+ "text/vnd.curl.scurl": {
+ "source": "apache",
+ "extensions": ["scurl"]
+ },
+ "text/vnd.debian.copyright": {
+ "source": "iana"
+ },
+ "text/vnd.dmclientscript": {
+ "source": "iana"
+ },
+ "text/vnd.dvb.subtitle": {
+ "source": "iana",
+ "extensions": ["sub"]
+ },
+ "text/vnd.esmertec.theme-descriptor": {
+ "source": "iana"
+ },
+ "text/vnd.fly": {
+ "source": "iana",
+ "extensions": ["fly"]
+ },
+ "text/vnd.fmi.flexstor": {
+ "source": "iana",
+ "extensions": ["flx"]
+ },
+ "text/vnd.graphviz": {
+ "source": "iana",
+ "extensions": ["gv"]
+ },
+ "text/vnd.in3d.3dml": {
+ "source": "iana",
+ "extensions": ["3dml"]
+ },
+ "text/vnd.in3d.spot": {
+ "source": "iana",
+ "extensions": ["spot"]
+ },
+ "text/vnd.iptc.newsml": {
+ "source": "iana"
+ },
+ "text/vnd.iptc.nitf": {
+ "source": "iana"
+ },
+ "text/vnd.latex-z": {
+ "source": "iana"
+ },
+ "text/vnd.motorola.reflex": {
+ "source": "iana"
+ },
+ "text/vnd.ms-mediapackage": {
+ "source": "iana"
+ },
+ "text/vnd.net2phone.commcenter.command": {
+ "source": "iana"
+ },
+ "text/vnd.radisys.msml-basic-layout": {
+ "source": "iana"
+ },
+ "text/vnd.si.uricatalogue": {
+ "source": "iana"
+ },
+ "text/vnd.sun.j2me.app-descriptor": {
+ "source": "iana",
+ "extensions": ["jad"]
+ },
+ "text/vnd.trolltech.linguist": {
+ "source": "iana"
+ },
+ "text/vnd.wap.si": {
+ "source": "iana"
+ },
+ "text/vnd.wap.sl": {
+ "source": "iana"
+ },
+ "text/vnd.wap.wml": {
+ "source": "iana",
+ "extensions": ["wml"]
+ },
+ "text/vnd.wap.wmlscript": {
+ "source": "iana",
+ "extensions": ["wmls"]
+ },
+ "text/vtt": {
+ "charset": "UTF-8",
+ "compressible": true,
+ "extensions": ["vtt"]
+ },
+ "text/x-asm": {
+ "source": "apache",
+ "extensions": ["s","asm"]
+ },
+ "text/x-c": {
+ "source": "apache",
+ "extensions": ["c","cc","cxx","cpp","h","hh","dic"]
+ },
+ "text/x-component": {
+ "extensions": ["htc"]
+ },
+ "text/x-fortran": {
+ "source": "apache",
+ "extensions": ["f","for","f77","f90"]
+ },
+ "text/x-gwt-rpc": {
+ "compressible": true
+ },
+ "text/x-handlebars-template": {
+ "extensions": ["hbs"]
+ },
+ "text/x-java-source": {
+ "source": "apache",
+ "extensions": ["java"]
+ },
+ "text/x-jquery-tmpl": {
+ "compressible": true
+ },
+ "text/x-lua": {
+ "extensions": ["lua"]
+ },
+ "text/x-markdown": {
+ "compressible": true,
+ "extensions": ["markdown","md","mkd"]
+ },
+ "text/x-nfo": {
+ "source": "apache",
+ "extensions": ["nfo"]
+ },
+ "text/x-opml": {
+ "source": "apache",
+ "extensions": ["opml"]
+ },
+ "text/x-pascal": {
+ "source": "apache",
+ "extensions": ["p","pas"]
+ },
+ "text/x-sass": {
+ "extensions": ["sass"]
+ },
+ "text/x-scss": {
+ "extensions": ["scss"]
+ },
+ "text/x-setext": {
+ "source": "apache",
+ "extensions": ["etx"]
+ },
+ "text/x-sfv": {
+ "source": "apache",
+ "extensions": ["sfv"]
+ },
+ "text/x-uuencode": {
+ "source": "apache",
+ "extensions": ["uu"]
+ },
+ "text/x-vcalendar": {
+ "source": "apache",
+ "extensions": ["vcs"]
+ },
+ "text/x-vcard": {
+ "source": "apache",
+ "extensions": ["vcf"]
+ },
+ "text/xml": {
+ "source": "iana",
+ "compressible": true
+ },
+ "text/xml-external-parsed-entity": {
+ "source": "iana"
+ },
+ "text/yaml": {
+ "extensions": ["yaml","yml"]
+ },
+ "video/1d-interleaved-parityfec": {
+ "source": "apache"
+ },
+ "video/3gpp": {
+ "source": "apache",
+ "extensions": ["3gp"]
+ },
+ "video/3gpp-tt": {
+ "source": "apache"
+ },
+ "video/3gpp2": {
+ "source": "apache",
+ "extensions": ["3g2"]
+ },
+ "video/bmpeg": {
+ "source": "apache"
+ },
+ "video/bt656": {
+ "source": "apache"
+ },
+ "video/celb": {
+ "source": "apache"
+ },
+ "video/dv": {
+ "source": "apache"
+ },
+ "video/h261": {
+ "source": "apache",
+ "extensions": ["h261"]
+ },
+ "video/h263": {
+ "source": "apache",
+ "extensions": ["h263"]
+ },
+ "video/h263-1998": {
+ "source": "apache"
+ },
+ "video/h263-2000": {
+ "source": "apache"
+ },
+ "video/h264": {
+ "source": "apache",
+ "extensions": ["h264"]
+ },
+ "video/h264-rcdo": {
+ "source": "apache"
+ },
+ "video/h264-svc": {
+ "source": "apache"
+ },
+ "video/jpeg": {
+ "source": "apache",
+ "extensions": ["jpgv"]
+ },
+ "video/jpeg2000": {
+ "source": "apache"
+ },
+ "video/jpm": {
+ "source": "apache",
+ "extensions": ["jpm","jpgm"]
+ },
+ "video/mj2": {
+ "source": "apache",
+ "extensions": ["mj2","mjp2"]
+ },
+ "video/mp1s": {
+ "source": "apache"
+ },
+ "video/mp2p": {
+ "source": "apache"
+ },
+ "video/mp2t": {
+ "source": "apache",
+ "extensions": ["ts"]
+ },
+ "video/mp4": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["mp4","mp4v","mpg4"]
+ },
+ "video/mp4v-es": {
+ "source": "apache"
+ },
+ "video/mpeg": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["mpeg","mpg","mpe","m1v","m2v"]
+ },
+ "video/mpeg4-generic": {
+ "source": "apache"
+ },
+ "video/mpv": {
+ "source": "apache"
+ },
+ "video/nv": {
+ "source": "apache"
+ },
+ "video/ogg": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["ogv"]
+ },
+ "video/parityfec": {
+ "source": "apache"
+ },
+ "video/pointer": {
+ "source": "apache"
+ },
+ "video/quicktime": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["qt","mov"]
+ },
+ "video/raw": {
+ "source": "apache"
+ },
+ "video/rtp-enc-aescm128": {
+ "source": "apache"
+ },
+ "video/rtx": {
+ "source": "apache"
+ },
+ "video/smpte292m": {
+ "source": "apache"
+ },
+ "video/ulpfec": {
+ "source": "apache"
+ },
+ "video/vc1": {
+ "source": "apache"
+ },
+ "video/vnd.cctv": {
+ "source": "apache"
+ },
+ "video/vnd.dece.hd": {
+ "source": "apache",
+ "extensions": ["uvh","uvvh"]
+ },
+ "video/vnd.dece.mobile": {
+ "source": "apache",
+ "extensions": ["uvm","uvvm"]
+ },
+ "video/vnd.dece.mp4": {
+ "source": "apache"
+ },
+ "video/vnd.dece.pd": {
+ "source": "apache",
+ "extensions": ["uvp","uvvp"]
+ },
+ "video/vnd.dece.sd": {
+ "source": "apache",
+ "extensions": ["uvs","uvvs"]
+ },
+ "video/vnd.dece.video": {
+ "source": "apache",
+ "extensions": ["uvv","uvvv"]
+ },
+ "video/vnd.directv.mpeg": {
+ "source": "apache"
+ },
+ "video/vnd.directv.mpeg-tts": {
+ "source": "apache"
+ },
+ "video/vnd.dlna.mpeg-tts": {
+ "source": "apache"
+ },
+ "video/vnd.dvb.file": {
+ "source": "apache",
+ "extensions": ["dvb"]
+ },
+ "video/vnd.fvt": {
+ "source": "apache",
+ "extensions": ["fvt"]
+ },
+ "video/vnd.hns.video": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.1dparityfec-1010": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.1dparityfec-2005": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.2dparityfec-1010": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.2dparityfec-2005": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.ttsavc": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.ttsmpeg2": {
+ "source": "apache"
+ },
+ "video/vnd.motorola.video": {
+ "source": "apache"
+ },
+ "video/vnd.motorola.videop": {
+ "source": "apache"
+ },
+ "video/vnd.mpegurl": {
+ "source": "apache",
+ "extensions": ["mxu","m4u"]
+ },
+ "video/vnd.ms-playready.media.pyv": {
+ "source": "apache",
+ "extensions": ["pyv"]
+ },
+ "video/vnd.nokia.interleaved-multimedia": {
+ "source": "apache"
+ },
+ "video/vnd.nokia.videovoip": {
+ "source": "apache"
+ },
+ "video/vnd.objectvideo": {
+ "source": "apache"
+ },
+ "video/vnd.sealed.mpeg1": {
+ "source": "apache"
+ },
+ "video/vnd.sealed.mpeg4": {
+ "source": "apache"
+ },
+ "video/vnd.sealed.swf": {
+ "source": "apache"
+ },
+ "video/vnd.sealedmedia.softseal.mov": {
+ "source": "apache"
+ },
+ "video/vnd.uvvu.mp4": {
+ "source": "apache",
+ "extensions": ["uvu","uvvu"]
+ },
+ "video/vnd.vivo": {
+ "source": "apache",
+ "extensions": ["viv"]
+ },
+ "video/webm": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["webm"]
+ },
+ "video/x-f4v": {
+ "source": "apache",
+ "extensions": ["f4v"]
+ },
+ "video/x-fli": {
+ "source": "apache",
+ "extensions": ["fli"]
+ },
+ "video/x-flv": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["flv"]
+ },
+ "video/x-m4v": {
+ "source": "apache",
+ "extensions": ["m4v"]
+ },
+ "video/x-matroska": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["mkv","mk3d","mks"]
+ },
+ "video/x-mng": {
+ "source": "apache",
+ "extensions": ["mng"]
+ },
+ "video/x-ms-asf": {
+ "source": "apache",
+ "extensions": ["asf","asx"]
+ },
+ "video/x-ms-vob": {
+ "source": "apache",
+ "extensions": ["vob"]
+ },
+ "video/x-ms-wm": {
+ "source": "apache",
+ "extensions": ["wm"]
+ },
+ "video/x-ms-wmv": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["wmv"]
+ },
+ "video/x-ms-wmx": {
+ "source": "apache",
+ "extensions": ["wmx"]
+ },
+ "video/x-ms-wvx": {
+ "source": "apache",
+ "extensions": ["wvx"]
+ },
+ "video/x-msvideo": {
+ "source": "apache",
+ "extensions": ["avi"]
+ },
+ "video/x-sgi-movie": {
+ "source": "apache",
+ "extensions": ["movie"]
+ },
+ "video/x-smv": {
+ "source": "apache",
+ "extensions": ["smv"]
+ },
+ "x-conference/x-cooltalk": {
+ "source": "apache",
+ "extensions": ["ice"]
+ },
+ "x-shader/x-fragment": {
+ "compressible": true
+ },
+ "x-shader/x-vertex": {
+ "compressible": true
+ }
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/index.js b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/index.js
new file mode 100755
index 00000000..551031f6
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/index.js
@@ -0,0 +1,11 @@
+/*!
+ * mime-db
+ * Copyright(c) 2014 Jonathan Ong
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = require('./db.json')
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/package.json b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/package.json
new file mode 100755
index 00000000..70438aca
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/node_modules/mime-db/package.json
@@ -0,0 +1,93 @@
+{
+ "name": "mime-db",
+ "description": "Media Type Database",
+ "version": "1.8.0",
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ {
+ "name": "Robert Kieffer",
+ "email": "robert@broofa.com",
+ "url": "http://github.com/broofa"
+ }
+ ],
+ "license": "MIT",
+ "keywords": [
+ "mime",
+ "db",
+ "type",
+ "types",
+ "database",
+ "charset",
+ "charsets"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/mime-db"
+ },
+ "devDependencies": {
+ "bluebird": "~2.9.14",
+ "co": "~4.4.0",
+ "cogent": "1",
+ "csv-parse": "0.0.9",
+ "gnode": "0.1.1",
+ "istanbul": "0.3.7",
+ "mocha": "~1.21.4",
+ "raw-body": "~1.3.3",
+ "stream-to-array": "2"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "README.md",
+ "db.json",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "build": "node scripts/build",
+ "fetch": "gnode scripts/extensions && gnode scripts/types",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "update": "npm run fetch && npm run build"
+ },
+ "gitHead": "cd5730a475ff03d2ef49fc571d5510a548b63494",
+ "bugs": {
+ "url": "https://github.com/jshttp/mime-db/issues"
+ },
+ "homepage": "https://github.com/jshttp/mime-db",
+ "_id": "mime-db@1.8.0",
+ "_shasum": "82a9b385f22b0f5954dec4d445faba0722c4ad25",
+ "_from": "mime-db@~1.8.0",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "82a9b385f22b0f5954dec4d445faba0722c4ad25",
+ "tarball": "http://registry.npmjs.org/mime-db/-/mime-db-1.8.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.8.0.tgz"
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/mime-types/package.json b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/package.json
new file mode 100755
index 00000000..5fe0d5d1
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/mime-types/package.json
@@ -0,0 +1,83 @@
+{
+ "name": "mime-types",
+ "description": "The ultimate javascript content-type utility.",
+ "version": "2.0.10",
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jeremiah Senkpiel",
+ "email": "fishrock123@rocketmail.com",
+ "url": "https://searchbeam.jit.su"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ }
+ ],
+ "license": "MIT",
+ "keywords": [
+ "mime",
+ "types"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/mime-types"
+ },
+ "dependencies": {
+ "mime-db": "~1.8.0"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.7",
+ "mocha": "~1.21.5"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec test/test.js",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/test.js",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot test/test.js"
+ },
+ "gitHead": "9d4533a2b3a68af48a7f3ded9f8f525648e7bcc1",
+ "bugs": {
+ "url": "https://github.com/jshttp/mime-types/issues"
+ },
+ "homepage": "https://github.com/jshttp/mime-types",
+ "_id": "mime-types@2.0.10",
+ "_shasum": "eacd81bb73cab2a77447549a078d4f2018c67b4d",
+ "_from": "mime-types@~2.0.4",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "eacd81bb73cab2a77447549a078d4f2018c67b4d",
+ "tarball": "http://registry.npmjs.org/mime-types/-/mime-types-2.0.10.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.0.10.tgz"
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/negotiator/LICENSE b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/LICENSE
new file mode 100755
index 00000000..692b5341
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2012 Federico Romero
+Copyright (c) 2012-2014 Isaac Z. Schlueter
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/negotiator/README.md b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/README.md
new file mode 100755
index 00000000..2461eb1e
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/README.md
@@ -0,0 +1,161 @@
+# negotiator
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+An HTTP content negotiator for Node.js
+
+## Installation
+
+```sh
+$ npm install negotiator
+```
+
+## API
+
+```js
+var Negotiator = require('negotiator')
+```
+
+### Accept Negotiation
+
+```js
+availableMediaTypes = ['text/html', 'text/plain', 'application/json']
+
+// The negotiator constructor receives a request object
+negotiator = new Negotiator(request)
+
+// Let's say Accept header is 'text/html, application/*;q=0.2, image/jpeg;q=0.8'
+
+negotiator.mediaTypes()
+// -> ['text/html', 'image/jpeg', 'application/*']
+
+negotiator.mediaTypes(availableMediaTypes)
+// -> ['text/html', 'application/json']
+
+negotiator.mediaType(availableMediaTypes)
+// -> 'text/html'
+```
+
+You can check a working example at `examples/accept.js`.
+
+#### Methods
+
+##### mediaTypes(availableMediaTypes):
+
+Returns an array of preferred media types ordered by priority from a list of available media types.
+
+##### mediaType(availableMediaType):
+
+Returns the top preferred media type from a list of available media types.
+
+### Accept-Language Negotiation
+
+```js
+negotiator = new Negotiator(request)
+
+availableLanguages = 'en', 'es', 'fr'
+
+// Let's say Accept-Language header is 'en;q=0.8, es, pt'
+
+negotiator.languages()
+// -> ['es', 'pt', 'en']
+
+negotiator.languages(availableLanguages)
+// -> ['es', 'en']
+
+language = negotiator.language(availableLanguages)
+// -> 'es'
+```
+
+You can check a working example at `examples/language.js`.
+
+#### Methods
+
+##### languages(availableLanguages):
+
+Returns an array of preferred languages ordered by priority from a list of available languages.
+
+##### language(availableLanguages):
+
+Returns the top preferred language from a list of available languages.
+
+### Accept-Charset Negotiation
+
+```js
+availableCharsets = ['utf-8', 'iso-8859-1', 'iso-8859-5']
+
+negotiator = new Negotiator(request)
+
+// Let's say Accept-Charset header is 'utf-8, iso-8859-1;q=0.8, utf-7;q=0.2'
+
+negotiator.charsets()
+// -> ['utf-8', 'iso-8859-1', 'utf-7']
+
+negotiator.charsets(availableCharsets)
+// -> ['utf-8', 'iso-8859-1']
+
+negotiator.charset(availableCharsets)
+// -> 'utf-8'
+```
+
+You can check a working example at `examples/charset.js`.
+
+#### Methods
+
+##### charsets(availableCharsets):
+
+Returns an array of preferred charsets ordered by priority from a list of available charsets.
+
+##### charset(availableCharsets):
+
+Returns the top preferred charset from a list of available charsets.
+
+### Accept-Encoding Negotiation
+
+```js
+availableEncodings = ['identity', 'gzip']
+
+negotiator = new Negotiator(request)
+
+// Let's say Accept-Encoding header is 'gzip, compress;q=0.2, identity;q=0.5'
+
+negotiator.encodings()
+// -> ['gzip', 'identity', 'compress']
+
+negotiator.encodings(availableEncodings)
+// -> ['gzip', 'identity']
+
+negotiator.encoding(availableEncodings)
+// -> 'gzip'
+```
+
+You can check a working example at `examples/encoding.js`.
+
+#### Methods
+
+##### encodings(availableEncodings):
+
+Returns an array of preferred encodings ordered by priority from a list of available encodings.
+
+##### encoding(availableEncodings):
+
+Returns the top preferred encoding from a list of available encodings.
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/negotiator.svg?style=flat
+[npm-url]: https://npmjs.org/package/negotiator
+[node-version-image]: https://img.shields.io/node/v/negotiator.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/negotiator.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/negotiator
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/negotiator.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/negotiator?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/negotiator.svg?style=flat
+[downloads-url]: https://npmjs.org/package/negotiator
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/charset.js b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/charset.js
new file mode 100755
index 00000000..58da58fc
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/charset.js
@@ -0,0 +1,87 @@
+module.exports = preferredCharsets;
+preferredCharsets.preferredCharsets = preferredCharsets;
+
+function parseAcceptCharset(accept) {
+ return accept.split(',').map(function(e, i) {
+ return parseCharset(e.trim(), i);
+ }).filter(function(e) {
+ return e;
+ });
+}
+
+function parseCharset(s, i) {
+ var match = s.match(/^\s*(\S+?)\s*(?:;(.*))?$/);
+ if (!match) return null;
+
+ var charset = match[1];
+ var q = 1;
+ if (match[2]) {
+ var params = match[2].split(';')
+ for (var i = 0; i < params.length; i ++) {
+ var p = params[i].trim().split('=');
+ if (p[0] === 'q') {
+ q = parseFloat(p[1]);
+ break;
+ }
+ }
+ }
+
+ return {
+ charset: charset,
+ q: q,
+ i: i
+ };
+}
+
+function getCharsetPriority(charset, accepted) {
+ return (accepted.map(function(a) {
+ return specify(charset, a);
+ }).filter(Boolean).sort(function (a, b) {
+ if(a.s == b.s) {
+ return a.q > b.q ? -1 : 1;
+ } else {
+ return a.s > b.s ? -1 : 1;
+ }
+ })[0] || {s: 0, q:0});
+}
+
+function specify(charset, spec) {
+ var s = 0;
+ if(spec.charset.toLowerCase() === charset.toLowerCase()){
+ s |= 1;
+ } else if (spec.charset !== '*' ) {
+ return null
+ }
+
+ return {
+ s: s,
+ q: spec.q,
+ }
+}
+
+function preferredCharsets(accept, provided) {
+ // RFC 2616 sec 14.2: no header = *
+ accept = parseAcceptCharset(accept === undefined ? '*' : accept || '');
+ if (provided) {
+ return provided.map(function(type) {
+ return [type, getCharsetPriority(type, accept)];
+ }).filter(function(pair) {
+ return pair[1].q > 0;
+ }).sort(function(a, b) {
+ var pa = a[1];
+ var pb = b[1];
+ return (pb.q - pa.q) || (pb.s - pa.s) || (pa.i - pb.i);
+ }).map(function(pair) {
+ return pair[0];
+ });
+ } else {
+ return accept.sort(function (a, b) {
+ // revsort
+ return (b.q - a.q) || (a.i - b.i);
+ }).filter(function(type) {
+ return type.q > 0;
+ }).map(function(type) {
+ return type.charset;
+ });
+ }
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/encoding.js b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/encoding.js
new file mode 100755
index 00000000..4b8acc1a
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/encoding.js
@@ -0,0 +1,117 @@
+module.exports = preferredEncodings;
+preferredEncodings.preferredEncodings = preferredEncodings;
+
+function parseAcceptEncoding(accept) {
+ var acceptableEncodings;
+
+ if (accept) {
+ acceptableEncodings = accept.split(',').map(function(e, i) {
+ return parseEncoding(e.trim(), i);
+ });
+ } else {
+ acceptableEncodings = [];
+ }
+
+ if (!acceptableEncodings.some(function(e) {
+ return e && specify('identity', e);
+ })) {
+ /*
+ * If identity doesn't explicitly appear in the accept-encoding header,
+ * it's added to the list of acceptable encoding with the lowest q
+ *
+ */
+ var lowestQ = 1;
+
+ for(var i = 0; i < acceptableEncodings.length; i++){
+ var e = acceptableEncodings[i];
+ if(e && e.q < lowestQ){
+ lowestQ = e.q;
+ }
+ }
+ acceptableEncodings.push({
+ encoding: 'identity',
+ q: lowestQ / 2,
+ });
+ }
+
+ return acceptableEncodings.filter(function(e) {
+ return e;
+ });
+}
+
+function parseEncoding(s, i) {
+ var match = s.match(/^\s*(\S+?)\s*(?:;(.*))?$/);
+
+ if (!match) return null;
+
+ var encoding = match[1];
+ var q = 1;
+ if (match[2]) {
+ var params = match[2].split(';');
+ for (var i = 0; i < params.length; i ++) {
+ var p = params[i].trim().split('=');
+ if (p[0] === 'q') {
+ q = parseFloat(p[1]);
+ break;
+ }
+ }
+ }
+
+ return {
+ encoding: encoding,
+ q: q,
+ i: i
+ };
+}
+
+function getEncodingPriority(encoding, accepted) {
+ return (accepted.map(function(a) {
+ return specify(encoding, a);
+ }).filter(Boolean).sort(function (a, b) {
+ if(a.s == b.s) {
+ return a.q > b.q ? -1 : 1;
+ } else {
+ return a.s > b.s ? -1 : 1;
+ }
+ })[0] || {s: 0, q: 0});
+}
+
+function specify(encoding, spec) {
+ var s = 0;
+ if(spec.encoding.toLowerCase() === encoding.toLowerCase()){
+ s |= 1;
+ } else if (spec.encoding !== '*' ) {
+ return null
+ }
+
+ return {
+ s: s,
+ q: spec.q,
+ }
+};
+
+function preferredEncodings(accept, provided) {
+ accept = parseAcceptEncoding(accept || '');
+ if (provided) {
+ return provided.map(function(type) {
+ return [type, getEncodingPriority(type, accept)];
+ }).filter(function(pair) {
+ return pair[1].q > 0;
+ }).sort(function(a, b) {
+ var pa = a[1];
+ var pb = b[1];
+ return (pb.q - pa.q) || (pb.s - pa.s) || (pa.i - pb.i);
+ }).map(function(pair) {
+ return pair[0];
+ });
+ } else {
+ return accept.sort(function (a, b) {
+ // revsort
+ return (b.q - a.q) || (a.i - b.i);
+ }).filter(function(type){
+ return type.q > 0;
+ }).map(function(type) {
+ return type.encoding;
+ });
+ }
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/language.js b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/language.js
new file mode 100755
index 00000000..8fc63dfe
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/language.js
@@ -0,0 +1,100 @@
+module.exports = preferredLanguages;
+preferredLanguages.preferredLanguages = preferredLanguages;
+
+function parseAcceptLanguage(accept) {
+ return accept.split(',').map(function(e, i) {
+ return parseLanguage(e.trim(), i);
+ }).filter(function(e) {
+ return e;
+ });
+}
+
+function parseLanguage(s, i) {
+ var match = s.match(/^\s*(\S+?)(?:-(\S+?))?\s*(?:;(.*))?$/);
+ if (!match) return null;
+
+ var prefix = match[1],
+ suffix = match[2],
+ full = prefix;
+
+ if (suffix) full += "-" + suffix;
+
+ var q = 1;
+ if (match[3]) {
+ var params = match[3].split(';')
+ for (var i = 0; i < params.length; i ++) {
+ var p = params[i].split('=');
+ if (p[0] === 'q') q = parseFloat(p[1]);
+ }
+ }
+
+ return {
+ prefix: prefix,
+ suffix: suffix,
+ q: q,
+ i: i,
+ full: full
+ };
+}
+
+function getLanguagePriority(language, accepted) {
+ return (accepted.map(function(a){
+ return specify(language, a);
+ }).filter(Boolean).sort(function (a, b) {
+ if(a.s == b.s) {
+ return a.q > b.q ? -1 : 1;
+ } else {
+ return a.s > b.s ? -1 : 1;
+ }
+ })[0] || {s: 0, q: 0});
+}
+
+function specify(language, spec) {
+ var p = parseLanguage(language)
+ if (!p) return null;
+ var s = 0;
+ if(spec.full.toLowerCase() === p.full.toLowerCase()){
+ s |= 4;
+ } else if (spec.prefix.toLowerCase() === p.full.toLowerCase()) {
+ s |= 2;
+ } else if (spec.full.toLowerCase() === p.prefix.toLowerCase()) {
+ s |= 1;
+ } else if (spec.full !== '*' ) {
+ return null
+ }
+
+ return {
+ s: s,
+ q: spec.q,
+ }
+};
+
+function preferredLanguages(accept, provided) {
+ // RFC 2616 sec 14.4: no header = *
+ accept = parseAcceptLanguage(accept === undefined ? '*' : accept || '');
+ if (provided) {
+
+ var ret = provided.map(function(type) {
+ return [type, getLanguagePriority(type, accept)];
+ }).filter(function(pair) {
+ return pair[1].q > 0;
+ }).sort(function(a, b) {
+ var pa = a[1];
+ var pb = b[1];
+ return (pb.q - pa.q) || (pb.s - pa.s) || (pa.i - pb.i);
+ }).map(function(pair) {
+ return pair[0];
+ });
+ return ret;
+
+ } else {
+ return accept.sort(function (a, b) {
+ // revsort
+ return (b.q - a.q) || (a.i - b.i);
+ }).filter(function(type) {
+ return type.q > 0;
+ }).map(function(type) {
+ return type.full;
+ });
+ }
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/mediaType.js b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/mediaType.js
new file mode 100755
index 00000000..e413cad4
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/mediaType.js
@@ -0,0 +1,122 @@
+module.exports = preferredMediaTypes;
+preferredMediaTypes.preferredMediaTypes = preferredMediaTypes;
+
+function parseAccept(accept) {
+ return accept.split(',').map(function(e, i) {
+ return parseMediaType(e.trim(), i);
+ }).filter(function(e) {
+ return e;
+ });
+};
+
+function parseMediaType(s, i) {
+ var match = s.match(/\s*(\S+?)\/([^;\s]+)\s*(?:;(.*))?/);
+ if (!match) return null;
+
+ var type = match[1],
+ subtype = match[2],
+ full = "" + type + "/" + subtype,
+ params = {},
+ q = 1;
+
+ if (match[3]) {
+ params = match[3].split(';').map(function(s) {
+ return s.trim().split('=');
+ }).reduce(function (set, p) {
+ set[p[0]] = p[1];
+ return set
+ }, params);
+
+ if (params.q != null) {
+ q = parseFloat(params.q);
+ delete params.q;
+ }
+ }
+
+ return {
+ type: type,
+ subtype: subtype,
+ params: params,
+ q: q,
+ i: i,
+ full: full
+ };
+}
+
+function getMediaTypePriority(type, accepted) {
+ return (accepted.map(function(a) {
+ return specify(type, a);
+ }).filter(Boolean).sort(function (a, b) {
+ if(a.s == b.s) {
+ return a.q > b.q ? -1 : 1;
+ } else {
+ return a.s > b.s ? -1 : 1;
+ }
+ })[0] || {s: 0, q: 0});
+}
+
+function specify(type, spec) {
+ var p = parseMediaType(type);
+ var s = 0;
+
+ if (!p) {
+ return null;
+ }
+
+ if(spec.type.toLowerCase() == p.type.toLowerCase()) {
+ s |= 4
+ } else if(spec.type != '*') {
+ return null;
+ }
+
+ if(spec.subtype.toLowerCase() == p.subtype.toLowerCase()) {
+ s |= 2
+ } else if(spec.subtype != '*') {
+ return null;
+ }
+
+ var keys = Object.keys(spec.params);
+ if (keys.length > 0) {
+ if (keys.every(function (k) {
+ return spec.params[k] == '*' || (spec.params[k] || '').toLowerCase() == (p.params[k] || '').toLowerCase();
+ })) {
+ s |= 1
+ } else {
+ return null
+ }
+ }
+
+ return {
+ q: spec.q,
+ s: s,
+ }
+
+}
+
+function preferredMediaTypes(accept, provided) {
+ // RFC 2616 sec 14.2: no header = */*
+ accept = parseAccept(accept === undefined ? '*/*' : accept || '');
+ if (provided) {
+ return provided.map(function(type) {
+ return [type, getMediaTypePriority(type, accept)];
+ }).filter(function(pair) {
+ return pair[1].q > 0;
+ }).sort(function(a, b) {
+ var pa = a[1];
+ var pb = b[1];
+ return (pb.q - pa.q) || (pb.s - pa.s) || (pa.i - pb.i);
+ }).map(function(pair) {
+ return pair[0];
+ });
+
+ } else {
+ return accept.sort(function (a, b) {
+ // revsort
+ return (b.q - a.q) || (a.i - b.i);
+ }).filter(function(type) {
+ return type.q > 0;
+ }).map(function(type) {
+ return type.full;
+ });
+ }
+}
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/negotiator.js b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/negotiator.js
new file mode 100755
index 00000000..ba0c48b9
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/lib/negotiator.js
@@ -0,0 +1,37 @@
+module.exports = Negotiator;
+Negotiator.Negotiator = Negotiator;
+
+function Negotiator(request) {
+ if (!(this instanceof Negotiator)) return new Negotiator(request);
+ this.request = request;
+}
+
+var set = { charset: 'accept-charset',
+ encoding: 'accept-encoding',
+ language: 'accept-language',
+ mediaType: 'accept' };
+
+
+function capitalize(string){
+ return string.charAt(0).toUpperCase() + string.slice(1);
+}
+
+Object.keys(set).forEach(function (k) {
+ var header = set[k],
+ method = require('./'+k+'.js'),
+ singular = k,
+ plural = k + 's';
+
+ Negotiator.prototype[plural] = function (available) {
+ return method(this.request.headers[header], available);
+ };
+
+ Negotiator.prototype[singular] = function(available) {
+ var set = this[plural](available);
+ if (set) return set[0];
+ };
+
+ // Keep preferred* methods for legacy compatibility
+ Negotiator.prototype['preferred'+capitalize(plural)] = Negotiator.prototype[plural];
+ Negotiator.prototype['preferred'+capitalize(singular)] = Negotiator.prototype[singular];
+})
diff --git a/server/node_modules/express/node_modules/accepts/node_modules/negotiator/package.json b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/package.json
new file mode 100755
index 00000000..10f8c8e6
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/node_modules/negotiator/package.json
@@ -0,0 +1,78 @@
+{
+ "name": "negotiator",
+ "description": "HTTP content negotiation",
+ "version": "0.4.9",
+ "author": {
+ "name": "Federico Romero",
+ "email": "federico.romero@outboxlabs.com"
+ },
+ "contributors": [
+ {
+ "name": "Isaac Z. Schlueter",
+ "email": "i@izs.me",
+ "url": "http://blog.izs.me/"
+ }
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/negotiator"
+ },
+ "keywords": [
+ "http",
+ "content negotiation",
+ "accept",
+ "accept-language",
+ "accept-encoding",
+ "accept-charset"
+ ],
+ "license": "MIT",
+ "devDependencies": {
+ "istanbul": "~0.3.2",
+ "nodeunit": "0.8.x"
+ },
+ "scripts": {
+ "test": "nodeunit test",
+ "test-cov": "istanbul cover ./node_modules/nodeunit/bin/nodeunit test"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "main": "lib/negotiator.js",
+ "files": [
+ "lib",
+ "LICENSE"
+ ],
+ "gitHead": "1e90abd710b662db80f1ea244e647cce3bd74504",
+ "bugs": {
+ "url": "https://github.com/jshttp/negotiator/issues"
+ },
+ "homepage": "https://github.com/jshttp/negotiator",
+ "_id": "negotiator@0.4.9",
+ "_shasum": "92e46b6db53c7e421ed64a2bc94f08be7630df3f",
+ "_from": "negotiator@0.4.9",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "federomero",
+ "email": "federomero@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "92e46b6db53c7e421ed64a2bc94f08be7630df3f",
+ "tarball": "http://registry.npmjs.org/negotiator/-/negotiator-0.4.9.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/negotiator/-/negotiator-0.4.9.tgz"
+}
diff --git a/server/node_modules/express/node_modules/accepts/package.json b/server/node_modules/express/node_modules/accepts/package.json
new file mode 100755
index 00000000..d60bd5ed
--- /dev/null
+++ b/server/node_modules/express/node_modules/accepts/package.json
@@ -0,0 +1,91 @@
+{
+ "name": "accepts",
+ "description": "Higher-level content negotiation",
+ "version": "1.1.4",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/accepts"
+ },
+ "dependencies": {
+ "mime-types": "~2.0.4",
+ "negotiator": "0.4.9"
+ },
+ "devDependencies": {
+ "istanbul": "~0.3.4",
+ "mocha": "~2.0.1"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "keywords": [
+ "content",
+ "negotiation",
+ "accept",
+ "accepts"
+ ],
+ "gitHead": "df66414d80f096627b28f137127fce0a851d7900",
+ "bugs": {
+ "url": "https://github.com/jshttp/accepts/issues"
+ },
+ "homepage": "https://github.com/jshttp/accepts",
+ "_id": "accepts@1.1.4",
+ "_shasum": "d71c96f7d41d0feda2c38cd14e8a27c04158df4a",
+ "_from": "accepts@~1.1.3",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "federomero",
+ "email": "federomero@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ {
+ "name": "mscdex",
+ "email": "mscdex@mscdex.net"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "d71c96f7d41d0feda2c38cd14e8a27c04158df4a",
+ "tarball": "http://registry.npmjs.org/accepts/-/accepts-1.1.4.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/accepts/-/accepts-1.1.4.tgz"
+}
diff --git a/server/node_modules/express/node_modules/content-disposition/HISTORY.md b/server/node_modules/express/node_modules/content-disposition/HISTORY.md
new file mode 100755
index 00000000..1192551e
--- /dev/null
+++ b/server/node_modules/express/node_modules/content-disposition/HISTORY.md
@@ -0,0 +1,40 @@
+0.5.0 / 2014-10-11
+==================
+
+ * Add `parse` function
+
+0.4.0 / 2014-09-21
+==================
+
+ * Expand non-Unicode `filename` to the full ISO-8859-1 charset
+
+0.3.0 / 2014-09-20
+==================
+
+ * Add `fallback` option
+ * Add `type` option
+
+0.2.0 / 2014-09-19
+==================
+
+ * Reduce ambiguity of file names with hex escape in buggy browsers
+
+0.1.2 / 2014-09-19
+==================
+
+ * Fix periodic invalid Unicode filename header
+
+0.1.1 / 2014-09-19
+==================
+
+ * Fix invalid characters appearing in `filename*` parameter
+
+0.1.0 / 2014-09-18
+==================
+
+ * Make the `filename` argument optional
+
+0.0.0 / 2014-09-18
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/content-disposition/LICENSE b/server/node_modules/express/node_modules/content-disposition/LICENSE
new file mode 100755
index 00000000..b7dce6cf
--- /dev/null
+++ b/server/node_modules/express/node_modules/content-disposition/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/content-disposition/README.md b/server/node_modules/express/node_modules/content-disposition/README.md
new file mode 100755
index 00000000..d265431c
--- /dev/null
+++ b/server/node_modules/express/node_modules/content-disposition/README.md
@@ -0,0 +1,141 @@
+# content-disposition
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create and parse HTTP `Content-Disposition` header
+
+## Installation
+
+```sh
+$ npm install content-disposition
+```
+
+## API
+
+```js
+var contentDisposition = require('content-disposition')
+```
+
+### contentDisposition(filename, options)
+
+Create an attachment `Content-Disposition` header value using the given file name,
+if supplied. The `filename` is optional and if no file name is desired, but you
+want to specify `options`, set `filename` to `undefined`.
+
+```js
+res.setHeader('Content-Disposition', contentDisposition('∫ maths.pdf'))
+```
+
+**note** HTTP headers are of the ISO-8859-1 character set. If you are writing this
+header through a means different from `setHeader` in Node.js, you'll want to specify
+the `'binary'` encoding in Node.js.
+
+#### Options
+
+`contentDisposition` accepts these properties in the options object.
+
+##### fallback
+
+If the `filename` option is outside ISO-8859-1, then the file name is actually
+stored in a supplemental field for clients that support Unicode file names and
+a ISO-8859-1 version of the file name is automatically generated.
+
+This specifies the ISO-8859-1 file name to override the automatic generation or
+disables the generation all together, defaults to `true`.
+
+ - A string will specify the ISO-8859-1 file name to use in place of automatic
+ generation.
+ - `false` will disable including a ISO-8859-1 file name and only include the
+ Unicode version (unless the file name is already ISO-8859-1).
+ - `true` will enable automatic generation if the file name is outside ISO-8859-1.
+
+If the `filename` option is ISO-8859-1 and this option is specified and has a
+different value, then the `filename` option is encoded in the extended field
+and this set as the fallback field, even though they are both ISO-8859-1.
+
+##### type
+
+Specifies the disposition type, defaults to `"attachment"`. This can also be
+`"inline"`, or any other value (all values except inline are treated like
+`attachment`, but can convey additional information if both parties agree to
+it). The type is normalized to lower-case.
+
+### contentDisposition.parse(string)
+
+```js
+var disposition = contentDisposition.parse('attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt"');
+```
+
+Parse a `Content-Disposition` header string. This automatically handles extended
+("Unicode") parameters by decoding them and providing them under the standard
+parameter name. This will return an object with the following properties (examples
+are shown for the string `'attachment; filename="EURO rates.txt"; filename*=UTF-8\'\'%e2%82%ac%20rates.txt'`):
+
+ - `type`: The disposition type (always lower case). Example: `'attachment'`
+
+ - `parameters`: An object of the parameters in the disposition (name of parameter
+ always lower case and extended versions replace non-extended versions). Example:
+ `{filename: "€ rates.txt"}`
+
+## Examples
+
+### Send a file for download
+
+```js
+var contentDisposition = require('content-disposition')
+var destroy = require('destroy')
+var http = require('http')
+var onFinished = require('on-finished')
+
+var filePath = '/path/to/public/plans.pdf'
+
+http.createServer(function onRequest(req, res) {
+ // set headers
+ res.setHeader('Content-Type', 'application/pdf')
+ res.setHeader('Content-Disposition', contentDisposition(filePath))
+
+ // send file
+ var stream = fs.createReadStream(filePath)
+ stream.pipe(res)
+ onFinished(res, function (err) {
+ destroy(stream)
+ })
+})
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## References
+
+- [RFC 2616: Hypertext Transfer Protocol -- HTTP/1.1][rfc-2616]
+- [RFC 5987: Character Set and Language Encoding for Hypertext Transfer Protocol (HTTP) Header Field Parameters][rfc-5987]
+- [RFC 6266: Use of the Content-Disposition Header Field in the Hypertext Transfer Protocol (HTTP)][rfc-6266]
+- [Test Cases for HTTP Content-Disposition header field (RFC 6266) and the Encodings defined in RFCs 2047, 2231 and 5987][tc-2231]
+
+[rfc-2616]: https://tools.ietf.org/html/rfc2616
+[rfc-5987]: https://tools.ietf.org/html/rfc5987
+[rfc-6266]: https://tools.ietf.org/html/rfc6266
+[tc-2231]: http://greenbytes.de/tech/tc2231/
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/content-disposition.svg?style=flat
+[npm-url]: https://npmjs.org/package/content-disposition
+[node-version-image]: https://img.shields.io/node/v/content-disposition.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/content-disposition.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/content-disposition
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/content-disposition.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/content-disposition?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/content-disposition.svg?style=flat
+[downloads-url]: https://npmjs.org/package/content-disposition
diff --git a/server/node_modules/express/node_modules/content-disposition/index.js b/server/node_modules/express/node_modules/content-disposition/index.js
new file mode 100755
index 00000000..fa3bc741
--- /dev/null
+++ b/server/node_modules/express/node_modules/content-disposition/index.js
@@ -0,0 +1,443 @@
+/*!
+ * content-disposition
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = contentDisposition
+module.exports.parse = parse
+
+/**
+ * Module dependencies.
+ */
+
+var basename = require('path').basename
+
+/**
+ * RegExp to match non attr-char, *after* encodeURIComponent (i.e. not including "%")
+ */
+
+var encodeUriAttrCharRegExp = /[\x00-\x20"'\(\)*,\/:;<=>?@\[\\\]\{\}\x7f]/g
+
+/**
+ * RegExp to match percent encoding escape.
+ */
+
+var hexEscapeRegExp = /%[0-9A-Fa-f]{2}/
+var hexEscapeReplaceRegExp = /%([0-9A-Fa-f]{2})/g
+
+/**
+ * RegExp to match non-latin1 characters.
+ */
+
+var nonLatin1RegExp = /[^\x20-\x7e\xa0-\xff]/g
+
+/**
+ * RegExp to match quoted-pair in RFC 2616
+ *
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ */
+
+var qescRegExp = /\\([\u0000-\u007f])/g;
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 2616
+ */
+
+var quoteRegExp = /([\\"])/g
+
+/**
+ * RegExp for various RFC 2616 grammar
+ *
+ * parameter = token "=" ( token | quoted-string )
+ * token = 1*
+ * separators = "(" | ")" | "<" | ">" | "@"
+ * | "," | ";" | ":" | "\" | <">
+ * | "/" | "[" | "]" | "?" | "="
+ * | "{" | "}" | SP | HT
+ * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
+ * qdtext = >
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * TEXT =
+ * LWS = [CRLF] 1*( SP | HT )
+ * CRLF = CR LF
+ * CR =
+ * LF =
+ * SP =
+ * HT =
+ * CTL =
+ * OCTET =
+ */
+
+var paramRegExp = /; *([!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) *= *("(?:[ !\x23-\x5b\x5d-\x7e\x80-\xff]|\\[\x20-\x7e])*"|[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) */g
+var textRegExp = /^[\x20-\x7e\x80-\xff]+$/
+var tokenRegExp = /^[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+$/
+
+/**
+ * RegExp for various RFC 5987 grammar
+ *
+ * ext-value = charset "'" [ language ] "'" value-chars
+ * charset = "UTF-8" / "ISO-8859-1" / mime-charset
+ * mime-charset = 1*mime-charsetc
+ * mime-charsetc = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "%" / "&"
+ * / "+" / "-" / "^" / "_" / "`"
+ * / "{" / "}" / "~"
+ * language = ( 2*3ALPHA [ extlang ] )
+ * / 4ALPHA
+ * / 5*8ALPHA
+ * extlang = *3( "-" 3ALPHA )
+ * value-chars = *( pct-encoded / attr-char )
+ * pct-encoded = "%" HEXDIG HEXDIG
+ * attr-char = ALPHA / DIGIT
+ * / "!" / "#" / "$" / "&" / "+" / "-" / "."
+ * / "^" / "_" / "`" / "|" / "~"
+ */
+
+var extValueRegExp = /^([A-Za-z0-9!#$%&+\-^_`{}~]+)'(?:[A-Za-z]{2,3}(?:-[A-Za-z]{3}){0,3}|[A-Za-z]{4,8}|)'((?:%[0-9A-Fa-f]{2}|[A-Za-z0-9!#$&+\-\.^_`|~])+)$/
+
+/**
+ * RegExp for various RFC 6266 grammar
+ *
+ * disposition-type = "inline" | "attachment" | disp-ext-type
+ * disp-ext-type = token
+ * disposition-parm = filename-parm | disp-ext-parm
+ * filename-parm = "filename" "=" value
+ * | "filename*" "=" ext-value
+ * disp-ext-parm = token "=" value
+ * | ext-token "=" ext-value
+ * ext-token =
+ */
+
+var dispositionTypeRegExp = /^([!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) *(?:$|;)/
+
+/**
+ * Create an attachment Content-Disposition header.
+ *
+ * @param {string} [filename]
+ * @param {object} [options]
+ * @param {string} [options.type=attachment]
+ * @param {string|boolean} [options.fallback=true]
+ * @return {string}
+ * @api public
+ */
+
+function contentDisposition(filename, options) {
+ var opts = options || {}
+
+ // get type
+ var type = opts.type || 'attachment'
+
+ // get parameters
+ var params = createparams(filename, opts.fallback)
+
+ // format into string
+ return format(new ContentDisposition(type, params))
+}
+
+/**
+ * Create parameters object from filename and fallback.
+ *
+ * @param {string} [filename]
+ * @param {string|boolean} [fallback=true]
+ * @return {object}
+ * @api private
+ */
+
+function createparams(filename, fallback) {
+ if (filename === undefined) {
+ return
+ }
+
+ var params = {}
+
+ if (typeof filename !== 'string') {
+ throw new TypeError('filename must be a string')
+ }
+
+ // fallback defaults to true
+ if (fallback === undefined) {
+ fallback = true
+ }
+
+ if (typeof fallback !== 'string' && typeof fallback !== 'boolean') {
+ throw new TypeError('fallback must be a string or boolean')
+ }
+
+ if (typeof fallback === 'string' && nonLatin1RegExp.test(fallback)) {
+ throw new TypeError('fallback must be ISO-8859-1 string')
+ }
+
+ // restrict to file base name
+ var name = basename(filename)
+
+ // determine if name is suitable for quoted string
+ var isQuotedString = textRegExp.test(name)
+
+ // generate fallback name
+ var fallbackName = typeof fallback !== 'string'
+ ? fallback && getlatin1(name)
+ : basename(fallback)
+ var hasFallback = typeof fallbackName === 'string' && fallbackName !== name
+
+ // set extended filename parameter
+ if (hasFallback || !isQuotedString || hexEscapeRegExp.test(name)) {
+ params['filename*'] = name
+ }
+
+ // set filename parameter
+ if (isQuotedString || hasFallback) {
+ params.filename = hasFallback
+ ? fallbackName
+ : name
+ }
+
+ return params
+}
+
+/**
+ * Format object to Content-Disposition header.
+ *
+ * @param {object} obj
+ * @param {string} obj.type
+ * @param {object} [obj.parameters]
+ * @return {string}
+ * @api private
+ */
+
+function format(obj) {
+ var parameters = obj.parameters
+ var type = obj.type
+
+ if (!type || typeof type !== 'string' || !tokenRegExp.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ // start with normalized type
+ var string = String(type).toLowerCase()
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ var val = param.substr(-1) === '*'
+ ? ustring(parameters[param])
+ : qstring(parameters[param])
+
+ string += '; ' + param + '=' + val
+ }
+ }
+
+ return string
+}
+
+/**
+ * Decode a RFC 6987 field value (gracefully).
+ *
+ * @param {string} str
+ * @return {string}
+ * @api private
+ */
+
+function decodefield(str) {
+ var match = extValueRegExp.exec(str)
+
+ if (!match) {
+ throw new TypeError('invalid extended field value')
+ }
+
+ var charset = match[1].toLowerCase()
+ var encoded = match[2]
+ var value
+
+ // to binary string
+ var binary = encoded.replace(hexEscapeReplaceRegExp, pdecode)
+
+ switch (charset) {
+ case 'iso-8859-1':
+ value = getlatin1(binary)
+ break
+ case 'utf-8':
+ value = new Buffer(binary, 'binary').toString('utf8')
+ break
+ default:
+ throw new TypeError('unsupported charset in extended field')
+ }
+
+ return value
+}
+
+/**
+ * Get ISO-8859-1 version of string.
+ *
+ * @param {string} val
+ * @return {string}
+ * @api private
+ */
+
+function getlatin1(val) {
+ // simple Unicode -> ISO-8859-1 transformation
+ return String(val).replace(nonLatin1RegExp, '?')
+}
+
+/**
+ * Parse Content-Disposition header string.
+ *
+ * @param {string} string
+ * @return {object}
+ * @api private
+ */
+
+function parse(string) {
+ if (!string || typeof string !== 'string') {
+ throw new TypeError('argument string is required')
+ }
+
+ var match = dispositionTypeRegExp.exec(string)
+
+ if (!match) {
+ throw new TypeError('invalid type format')
+ }
+
+ // normalize type
+ var index = match[0].length
+ var type = match[1].toLowerCase()
+
+ var key
+ var names = []
+ var params = {}
+ var value
+
+ // calculate index to start at
+ index = paramRegExp.lastIndex = match[0].substr(-1) === ';'
+ ? index - 1
+ : index
+
+ // match parameters
+ while (match = paramRegExp.exec(string)) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (names.indexOf(key) !== -1) {
+ throw new TypeError('invalid duplicate parameter')
+ }
+
+ names.push(key)
+
+ if (key.indexOf('*') + 1 === key.length) {
+ // decode extended value
+ key = key.slice(0, -1)
+ value = decodefield(value)
+
+ // overwrite existing value
+ params[key] = value
+ continue
+ }
+
+ if (typeof params[key] === 'string') {
+ continue
+ }
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(qescRegExp, '$1')
+ }
+
+ params[key] = value
+ }
+
+ if (index !== -1 && index !== string.length) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ return new ContentDisposition(type, params)
+}
+
+/**
+ * Percent decode a single character.
+ *
+ * @param {string} str
+ * @param {string} hex
+ * @return {string}
+ * @api private
+ */
+
+function pdecode(str, hex) {
+ return String.fromCharCode(parseInt(hex, 16))
+}
+
+/**
+ * Percent encode a single character.
+ *
+ * @param {string} char
+ * @return {string}
+ * @api private
+ */
+
+function pencode(char) {
+ var hex = String(char)
+ .charCodeAt(0)
+ .toString(16)
+ .toUpperCase()
+ return hex.length === 1
+ ? '%0' + hex
+ : '%' + hex
+}
+
+/**
+ * Quote a string for HTTP.
+ *
+ * @param {string} val
+ * @return {string}
+ * @api private
+ */
+
+function qstring(val) {
+ var str = String(val)
+
+ return '"' + str.replace(quoteRegExp, '\\$1') + '"'
+}
+
+/**
+ * Encode a Unicode string for HTTP (RFC 5987).
+ *
+ * @param {string} val
+ * @return {string}
+ * @api private
+ */
+
+function ustring(val) {
+ var str = String(val)
+
+ // percent encode as UTF-8
+ var encoded = encodeURIComponent(str)
+ .replace(encodeUriAttrCharRegExp, pencode)
+
+ return 'UTF-8\'\'' + encoded
+}
+
+/**
+ * Class for parsed Content-Disposition header for v8 optimization
+ */
+
+function ContentDisposition(type, parameters) {
+ this.type = type
+ this.parameters = parameters
+}
diff --git a/server/node_modules/express/node_modules/content-disposition/package.json b/server/node_modules/express/node_modules/content-disposition/package.json
new file mode 100755
index 00000000..b0bb7ec6
--- /dev/null
+++ b/server/node_modules/express/node_modules/content-disposition/package.json
@@ -0,0 +1,66 @@
+{
+ "name": "content-disposition",
+ "description": "Create and parse Content-Disposition header",
+ "version": "0.5.0",
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "license": "MIT",
+ "keywords": [
+ "content-disposition",
+ "http",
+ "rfc6266",
+ "res"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/content-disposition"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.2",
+ "mocha": "~1.21.4"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "f3c915f0c9d9f5ec79713dba24c8c6181b73305d",
+ "bugs": {
+ "url": "https://github.com/jshttp/content-disposition/issues"
+ },
+ "homepage": "https://github.com/jshttp/content-disposition",
+ "_id": "content-disposition@0.5.0",
+ "_shasum": "4284fe6ae0630874639e44e80a418c2934135e9e",
+ "_from": "content-disposition@0.5.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "4284fe6ae0630874639e44e80a418c2934135e9e",
+ "tarball": "http://registry.npmjs.org/content-disposition/-/content-disposition-0.5.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/content-disposition/-/content-disposition-0.5.0.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/cookie-signature/.npmignore b/server/node_modules/express/node_modules/cookie-signature/.npmignore
new file mode 100755
index 00000000..f1250e58
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie-signature/.npmignore
@@ -0,0 +1,4 @@
+support
+test
+examples
+*.sock
diff --git a/server/node_modules/express/node_modules/cookie-signature/History.md b/server/node_modules/express/node_modules/cookie-signature/History.md
new file mode 100755
index 00000000..2bbc4b39
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie-signature/History.md
@@ -0,0 +1,27 @@
+1.0.4 / 2014-06-25
+==================
+
+ * corrected avoidance of timing attacks (thanks @tenbits!)
+
+
+1.0.3 / 2014-01-28
+==================
+
+ * [incorrect] fix for timing attacks
+
+1.0.2 / 2014-01-28
+==================
+
+ * fix missing repository warning
+ * fix typo in test
+
+1.0.1 / 2013-04-15
+==================
+
+ * Revert "Changed underlying HMAC algo. to sha512."
+ * Revert "Fix for timing attacks on MAC verification."
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/cookie-signature/Makefile b/server/node_modules/express/node_modules/cookie-signature/Makefile
new file mode 100755
index 00000000..4e9c8d36
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie-signature/Makefile
@@ -0,0 +1,7 @@
+
+test:
+ @./node_modules/.bin/mocha \
+ --require should \
+ --reporter spec
+
+.PHONY: test
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/cookie-signature/Readme.md b/server/node_modules/express/node_modules/cookie-signature/Readme.md
new file mode 100755
index 00000000..2559e841
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie-signature/Readme.md
@@ -0,0 +1,42 @@
+
+# cookie-signature
+
+ Sign and unsign cookies.
+
+## Example
+
+```js
+var cookie = require('cookie-signature');
+
+var val = cookie.sign('hello', 'tobiiscool');
+val.should.equal('hello.DGDUkGlIkCzPz+C0B064FNgHdEjox7ch8tOBGslZ5QI');
+
+var val = cookie.sign('hello', 'tobiiscool');
+cookie.unsign(val, 'tobiiscool').should.equal('hello');
+cookie.unsign(val, 'luna').should.be.false;
+```
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2012 LearnBoost <tj@learnboost.com>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/cookie-signature/index.js b/server/node_modules/express/node_modules/cookie-signature/index.js
new file mode 100755
index 00000000..b63bf84a
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie-signature/index.js
@@ -0,0 +1,51 @@
+/**
+ * Module dependencies.
+ */
+
+var crypto = require('crypto');
+
+/**
+ * Sign the given `val` with `secret`.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String}
+ * @api private
+ */
+
+exports.sign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError('cookie required');
+ if ('string' != typeof secret) throw new TypeError('secret required');
+ return val + '.' + crypto
+ .createHmac('sha256', secret)
+ .update(val)
+ .digest('base64')
+ .replace(/\=+$/, '');
+};
+
+/**
+ * Unsign and decode the given `val` with `secret`,
+ * returning `false` if the signature is invalid.
+ *
+ * @param {String} val
+ * @param {String} secret
+ * @return {String|Boolean}
+ * @api private
+ */
+
+exports.unsign = function(val, secret){
+ if ('string' != typeof val) throw new TypeError('cookie required');
+ if ('string' != typeof secret) throw new TypeError('secret required');
+ var str = val.slice(0, val.lastIndexOf('.'))
+ , mac = exports.sign(str, secret);
+
+ return sha1(mac) == sha1(val) ? str : false;
+};
+
+/**
+ * Private
+ */
+
+function sha1(str){
+ return crypto.createHash('sha1').update(str).digest('hex');
+}
diff --git a/server/node_modules/express/node_modules/cookie-signature/package.json b/server/node_modules/express/node_modules/cookie-signature/package.json
new file mode 100755
index 00000000..741961f8
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie-signature/package.json
@@ -0,0 +1,56 @@
+{
+ "name": "cookie-signature",
+ "version": "1.0.5",
+ "description": "Sign and unsign cookies",
+ "keywords": [
+ "cookie",
+ "sign",
+ "unsign"
+ ],
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@learnboost.com"
+ },
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/visionmedia/node-cookie-signature.git"
+ },
+ "dependencies": {},
+ "devDependencies": {
+ "mocha": "*",
+ "should": "*"
+ },
+ "main": "index",
+ "gitHead": "73ed69b511b3ef47555d71b4ed1deea9e5ed6e1f",
+ "bugs": {
+ "url": "https://github.com/visionmedia/node-cookie-signature/issues"
+ },
+ "homepage": "https://github.com/visionmedia/node-cookie-signature",
+ "_id": "cookie-signature@1.0.5",
+ "scripts": {},
+ "_shasum": "a122e3f1503eca0f5355795b0711bb2368d450f9",
+ "_from": "cookie-signature@1.0.5",
+ "_npmVersion": "1.4.20",
+ "_npmUser": {
+ "name": "natevw",
+ "email": "natevw@yahoo.com"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "natevw",
+ "email": "natevw@yahoo.com"
+ }
+ ],
+ "dist": {
+ "shasum": "a122e3f1503eca0f5355795b0711bb2368d450f9",
+ "tarball": "http://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.5.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/cookie-signature/-/cookie-signature-1.0.5.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/cookie/.npmignore b/server/node_modules/express/node_modules/cookie/.npmignore
new file mode 100755
index 00000000..efab07fb
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie/.npmignore
@@ -0,0 +1,2 @@
+test
+.travis.yml
diff --git a/server/node_modules/express/node_modules/cookie/LICENSE b/server/node_modules/express/node_modules/cookie/LICENSE
new file mode 100755
index 00000000..249d9def
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie/LICENSE
@@ -0,0 +1,9 @@
+// MIT License
+
+Copyright (C) Roman Shtylman
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/cookie/README.md b/server/node_modules/express/node_modules/cookie/README.md
new file mode 100755
index 00000000..3170b4b8
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie/README.md
@@ -0,0 +1,44 @@
+# cookie [](http://travis-ci.org/defunctzombie/node-cookie) #
+
+cookie is a basic cookie parser and serializer. It doesn't make assumptions about how you are going to deal with your cookies. It basically just provides a way to read and write the HTTP cookie headers.
+
+See [RFC6265](http://tools.ietf.org/html/rfc6265) for details about the http header for cookies.
+
+## how?
+
+```
+npm install cookie
+```
+
+```javascript
+var cookie = require('cookie');
+
+var hdr = cookie.serialize('foo', 'bar');
+// hdr = 'foo=bar';
+
+var cookies = cookie.parse('foo=bar; cat=meow; dog=ruff');
+// cookies = { foo: 'bar', cat: 'meow', dog: 'ruff' };
+```
+
+## more
+
+The serialize function takes a third parameter, an object, to set cookie options. See the RFC for valid values.
+
+### path
+> cookie path
+
+### expires
+> absolute expiration date for the cookie (Date object)
+
+### maxAge
+> relative max age of the cookie from when the client receives it (seconds)
+
+### domain
+> domain for the cookie
+
+### secure
+> true or false
+
+### httpOnly
+> true or false
+
diff --git a/server/node_modules/express/node_modules/cookie/index.js b/server/node_modules/express/node_modules/cookie/index.js
new file mode 100755
index 00000000..00d54a7b
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie/index.js
@@ -0,0 +1,75 @@
+
+/// Serialize the a name value pair into a cookie string suitable for
+/// http headers. An optional options object specified cookie parameters
+///
+/// serialize('foo', 'bar', { httpOnly: true })
+/// => "foo=bar; httpOnly"
+///
+/// @param {String} name
+/// @param {String} val
+/// @param {Object} options
+/// @return {String}
+var serialize = function(name, val, opt){
+ opt = opt || {};
+ var enc = opt.encode || encode;
+ var pairs = [name + '=' + enc(val)];
+
+ if (null != opt.maxAge) {
+ var maxAge = opt.maxAge - 0;
+ if (isNaN(maxAge)) throw new Error('maxAge should be a Number');
+ pairs.push('Max-Age=' + maxAge);
+ }
+
+ if (opt.domain) pairs.push('Domain=' + opt.domain);
+ if (opt.path) pairs.push('Path=' + opt.path);
+ if (opt.expires) pairs.push('Expires=' + opt.expires.toUTCString());
+ if (opt.httpOnly) pairs.push('HttpOnly');
+ if (opt.secure) pairs.push('Secure');
+
+ return pairs.join('; ');
+};
+
+/// Parse the given cookie header string into an object
+/// The object has the various cookies as keys(names) => values
+/// @param {String} str
+/// @return {Object}
+var parse = function(str, opt) {
+ opt = opt || {};
+ var obj = {}
+ var pairs = str.split(/; */);
+ var dec = opt.decode || decode;
+
+ pairs.forEach(function(pair) {
+ var eq_idx = pair.indexOf('=')
+
+ // skip things that don't look like key=value
+ if (eq_idx < 0) {
+ return;
+ }
+
+ var key = pair.substr(0, eq_idx).trim()
+ var val = pair.substr(++eq_idx, pair.length).trim();
+
+ // quoted values
+ if ('"' == val[0]) {
+ val = val.slice(1, -1);
+ }
+
+ // only assign once
+ if (undefined == obj[key]) {
+ try {
+ obj[key] = dec(val);
+ } catch (e) {
+ obj[key] = val;
+ }
+ }
+ });
+
+ return obj;
+};
+
+var encode = encodeURIComponent;
+var decode = decodeURIComponent;
+
+module.exports.serialize = serialize;
+module.exports.parse = parse;
diff --git a/server/node_modules/express/node_modules/cookie/package.json b/server/node_modules/express/node_modules/cookie/package.json
new file mode 100755
index 00000000..7dbb395f
--- /dev/null
+++ b/server/node_modules/express/node_modules/cookie/package.json
@@ -0,0 +1,54 @@
+{
+ "author": {
+ "name": "Roman Shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ "name": "cookie",
+ "description": "cookie parsing and serialization",
+ "version": "0.1.2",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/shtylman/node-cookie.git"
+ },
+ "keywords": [
+ "cookie",
+ "cookies"
+ ],
+ "main": "index.js",
+ "scripts": {
+ "test": "mocha"
+ },
+ "dependencies": {},
+ "devDependencies": {
+ "mocha": "1.x.x"
+ },
+ "optionalDependencies": {},
+ "engines": {
+ "node": "*"
+ },
+ "bugs": {
+ "url": "https://github.com/shtylman/node-cookie/issues"
+ },
+ "homepage": "https://github.com/shtylman/node-cookie",
+ "_id": "cookie@0.1.2",
+ "dist": {
+ "shasum": "72fec3d24e48a3432073d90c12642005061004b1",
+ "tarball": "http://registry.npmjs.org/cookie/-/cookie-0.1.2.tgz"
+ },
+ "_from": "cookie@0.1.2",
+ "_npmVersion": "1.4.6",
+ "_npmUser": {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ }
+ ],
+ "directories": {},
+ "_shasum": "72fec3d24e48a3432073d90c12642005061004b1",
+ "_resolved": "https://registry.npmjs.org/cookie/-/cookie-0.1.2.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/debug/.jshintrc b/server/node_modules/express/node_modules/debug/.jshintrc
new file mode 100755
index 00000000..299877f2
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/.jshintrc
@@ -0,0 +1,3 @@
+{
+ "laxbreak": true
+}
diff --git a/server/node_modules/express/node_modules/debug/.npmignore b/server/node_modules/express/node_modules/debug/.npmignore
new file mode 100755
index 00000000..7e6163db
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/.npmignore
@@ -0,0 +1,6 @@
+support
+test
+examples
+example
+*.sock
+dist
diff --git a/server/node_modules/express/node_modules/debug/History.md b/server/node_modules/express/node_modules/debug/History.md
new file mode 100755
index 00000000..770e4832
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/History.md
@@ -0,0 +1,186 @@
+
+2.1.3 / 2015-03-13
+==================
+
+ * Updated stdout/stderr example (#186)
+ * Updated example/stdout.js to match debug current behaviour
+ * Renamed example/stderr.js to stdout.js
+ * Update Readme.md (#184)
+ * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+ * dist: recompile
+ * update "ms" to v0.7.0
+ * package: update "browserify" to v9.0.3
+ * component: fix "ms.js" repo location
+ * changed bower package name
+ * updated documentation about using debug in a browser
+ * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+ * browser: use `typeof` to check for `console` existence
+ * browser: check for `console.log` truthiness (fix IE 8/9)
+ * browser: add support for Chrome apps
+ * Readme: added Windows usage remarks
+ * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+ * node: implement `DEBUG_FD` env variable support
+ * package: update "browserify" to v6.1.0
+ * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+ * package: update "browserify" to v5.11.0
+ * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+ * dist: recompile
+ * example: remove `console.info()` log usage
+ * example: add "Content-Type" UTF-8 header to browser example
+ * browser: place %c marker after the space character
+ * browser: reset the "content" color via `color: inherit`
+ * browser: add colors support for Firefox >= v31
+ * debug: prefer an instance `log()` function over the global one (#119)
+ * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+ * Add support for multiple wildcards in namespaces (#122, @seegno)
+ * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+ * browser: update color palette (#113, @gscottolson)
+ * common: make console logging function configurable (#108, @timoxley)
+ * node: fix %o colors on old node <= 0.8.x
+ * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+ * browser: use `removeItem()` to clear localStorage
+ * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+ * package: add "contributors" section
+ * node: fix comment typo
+ * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+ * make ms diff be global, not be scope
+ * debug: ignore empty strings in enable()
+ * node: make DEBUG_COLORS able to disable coloring
+ * *: export the `colors` array
+ * npmignore: don't publish the `dist` dir
+ * Makefile: refactor to use browserify
+ * package: add "browserify" as a dev dependency
+ * Readme: add Web Inspector Colors section
+ * node: reset terminal color for the debug content
+ * node: map "%o" to `util.inspect()`
+ * browser: map "%j" to `JSON.stringify()`
+ * debug: add custom "formatters"
+ * debug: use "ms" module for humanizing the diff
+ * Readme: add "bash" syntax highlighting
+ * browser: add Firebug color support
+ * browser: add colors for WebKit browsers
+ * node: apply log to `console`
+ * rewrite: abstract common logic for Node & browsers
+ * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+ * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+ * add `enable()` method for nodejs. Closes #27
+ * change from stderr to stdout
+ * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+ * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+ * fix: catch localStorage security error when cookies are blocked (Chrome)
+ * add debug(err) support. Closes #46
+ * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+ * fix package.json
+ * fix: Mobile Safari (private mode) is broken with debug
+ * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+ * add repository URL to package.json
+ * add DEBUG_COLORED to force colored output
+ * add browserify support
+ * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+ * Added .component to package.json
+ * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+ * Added support for "-" prefix in DEBUG [Vinay Pulim]
+ * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+ * Added: humanize diffs. Closes #8
+ * Added `debug.disable()` to the CS variant
+ * Removed padding. Closes #10
+ * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+ * Added browser variant support for older browsers [TooTallNate]
+ * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+ * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+ * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+ * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+ * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/debug/Makefile b/server/node_modules/express/node_modules/debug/Makefile
new file mode 100755
index 00000000..b0bde6e6
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/Makefile
@@ -0,0 +1,33 @@
+
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# applications
+NODE ?= $(shell which node)
+NPM ?= $(NODE) $(shell which npm)
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+all: dist/debug.js
+
+install: node_modules
+
+clean:
+ @rm -rf node_modules dist
+
+dist:
+ @mkdir -p $@
+
+dist/debug.js: node_modules browser.js debug.js dist
+ @$(BROWSERIFY) \
+ --standalone debug \
+ . > $@
+
+node_modules: package.json
+ @NODE_ENV= $(NPM) install
+ @touch node_modules
+
+.PHONY: all install clean
diff --git a/server/node_modules/express/node_modules/debug/Readme.md b/server/node_modules/express/node_modules/debug/Readme.md
new file mode 100755
index 00000000..14222e0c
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/Readme.md
@@ -0,0 +1,178 @@
+# debug
+
+ tiny node.js debugging utility modelled after node core's debugging technique.
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+ With `debug` you simply invoke the exported function to generate your debug function, passing it a name which will determine if a noop function is returned, or a decorated `console.error`, so all of the `console` format string goodies you're used to work fine. A unique color is selected per-function for visibility.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+ debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+ 
+
+ 
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+ When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+ 
+
+ When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+ 
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+ The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect.compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+ You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Browser support
+
+ Debug works in the browser as well, currently persisted by `localStorage`. Consider the situation shown below where you have `worker:a` and `worker:b`, and wish to debug both. Somewhere in the code on your page, include:
+
+```js
+window.myDebug = require("debug");
+```
+
+ ("debug" is a global object in the browser so we give this object a different name.) When your page is open in the browser, type the following in the console:
+
+```js
+myDebug.enable("worker:*")
+```
+
+ Refresh the page. Debug output will continue to be sent to the console until it is disabled by typing `myDebug.disable()` in the console.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+ Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+ option. These are WebKit web inspectors, Firefox ([since version
+ 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+ and the Firebug plugin for Firefox (any version).
+
+ Colored output looks something like:
+
+ 
+
+### stderr vs stdout
+
+You can set an alternative logging method per-namespace by overriding the `log` method on a per-namespace or globally:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+
+## License
+
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca>
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/debug/bower.json b/server/node_modules/express/node_modules/debug/bower.json
new file mode 100755
index 00000000..f7d3f6dc
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/bower.json
@@ -0,0 +1,28 @@
+{
+ "name": "visionmedia-debug",
+ "main": "dist/debug.js",
+ "version": "2.1.3",
+ "homepage": "https://github.com/visionmedia/debug",
+ "authors": [
+ "TJ Holowaychuk "
+ ],
+ "description": "visionmedia-debug",
+ "moduleType": [
+ "amd",
+ "es6",
+ "globals",
+ "node"
+ ],
+ "keywords": [
+ "visionmedia",
+ "debug"
+ ],
+ "license": "MIT",
+ "ignore": [
+ "**/.*",
+ "node_modules",
+ "bower_components",
+ "test",
+ "tests"
+ ]
+}
diff --git a/server/node_modules/express/node_modules/debug/browser.js b/server/node_modules/express/node_modules/debug/browser.js
new file mode 100755
index 00000000..55f4cf92
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/browser.js
@@ -0,0 +1,175 @@
+
+/**
+ * This is the web browser implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Use chrome.storage.local if we are in an app
+ */
+
+var storage;
+
+if (typeof chrome !== 'undefined' && typeof chrome.storage !== 'undefined')
+ storage = chrome.storage.local;
+else
+ storage = localstorage();
+
+/**
+ * Colors.
+ */
+
+exports.colors = [
+ 'lightseagreen',
+ 'forestgreen',
+ 'goldenrod',
+ 'dodgerblue',
+ 'darkorchid',
+ 'crimson'
+];
+
+/**
+ * Currently only WebKit-based Web Inspectors, Firefox >= v31,
+ * and the Firebug extension (any Firefox version) are known
+ * to support "%c" CSS customizations.
+ *
+ * TODO: add a `localStorage` variable to explicitly enable/disable colors
+ */
+
+function useColors() {
+ // is webkit? http://stackoverflow.com/a/16459606/376773
+ return ('WebkitAppearance' in document.documentElement.style) ||
+ // is firebug? http://stackoverflow.com/a/398120/376773
+ (window.console && (console.firebug || (console.exception && console.table))) ||
+ // is firefox >= v31?
+ // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages
+ (navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31);
+}
+
+/**
+ * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default.
+ */
+
+exports.formatters.j = function(v) {
+ return JSON.stringify(v);
+};
+
+
+/**
+ * Colorize log arguments if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs() {
+ var args = arguments;
+ var useColors = this.useColors;
+
+ args[0] = (useColors ? '%c' : '')
+ + this.namespace
+ + (useColors ? ' %c' : ' ')
+ + args[0]
+ + (useColors ? '%c ' : ' ')
+ + '+' + exports.humanize(this.diff);
+
+ if (!useColors) return args;
+
+ var c = 'color: ' + this.color;
+ args = [args[0], c, 'color: inherit'].concat(Array.prototype.slice.call(args, 1));
+
+ // the final "%c" is somewhat tricky, because there could be other
+ // arguments passed either before or after the %c, so we need to
+ // figure out the correct index to insert the CSS into
+ var index = 0;
+ var lastC = 0;
+ args[0].replace(/%[a-z%]/g, function(match) {
+ if ('%%' === match) return;
+ index++;
+ if ('%c' === match) {
+ // we only are interested in the *last* %c
+ // (the user may have provided their own)
+ lastC = index;
+ }
+ });
+
+ args.splice(lastC, 0, c);
+ return args;
+}
+
+/**
+ * Invokes `console.log()` when available.
+ * No-op when `console.log` is not a "function".
+ *
+ * @api public
+ */
+
+function log() {
+ // this hackery is required for IE8/9, where
+ // the `console.log` function doesn't have 'apply'
+ return 'object' === typeof console
+ && console.log
+ && Function.prototype.apply.call(console.log, console, arguments);
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ try {
+ if (null == namespaces) {
+ storage.removeItem('debug');
+ } else {
+ storage.debug = namespaces;
+ }
+ } catch(e) {}
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ var r;
+ try {
+ r = storage.debug;
+ } catch(e) {}
+ return r;
+}
+
+/**
+ * Enable namespaces listed in `localStorage.debug` initially.
+ */
+
+exports.enable(load());
+
+/**
+ * Localstorage attempts to return the localstorage.
+ *
+ * This is necessary because safari throws
+ * when a user disables cookies/localstorage
+ * and you attempt to access it.
+ *
+ * @return {LocalStorage}
+ * @api private
+ */
+
+function localstorage(){
+ try {
+ return window.localStorage;
+ } catch (e) {}
+}
diff --git a/server/node_modules/express/node_modules/debug/component.json b/server/node_modules/express/node_modules/debug/component.json
new file mode 100755
index 00000000..52ffd422
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/component.json
@@ -0,0 +1,19 @@
+{
+ "name": "debug",
+ "repo": "visionmedia/debug",
+ "description": "small debugging utility",
+ "version": "2.1.3",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "main": "browser.js",
+ "scripts": [
+ "browser.js",
+ "debug.js"
+ ],
+ "dependencies": {
+ "rauchg/ms.js": "0.7.0"
+ }
+}
diff --git a/server/node_modules/express/node_modules/debug/debug.js b/server/node_modules/express/node_modules/debug/debug.js
new file mode 100755
index 00000000..7571a860
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/debug.js
@@ -0,0 +1,197 @@
+
+/**
+ * This is the common logic for both the Node.js and web browser
+ * implementations of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = debug;
+exports.coerce = coerce;
+exports.disable = disable;
+exports.enable = enable;
+exports.enabled = enabled;
+exports.humanize = require('ms');
+
+/**
+ * The currently active debug mode names, and names to skip.
+ */
+
+exports.names = [];
+exports.skips = [];
+
+/**
+ * Map of special "%n" handling functions, for the debug "format" argument.
+ *
+ * Valid key names are a single, lowercased letter, i.e. "n".
+ */
+
+exports.formatters = {};
+
+/**
+ * Previously assigned color.
+ */
+
+var prevColor = 0;
+
+/**
+ * Previous log timestamp.
+ */
+
+var prevTime;
+
+/**
+ * Select a color.
+ *
+ * @return {Number}
+ * @api private
+ */
+
+function selectColor() {
+ return exports.colors[prevColor++ % exports.colors.length];
+}
+
+/**
+ * Create a debugger with the given `namespace`.
+ *
+ * @param {String} namespace
+ * @return {Function}
+ * @api public
+ */
+
+function debug(namespace) {
+
+ // define the `disabled` version
+ function disabled() {
+ }
+ disabled.enabled = false;
+
+ // define the `enabled` version
+ function enabled() {
+
+ var self = enabled;
+
+ // set `diff` timestamp
+ var curr = +new Date();
+ var ms = curr - (prevTime || curr);
+ self.diff = ms;
+ self.prev = prevTime;
+ self.curr = curr;
+ prevTime = curr;
+
+ // add the `color` if not set
+ if (null == self.useColors) self.useColors = exports.useColors();
+ if (null == self.color && self.useColors) self.color = selectColor();
+
+ var args = Array.prototype.slice.call(arguments);
+
+ args[0] = exports.coerce(args[0]);
+
+ if ('string' !== typeof args[0]) {
+ // anything else let's inspect with %o
+ args = ['%o'].concat(args);
+ }
+
+ // apply any `formatters` transformations
+ var index = 0;
+ args[0] = args[0].replace(/%([a-z%])/g, function(match, format) {
+ // if we encounter an escaped % then don't increase the array index
+ if (match === '%%') return match;
+ index++;
+ var formatter = exports.formatters[format];
+ if ('function' === typeof formatter) {
+ var val = args[index];
+ match = formatter.call(self, val);
+
+ // now we need to remove `args[index]` since it's inlined in the `format`
+ args.splice(index, 1);
+ index--;
+ }
+ return match;
+ });
+
+ if ('function' === typeof exports.formatArgs) {
+ args = exports.formatArgs.apply(self, args);
+ }
+ var logFn = enabled.log || exports.log || console.log.bind(console);
+ logFn.apply(self, args);
+ }
+ enabled.enabled = true;
+
+ var fn = exports.enabled(namespace) ? enabled : disabled;
+
+ fn.namespace = namespace;
+
+ return fn;
+}
+
+/**
+ * Enables a debug mode by namespaces. This can include modes
+ * separated by a colon and wildcards.
+ *
+ * @param {String} namespaces
+ * @api public
+ */
+
+function enable(namespaces) {
+ exports.save(namespaces);
+
+ var split = (namespaces || '').split(/[\s,]+/);
+ var len = split.length;
+
+ for (var i = 0; i < len; i++) {
+ if (!split[i]) continue; // ignore empty strings
+ namespaces = split[i].replace(/\*/g, '.*?');
+ if (namespaces[0] === '-') {
+ exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$'));
+ } else {
+ exports.names.push(new RegExp('^' + namespaces + '$'));
+ }
+ }
+}
+
+/**
+ * Disable debug output.
+ *
+ * @api public
+ */
+
+function disable() {
+ exports.enable('');
+}
+
+/**
+ * Returns true if the given mode name is enabled, false otherwise.
+ *
+ * @param {String} name
+ * @return {Boolean}
+ * @api public
+ */
+
+function enabled(name) {
+ var i, len;
+ for (i = 0, len = exports.skips.length; i < len; i++) {
+ if (exports.skips[i].test(name)) {
+ return false;
+ }
+ }
+ for (i = 0, len = exports.names.length; i < len; i++) {
+ if (exports.names[i].test(name)) {
+ return true;
+ }
+ }
+ return false;
+}
+
+/**
+ * Coerce `val`.
+ *
+ * @param {Mixed} val
+ * @return {Mixed}
+ * @api private
+ */
+
+function coerce(val) {
+ if (val instanceof Error) return val.stack || val.message;
+ return val;
+}
diff --git a/server/node_modules/express/node_modules/debug/node.js b/server/node_modules/express/node_modules/debug/node.js
new file mode 100755
index 00000000..1d392a81
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/node.js
@@ -0,0 +1,209 @@
+
+/**
+ * Module dependencies.
+ */
+
+var tty = require('tty');
+var util = require('util');
+
+/**
+ * This is the Node.js implementation of `debug()`.
+ *
+ * Expose `debug()` as the module.
+ */
+
+exports = module.exports = require('./debug');
+exports.log = log;
+exports.formatArgs = formatArgs;
+exports.save = save;
+exports.load = load;
+exports.useColors = useColors;
+
+/**
+ * Colors.
+ */
+
+exports.colors = [6, 2, 3, 4, 5, 1];
+
+/**
+ * The file descriptor to write the `debug()` calls to.
+ * Set the `DEBUG_FD` env variable to override with another value. i.e.:
+ *
+ * $ DEBUG_FD=3 node script.js 3>debug.log
+ */
+
+var fd = parseInt(process.env.DEBUG_FD, 10) || 2;
+var stream = 1 === fd ? process.stdout :
+ 2 === fd ? process.stderr :
+ createWritableStdioStream(fd);
+
+/**
+ * Is stdout a TTY? Colored output is enabled when `true`.
+ */
+
+function useColors() {
+ var debugColors = (process.env.DEBUG_COLORS || '').trim().toLowerCase();
+ if (0 === debugColors.length) {
+ return tty.isatty(fd);
+ } else {
+ return '0' !== debugColors
+ && 'no' !== debugColors
+ && 'false' !== debugColors
+ && 'disabled' !== debugColors;
+ }
+}
+
+/**
+ * Map %o to `util.inspect()`, since Node doesn't do that out of the box.
+ */
+
+var inspect = (4 === util.inspect.length ?
+ // node <= 0.8.x
+ function (v, colors) {
+ return util.inspect(v, void 0, void 0, colors);
+ } :
+ // node > 0.8.x
+ function (v, colors) {
+ return util.inspect(v, { colors: colors });
+ }
+);
+
+exports.formatters.o = function(v) {
+ return inspect(v, this.useColors)
+ .replace(/\s*\n\s*/g, ' ');
+};
+
+/**
+ * Adds ANSI color escape codes if enabled.
+ *
+ * @api public
+ */
+
+function formatArgs() {
+ var args = arguments;
+ var useColors = this.useColors;
+ var name = this.namespace;
+
+ if (useColors) {
+ var c = this.color;
+
+ args[0] = ' \u001b[3' + c + ';1m' + name + ' '
+ + '\u001b[0m'
+ + args[0] + '\u001b[3' + c + 'm'
+ + ' +' + exports.humanize(this.diff) + '\u001b[0m';
+ } else {
+ args[0] = new Date().toUTCString()
+ + ' ' + name + ' ' + args[0];
+ }
+ return args;
+}
+
+/**
+ * Invokes `console.error()` with the specified arguments.
+ */
+
+function log() {
+ return stream.write(util.format.apply(this, arguments) + '\n');
+}
+
+/**
+ * Save `namespaces`.
+ *
+ * @param {String} namespaces
+ * @api private
+ */
+
+function save(namespaces) {
+ if (null == namespaces) {
+ // If you set a process.env field to null or undefined, it gets cast to the
+ // string 'null' or 'undefined'. Just delete instead.
+ delete process.env.DEBUG;
+ } else {
+ process.env.DEBUG = namespaces;
+ }
+}
+
+/**
+ * Load `namespaces`.
+ *
+ * @return {String} returns the previously persisted debug modes
+ * @api private
+ */
+
+function load() {
+ return process.env.DEBUG;
+}
+
+/**
+ * Copied from `node/src/node.js`.
+ *
+ * XXX: It's lame that node doesn't expose this API out-of-the-box. It also
+ * relies on the undocumented `tty_wrap.guessHandleType()` which is also lame.
+ */
+
+function createWritableStdioStream (fd) {
+ var stream;
+ var tty_wrap = process.binding('tty_wrap');
+
+ // Note stream._type is used for test-module-load-list.js
+
+ switch (tty_wrap.guessHandleType(fd)) {
+ case 'TTY':
+ stream = new tty.WriteStream(fd);
+ stream._type = 'tty';
+
+ // Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ case 'FILE':
+ var fs = require('fs');
+ stream = new fs.SyncWriteStream(fd, { autoClose: false });
+ stream._type = 'fs';
+ break;
+
+ case 'PIPE':
+ case 'TCP':
+ var net = require('net');
+ stream = new net.Socket({
+ fd: fd,
+ readable: false,
+ writable: true
+ });
+
+ // FIXME Should probably have an option in net.Socket to create a
+ // stream from an existing fd which is writable only. But for now
+ // we'll just add this hack and set the `readable` member to false.
+ // Test: ./node test/fixtures/echo.js < /etc/passwd
+ stream.readable = false;
+ stream.read = null;
+ stream._type = 'pipe';
+
+ // FIXME Hack to have stream not keep the event loop alive.
+ // See https://github.com/joyent/node/issues/1726
+ if (stream._handle && stream._handle.unref) {
+ stream._handle.unref();
+ }
+ break;
+
+ default:
+ // Probably an error on in uv_guess_handle()
+ throw new Error('Implement me. Unknown stream file type!');
+ }
+
+ // For supporting legacy API we put the FD here.
+ stream.fd = fd;
+
+ stream._isStdio = true;
+
+ return stream;
+}
+
+/**
+ * Enable namespaces listed in `process.env.DEBUG` initially.
+ */
+
+exports.enable(load());
diff --git a/server/node_modules/express/node_modules/debug/node_modules/ms/.npmignore b/server/node_modules/express/node_modules/debug/node_modules/ms/.npmignore
new file mode 100755
index 00000000..d1aa0ce4
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/node_modules/ms/.npmignore
@@ -0,0 +1,5 @@
+node_modules
+test
+History.md
+Makefile
+component.json
diff --git a/server/node_modules/express/node_modules/debug/node_modules/ms/LICENSE b/server/node_modules/express/node_modules/debug/node_modules/ms/LICENSE
new file mode 100755
index 00000000..6c07561b
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/node_modules/ms/LICENSE
@@ -0,0 +1,20 @@
+(The MIT License)
+
+Copyright (c) 2014 Guillermo Rauch
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/debug/node_modules/ms/README.md b/server/node_modules/express/node_modules/debug/node_modules/ms/README.md
new file mode 100755
index 00000000..0fd54fdc
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/node_modules/ms/README.md
@@ -0,0 +1,35 @@
+# ms.js: miliseconds conversion utility
+
+```js
+ms('2 days') // 172800000
+ms('1d') // 86400000
+ms('10h') // 36000000
+ms('2.5 hrs') // 9000000
+ms('2h') // 7200000
+ms('1m') // 60000
+ms('5s') // 5000
+ms('100') // 100
+```
+
+```js
+ms(60000) // "1m"
+ms(2 * 60000) // "2m"
+ms(ms('10 hours')) // "10h"
+```
+
+```js
+ms(60000, { long: true }) // "1 minute"
+ms(2 * 60000, { long: true }) // "2 minutes"
+ms(ms('10 hours'), { long: true }) // "10 hours"
+```
+
+- Node/Browser compatible. Published as [`ms`](https://www.npmjs.org/package/ms) in [NPM](nodejs.org/download).
+- If a number is supplied to `ms`, a string with a unit is returned.
+- If a string that contains the number is supplied, it returns it as
+a number (e.g: it returns `100` for `'100'`).
+- If you pass a string with a number and a valid unit, the number of
+equivalent ms is returned.
+
+## License
+
+MIT
diff --git a/server/node_modules/express/node_modules/debug/node_modules/ms/index.js b/server/node_modules/express/node_modules/debug/node_modules/ms/index.js
new file mode 100755
index 00000000..e79bfa18
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/node_modules/ms/index.js
@@ -0,0 +1,123 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ * - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} options
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options){
+ options = options || {};
+ if ('string' == typeof val) return parse(val);
+ return options.long
+ ? long(val)
+ : short(val);
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+ var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec(str);
+ if (!match) return;
+ var n = parseFloat(match[1]);
+ var type = (match[2] || 'ms').toLowerCase();
+ switch (type) {
+ case 'years':
+ case 'year':
+ case 'yrs':
+ case 'yr':
+ case 'y':
+ return n * y;
+ case 'days':
+ case 'day':
+ case 'd':
+ return n * d;
+ case 'hours':
+ case 'hour':
+ case 'hrs':
+ case 'hr':
+ case 'h':
+ return n * h;
+ case 'minutes':
+ case 'minute':
+ case 'mins':
+ case 'min':
+ case 'm':
+ return n * m;
+ case 'seconds':
+ case 'second':
+ case 'secs':
+ case 'sec':
+ case 's':
+ return n * s;
+ case 'milliseconds':
+ case 'millisecond':
+ case 'msecs':
+ case 'msec':
+ case 'ms':
+ return n;
+ }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function short(ms) {
+ if (ms >= d) return Math.round(ms / d) + 'd';
+ if (ms >= h) return Math.round(ms / h) + 'h';
+ if (ms >= m) return Math.round(ms / m) + 'm';
+ if (ms >= s) return Math.round(ms / s) + 's';
+ return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function long(ms) {
+ return plural(ms, d, 'day')
+ || plural(ms, h, 'hour')
+ || plural(ms, m, 'minute')
+ || plural(ms, s, 'second')
+ || ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, n, name) {
+ if (ms < n) return;
+ if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name;
+ return Math.ceil(ms / n) + ' ' + name + 's';
+}
diff --git a/server/node_modules/express/node_modules/debug/node_modules/ms/package.json b/server/node_modules/express/node_modules/debug/node_modules/ms/package.json
new file mode 100755
index 00000000..f1e5ef8f
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/node_modules/ms/package.json
@@ -0,0 +1,46 @@
+{
+ "name": "ms",
+ "version": "0.7.0",
+ "description": "Tiny ms conversion utility",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/guille/ms.js.git"
+ },
+ "main": "./index",
+ "devDependencies": {
+ "mocha": "*",
+ "expect.js": "*",
+ "serve": "*"
+ },
+ "component": {
+ "scripts": {
+ "ms/index.js": "index.js"
+ }
+ },
+ "gitHead": "1e9cd9b05ef0dc26f765434d2bfee42394376e52",
+ "bugs": {
+ "url": "https://github.com/guille/ms.js/issues"
+ },
+ "homepage": "https://github.com/guille/ms.js",
+ "_id": "ms@0.7.0",
+ "scripts": {},
+ "_shasum": "865be94c2e7397ad8a57da6a633a6e2f30798b83",
+ "_from": "ms@0.7.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "rauchg",
+ "email": "rauchg@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "rauchg",
+ "email": "rauchg@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "865be94c2e7397ad8a57da6a633a6e2f30798b83",
+ "tarball": "http://registry.npmjs.org/ms/-/ms-0.7.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/ms/-/ms-0.7.0.tgz"
+}
diff --git a/server/node_modules/express/node_modules/debug/package.json b/server/node_modules/express/node_modules/debug/package.json
new file mode 100755
index 00000000..c703a948
--- /dev/null
+++ b/server/node_modules/express/node_modules/debug/package.json
@@ -0,0 +1,72 @@
+{
+ "name": "debug",
+ "version": "2.1.3",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/visionmedia/debug.git"
+ },
+ "description": "small debugging utility",
+ "keywords": [
+ "debug",
+ "log",
+ "debugger"
+ ],
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ "contributors": [
+ {
+ "name": "Nathan Rajlich",
+ "email": "nathan@tootallnate.net",
+ "url": "http://n8.io"
+ }
+ ],
+ "license": "MIT",
+ "dependencies": {
+ "ms": "0.7.0"
+ },
+ "devDependencies": {
+ "browserify": "9.0.3",
+ "mocha": "*"
+ },
+ "main": "./node.js",
+ "browser": "./browser.js",
+ "component": {
+ "scripts": {
+ "debug/index.js": "browser.js",
+ "debug/debug.js": "debug.js"
+ }
+ },
+ "gitHead": "0a8e4b7e0d2d1b55ef4e7422498ca24c677ae63a",
+ "bugs": {
+ "url": "https://github.com/visionmedia/debug/issues"
+ },
+ "homepage": "https://github.com/visionmedia/debug",
+ "_id": "debug@2.1.3",
+ "scripts": {},
+ "_shasum": "ce8ab1b5ee8fbee2bfa3b633cab93d366b63418e",
+ "_from": "debug@~2.1.0",
+ "_npmVersion": "2.5.1",
+ "_nodeVersion": "0.12.0",
+ "_npmUser": {
+ "name": "tootallnate",
+ "email": "nathan@tootallnate.net"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "tootallnate",
+ "email": "nathan@tootallnate.net"
+ }
+ ],
+ "dist": {
+ "shasum": "ce8ab1b5ee8fbee2bfa3b633cab93d366b63418e",
+ "tarball": "http://registry.npmjs.org/debug/-/debug-2.1.3.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/debug/-/debug-2.1.3.tgz"
+}
diff --git a/server/node_modules/express/node_modules/depd/History.md b/server/node_modules/express/node_modules/depd/History.md
new file mode 100755
index 00000000..4a36a6cb
--- /dev/null
+++ b/server/node_modules/express/node_modules/depd/History.md
@@ -0,0 +1,75 @@
+1.0.1 / 2015-04-07
+==================
+
+ * Fix `TypeError`s when under `'use strict'` code
+ * Fix useless type name on auto-generated messages
+ * Support io.js 1.x
+ * Support Node.js 0.12
+
+1.0.0 / 2014-09-17
+==================
+
+ * No changes
+
+0.4.5 / 2014-09-09
+==================
+
+ * Improve call speed to functions using the function wrapper
+ * Support Node.js 0.6
+
+0.4.4 / 2014-07-27
+==================
+
+ * Work-around v8 generating empty stack traces
+
+0.4.3 / 2014-07-26
+==================
+
+ * Fix exception when global `Error.stackTraceLimit` is too low
+
+0.4.2 / 2014-07-19
+==================
+
+ * Correct call site for wrapped functions and properties
+
+0.4.1 / 2014-07-19
+==================
+
+ * Improve automatic message generation for function properties
+
+0.4.0 / 2014-07-19
+==================
+
+ * Add `TRACE_DEPRECATION` environment variable
+ * Remove non-standard grey color from color output
+ * Support `--no-deprecation` argument
+ * Support `--trace-deprecation` argument
+ * Support `deprecate.property(fn, prop, message)`
+
+0.3.0 / 2014-06-16
+==================
+
+ * Add `NO_DEPRECATION` environment variable
+
+0.2.0 / 2014-06-15
+==================
+
+ * Add `deprecate.property(obj, prop, message)`
+ * Remove `supports-color` dependency for node.js 0.8
+
+0.1.0 / 2014-06-15
+==================
+
+ * Add `deprecate.function(fn, message)`
+ * Add `process.on('deprecation', fn)` emitter
+ * Automatically generate message when omitted from `deprecate()`
+
+0.0.1 / 2014-06-15
+==================
+
+ * Fix warning for dynamic calls at singe call site
+
+0.0.0 / 2014-06-15
+==================
+
+ * Initial implementation
diff --git a/server/node_modules/express/node_modules/depd/LICENSE b/server/node_modules/express/node_modules/depd/LICENSE
new file mode 100755
index 00000000..b7dce6cf
--- /dev/null
+++ b/server/node_modules/express/node_modules/depd/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/depd/Readme.md b/server/node_modules/express/node_modules/depd/Readme.md
new file mode 100755
index 00000000..5ead5da7
--- /dev/null
+++ b/server/node_modules/express/node_modules/depd/Readme.md
@@ -0,0 +1,274 @@
+# depd
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Linux Build][travis-image]][travis-url]
+[![Windows Build][appveyor-image]][appveyor-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+[![Gratipay][gratipay-image]][gratipay-url]
+
+Deprecate all the things
+
+> With great modules comes great responsibility; mark things deprecated!
+
+## Install
+
+```sh
+$ npm install depd
+```
+
+## API
+
+```js
+var deprecate = require('depd')('my-module')
+```
+
+This library allows you to display deprecation messages to your users.
+This library goes above and beyond with deprecation warnings by
+introspection of the call stack (but only the bits that it is interested
+in).
+
+Instead of just warning on the first invocation of a deprecated
+function and never again, this module will warn on the first invocation
+of a deprecated function per unique call site, making it ideal to alert
+users of all deprecated uses across the code base, rather than just
+whatever happens to execute first.
+
+The deprecation warnings from this module also include the file and line
+information for the call into the module that the deprecated function was
+in.
+
+**NOTE** this library has a similar interface to the `debug` module, and
+this module uses the calling file to get the boundary for the call stacks,
+so you should always create a new `deprecate` object in each file and not
+within some central file.
+
+### depd(namespace)
+
+Create a new deprecate function that uses the given namespace name in the
+messages and will display the call site prior to the stack entering the
+file this function was called from. It is highly suggested you use the
+name of your module as the namespace.
+
+### deprecate(message)
+
+Call this function from deprecated code to display a deprecation message.
+This message will appear once per unique caller site. Caller site is the
+first call site in the stack in a different file from the caller of this
+function.
+
+If the message is omitted, a message is generated for you based on the site
+of the `deprecate()` call and will display the name of the function called,
+similar to the name displayed in a stack trace.
+
+### deprecate.function(fn, message)
+
+Call this function to wrap a given function in a deprecation message on any
+call to the function. An optional message can be supplied to provide a custom
+message.
+
+### deprecate.property(obj, prop, message)
+
+Call this function to wrap a given property on object in a deprecation message
+on any accessing or setting of the property. An optional message can be supplied
+to provide a custom message.
+
+The method must be called on the object where the property belongs (not
+inherited from the prototype).
+
+If the property is a data descriptor, it will be converted to an accessor
+descriptor in order to display the deprecation message.
+
+### process.on('deprecation', fn)
+
+This module will allow easy capturing of deprecation errors by emitting the
+errors as the type "deprecation" on the global `process`. If there are no
+listeners for this type, the errors are written to STDERR as normal, but if
+there are any listeners, nothing will be written to STDERR and instead only
+emitted. From there, you can write the errors in a different format or to a
+logging source.
+
+The error represents the deprecation and is emitted only once with the same
+rules as writing to STDERR. The error has the following properties:
+
+ - `message` - This is the message given by the library
+ - `name` - This is always `'DeprecationError'`
+ - `namespace` - This is the namespace the deprecation came from
+ - `stack` - This is the stack of the call to the deprecated thing
+
+Example `error.stack` output:
+
+```
+DeprecationError: my-cool-module deprecated oldfunction
+ at Object. ([eval]-wrapper:6:22)
+ at Module._compile (module.js:456:26)
+ at evalScript (node.js:532:25)
+ at startup (node.js:80:7)
+ at node.js:902:3
+```
+
+### process.env.NO_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `NO_DEPRECATION`
+is provided as a quick solution to silencing deprecation warnings from being
+output. The format of this is similar to that of `DEBUG`:
+
+```sh
+$ NO_DEPRECATION=my-module,othermod node app.js
+```
+
+This will suppress deprecations from being output for "my-module" and "othermod".
+The value is a list of comma-separated namespaces. To suppress every warning
+across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--no-deprecation` to the `node` executable will suppress
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not suppress the deperecations given to any "deprecation"
+event listeners, just the output to STDERR.
+
+### process.env.TRACE_DEPRECATION
+
+As a user of modules that are deprecated, the environment variable `TRACE_DEPRECATION`
+is provided as a solution to getting more detailed location information in deprecation
+warnings by including the entire stack trace. The format of this is the same as
+`NO_DEPRECATION`:
+
+```sh
+$ TRACE_DEPRECATION=my-module,othermod node app.js
+```
+
+This will include stack traces for deprecations being output for "my-module" and
+"othermod". The value is a list of comma-separated namespaces. To trace every
+warning across all namespaces, use the value `*` for a namespace.
+
+Providing the argument `--trace-deprecation` to the `node` executable will trace
+all deprecations (only available in Node.js 0.8 or higher).
+
+**NOTE** This will not trace the deperecations silenced by `NO_DEPRECATION`.
+
+## Display
+
+
+
+When a user calls a function in your library that you mark deprecated, they
+will see the following written to STDERR (in the given colors, similar colors
+and layout to the `debug` module):
+
+```
+bright cyan bright yellow
+| | reset cyan
+| | | |
+▼ ▼ ▼ ▼
+my-cool-module deprecated oldfunction [eval]-wrapper:6:22
+▲ ▲ ▲ ▲
+| | | |
+namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+If the user redirects their STDERR to a file or somewhere that does not support
+colors, they see (similar layout to the `debug` module):
+
+```
+Sun, 15 Jun 2014 05:21:37 GMT my-cool-module deprecated oldfunction at [eval]-wrapper:6:22
+▲ ▲ ▲ ▲ ▲
+| | | | |
+timestamp of message namespace | | location of mycoolmod.oldfunction() call
+ | deprecation message
+ the word "deprecated"
+```
+
+## Examples
+
+### Deprecating all calls to a function
+
+This will display a deprecated message about "oldfunction" being deprecated
+from "my-module" on STDERR.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+// message automatically derived from function name
+// Object.oldfunction
+exports.oldfunction = deprecate.function(function oldfunction() {
+ // all calls to function are deprecated
+})
+
+// specific message
+exports.oldfunction = deprecate.function(function () {
+ // all calls to function are deprecated
+}, 'oldfunction')
+```
+
+### Conditionally deprecating a function call
+
+This will display a deprecated message about "weirdfunction" being deprecated
+from "my-module" on STDERR when called with less than 2 arguments.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ }
+}
+```
+
+When calling `deprecate` as a function, the warning is counted per call site
+within your own module, so you can display different deprecations depending
+on different situations and the users will still get all the warnings:
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.weirdfunction = function () {
+ if (arguments.length < 2) {
+ // calls with 0 or 1 args are deprecated
+ deprecate('weirdfunction args < 2')
+ } else if (typeof arguments[0] !== 'string') {
+ // calls with non-string first argument are deprecated
+ deprecate('weirdfunction non-string first arg')
+ }
+}
+```
+
+### Deprecating property access
+
+This will display a deprecated message about "oldprop" being deprecated
+from "my-module" on STDERR when accessed. A deprecation will be displayed
+when setting the value and when getting the value.
+
+```js
+var deprecate = require('depd')('my-cool-module')
+
+exports.oldprop = 'something'
+
+// message automatically derives from property name
+deprecate.property(exports, 'oldprop')
+
+// explicit message
+deprecate.property(exports, 'oldprop', 'oldprop >= 0.10')
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-version-image]: https://img.shields.io/npm/v/depd.svg
+[npm-downloads-image]: https://img.shields.io/npm/dm/depd.svg
+[npm-url]: https://npmjs.org/package/depd
+[travis-image]: https://img.shields.io/travis/dougwilson/nodejs-depd/master.svg?label=linux
+[travis-url]: https://travis-ci.org/dougwilson/nodejs-depd
+[appveyor-image]: https://img.shields.io/appveyor/ci/dougwilson/nodejs-depd/master.svg?label=windows
+[appveyor-url]: https://ci.appveyor.com/project/dougwilson/nodejs-depd
+[coveralls-image]: https://img.shields.io/coveralls/dougwilson/nodejs-depd/master.svg
+[coveralls-url]: https://coveralls.io/r/dougwilson/nodejs-depd?branch=master
+[node-image]: https://img.shields.io/node/v/depd.svg
+[node-url]: http://nodejs.org/download/
+[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg
+[gratipay-url]: https://www.gratipay.com/dougwilson/
diff --git a/server/node_modules/express/node_modules/depd/index.js b/server/node_modules/express/node_modules/depd/index.js
new file mode 100755
index 00000000..d183b0a4
--- /dev/null
+++ b/server/node_modules/express/node_modules/depd/index.js
@@ -0,0 +1,529 @@
+/*!
+ * depd
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var callSiteToString = require('./lib/compat').callSiteToString
+var EventEmitter = require('events').EventEmitter
+var relative = require('path').relative
+
+/**
+ * Module exports.
+ */
+
+module.exports = depd
+
+/**
+ * Get the path to base files on.
+ */
+
+var basePath = process.cwd()
+
+/**
+ * Get listener count on event emitter.
+ */
+
+/*istanbul ignore next*/
+var eventListenerCount = EventEmitter.listenerCount
+ || function (emitter, type) { return emitter.listeners(type).length }
+
+/**
+ * Determine if namespace is contained in the string.
+ */
+
+function containsNamespace(str, namespace) {
+ var val = str.split(/[ ,]+/)
+
+ namespace = String(namespace).toLowerCase()
+
+ for (var i = 0 ; i < val.length; i++) {
+ if (!(str = val[i])) continue;
+
+ // namespace contained
+ if (str === '*' || str.toLowerCase() === namespace) {
+ return true
+ }
+ }
+
+ return false
+}
+
+/**
+ * Convert a data descriptor to accessor descriptor.
+ */
+
+function convertDataDescriptorToAccessor(obj, prop, message) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+ var value = descriptor.value
+
+ descriptor.get = function getter() { return value }
+
+ if (descriptor.writable) {
+ descriptor.set = function setter(val) { return value = val }
+ }
+
+ delete descriptor.value
+ delete descriptor.writable
+
+ Object.defineProperty(obj, prop, descriptor)
+
+ return descriptor
+}
+
+/**
+ * Create arguments string to keep arity.
+ */
+
+function createArgumentsString(arity) {
+ var str = ''
+
+ for (var i = 0; i < arity; i++) {
+ str += ', arg' + i
+ }
+
+ return str.substr(2)
+}
+
+/**
+ * Create stack string from stack.
+ */
+
+function createStackString(stack) {
+ var str = this.name + ': ' + this.namespace
+
+ if (this.message) {
+ str += ' deprecated ' + this.message
+ }
+
+ for (var i = 0; i < stack.length; i++) {
+ str += '\n at ' + callSiteToString(stack[i])
+ }
+
+ return str
+}
+
+/**
+ * Create deprecate for namespace in caller.
+ */
+
+function depd(namespace) {
+ if (!namespace) {
+ throw new TypeError('argument namespace is required')
+ }
+
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+ var file = site[0]
+
+ function deprecate(message) {
+ // call to self as log
+ log.call(deprecate, message)
+ }
+
+ deprecate._file = file
+ deprecate._ignored = isignored(namespace)
+ deprecate._namespace = namespace
+ deprecate._traced = istraced(namespace)
+ deprecate._warned = Object.create(null)
+
+ deprecate.function = wrapfunction
+ deprecate.property = wrapproperty
+
+ return deprecate
+}
+
+/**
+ * Determine if namespace is ignored.
+ */
+
+function isignored(namespace) {
+ /* istanbul ignore next: tested in a child processs */
+ if (process.noDeprecation) {
+ // --no-deprecation support
+ return true
+ }
+
+ var str = process.env.NO_DEPRECATION || ''
+
+ // namespace ignored
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Determine if namespace is traced.
+ */
+
+function istraced(namespace) {
+ /* istanbul ignore next: tested in a child processs */
+ if (process.traceDeprecation) {
+ // --trace-deprecation support
+ return true
+ }
+
+ var str = process.env.TRACE_DEPRECATION || ''
+
+ // namespace traced
+ return containsNamespace(str, namespace)
+}
+
+/**
+ * Display deprecation message.
+ */
+
+function log(message, site) {
+ var haslisteners = eventListenerCount(process, 'deprecation') !== 0
+
+ // abort early if no destination
+ if (!haslisteners && this._ignored) {
+ return
+ }
+
+ var caller
+ var callFile
+ var callSite
+ var i = 0
+ var seen = false
+ var stack = getStack()
+ var file = this._file
+
+ if (site) {
+ // provided site
+ callSite = callSiteLocation(stack[1])
+ callSite.name = site.name
+ file = callSite[0]
+ } else {
+ // get call site
+ i = 2
+ site = callSiteLocation(stack[i])
+ callSite = site
+ }
+
+ // get caller of deprecated thing in relation to file
+ for (; i < stack.length; i++) {
+ caller = callSiteLocation(stack[i])
+ callFile = caller[0]
+
+ if (callFile === file) {
+ seen = true
+ } else if (callFile === this._file) {
+ file = this._file
+ } else if (seen) {
+ break
+ }
+ }
+
+ var key = caller
+ ? site.join(':') + '__' + caller.join(':')
+ : undefined
+
+ if (key !== undefined && key in this._warned) {
+ // already warned
+ return
+ }
+
+ this._warned[key] = true
+
+ // generate automatic message from call site
+ if (!message) {
+ message = callSite === site || !callSite.name
+ ? defaultMessage(site)
+ : defaultMessage(callSite)
+ }
+
+ // emit deprecation if listeners exist
+ if (haslisteners) {
+ var err = DeprecationError(this._namespace, message, stack.slice(i))
+ process.emit('deprecation', err)
+ return
+ }
+
+ // format and write message
+ var format = process.stderr.isTTY
+ ? formatColor
+ : formatPlain
+ var msg = format.call(this, message, caller, stack.slice(i))
+ process.stderr.write(msg + '\n', 'utf8')
+
+ return
+}
+
+/**
+ * Get call site location as array.
+ */
+
+function callSiteLocation(callSite) {
+ var file = callSite.getFileName() || ''
+ var line = callSite.getLineNumber()
+ var colm = callSite.getColumnNumber()
+
+ if (callSite.isEval()) {
+ file = callSite.getEvalOrigin() + ', ' + file
+ }
+
+ var site = [file, line, colm]
+
+ site.callSite = callSite
+ site.name = callSite.getFunctionName()
+
+ return site
+}
+
+/**
+ * Generate a default message from the site.
+ */
+
+function defaultMessage(site) {
+ var callSite = site.callSite
+ var funcName = site.name
+
+ // make useful anonymous name
+ if (!funcName) {
+ funcName = ''
+ }
+
+ var context = callSite.getThis()
+ var typeName = context && callSite.getTypeName()
+
+ // ignore useless type name
+ if (typeName === 'Object') {
+ typeName = undefined
+ }
+
+ // make useful type name
+ if (typeName === 'Function') {
+ typeName = context.name || typeName
+ }
+
+ return typeName && callSite.getMethodName()
+ ? typeName + '.' + funcName
+ : funcName
+}
+
+/**
+ * Format deprecation message without color.
+ */
+
+function formatPlain(msg, caller, stack) {
+ var timestamp = new Date().toUTCString()
+
+ var formatted = timestamp
+ + ' ' + this._namespace
+ + ' deprecated ' + msg
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n at ' + callSiteToString(stack[i])
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' at ' + formatLocation(caller)
+ }
+
+ return formatted
+}
+
+/**
+ * Format deprecation message with color.
+ */
+
+function formatColor(msg, caller, stack) {
+ var formatted = '\x1b[36;1m' + this._namespace + '\x1b[22;39m' // bold cyan
+ + ' \x1b[33;1mdeprecated\x1b[22;39m' // bold yellow
+ + ' \x1b[0m' + msg + '\x1b[39m' // reset
+
+ // add stack trace
+ if (this._traced) {
+ for (var i = 0; i < stack.length; i++) {
+ formatted += '\n \x1b[36mat ' + callSiteToString(stack[i]) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+ }
+
+ if (caller) {
+ formatted += ' \x1b[36m' + formatLocation(caller) + '\x1b[39m' // cyan
+ }
+
+ return formatted
+}
+
+/**
+ * Format call site location.
+ */
+
+function formatLocation(callSite) {
+ return relative(basePath, callSite[0])
+ + ':' + callSite[1]
+ + ':' + callSite[2]
+}
+
+/**
+ * Get the stack as array of call sites.
+ */
+
+function getStack() {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = Math.max(10, limit)
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice this function off the top
+ var stack = obj.stack.slice(1)
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack
+}
+
+/**
+ * Capture call site stack from v8.
+ */
+
+function prepareObjectStackTrace(obj, stack) {
+ return stack
+}
+
+/**
+ * Return a wrapped function in a deprecation message.
+ */
+
+function wrapfunction(fn, message) {
+ if (typeof fn !== 'function') {
+ throw new TypeError('argument fn must be a function')
+ }
+
+ var args = createArgumentsString(fn.length)
+ var deprecate = this
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ site.name = fn.name
+
+ var deprecatedfn = eval('(function (' + args + ') {\n'
+ + '"use strict"\n'
+ + 'log.call(deprecate, message, site)\n'
+ + 'return fn.apply(this, arguments)\n'
+ + '})')
+
+ return deprecatedfn
+}
+
+/**
+ * Wrap property in a deprecation message.
+ */
+
+function wrapproperty(obj, prop, message) {
+ if (!obj || (typeof obj !== 'object' && typeof obj !== 'function')) {
+ throw new TypeError('argument obj must be object')
+ }
+
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop)
+
+ if (!descriptor) {
+ throw new TypeError('must call property on owner object')
+ }
+
+ if (!descriptor.configurable) {
+ throw new TypeError('property must be configurable')
+ }
+
+ var deprecate = this
+ var stack = getStack()
+ var site = callSiteLocation(stack[1])
+
+ // set site name
+ site.name = prop
+
+ // convert data descriptor
+ if ('value' in descriptor) {
+ descriptor = convertDataDescriptorToAccessor(obj, prop, message)
+ }
+
+ var get = descriptor.get
+ var set = descriptor.set
+
+ // wrap getter
+ if (typeof get === 'function') {
+ descriptor.get = function getter() {
+ log.call(deprecate, message, site)
+ return get.apply(this, arguments)
+ }
+ }
+
+ // wrap setter
+ if (typeof set === 'function') {
+ descriptor.set = function setter() {
+ log.call(deprecate, message, site)
+ return set.apply(this, arguments)
+ }
+ }
+
+ Object.defineProperty(obj, prop, descriptor)
+}
+
+/**
+ * Create DeprecationError for deprecation
+ */
+
+function DeprecationError(namespace, message, stack) {
+ var error = new Error()
+ var stackString
+
+ Object.defineProperty(error, 'constructor', {
+ value: DeprecationError
+ })
+
+ Object.defineProperty(error, 'message', {
+ configurable: true,
+ enumerable: false,
+ value: message,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'name', {
+ enumerable: false,
+ configurable: true,
+ value: 'DeprecationError',
+ writable: true
+ })
+
+ Object.defineProperty(error, 'namespace', {
+ configurable: true,
+ enumerable: false,
+ value: namespace,
+ writable: true
+ })
+
+ Object.defineProperty(error, 'stack', {
+ configurable: true,
+ enumerable: false,
+ get: function () {
+ if (stackString !== undefined) {
+ return stackString
+ }
+
+ // prepare stack trace
+ return stackString = createStackString.call(this, stack)
+ },
+ set: function setter(val) {
+ stackString = val
+ }
+ })
+
+ return error
+}
diff --git a/server/node_modules/express/node_modules/depd/lib/compat/buffer-concat.js b/server/node_modules/express/node_modules/depd/lib/compat/buffer-concat.js
new file mode 100755
index 00000000..09d97219
--- /dev/null
+++ b/server/node_modules/express/node_modules/depd/lib/compat/buffer-concat.js
@@ -0,0 +1,33 @@
+/*!
+ * depd
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = bufferConcat
+
+/**
+ * Concatenate an array of Buffers.
+ */
+
+function bufferConcat(bufs) {
+ var length = 0
+
+ for (var i = 0, len = bufs.length; i < len; i++) {
+ length += bufs[i].length
+ }
+
+ var buf = new Buffer(length)
+ var pos = 0
+
+ for (var i = 0, len = bufs.length; i < len; i++) {
+ bufs[i].copy(buf, pos)
+ pos += bufs[i].length
+ }
+
+ return buf
+}
diff --git a/server/node_modules/express/node_modules/depd/lib/compat/callsite-tostring.js b/server/node_modules/express/node_modules/depd/lib/compat/callsite-tostring.js
new file mode 100755
index 00000000..17cf7ed1
--- /dev/null
+++ b/server/node_modules/express/node_modules/depd/lib/compat/callsite-tostring.js
@@ -0,0 +1,101 @@
+/*!
+ * depd
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = callSiteToString
+
+/**
+ * Format a CallSite file location to a string.
+ */
+
+function callSiteFileLocation(callSite) {
+ var fileName
+ var fileLocation = ''
+
+ if (callSite.isNative()) {
+ fileLocation = 'native'
+ } else if (callSite.isEval()) {
+ fileName = callSite.getScriptNameOrSourceURL()
+ if (!fileName) {
+ fileLocation = callSite.getEvalOrigin()
+ }
+ } else {
+ fileName = callSite.getFileName()
+ }
+
+ if (fileName) {
+ fileLocation += fileName
+
+ var lineNumber = callSite.getLineNumber()
+ if (lineNumber != null) {
+ fileLocation += ':' + lineNumber
+
+ var columnNumber = callSite.getColumnNumber()
+ if (columnNumber) {
+ fileLocation += ':' + columnNumber
+ }
+ }
+ }
+
+ return fileLocation || 'unknown source'
+}
+
+/**
+ * Format a CallSite to a string.
+ */
+
+function callSiteToString(callSite) {
+ var addSuffix = true
+ var fileLocation = callSiteFileLocation(callSite)
+ var functionName = callSite.getFunctionName()
+ var isConstructor = callSite.isConstructor()
+ var isMethodCall = !(callSite.isToplevel() || isConstructor)
+ var line = ''
+
+ if (isMethodCall) {
+ var methodName = callSite.getMethodName()
+ var typeName = getConstructorName(callSite)
+
+ if (functionName) {
+ if (typeName && functionName.indexOf(typeName) !== 0) {
+ line += typeName + '.'
+ }
+
+ line += functionName
+
+ if (methodName && functionName.lastIndexOf('.' + methodName) !== functionName.length - methodName.length - 1) {
+ line += ' [as ' + methodName + ']'
+ }
+ } else {
+ line += typeName + '.' + (methodName || '')
+ }
+ } else if (isConstructor) {
+ line += 'new ' + (functionName || '')
+ } else if (functionName) {
+ line += functionName
+ } else {
+ addSuffix = false
+ line += fileLocation
+ }
+
+ if (addSuffix) {
+ line += ' (' + fileLocation + ')'
+ }
+
+ return line
+}
+
+/**
+ * Get constructor name of reviver.
+ */
+
+function getConstructorName(obj) {
+ var receiver = obj.receiver
+ return (receiver.constructor && receiver.constructor.name) || null
+}
diff --git a/server/node_modules/express/node_modules/depd/lib/compat/index.js b/server/node_modules/express/node_modules/depd/lib/compat/index.js
new file mode 100755
index 00000000..7fee026e
--- /dev/null
+++ b/server/node_modules/express/node_modules/depd/lib/compat/index.js
@@ -0,0 +1,69 @@
+/*!
+ * depd
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+lazyProperty(module.exports, 'bufferConcat', function bufferConcat() {
+ return Buffer.concat || require('./buffer-concat')
+})
+
+lazyProperty(module.exports, 'callSiteToString', function callSiteToString() {
+ var limit = Error.stackTraceLimit
+ var obj = {}
+ var prep = Error.prepareStackTrace
+
+ function prepareObjectStackTrace(obj, stack) {
+ return stack
+ }
+
+ Error.prepareStackTrace = prepareObjectStackTrace
+ Error.stackTraceLimit = 2
+
+ // capture the stack
+ Error.captureStackTrace(obj)
+
+ // slice the stack
+ var stack = obj.stack.slice()
+
+ Error.prepareStackTrace = prep
+ Error.stackTraceLimit = limit
+
+ return stack[0].toString ? toString : require('./callsite-tostring')
+})
+
+/**
+ * Define a lazy property.
+ */
+
+function lazyProperty(obj, prop, getter) {
+ function get() {
+ var val = getter()
+
+ Object.defineProperty(obj, prop, {
+ configurable: true,
+ enumerable: true,
+ value: val
+ })
+
+ return val
+ }
+
+ Object.defineProperty(obj, prop, {
+ configurable: true,
+ enumerable: true,
+ get: get
+ })
+}
+
+/**
+ * Call toString() on the obj
+ */
+
+function toString(obj) {
+ return obj.toString()
+}
diff --git a/server/node_modules/express/node_modules/depd/package.json b/server/node_modules/express/node_modules/depd/package.json
new file mode 100755
index 00000000..6adbbe07
--- /dev/null
+++ b/server/node_modules/express/node_modules/depd/package.json
@@ -0,0 +1,65 @@
+{
+ "name": "depd",
+ "description": "Deprecate all the things",
+ "version": "1.0.1",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "license": "MIT",
+ "keywords": [
+ "deprecate",
+ "deprecated"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/dougwilson/nodejs-depd"
+ },
+ "devDependencies": {
+ "benchmark": "1.0.0",
+ "beautify-benchmark": "0.2.4",
+ "istanbul": "0.3.5",
+ "mocha": "~1.21.5"
+ },
+ "files": [
+ "lib/",
+ "History.md",
+ "LICENSE",
+ "index.js",
+ "Readme.md"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "test": "mocha --reporter spec --bail test/",
+ "test-ci": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --no-exit test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/"
+ },
+ "gitHead": "769e0f8108463c35a6937a9d634ab19fee45100a",
+ "bugs": {
+ "url": "https://github.com/dougwilson/nodejs-depd/issues"
+ },
+ "homepage": "https://github.com/dougwilson/nodejs-depd",
+ "_id": "depd@1.0.1",
+ "_shasum": "80aec64c9d6d97e65cc2a9caa93c0aa6abf73aaa",
+ "_from": "depd@~1.0.0",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "80aec64c9d6d97e65cc2a9caa93c0aa6abf73aaa",
+ "tarball": "http://registry.npmjs.org/depd/-/depd-1.0.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/depd/-/depd-1.0.1.tgz"
+}
diff --git a/server/node_modules/express/node_modules/escape-html/.npmignore b/server/node_modules/express/node_modules/escape-html/.npmignore
new file mode 100755
index 00000000..48a2e246
--- /dev/null
+++ b/server/node_modules/express/node_modules/escape-html/.npmignore
@@ -0,0 +1,2 @@
+components
+build
diff --git a/server/node_modules/express/node_modules/escape-html/Makefile b/server/node_modules/express/node_modules/escape-html/Makefile
new file mode 100755
index 00000000..3f6119d2
--- /dev/null
+++ b/server/node_modules/express/node_modules/escape-html/Makefile
@@ -0,0 +1,11 @@
+
+build: components index.js
+ @component build
+
+components:
+ @Component install
+
+clean:
+ rm -fr build components template.js
+
+.PHONY: clean
diff --git a/server/node_modules/express/node_modules/escape-html/Readme.md b/server/node_modules/express/node_modules/escape-html/Readme.md
new file mode 100755
index 00000000..2cfcc997
--- /dev/null
+++ b/server/node_modules/express/node_modules/escape-html/Readme.md
@@ -0,0 +1,15 @@
+
+# escape-html
+
+ Escape HTML entities
+
+## Example
+
+```js
+var escape = require('escape-html');
+escape(str);
+```
+
+## License
+
+ MIT
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/escape-html/component.json b/server/node_modules/express/node_modules/escape-html/component.json
new file mode 100755
index 00000000..cb9740fd
--- /dev/null
+++ b/server/node_modules/express/node_modules/escape-html/component.json
@@ -0,0 +1,10 @@
+{
+ "name": "escape-html",
+ "description": "Escape HTML entities",
+ "version": "1.0.1",
+ "keywords": ["escape", "html", "utility"],
+ "dependencies": {},
+ "scripts": [
+ "index.js"
+ ]
+}
diff --git a/server/node_modules/express/node_modules/escape-html/index.js b/server/node_modules/express/node_modules/escape-html/index.js
new file mode 100755
index 00000000..27652114
--- /dev/null
+++ b/server/node_modules/express/node_modules/escape-html/index.js
@@ -0,0 +1,16 @@
+/**
+ * Escape special characters in the given string of html.
+ *
+ * @param {String} html
+ * @return {String}
+ * @api private
+ */
+
+module.exports = function(html) {
+ return String(html)
+ .replace(/&/g, '&')
+ .replace(/"/g, '"')
+ .replace(/'/g, ''')
+ .replace(//g, '>');
+}
diff --git a/server/node_modules/express/node_modules/escape-html/package.json b/server/node_modules/express/node_modules/escape-html/package.json
new file mode 100755
index 00000000..fefdb4e2
--- /dev/null
+++ b/server/node_modules/express/node_modules/escape-html/package.json
@@ -0,0 +1,46 @@
+{
+ "name": "escape-html",
+ "description": "Escape HTML entities",
+ "version": "1.0.1",
+ "keywords": [
+ "escape",
+ "html",
+ "utility"
+ ],
+ "dependencies": {},
+ "main": "index.js",
+ "component": {
+ "scripts": {
+ "escape-html/index.js": "index.js"
+ }
+ },
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/component/escape-html.git"
+ },
+ "bugs": {
+ "url": "https://github.com/component/escape-html/issues"
+ },
+ "homepage": "https://github.com/component/escape-html",
+ "_id": "escape-html@1.0.1",
+ "dist": {
+ "shasum": "181a286ead397a39a92857cfb1d43052e356bff0",
+ "tarball": "http://registry.npmjs.org/escape-html/-/escape-html-1.0.1.tgz"
+ },
+ "_from": "escape-html@1.0.1",
+ "_npmVersion": "1.3.15",
+ "_npmUser": {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ }
+ ],
+ "directories": {},
+ "_shasum": "181a286ead397a39a92857cfb1d43052e356bff0",
+ "_resolved": "https://registry.npmjs.org/escape-html/-/escape-html-1.0.1.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/etag/HISTORY.md b/server/node_modules/express/node_modules/etag/HISTORY.md
new file mode 100755
index 00000000..10cf5040
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/HISTORY.md
@@ -0,0 +1,55 @@
+1.5.1 / 2014-11-19
+==================
+
+ * deps: crc@3.2.1
+ - Minor fixes
+
+1.5.0 / 2014-10-14
+==================
+
+ * Improve string performance
+ * Slightly improve speed for weak ETags over 1KB
+
+1.4.0 / 2014-09-21
+==================
+
+ * Support "fake" stats objects
+ * Support Node.js 0.6
+
+1.3.1 / 2014-09-14
+==================
+
+ * Use the (new and improved) `crc` for crc32
+
+1.3.0 / 2014-08-29
+==================
+
+ * Default strings to strong ETags
+ * Improve speed for weak ETags over 1KB
+
+1.2.1 / 2014-08-29
+==================
+
+ * Use the (much faster) `buffer-crc32` for crc32
+
+1.2.0 / 2014-08-24
+==================
+
+ * Add support for file stat objects
+
+1.1.0 / 2014-08-24
+==================
+
+ * Add fast-path for empty entity
+ * Add weak ETag generation
+ * Shrink size of generated ETags
+
+1.0.1 / 2014-08-24
+==================
+
+ * Fix behavior of string containing Unicode
+
+1.0.0 / 2014-05-18
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/etag/LICENSE b/server/node_modules/express/node_modules/etag/LICENSE
new file mode 100755
index 00000000..b7dce6cf
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/etag/README.md b/server/node_modules/express/node_modules/etag/README.md
new file mode 100755
index 00000000..68c16d5c
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/README.md
@@ -0,0 +1,141 @@
+# etag
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Create simple ETags
+
+## Installation
+
+```sh
+$ npm install etag
+```
+
+## API
+
+```js
+var etag = require('etag')
+```
+
+### etag(entity, [options])
+
+Generate a strong ETag for the given entity. This should be the complete
+body of the entity. Strings, `Buffer`s, and `fs.Stats` are accepted. By
+default, a strong ETag is generated except for `fs.Stats`, which will
+generate a weak ETag (this can be overwritten by `options.weak`).
+
+```js
+res.setHeader('ETag', etag(body))
+```
+
+#### Options
+
+`etag` accepts these properties in the options object.
+
+##### weak
+
+Specifies if a "strong" or a "weak" ETag will be generated. The ETag can only
+really be a strong as the given input.
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmark
+
+```bash
+$ npm run-script bench
+
+> etag@1.5.1 bench nodejs-etag
+> node benchmark/index.js
+
+> node benchmark/body0-100b.js
+
+ 100B body
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+ 4 tests completed.
+
+ buffer - strong x 425,007 ops/sec ±1.47% (184 runs sampled)
+* buffer - weak x 1,009,859 ops/sec ±0.18% (197 runs sampled)
+ string - strong x 442,096 ops/sec ±1.20% (181 runs sampled)
+ string - weak x 325,063 ops/sec ±0.31% (192 runs sampled)
+
+> node benchmark/body1-1kb.js
+
+ 1KB body
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+ 4 tests completed.
+
+ buffer - strong x 263,069 ops/sec ±1.60% (190 runs sampled)
+* buffer - weak x 295,732 ops/sec ±0.43% (199 runs sampled)
+ string - strong x 274,822 ops/sec ±1.15% (191 runs sampled)
+ string - weak x 169,473 ops/sec ±1.59% (194 runs sampled)
+
+> node benchmark/body2-5kb.js
+
+ 5KB body
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+ 4 tests completed.
+
+ buffer - strong x 104,299 ops/sec ±0.60% (193 runs sampled)
+* buffer - weak x 108,126 ops/sec ±0.65% (196 runs sampled)
+ string - strong x 101,736 ops/sec ±0.78% (194 runs sampled)
+ string - weak x 101,266 ops/sec ±0.85% (192 runs sampled)
+
+> node benchmark/body3-10kb.js
+
+ 10KB body
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+ 4 tests completed.
+
+ buffer - strong x 59,007 ops/sec ±0.29% (198 runs sampled)
+* buffer - weak x 60,968 ops/sec ±0.48% (197 runs sampled)
+ string - strong x 51,873 ops/sec ±1.78% (178 runs sampled)
+ string - weak x 52,307 ops/sec ±2.63% (193 runs sampled)
+
+> node benchmark/body4-100kb.js
+
+ 100KB body
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+ 4 tests completed.
+
+ buffer - strong x 6,712 ops/sec ±0.11% (198 runs sampled)
+* buffer - weak x 6,716 ops/sec ±0.50% (196 runs sampled)
+ string - strong x 6,397 ops/sec ±0.36% (196 runs sampled)
+ string - weak x 6,635 ops/sec ±0.15% (198 runs sampled)
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/etag.svg?style=flat
+[npm-url]: https://npmjs.org/package/etag
+[node-version-image]: https://img.shields.io/node/v/etag.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/etag.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/etag
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/etag.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/etag?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/etag.svg?style=flat
+[downloads-url]: https://npmjs.org/package/etag
diff --git a/server/node_modules/express/node_modules/etag/index.js b/server/node_modules/express/node_modules/etag/index.js
new file mode 100755
index 00000000..bb05eb7e
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/index.js
@@ -0,0 +1,171 @@
+/*!
+ * etag
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = etag
+
+/**
+ * Module dependencies.
+ */
+
+var crc = require('crc').crc32
+var crypto = require('crypto')
+var Stats = require('fs').Stats
+
+/**
+ * Module variables.
+ */
+
+var crc32threshold = 1000 // 1KB
+var NULL = new Buffer([0])
+var toString = Object.prototype.toString
+
+/**
+ * Create a simple ETag.
+ *
+ * @param {string|Buffer|Stats} entity
+ * @param {object} [options]
+ * @param {boolean} [options.weak]
+ * @return {String}
+ * @api public
+ */
+
+function etag(entity, options) {
+ if (entity == null) {
+ throw new TypeError('argument entity is required')
+ }
+
+ var isStats = isstats(entity)
+ var weak = options && typeof options.weak === 'boolean'
+ ? options.weak
+ : isStats
+
+ // support fs.Stats object
+ if (isStats) {
+ return stattag(entity, weak)
+ }
+
+ if (typeof entity !== 'string' && !Buffer.isBuffer(entity)) {
+ throw new TypeError('argument entity must be string, Buffer, or fs.Stats')
+ }
+
+ var hash = weak
+ ? weakhash(entity)
+ : stronghash(entity)
+
+ return weak
+ ? 'W/"' + hash + '"'
+ : '"' + hash + '"'
+}
+
+/**
+ * Determine if object is a Stats object.
+ *
+ * @param {object} obj
+ * @return {boolean}
+ * @api private
+ */
+
+function isstats(obj) {
+ // not even an object
+ if (obj === null || typeof obj !== 'object') {
+ return false
+ }
+
+ // genuine fs.Stats
+ if (obj instanceof Stats) {
+ return true
+ }
+
+ // quack quack
+ return 'atime' in obj && toString.call(obj.atime) === '[object Date]'
+ && 'ctime' in obj && toString.call(obj.ctime) === '[object Date]'
+ && 'mtime' in obj && toString.call(obj.mtime) === '[object Date]'
+ && 'ino' in obj && typeof obj.ino === 'number'
+ && 'size' in obj && typeof obj.size === 'number'
+}
+
+/**
+ * Generate a tag for a stat.
+ *
+ * @param {Buffer} entity
+ * @return {String}
+ * @api private
+ */
+
+function stattag(stat, weak) {
+ var mtime = stat.mtime.toISOString()
+ var size = stat.size.toString(16)
+
+ if (weak) {
+ return 'W/"' + size + '-' + crc(mtime) + '"'
+ }
+
+ var hash = crypto
+ .createHash('md5')
+ .update('file', 'utf8')
+ .update(NULL)
+ .update(size, 'utf8')
+ .update(NULL)
+ .update(mtime, 'utf8')
+ .digest('base64')
+
+ return '"' + hash + '"'
+}
+
+/**
+ * Generate a strong hash.
+ *
+ * @param {Buffer} entity
+ * @return {String}
+ * @api private
+ */
+
+function stronghash(entity) {
+ if (entity.length === 0) {
+ // fast-path empty
+ return '1B2M2Y8AsgTpgAmY7PhCfg=='
+ }
+
+ return crypto
+ .createHash('md5')
+ .update(entity, 'utf8')
+ .digest('base64')
+}
+
+/**
+ * Generate a weak hash.
+ *
+ * @param {Buffer} entity
+ * @return {String}
+ * @api private
+ */
+
+function weakhash(entity) {
+ if (entity.length === 0) {
+ // fast-path empty
+ return '0-0'
+ }
+
+ var len = typeof entity === 'string'
+ ? Buffer.byteLength(entity, 'utf8')
+ : entity.length
+
+ if (len <= crc32threshold) {
+ // crc32 plus length when it's fast
+ // crc(str) only accepts utf-8 encoding
+ return len.toString(16) + '-' + crc(entity).toString(16)
+ }
+
+ // use md4 for long strings
+ return crypto
+ .createHash('md4')
+ .update(entity, 'utf8')
+ .digest('base64')
+}
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/.npmignore b/server/node_modules/express/node_modules/etag/node_modules/crc/.npmignore
new file mode 100755
index 00000000..57d4cb8a
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/.npmignore
@@ -0,0 +1,5 @@
+benchmark
+src
+test
+.travis.yml
+bitcoin.png
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/LICENSE b/server/node_modules/express/node_modules/etag/node_modules/crc/LICENSE
new file mode 100755
index 00000000..c49097c5
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/LICENSE
@@ -0,0 +1,22 @@
+The MIT License (MIT)
+
+Copyright 2014 Alex Gorbatchev
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND
+NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE
+LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION
+OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION
+WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/README.md b/server/node_modules/express/node_modules/etag/node_modules/crc/README.md
new file mode 100755
index 00000000..6473cbd0
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/README.md
@@ -0,0 +1,98 @@
+# crc
+
+[](https://www.gittip.com/alexgorbatchev/)
+[](https://david-dm.org/alexgorbatchev/node-crc)
+[](https://david-dm.org/alexgorbatchev/node-crc#info=devDependencies)
+[](https://travis-ci.org/alexgorbatchev/node-crc)
+
+[](https://npmjs.org/package/node-crc)
+
+Module for calculating Cyclic Redundancy Check (CRC).
+
+## Features
+
+* Full test suite comparing values against reference `pycrc` implementation.
+* Version 3.x is 3x to 4x faster than version 2.x.
+* Pure JavaScript implementation, no dependencies.
+* Provides CRC Tables for optimized calculations.
+* Provides support for the following CRC algorithms:
+ * CRC1 `crc.crc1(…)`
+ * CRC8 `crc.crc8(…)`
+ * CRC8 1-Wire `crc.crc81wire(…)`
+ * CRC16 `crc.crc16(…)`
+ * CRC16 CCITT `crc.crc16ccitt(…)`
+ * CRC16 Modbus `crc.crc16modbus(…)`
+ * CRC24 `crc.crc24(…)`
+ * CRC32 `crc.crc32(…)`
+
+## IMPORTANT
+
+If you've used `crc` module prior to version 2.x, you might have some inconsistentcies with the current implementation because it relied on very old code and wasn't checked against reference implementation. If you upgrading from 1.x, please take special care.
+
+## Support
+
+
Please support me on [GitTip](https://www.gittip.com/alexgorbatchev/). I've spend days developing and grooming this module and hope to spend more time. If you have bitcoin, please use the QR code or this wallet address [`1CZyBREeHTmy8C5zVGHZHPwqBuWFmEuUCQ`](https://blockchain.info/address/1CZyBREeHTmy8C5zVGHZHPwqBuWFmEuUCQ):
+
+## Installation
+
+ npm install crc
+
+## Running tests
+
+ $ npm install
+ $ npm test
+
+## Usage Example
+
+Calculate a CRC32:
+
+ var crc = require('crc');
+
+ crc.crc32('hello').toString(16);
+ # => "3610a686"
+
+Calculate a CRC32 of a file:
+
+ crc.crc32(fs.readFileSync('README.md', 'utf8')).toString(16);
+ # => "127ad531"
+
+Or using a `Buffer`:
+
+ crc.crc32(fs.readFileSync('README.md')).toString(16);
+ # => "127ad531"
+
+Incrementally calculate a CRC32:
+
+ value = crc32('one');
+ value = crc32('two', value);
+ value = crc32('three', value);
+ value.toString(16);
+ # => "09e1c092"
+
+## Thanks!
+
+[pycrc](http://www.tty1.net/pycrc/) library is which the source of all of the CRC tables.
+
+# License
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Alex Gorbatchev
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc.js
new file mode 100755
index 00000000..1c342b7e
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc.js
@@ -0,0 +1,71 @@
+// Generated by CoffeeScript 1.7.1
+var CRC, hex;
+
+hex = require('./hex');
+
+module.exports = CRC = (function() {
+ CRC.prototype.INIT_CRC = 0x00;
+
+ CRC.prototype.XOR_MASK = 0x00;
+
+ CRC.prototype.WIDTH = 0;
+
+ CRC.prototype.pack = function(crc) {
+ return '';
+ };
+
+ CRC.prototype.each_byte = function(buf, cb) {
+ var i, _i, _ref, _results;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ _results = [];
+ for (i = _i = 0, _ref = buf.length - 1; 0 <= _ref ? _i <= _ref : _i >= _ref; i = 0 <= _ref ? ++_i : --_i) {
+ _results.push(cb(buf[i]));
+ }
+ return _results;
+ };
+
+ function CRC() {
+ this.crc = this.INIT_CRC;
+ }
+
+ CRC.prototype.digest_length = function() {
+ return Math.ceil(this.WIDTH / 8.0);
+ };
+
+ CRC.prototype.update = function(data) {};
+
+ CRC.prototype.reset = function() {
+ return this.crc = this.INIT_CRC;
+ };
+
+ CRC.prototype.checksum = function(signed) {
+ var sum;
+ if (signed == null) {
+ signed = true;
+ }
+ sum = this.crc ^ this.XOR_MASK;
+ if (signed) {
+ sum = sum >>> 0;
+ }
+ return sum;
+ };
+
+ CRC.prototype.finish = function() {
+ return this.pack(this.checksum());
+ };
+
+ CRC.prototype.hexdigest = function(value) {
+ var result;
+ if (value != null) {
+ this.update(value);
+ }
+ result = this.finish();
+ this.reset();
+ return result;
+ };
+
+ return CRC;
+
+})();
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc1.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc1.js
new file mode 100755
index 00000000..f0945678
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc1.js
@@ -0,0 +1,21 @@
+// Generated by CoffeeScript 1.7.1
+var Buffer, create;
+
+Buffer = require('buffer').Buffer;
+
+create = require('./create');
+
+module.exports = create('crc1', function(buf, previous) {
+ var accum, byte, crc, _i, _len;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ crc = ~~previous;
+ accum = 0;
+ for (_i = 0, _len = buf.length; _i < _len; _i++) {
+ byte = buf[_i];
+ accum += byte;
+ }
+ crc += accum % 256;
+ return crc % 256;
+});
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16.js
new file mode 100755
index 00000000..a09cd1ef
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16.js
@@ -0,0 +1,25 @@
+// Generated by CoffeeScript 1.7.1
+var Buffer, TABLE, create;
+
+Buffer = require('buffer').Buffer;
+
+create = require('./create');
+
+TABLE = [0x0000, 0xc0c1, 0xc181, 0x0140, 0xc301, 0x03c0, 0x0280, 0xc241, 0xc601, 0x06c0, 0x0780, 0xc741, 0x0500, 0xc5c1, 0xc481, 0x0440, 0xcc01, 0x0cc0, 0x0d80, 0xcd41, 0x0f00, 0xcfc1, 0xce81, 0x0e40, 0x0a00, 0xcac1, 0xcb81, 0x0b40, 0xc901, 0x09c0, 0x0880, 0xc841, 0xd801, 0x18c0, 0x1980, 0xd941, 0x1b00, 0xdbc1, 0xda81, 0x1a40, 0x1e00, 0xdec1, 0xdf81, 0x1f40, 0xdd01, 0x1dc0, 0x1c80, 0xdc41, 0x1400, 0xd4c1, 0xd581, 0x1540, 0xd701, 0x17c0, 0x1680, 0xd641, 0xd201, 0x12c0, 0x1380, 0xd341, 0x1100, 0xd1c1, 0xd081, 0x1040, 0xf001, 0x30c0, 0x3180, 0xf141, 0x3300, 0xf3c1, 0xf281, 0x3240, 0x3600, 0xf6c1, 0xf781, 0x3740, 0xf501, 0x35c0, 0x3480, 0xf441, 0x3c00, 0xfcc1, 0xfd81, 0x3d40, 0xff01, 0x3fc0, 0x3e80, 0xfe41, 0xfa01, 0x3ac0, 0x3b80, 0xfb41, 0x3900, 0xf9c1, 0xf881, 0x3840, 0x2800, 0xe8c1, 0xe981, 0x2940, 0xeb01, 0x2bc0, 0x2a80, 0xea41, 0xee01, 0x2ec0, 0x2f80, 0xef41, 0x2d00, 0xedc1, 0xec81, 0x2c40, 0xe401, 0x24c0, 0x2580, 0xe541, 0x2700, 0xe7c1, 0xe681, 0x2640, 0x2200, 0xe2c1, 0xe381, 0x2340, 0xe101, 0x21c0, 0x2080, 0xe041, 0xa001, 0x60c0, 0x6180, 0xa141, 0x6300, 0xa3c1, 0xa281, 0x6240, 0x6600, 0xa6c1, 0xa781, 0x6740, 0xa501, 0x65c0, 0x6480, 0xa441, 0x6c00, 0xacc1, 0xad81, 0x6d40, 0xaf01, 0x6fc0, 0x6e80, 0xae41, 0xaa01, 0x6ac0, 0x6b80, 0xab41, 0x6900, 0xa9c1, 0xa881, 0x6840, 0x7800, 0xb8c1, 0xb981, 0x7940, 0xbb01, 0x7bc0, 0x7a80, 0xba41, 0xbe01, 0x7ec0, 0x7f80, 0xbf41, 0x7d00, 0xbdc1, 0xbc81, 0x7c40, 0xb401, 0x74c0, 0x7580, 0xb541, 0x7700, 0xb7c1, 0xb681, 0x7640, 0x7200, 0xb2c1, 0xb381, 0x7340, 0xb101, 0x71c0, 0x7080, 0xb041, 0x5000, 0x90c1, 0x9181, 0x5140, 0x9301, 0x53c0, 0x5280, 0x9241, 0x9601, 0x56c0, 0x5780, 0x9741, 0x5500, 0x95c1, 0x9481, 0x5440, 0x9c01, 0x5cc0, 0x5d80, 0x9d41, 0x5f00, 0x9fc1, 0x9e81, 0x5e40, 0x5a00, 0x9ac1, 0x9b81, 0x5b40, 0x9901, 0x59c0, 0x5880, 0x9841, 0x8801, 0x48c0, 0x4980, 0x8941, 0x4b00, 0x8bc1, 0x8a81, 0x4a40, 0x4e00, 0x8ec1, 0x8f81, 0x4f40, 0x8d01, 0x4dc0, 0x4c80, 0x8c41, 0x4400, 0x84c1, 0x8581, 0x4540, 0x8701, 0x47c0, 0x4680, 0x8641, 0x8201, 0x42c0, 0x4380, 0x8341, 0x4100, 0x81c1, 0x8081, 0x4040];
+
+if (typeof Int32Array !== 'undefined') {
+ TABLE = new Int32Array(TABLE);
+}
+
+module.exports = create('crc-16', function(buf, previous) {
+ var byte, crc, _i, _len;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ crc = ~~previous;
+ for (_i = 0, _len = buf.length; _i < _len; _i++) {
+ byte = buf[_i];
+ crc = (TABLE[(crc ^ byte) & 0xff] ^ (crc >> 8)) & 0xffff;
+ }
+ return crc;
+});
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16_ccitt.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16_ccitt.js
new file mode 100755
index 00000000..0bdb0bf6
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16_ccitt.js
@@ -0,0 +1,25 @@
+// Generated by CoffeeScript 1.7.1
+var Buffer, TABLE, create;
+
+Buffer = require('buffer').Buffer;
+
+create = require('./create');
+
+TABLE = [0x0000, 0x1021, 0x2042, 0x3063, 0x4084, 0x50a5, 0x60c6, 0x70e7, 0x8108, 0x9129, 0xa14a, 0xb16b, 0xc18c, 0xd1ad, 0xe1ce, 0xf1ef, 0x1231, 0x0210, 0x3273, 0x2252, 0x52b5, 0x4294, 0x72f7, 0x62d6, 0x9339, 0x8318, 0xb37b, 0xa35a, 0xd3bd, 0xc39c, 0xf3ff, 0xe3de, 0x2462, 0x3443, 0x0420, 0x1401, 0x64e6, 0x74c7, 0x44a4, 0x5485, 0xa56a, 0xb54b, 0x8528, 0x9509, 0xe5ee, 0xf5cf, 0xc5ac, 0xd58d, 0x3653, 0x2672, 0x1611, 0x0630, 0x76d7, 0x66f6, 0x5695, 0x46b4, 0xb75b, 0xa77a, 0x9719, 0x8738, 0xf7df, 0xe7fe, 0xd79d, 0xc7bc, 0x48c4, 0x58e5, 0x6886, 0x78a7, 0x0840, 0x1861, 0x2802, 0x3823, 0xc9cc, 0xd9ed, 0xe98e, 0xf9af, 0x8948, 0x9969, 0xa90a, 0xb92b, 0x5af5, 0x4ad4, 0x7ab7, 0x6a96, 0x1a71, 0x0a50, 0x3a33, 0x2a12, 0xdbfd, 0xcbdc, 0xfbbf, 0xeb9e, 0x9b79, 0x8b58, 0xbb3b, 0xab1a, 0x6ca6, 0x7c87, 0x4ce4, 0x5cc5, 0x2c22, 0x3c03, 0x0c60, 0x1c41, 0xedae, 0xfd8f, 0xcdec, 0xddcd, 0xad2a, 0xbd0b, 0x8d68, 0x9d49, 0x7e97, 0x6eb6, 0x5ed5, 0x4ef4, 0x3e13, 0x2e32, 0x1e51, 0x0e70, 0xff9f, 0xefbe, 0xdfdd, 0xcffc, 0xbf1b, 0xaf3a, 0x9f59, 0x8f78, 0x9188, 0x81a9, 0xb1ca, 0xa1eb, 0xd10c, 0xc12d, 0xf14e, 0xe16f, 0x1080, 0x00a1, 0x30c2, 0x20e3, 0x5004, 0x4025, 0x7046, 0x6067, 0x83b9, 0x9398, 0xa3fb, 0xb3da, 0xc33d, 0xd31c, 0xe37f, 0xf35e, 0x02b1, 0x1290, 0x22f3, 0x32d2, 0x4235, 0x5214, 0x6277, 0x7256, 0xb5ea, 0xa5cb, 0x95a8, 0x8589, 0xf56e, 0xe54f, 0xd52c, 0xc50d, 0x34e2, 0x24c3, 0x14a0, 0x0481, 0x7466, 0x6447, 0x5424, 0x4405, 0xa7db, 0xb7fa, 0x8799, 0x97b8, 0xe75f, 0xf77e, 0xc71d, 0xd73c, 0x26d3, 0x36f2, 0x0691, 0x16b0, 0x6657, 0x7676, 0x4615, 0x5634, 0xd94c, 0xc96d, 0xf90e, 0xe92f, 0x99c8, 0x89e9, 0xb98a, 0xa9ab, 0x5844, 0x4865, 0x7806, 0x6827, 0x18c0, 0x08e1, 0x3882, 0x28a3, 0xcb7d, 0xdb5c, 0xeb3f, 0xfb1e, 0x8bf9, 0x9bd8, 0xabbb, 0xbb9a, 0x4a75, 0x5a54, 0x6a37, 0x7a16, 0x0af1, 0x1ad0, 0x2ab3, 0x3a92, 0xfd2e, 0xed0f, 0xdd6c, 0xcd4d, 0xbdaa, 0xad8b, 0x9de8, 0x8dc9, 0x7c26, 0x6c07, 0x5c64, 0x4c45, 0x3ca2, 0x2c83, 0x1ce0, 0x0cc1, 0xef1f, 0xff3e, 0xcf5d, 0xdf7c, 0xaf9b, 0xbfba, 0x8fd9, 0x9ff8, 0x6e17, 0x7e36, 0x4e55, 0x5e74, 0x2e93, 0x3eb2, 0x0ed1, 0x1ef0];
+
+if (typeof Int32Array !== 'undefined') {
+ TABLE = new Int32Array(TABLE);
+}
+
+module.exports = create('ccitt', function(buf, previous) {
+ var byte, crc, _i, _len;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ crc = previous != null ? ~~previous : 0xffff;
+ for (_i = 0, _len = buf.length; _i < _len; _i++) {
+ byte = buf[_i];
+ crc = (TABLE[((crc >> 8) ^ byte) & 0xff] ^ (crc << 8)) & 0xffff;
+ }
+ return crc;
+});
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16_modbus.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16_modbus.js
new file mode 100755
index 00000000..52a536a0
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc16_modbus.js
@@ -0,0 +1,25 @@
+// Generated by CoffeeScript 1.7.1
+var Buffer, TABLE, create;
+
+Buffer = require('buffer').Buffer;
+
+create = require('./create');
+
+TABLE = [0x0000, 0xc0c1, 0xc181, 0x0140, 0xc301, 0x03c0, 0x0280, 0xc241, 0xc601, 0x06c0, 0x0780, 0xc741, 0x0500, 0xc5c1, 0xc481, 0x0440, 0xcc01, 0x0cc0, 0x0d80, 0xcd41, 0x0f00, 0xcfc1, 0xce81, 0x0e40, 0x0a00, 0xcac1, 0xcb81, 0x0b40, 0xc901, 0x09c0, 0x0880, 0xc841, 0xd801, 0x18c0, 0x1980, 0xd941, 0x1b00, 0xdbc1, 0xda81, 0x1a40, 0x1e00, 0xdec1, 0xdf81, 0x1f40, 0xdd01, 0x1dc0, 0x1c80, 0xdc41, 0x1400, 0xd4c1, 0xd581, 0x1540, 0xd701, 0x17c0, 0x1680, 0xd641, 0xd201, 0x12c0, 0x1380, 0xd341, 0x1100, 0xd1c1, 0xd081, 0x1040, 0xf001, 0x30c0, 0x3180, 0xf141, 0x3300, 0xf3c1, 0xf281, 0x3240, 0x3600, 0xf6c1, 0xf781, 0x3740, 0xf501, 0x35c0, 0x3480, 0xf441, 0x3c00, 0xfcc1, 0xfd81, 0x3d40, 0xff01, 0x3fc0, 0x3e80, 0xfe41, 0xfa01, 0x3ac0, 0x3b80, 0xfb41, 0x3900, 0xf9c1, 0xf881, 0x3840, 0x2800, 0xe8c1, 0xe981, 0x2940, 0xeb01, 0x2bc0, 0x2a80, 0xea41, 0xee01, 0x2ec0, 0x2f80, 0xef41, 0x2d00, 0xedc1, 0xec81, 0x2c40, 0xe401, 0x24c0, 0x2580, 0xe541, 0x2700, 0xe7c1, 0xe681, 0x2640, 0x2200, 0xe2c1, 0xe381, 0x2340, 0xe101, 0x21c0, 0x2080, 0xe041, 0xa001, 0x60c0, 0x6180, 0xa141, 0x6300, 0xa3c1, 0xa281, 0x6240, 0x6600, 0xa6c1, 0xa781, 0x6740, 0xa501, 0x65c0, 0x6480, 0xa441, 0x6c00, 0xacc1, 0xad81, 0x6d40, 0xaf01, 0x6fc0, 0x6e80, 0xae41, 0xaa01, 0x6ac0, 0x6b80, 0xab41, 0x6900, 0xa9c1, 0xa881, 0x6840, 0x7800, 0xb8c1, 0xb981, 0x7940, 0xbb01, 0x7bc0, 0x7a80, 0xba41, 0xbe01, 0x7ec0, 0x7f80, 0xbf41, 0x7d00, 0xbdc1, 0xbc81, 0x7c40, 0xb401, 0x74c0, 0x7580, 0xb541, 0x7700, 0xb7c1, 0xb681, 0x7640, 0x7200, 0xb2c1, 0xb381, 0x7340, 0xb101, 0x71c0, 0x7080, 0xb041, 0x5000, 0x90c1, 0x9181, 0x5140, 0x9301, 0x53c0, 0x5280, 0x9241, 0x9601, 0x56c0, 0x5780, 0x9741, 0x5500, 0x95c1, 0x9481, 0x5440, 0x9c01, 0x5cc0, 0x5d80, 0x9d41, 0x5f00, 0x9fc1, 0x9e81, 0x5e40, 0x5a00, 0x9ac1, 0x9b81, 0x5b40, 0x9901, 0x59c0, 0x5880, 0x9841, 0x8801, 0x48c0, 0x4980, 0x8941, 0x4b00, 0x8bc1, 0x8a81, 0x4a40, 0x4e00, 0x8ec1, 0x8f81, 0x4f40, 0x8d01, 0x4dc0, 0x4c80, 0x8c41, 0x4400, 0x84c1, 0x8581, 0x4540, 0x8701, 0x47c0, 0x4680, 0x8641, 0x8201, 0x42c0, 0x4380, 0x8341, 0x4100, 0x81c1, 0x8081, 0x4040];
+
+if (typeof Int32Array !== 'undefined') {
+ TABLE = new Int32Array(TABLE);
+}
+
+module.exports = create('crc-16-modbus', function(buf, previous) {
+ var byte, crc, _i, _len;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ crc = previous != null ? ~~previous : 0xffff;
+ for (_i = 0, _len = buf.length; _i < _len; _i++) {
+ byte = buf[_i];
+ crc = (TABLE[(crc ^ byte) & 0xff] ^ (crc >> 8)) & 0xffff;
+ }
+ return crc;
+});
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc24.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc24.js
new file mode 100755
index 00000000..ff67bc1e
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc24.js
@@ -0,0 +1,25 @@
+// Generated by CoffeeScript 1.7.1
+var Buffer, TABLE, create;
+
+Buffer = require('buffer').Buffer;
+
+create = require('./create');
+
+TABLE = [0x000000, 0x864cfb, 0x8ad50d, 0x0c99f6, 0x93e6e1, 0x15aa1a, 0x1933ec, 0x9f7f17, 0xa18139, 0x27cdc2, 0x2b5434, 0xad18cf, 0x3267d8, 0xb42b23, 0xb8b2d5, 0x3efe2e, 0xc54e89, 0x430272, 0x4f9b84, 0xc9d77f, 0x56a868, 0xd0e493, 0xdc7d65, 0x5a319e, 0x64cfb0, 0xe2834b, 0xee1abd, 0x685646, 0xf72951, 0x7165aa, 0x7dfc5c, 0xfbb0a7, 0x0cd1e9, 0x8a9d12, 0x8604e4, 0x00481f, 0x9f3708, 0x197bf3, 0x15e205, 0x93aefe, 0xad50d0, 0x2b1c2b, 0x2785dd, 0xa1c926, 0x3eb631, 0xb8faca, 0xb4633c, 0x322fc7, 0xc99f60, 0x4fd39b, 0x434a6d, 0xc50696, 0x5a7981, 0xdc357a, 0xd0ac8c, 0x56e077, 0x681e59, 0xee52a2, 0xe2cb54, 0x6487af, 0xfbf8b8, 0x7db443, 0x712db5, 0xf7614e, 0x19a3d2, 0x9fef29, 0x9376df, 0x153a24, 0x8a4533, 0x0c09c8, 0x00903e, 0x86dcc5, 0xb822eb, 0x3e6e10, 0x32f7e6, 0xb4bb1d, 0x2bc40a, 0xad88f1, 0xa11107, 0x275dfc, 0xdced5b, 0x5aa1a0, 0x563856, 0xd074ad, 0x4f0bba, 0xc94741, 0xc5deb7, 0x43924c, 0x7d6c62, 0xfb2099, 0xf7b96f, 0x71f594, 0xee8a83, 0x68c678, 0x645f8e, 0xe21375, 0x15723b, 0x933ec0, 0x9fa736, 0x19ebcd, 0x8694da, 0x00d821, 0x0c41d7, 0x8a0d2c, 0xb4f302, 0x32bff9, 0x3e260f, 0xb86af4, 0x2715e3, 0xa15918, 0xadc0ee, 0x2b8c15, 0xd03cb2, 0x567049, 0x5ae9bf, 0xdca544, 0x43da53, 0xc596a8, 0xc90f5e, 0x4f43a5, 0x71bd8b, 0xf7f170, 0xfb6886, 0x7d247d, 0xe25b6a, 0x641791, 0x688e67, 0xeec29c, 0x3347a4, 0xb50b5f, 0xb992a9, 0x3fde52, 0xa0a145, 0x26edbe, 0x2a7448, 0xac38b3, 0x92c69d, 0x148a66, 0x181390, 0x9e5f6b, 0x01207c, 0x876c87, 0x8bf571, 0x0db98a, 0xf6092d, 0x7045d6, 0x7cdc20, 0xfa90db, 0x65efcc, 0xe3a337, 0xef3ac1, 0x69763a, 0x578814, 0xd1c4ef, 0xdd5d19, 0x5b11e2, 0xc46ef5, 0x42220e, 0x4ebbf8, 0xc8f703, 0x3f964d, 0xb9dab6, 0xb54340, 0x330fbb, 0xac70ac, 0x2a3c57, 0x26a5a1, 0xa0e95a, 0x9e1774, 0x185b8f, 0x14c279, 0x928e82, 0x0df195, 0x8bbd6e, 0x872498, 0x016863, 0xfad8c4, 0x7c943f, 0x700dc9, 0xf64132, 0x693e25, 0xef72de, 0xe3eb28, 0x65a7d3, 0x5b59fd, 0xdd1506, 0xd18cf0, 0x57c00b, 0xc8bf1c, 0x4ef3e7, 0x426a11, 0xc426ea, 0x2ae476, 0xaca88d, 0xa0317b, 0x267d80, 0xb90297, 0x3f4e6c, 0x33d79a, 0xb59b61, 0x8b654f, 0x0d29b4, 0x01b042, 0x87fcb9, 0x1883ae, 0x9ecf55, 0x9256a3, 0x141a58, 0xefaaff, 0x69e604, 0x657ff2, 0xe33309, 0x7c4c1e, 0xfa00e5, 0xf69913, 0x70d5e8, 0x4e2bc6, 0xc8673d, 0xc4fecb, 0x42b230, 0xddcd27, 0x5b81dc, 0x57182a, 0xd154d1, 0x26359f, 0xa07964, 0xace092, 0x2aac69, 0xb5d37e, 0x339f85, 0x3f0673, 0xb94a88, 0x87b4a6, 0x01f85d, 0x0d61ab, 0x8b2d50, 0x145247, 0x921ebc, 0x9e874a, 0x18cbb1, 0xe37b16, 0x6537ed, 0x69ae1b, 0xefe2e0, 0x709df7, 0xf6d10c, 0xfa48fa, 0x7c0401, 0x42fa2f, 0xc4b6d4, 0xc82f22, 0x4e63d9, 0xd11cce, 0x575035, 0x5bc9c3, 0xdd8538];
+
+if (typeof Int32Array !== 'undefined') {
+ TABLE = new Int32Array(TABLE);
+}
+
+module.exports = create('crc-24', function(buf, previous) {
+ var byte, crc, _i, _len;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ crc = previous != null ? ~~previous : 0xb704ce;
+ for (_i = 0, _len = buf.length; _i < _len; _i++) {
+ byte = buf[_i];
+ crc = (TABLE[((crc >> 16) ^ byte) & 0xff] ^ (crc << 8)) & 0xffffff;
+ }
+ return crc;
+});
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc32.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc32.js
new file mode 100755
index 00000000..20bc0247
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc32.js
@@ -0,0 +1,25 @@
+// Generated by CoffeeScript 1.7.1
+var Buffer, TABLE, create;
+
+Buffer = require('buffer').Buffer;
+
+create = require('./create');
+
+TABLE = [0x00000000, 0x77073096, 0xee0e612c, 0x990951ba, 0x076dc419, 0x706af48f, 0xe963a535, 0x9e6495a3, 0x0edb8832, 0x79dcb8a4, 0xe0d5e91e, 0x97d2d988, 0x09b64c2b, 0x7eb17cbd, 0xe7b82d07, 0x90bf1d91, 0x1db71064, 0x6ab020f2, 0xf3b97148, 0x84be41de, 0x1adad47d, 0x6ddde4eb, 0xf4d4b551, 0x83d385c7, 0x136c9856, 0x646ba8c0, 0xfd62f97a, 0x8a65c9ec, 0x14015c4f, 0x63066cd9, 0xfa0f3d63, 0x8d080df5, 0x3b6e20c8, 0x4c69105e, 0xd56041e4, 0xa2677172, 0x3c03e4d1, 0x4b04d447, 0xd20d85fd, 0xa50ab56b, 0x35b5a8fa, 0x42b2986c, 0xdbbbc9d6, 0xacbcf940, 0x32d86ce3, 0x45df5c75, 0xdcd60dcf, 0xabd13d59, 0x26d930ac, 0x51de003a, 0xc8d75180, 0xbfd06116, 0x21b4f4b5, 0x56b3c423, 0xcfba9599, 0xb8bda50f, 0x2802b89e, 0x5f058808, 0xc60cd9b2, 0xb10be924, 0x2f6f7c87, 0x58684c11, 0xc1611dab, 0xb6662d3d, 0x76dc4190, 0x01db7106, 0x98d220bc, 0xefd5102a, 0x71b18589, 0x06b6b51f, 0x9fbfe4a5, 0xe8b8d433, 0x7807c9a2, 0x0f00f934, 0x9609a88e, 0xe10e9818, 0x7f6a0dbb, 0x086d3d2d, 0x91646c97, 0xe6635c01, 0x6b6b51f4, 0x1c6c6162, 0x856530d8, 0xf262004e, 0x6c0695ed, 0x1b01a57b, 0x8208f4c1, 0xf50fc457, 0x65b0d9c6, 0x12b7e950, 0x8bbeb8ea, 0xfcb9887c, 0x62dd1ddf, 0x15da2d49, 0x8cd37cf3, 0xfbd44c65, 0x4db26158, 0x3ab551ce, 0xa3bc0074, 0xd4bb30e2, 0x4adfa541, 0x3dd895d7, 0xa4d1c46d, 0xd3d6f4fb, 0x4369e96a, 0x346ed9fc, 0xad678846, 0xda60b8d0, 0x44042d73, 0x33031de5, 0xaa0a4c5f, 0xdd0d7cc9, 0x5005713c, 0x270241aa, 0xbe0b1010, 0xc90c2086, 0x5768b525, 0x206f85b3, 0xb966d409, 0xce61e49f, 0x5edef90e, 0x29d9c998, 0xb0d09822, 0xc7d7a8b4, 0x59b33d17, 0x2eb40d81, 0xb7bd5c3b, 0xc0ba6cad, 0xedb88320, 0x9abfb3b6, 0x03b6e20c, 0x74b1d29a, 0xead54739, 0x9dd277af, 0x04db2615, 0x73dc1683, 0xe3630b12, 0x94643b84, 0x0d6d6a3e, 0x7a6a5aa8, 0xe40ecf0b, 0x9309ff9d, 0x0a00ae27, 0x7d079eb1, 0xf00f9344, 0x8708a3d2, 0x1e01f268, 0x6906c2fe, 0xf762575d, 0x806567cb, 0x196c3671, 0x6e6b06e7, 0xfed41b76, 0x89d32be0, 0x10da7a5a, 0x67dd4acc, 0xf9b9df6f, 0x8ebeeff9, 0x17b7be43, 0x60b08ed5, 0xd6d6a3e8, 0xa1d1937e, 0x38d8c2c4, 0x4fdff252, 0xd1bb67f1, 0xa6bc5767, 0x3fb506dd, 0x48b2364b, 0xd80d2bda, 0xaf0a1b4c, 0x36034af6, 0x41047a60, 0xdf60efc3, 0xa867df55, 0x316e8eef, 0x4669be79, 0xcb61b38c, 0xbc66831a, 0x256fd2a0, 0x5268e236, 0xcc0c7795, 0xbb0b4703, 0x220216b9, 0x5505262f, 0xc5ba3bbe, 0xb2bd0b28, 0x2bb45a92, 0x5cb36a04, 0xc2d7ffa7, 0xb5d0cf31, 0x2cd99e8b, 0x5bdeae1d, 0x9b64c2b0, 0xec63f226, 0x756aa39c, 0x026d930a, 0x9c0906a9, 0xeb0e363f, 0x72076785, 0x05005713, 0x95bf4a82, 0xe2b87a14, 0x7bb12bae, 0x0cb61b38, 0x92d28e9b, 0xe5d5be0d, 0x7cdcefb7, 0x0bdbdf21, 0x86d3d2d4, 0xf1d4e242, 0x68ddb3f8, 0x1fda836e, 0x81be16cd, 0xf6b9265b, 0x6fb077e1, 0x18b74777, 0x88085ae6, 0xff0f6a70, 0x66063bca, 0x11010b5c, 0x8f659eff, 0xf862ae69, 0x616bffd3, 0x166ccf45, 0xa00ae278, 0xd70dd2ee, 0x4e048354, 0x3903b3c2, 0xa7672661, 0xd06016f7, 0x4969474d, 0x3e6e77db, 0xaed16a4a, 0xd9d65adc, 0x40df0b66, 0x37d83bf0, 0xa9bcae53, 0xdebb9ec5, 0x47b2cf7f, 0x30b5ffe9, 0xbdbdf21c, 0xcabac28a, 0x53b39330, 0x24b4a3a6, 0xbad03605, 0xcdd70693, 0x54de5729, 0x23d967bf, 0xb3667a2e, 0xc4614ab8, 0x5d681b02, 0x2a6f2b94, 0xb40bbe37, 0xc30c8ea1, 0x5a05df1b, 0x2d02ef8d];
+
+if (typeof Int32Array !== 'undefined') {
+ TABLE = new Int32Array(TABLE);
+}
+
+module.exports = create('crc-32', function(buf, previous) {
+ var byte, crc, _i, _len;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ crc = previous === 0 ? 0 : ~~previous ^ -1;
+ for (_i = 0, _len = buf.length; _i < _len; _i++) {
+ byte = buf[_i];
+ crc = TABLE[(crc ^ byte) & 0xff] ^ (crc >>> 8);
+ }
+ return crc ^ -1;
+});
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc8.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc8.js
new file mode 100755
index 00000000..6ebe77c2
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc8.js
@@ -0,0 +1,25 @@
+// Generated by CoffeeScript 1.7.1
+var Buffer, TABLE, create;
+
+Buffer = require('buffer').Buffer;
+
+create = require('./create');
+
+TABLE = [0x00, 0x07, 0x0e, 0x09, 0x1c, 0x1b, 0x12, 0x15, 0x38, 0x3f, 0x36, 0x31, 0x24, 0x23, 0x2a, 0x2d, 0x70, 0x77, 0x7e, 0x79, 0x6c, 0x6b, 0x62, 0x65, 0x48, 0x4f, 0x46, 0x41, 0x54, 0x53, 0x5a, 0x5d, 0xe0, 0xe7, 0xee, 0xe9, 0xfc, 0xfb, 0xf2, 0xf5, 0xd8, 0xdf, 0xd6, 0xd1, 0xc4, 0xc3, 0xca, 0xcd, 0x90, 0x97, 0x9e, 0x99, 0x8c, 0x8b, 0x82, 0x85, 0xa8, 0xaf, 0xa6, 0xa1, 0xb4, 0xb3, 0xba, 0xbd, 0xc7, 0xc0, 0xc9, 0xce, 0xdb, 0xdc, 0xd5, 0xd2, 0xff, 0xf8, 0xf1, 0xf6, 0xe3, 0xe4, 0xed, 0xea, 0xb7, 0xb0, 0xb9, 0xbe, 0xab, 0xac, 0xa5, 0xa2, 0x8f, 0x88, 0x81, 0x86, 0x93, 0x94, 0x9d, 0x9a, 0x27, 0x20, 0x29, 0x2e, 0x3b, 0x3c, 0x35, 0x32, 0x1f, 0x18, 0x11, 0x16, 0x03, 0x04, 0x0d, 0x0a, 0x57, 0x50, 0x59, 0x5e, 0x4b, 0x4c, 0x45, 0x42, 0x6f, 0x68, 0x61, 0x66, 0x73, 0x74, 0x7d, 0x7a, 0x89, 0x8e, 0x87, 0x80, 0x95, 0x92, 0x9b, 0x9c, 0xb1, 0xb6, 0xbf, 0xb8, 0xad, 0xaa, 0xa3, 0xa4, 0xf9, 0xfe, 0xf7, 0xf0, 0xe5, 0xe2, 0xeb, 0xec, 0xc1, 0xc6, 0xcf, 0xc8, 0xdd, 0xda, 0xd3, 0xd4, 0x69, 0x6e, 0x67, 0x60, 0x75, 0x72, 0x7b, 0x7c, 0x51, 0x56, 0x5f, 0x58, 0x4d, 0x4a, 0x43, 0x44, 0x19, 0x1e, 0x17, 0x10, 0x05, 0x02, 0x0b, 0x0c, 0x21, 0x26, 0x2f, 0x28, 0x3d, 0x3a, 0x33, 0x34, 0x4e, 0x49, 0x40, 0x47, 0x52, 0x55, 0x5c, 0x5b, 0x76, 0x71, 0x78, 0x7f, 0x6a, 0x6d, 0x64, 0x63, 0x3e, 0x39, 0x30, 0x37, 0x22, 0x25, 0x2c, 0x2b, 0x06, 0x01, 0x08, 0x0f, 0x1a, 0x1d, 0x14, 0x13, 0xae, 0xa9, 0xa0, 0xa7, 0xb2, 0xb5, 0xbc, 0xbb, 0x96, 0x91, 0x98, 0x9f, 0x8a, 0x8d, 0x84, 0x83, 0xde, 0xd9, 0xd0, 0xd7, 0xc2, 0xc5, 0xcc, 0xcb, 0xe6, 0xe1, 0xe8, 0xef, 0xfa, 0xfd, 0xf4, 0xf3];
+
+if (typeof Int32Array !== 'undefined') {
+ TABLE = new Int32Array(TABLE);
+}
+
+module.exports = create('crc-8', function(buf, previous) {
+ var byte, crc, _i, _len;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ crc = ~~previous;
+ for (_i = 0, _len = buf.length; _i < _len; _i++) {
+ byte = buf[_i];
+ crc = TABLE[(crc ^ byte) & 0xff] & 0xff;
+ }
+ return crc;
+});
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc8_1wire.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc8_1wire.js
new file mode 100755
index 00000000..b5612463
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/crc8_1wire.js
@@ -0,0 +1,25 @@
+// Generated by CoffeeScript 1.7.1
+var Buffer, TABLE, create;
+
+Buffer = require('buffer').Buffer;
+
+create = require('./create');
+
+TABLE = [0x00, 0x5e, 0xbc, 0xe2, 0x61, 0x3f, 0xdd, 0x83, 0xc2, 0x9c, 0x7e, 0x20, 0xa3, 0xfd, 0x1f, 0x41, 0x9d, 0xc3, 0x21, 0x7f, 0xfc, 0xa2, 0x40, 0x1e, 0x5f, 0x01, 0xe3, 0xbd, 0x3e, 0x60, 0x82, 0xdc, 0x23, 0x7d, 0x9f, 0xc1, 0x42, 0x1c, 0xfe, 0xa0, 0xe1, 0xbf, 0x5d, 0x03, 0x80, 0xde, 0x3c, 0x62, 0xbe, 0xe0, 0x02, 0x5c, 0xdf, 0x81, 0x63, 0x3d, 0x7c, 0x22, 0xc0, 0x9e, 0x1d, 0x43, 0xa1, 0xff, 0x46, 0x18, 0xfa, 0xa4, 0x27, 0x79, 0x9b, 0xc5, 0x84, 0xda, 0x38, 0x66, 0xe5, 0xbb, 0x59, 0x07, 0xdb, 0x85, 0x67, 0x39, 0xba, 0xe4, 0x06, 0x58, 0x19, 0x47, 0xa5, 0xfb, 0x78, 0x26, 0xc4, 0x9a, 0x65, 0x3b, 0xd9, 0x87, 0x04, 0x5a, 0xb8, 0xe6, 0xa7, 0xf9, 0x1b, 0x45, 0xc6, 0x98, 0x7a, 0x24, 0xf8, 0xa6, 0x44, 0x1a, 0x99, 0xc7, 0x25, 0x7b, 0x3a, 0x64, 0x86, 0xd8, 0x5b, 0x05, 0xe7, 0xb9, 0x8c, 0xd2, 0x30, 0x6e, 0xed, 0xb3, 0x51, 0x0f, 0x4e, 0x10, 0xf2, 0xac, 0x2f, 0x71, 0x93, 0xcd, 0x11, 0x4f, 0xad, 0xf3, 0x70, 0x2e, 0xcc, 0x92, 0xd3, 0x8d, 0x6f, 0x31, 0xb2, 0xec, 0x0e, 0x50, 0xaf, 0xf1, 0x13, 0x4d, 0xce, 0x90, 0x72, 0x2c, 0x6d, 0x33, 0xd1, 0x8f, 0x0c, 0x52, 0xb0, 0xee, 0x32, 0x6c, 0x8e, 0xd0, 0x53, 0x0d, 0xef, 0xb1, 0xf0, 0xae, 0x4c, 0x12, 0x91, 0xcf, 0x2d, 0x73, 0xca, 0x94, 0x76, 0x28, 0xab, 0xf5, 0x17, 0x49, 0x08, 0x56, 0xb4, 0xea, 0x69, 0x37, 0xd5, 0x8b, 0x57, 0x09, 0xeb, 0xb5, 0x36, 0x68, 0x8a, 0xd4, 0x95, 0xcb, 0x29, 0x77, 0xf4, 0xaa, 0x48, 0x16, 0xe9, 0xb7, 0x55, 0x0b, 0x88, 0xd6, 0x34, 0x6a, 0x2b, 0x75, 0x97, 0xc9, 0x4a, 0x14, 0xf6, 0xa8, 0x74, 0x2a, 0xc8, 0x96, 0x15, 0x4b, 0xa9, 0xf7, 0xb6, 0xe8, 0x0a, 0x54, 0xd7, 0x89, 0x6b, 0x35];
+
+if (typeof Int32Array !== 'undefined') {
+ TABLE = new Int32Array(TABLE);
+}
+
+module.exports = create('dallas-1-wire', function(buf, previous) {
+ var byte, crc, _i, _len;
+ if (!Buffer.isBuffer(buf)) {
+ buf = Buffer(buf);
+ }
+ crc = ~~previous;
+ for (_i = 0, _len = buf.length; _i < _len; _i++) {
+ byte = buf[_i];
+ crc = TABLE[(crc ^ byte) & 0xff] & 0xff;
+ }
+ return crc;
+});
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/create.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/create.js
new file mode 100755
index 00000000..2d856bd2
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/create.js
@@ -0,0 +1,11 @@
+// Generated by CoffeeScript 1.7.1
+module.exports = function(model, calc) {
+ var fn;
+ fn = function(buf, previous) {
+ return calc(buf, previous) >>> 0;
+ };
+ fn.signed = calc;
+ fn.unsigned = fn;
+ fn.model = model;
+ return fn;
+};
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/hex.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/hex.js
new file mode 100755
index 00000000..0a6aa4c5
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/hex.js
@@ -0,0 +1,9 @@
+// Generated by CoffeeScript 1.7.1
+module.exports = function(number) {
+ var result;
+ result = number.toString(16);
+ while (result.length % 2) {
+ result = "0" + result;
+ }
+ return result;
+};
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/lib/index.js b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/index.js
new file mode 100755
index 00000000..15ac34cd
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/lib/index.js
@@ -0,0 +1,11 @@
+// Generated by CoffeeScript 1.7.1
+module.exports = {
+ crc1: require('./crc1'),
+ crc8: require('./crc8'),
+ crc81wire: require('./crc8_1wire'),
+ crc16: require('./crc16'),
+ crc16ccitt: require('./crc16_ccitt'),
+ crc16modbus: require('./crc16_modbus'),
+ crc24: require('./crc24'),
+ crc32: require('./crc32')
+};
diff --git a/server/node_modules/express/node_modules/etag/node_modules/crc/package.json b/server/node_modules/express/node_modules/etag/node_modules/crc/package.json
new file mode 100755
index 00000000..1b2418aa
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/node_modules/crc/package.json
@@ -0,0 +1,57 @@
+{
+ "name": "crc",
+ "version": "3.2.1",
+ "description": "Various CRC JavaScript implementations",
+ "keywords": [
+ "crc"
+ ],
+ "main": "./lib/index.js",
+ "scripts": {
+ "test": "mocha test/*.spec.coffee",
+ "pretest": "coffee --bare --output ./lib --compile ./src/*.coffee"
+ },
+ "author": {
+ "name": "Alex Gorbatchev",
+ "url": "https://github.com/alexgorbatchev"
+ },
+ "devDependencies": {
+ "beautify-benchmark": "^0.2.4",
+ "benchmark": "^1.0.0",
+ "buffer-crc32": "^0.2.3",
+ "chai": "~1.9.1",
+ "coffee-errors": "~0.8.6",
+ "coffee-script": "~1.7.1",
+ "mocha": "*",
+ "seedrandom": "^2.3.6"
+ },
+ "homepage": "https://github.com/alexgorbatchev/node-crc",
+ "bugs": {
+ "url": "https://github.com/alexgorbatchev/node-crc/issues"
+ },
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/alexgorbatchev/node-crc.git"
+ },
+ "license": "MIT",
+ "gitHead": "71caf362b061992bfe4ca8706ee264e764d2e88e",
+ "_id": "crc@3.2.1",
+ "_shasum": "5d9c8fb77a245cd5eca291e5d2d005334bab0082",
+ "_from": "crc@3.2.1",
+ "_npmVersion": "1.4.13",
+ "_npmUser": {
+ "name": "alexgorbatchev",
+ "email": "alex.gorbatchev@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "alexgorbatchev",
+ "email": "alex.gorbatchev@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "5d9c8fb77a245cd5eca291e5d2d005334bab0082",
+ "tarball": "http://registry.npmjs.org/crc/-/crc-3.2.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/crc/-/crc-3.2.1.tgz"
+}
diff --git a/server/node_modules/express/node_modules/etag/package.json b/server/node_modules/express/node_modules/etag/package.json
new file mode 100755
index 00000000..13f0b417
--- /dev/null
+++ b/server/node_modules/express/node_modules/etag/package.json
@@ -0,0 +1,74 @@
+{
+ "name": "etag",
+ "description": "Create simple ETags",
+ "version": "1.5.1",
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "David Björklund",
+ "email": "david.bjorklund@gmail.com"
+ }
+ ],
+ "license": "MIT",
+ "keywords": [
+ "etag",
+ "http",
+ "res"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/etag"
+ },
+ "dependencies": {
+ "crc": "3.2.1"
+ },
+ "devDependencies": {
+ "benchmark": "1.0.0",
+ "beautify-benchmark": "0.2.4",
+ "istanbul": "0.3.2",
+ "mocha": "~1.21.4",
+ "seedrandom": "~2.3.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "27335e2265388109e50a9f037452081dc8a8260f",
+ "bugs": {
+ "url": "https://github.com/jshttp/etag/issues"
+ },
+ "homepage": "https://github.com/jshttp/etag",
+ "_id": "etag@1.5.1",
+ "_shasum": "54c50de04ee42695562925ac566588291be7e9ea",
+ "_from": "etag@~1.5.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "54c50de04ee42695562925ac566588291be7e9ea",
+ "tarball": "http://registry.npmjs.org/etag/-/etag-1.5.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/etag/-/etag-1.5.1.tgz"
+}
diff --git a/server/node_modules/express/node_modules/finalhandler/HISTORY.md b/server/node_modules/express/node_modules/finalhandler/HISTORY.md
new file mode 100755
index 00000000..2c7e1ef9
--- /dev/null
+++ b/server/node_modules/express/node_modules/finalhandler/HISTORY.md
@@ -0,0 +1,51 @@
+0.3.2 / 2014-10-22
+==================
+
+ * deps: on-finished@~2.1.1
+ - Fix handling of pipelined requests
+
+0.3.1 / 2014-10-16
+==================
+
+ * deps: debug@~2.1.0
+ - Implement `DEBUG_FD` env variable support
+
+0.3.0 / 2014-09-17
+==================
+
+ * Terminate in progress response only on error
+ * Use `on-finished` to determine request status
+
+0.2.0 / 2014-09-03
+==================
+
+ * Set `X-Content-Type-Options: nosniff` header
+ * deps: debug@~2.0.0
+
+0.1.0 / 2014-07-16
+==================
+
+ * Respond after request fully read
+ - prevents hung responses and socket hang ups
+ * deps: debug@1.0.4
+
+0.0.3 / 2014-07-11
+==================
+
+ * deps: debug@1.0.3
+ - Add support for multiple wildcards in namespaces
+
+0.0.2 / 2014-06-19
+==================
+
+ * Handle invalid status codes
+
+0.0.1 / 2014-06-05
+==================
+
+ * deps: debug@1.0.2
+
+0.0.0 / 2014-06-05
+==================
+
+ * Extracted from connect/express
diff --git a/server/node_modules/express/node_modules/finalhandler/LICENSE b/server/node_modules/express/node_modules/finalhandler/LICENSE
new file mode 100755
index 00000000..eda23054
--- /dev/null
+++ b/server/node_modules/express/node_modules/finalhandler/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/finalhandler/README.md b/server/node_modules/express/node_modules/finalhandler/README.md
new file mode 100755
index 00000000..2015ac0c
--- /dev/null
+++ b/server/node_modules/express/node_modules/finalhandler/README.md
@@ -0,0 +1,133 @@
+# finalhandler
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Node.js function to invoke as the final step to respond to HTTP request.
+
+## Installation
+
+```sh
+$ npm install finalhandler
+```
+
+## API
+
+```js
+var finalhandler = require('finalhandler')
+```
+
+### finalhandler(req, res, [options])
+
+Returns function to be invoked as the final step for the given `req` and `res`.
+This function is to be invoked as `fn(err)`. If `err` is falsy, the handler will
+write out a 404 response to the `res`. If it is truthy, an error response will
+be written out to the `res`, and `res.statusCode` is set from `err.status`.
+
+The final handler will also unpipe anything from `req` when it is invoked.
+
+#### options.env
+
+By default, the environment is determined by `NODE_ENV` variable, but it can be
+overridden by this option.
+
+#### options.onerror
+
+Provide a function to be called with the `err` when it exists. Can be used for
+writing errors to a central location without excessive function generation. Called
+as `onerror(err, req, res)`.
+
+## Examples
+
+### always 404
+
+```js
+var finalhandler = require('finalhandler')
+var http = require('http')
+
+var server = http.createServer(function (req, res) {
+ var done = finalhandler(req, res)
+ done()
+})
+
+server.listen(3000)
+```
+
+### perform simple action
+
+```js
+var finalhandler = require('finalhandler')
+var fs = require('fs')
+var http = require('http')
+
+var server = http.createServer(function (req, res) {
+ var done = finalhandler(req, res)
+
+ fs.readFile('index.html', function (err, buf) {
+ if (err) return done(err)
+ res.setHeader('Content-Type', 'text/html')
+ res.end(buf)
+ })
+})
+
+server.listen(3000)
+```
+
+### use with middleware-style functions
+
+```js
+var finalhandler = require('finalhandler')
+var http = require('http')
+var serveStatic = require('serve-static')
+
+var serve = serveStatic('public')
+
+var server = http.createServer(function (req, res) {
+ var done = finalhandler(req, res)
+ serve(req, res, done)
+})
+
+server.listen(3000)
+```
+
+### keep log of all errors
+
+```js
+var finalhandler = require('finalhandler')
+var fs = require('fs')
+var http = require('http')
+
+var server = http.createServer(function (req, res) {
+ var done = finalhandler(req, res, {onerror: logerror})
+
+ fs.readFile('index.html', function (err, buf) {
+ if (err) return done(err)
+ res.setHeader('Content-Type', 'text/html')
+ res.end(buf)
+ })
+})
+
+server.listen(3000)
+
+function logerror(err) {
+ console.error(err.stack || err.toString())
+}
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/finalhandler.svg?style=flat
+[npm-url]: https://npmjs.org/package/finalhandler
+[node-image]: https://img.shields.io/node/v/finalhandler.svg?style=flat
+[node-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/pillarjs/finalhandler.svg?style=flat
+[travis-url]: https://travis-ci.org/pillarjs/finalhandler
+[coveralls-image]: https://img.shields.io/coveralls/pillarjs/finalhandler.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/pillarjs/finalhandler?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/finalhandler.svg?style=flat
+[downloads-url]: https://npmjs.org/package/finalhandler
diff --git a/server/node_modules/express/node_modules/finalhandler/index.js b/server/node_modules/express/node_modules/finalhandler/index.js
new file mode 100755
index 00000000..bb2bb583
--- /dev/null
+++ b/server/node_modules/express/node_modules/finalhandler/index.js
@@ -0,0 +1,171 @@
+/*!
+ * finalhandler
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var debug = require('debug')('finalhandler')
+var escapeHtml = require('escape-html')
+var http = require('http')
+var onFinished = require('on-finished')
+
+/**
+ * Variables.
+ */
+
+/* istanbul ignore next */
+var defer = typeof setImmediate === 'function'
+ ? setImmediate
+ : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) }
+var isFinished = onFinished.isFinished
+
+/**
+ * Module exports.
+ */
+
+module.exports = finalhandler
+
+/**
+ * Final handler:
+ *
+ * @param {Request} req
+ * @param {Response} res
+ * @param {Object} [options]
+ * @return {Function}
+ * @api public
+ */
+
+function finalhandler(req, res, options) {
+ options = options || {}
+
+ // get environment
+ var env = options.env || process.env.NODE_ENV || 'development'
+
+ // get error callback
+ var onerror = options.onerror
+
+ return function (err) {
+ var msg
+
+ // ignore 404 on in-flight response
+ if (!err && res._header) {
+ debug('cannot 404 after headers sent')
+ return
+ }
+
+ // unhandled error
+ if (err) {
+ // default status code to 500
+ if (!res.statusCode || res.statusCode < 400) {
+ res.statusCode = 500
+ }
+
+ // respect err.status
+ if (err.status) {
+ res.statusCode = err.status
+ }
+
+ // production gets a basic error message
+ var msg = env === 'production'
+ ? http.STATUS_CODES[res.statusCode]
+ : err.stack || err.toString()
+ msg = escapeHtml(msg)
+ .replace(/\n/g, '
')
+ .replace(/ /g, ' ') + '\n'
+ } else {
+ res.statusCode = 404
+ msg = 'Cannot ' + escapeHtml(req.method) + ' ' + escapeHtml(req.originalUrl || req.url) + '\n'
+ }
+
+ debug('default %s', res.statusCode)
+
+ // schedule onerror callback
+ if (err && onerror) {
+ defer(onerror, err, req, res)
+ }
+
+ // cannot actually respond
+ if (res._header) {
+ return req.socket.destroy()
+ }
+
+ send(req, res, res.statusCode, msg)
+ }
+}
+
+/**
+ * Send response.
+ *
+ * @param {IncomingMessage} req
+ * @param {OutgoingMessage} res
+ * @param {number} status
+ * @param {string} body
+ * @api private
+ */
+
+function send(req, res, status, body) {
+ function write() {
+ res.statusCode = status
+
+ // security header for content sniffing
+ res.setHeader('X-Content-Type-Options', 'nosniff')
+
+ // standard headers
+ res.setHeader('Content-Type', 'text/html; charset=utf-8')
+ res.setHeader('Content-Length', Buffer.byteLength(body, 'utf8'))
+
+ if (req.method === 'HEAD') {
+ res.end()
+ return
+ }
+
+ res.end(body, 'utf8')
+ }
+
+ if (isFinished(req)) {
+ write()
+ return
+ }
+
+ // unpipe everything from the request
+ unpipe(req)
+
+ // flush the request
+ onFinished(req, write)
+ req.resume()
+}
+
+/**
+ * Unpipe everything from a stream.
+ *
+ * @param {Object} stream
+ * @api private
+ */
+
+/* istanbul ignore next: implementation differs between versions */
+function unpipe(stream) {
+ if (typeof stream.unpipe === 'function') {
+ // new-style
+ stream.unpipe()
+ return
+ }
+
+ // Node.js 0.8 hack
+ var listener
+ var listeners = stream.listeners('close')
+
+ for (var i = 0; i < listeners.length; i++) {
+ listener = listeners[i]
+
+ if (listener.name !== 'cleanup' && listener.name !== 'onclose') {
+ continue
+ }
+
+ // invoke the listener
+ listener.call(stream)
+ }
+}
diff --git a/server/node_modules/express/node_modules/finalhandler/package.json b/server/node_modules/express/node_modules/finalhandler/package.json
new file mode 100755
index 00000000..fc73a8a5
--- /dev/null
+++ b/server/node_modules/express/node_modules/finalhandler/package.json
@@ -0,0 +1,80 @@
+{
+ "name": "finalhandler",
+ "description": "Node.js final http responder",
+ "version": "0.3.2",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/pillarjs/finalhandler"
+ },
+ "dependencies": {
+ "debug": "~2.1.0",
+ "escape-html": "1.0.1",
+ "on-finished": "~2.1.1"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.2",
+ "mocha": "~2.0.0",
+ "readable-stream": "~1.0.33",
+ "should": "~4.1.0",
+ "supertest": "~0.14.0"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "1dc292faf576fade3b0218caab39060f4da5fe9c",
+ "bugs": {
+ "url": "https://github.com/pillarjs/finalhandler/issues"
+ },
+ "homepage": "https://github.com/pillarjs/finalhandler",
+ "_id": "finalhandler@0.3.2",
+ "_shasum": "7b389b0fd3647a6f90bd564e22624bf8a4a77fb5",
+ "_from": "finalhandler@0.3.2",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "7b389b0fd3647a6f90bd564e22624bf8a4a77fb5",
+ "tarball": "http://registry.npmjs.org/finalhandler/-/finalhandler-0.3.2.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/finalhandler/-/finalhandler-0.3.2.tgz"
+}
diff --git a/server/node_modules/express/node_modules/fresh/HISTORY.md b/server/node_modules/express/node_modules/fresh/HISTORY.md
new file mode 100755
index 00000000..56361df8
--- /dev/null
+++ b/server/node_modules/express/node_modules/fresh/HISTORY.md
@@ -0,0 +1,24 @@
+0.2.4 / 2014-09-07
+==================
+
+ * Support Node.js 0.6
+
+0.2.3 / 2014-09-07
+==================
+
+ * Move repository to jshttp
+
+0.2.2 / 2014-02-19
+==================
+
+ * Revert "Fix for blank page on Safari reload"
+
+0.2.1 / 2014-01-29
+==================
+
+ * fix: support max-age=0 for end-to-end revalidation
+
+0.2.0 / 2013-08-11
+==================
+
+ * fix: return false for no-cache
diff --git a/server/node_modules/express/node_modules/fresh/LICENSE b/server/node_modules/express/node_modules/fresh/LICENSE
new file mode 100755
index 00000000..f5273943
--- /dev/null
+++ b/server/node_modules/express/node_modules/fresh/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2012 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/fresh/README.md b/server/node_modules/express/node_modules/fresh/README.md
new file mode 100755
index 00000000..54a885fb
--- /dev/null
+++ b/server/node_modules/express/node_modules/fresh/README.md
@@ -0,0 +1,58 @@
+# fresh
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+HTTP response freshness testing
+
+## Installation
+
+```
+$ npm install fresh
+```
+
+## API
+
+```js
+var fresh = require('fresh')
+```
+
+### fresh(req, res)
+
+ Check freshness of `req` and `res` headers.
+
+ When the cache is "fresh" __true__ is returned,
+ otherwise __false__ is returned to indicate that
+ the cache is now stale.
+
+## Example
+
+```js
+var req = { 'if-none-match': 'tobi' };
+var res = { 'etag': 'luna' };
+fresh(req, res);
+// => false
+
+var req = { 'if-none-match': 'tobi' };
+var res = { 'etag': 'tobi' };
+fresh(req, res);
+// => true
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/fresh.svg?style=flat
+[npm-url]: https://npmjs.org/package/fresh
+[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/fresh.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/fresh
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/fresh.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/fresh?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/fresh.svg?style=flat
+[downloads-url]: https://npmjs.org/package/fresh
diff --git a/server/node_modules/express/node_modules/fresh/index.js b/server/node_modules/express/node_modules/fresh/index.js
new file mode 100755
index 00000000..9c3f47d1
--- /dev/null
+++ b/server/node_modules/express/node_modules/fresh/index.js
@@ -0,0 +1,53 @@
+
+/**
+ * Expose `fresh()`.
+ */
+
+module.exports = fresh;
+
+/**
+ * Check freshness of `req` and `res` headers.
+ *
+ * When the cache is "fresh" __true__ is returned,
+ * otherwise __false__ is returned to indicate that
+ * the cache is now stale.
+ *
+ * @param {Object} req
+ * @param {Object} res
+ * @return {Boolean}
+ * @api public
+ */
+
+function fresh(req, res) {
+ // defaults
+ var etagMatches = true;
+ var notModified = true;
+
+ // fields
+ var modifiedSince = req['if-modified-since'];
+ var noneMatch = req['if-none-match'];
+ var lastModified = res['last-modified'];
+ var etag = res['etag'];
+ var cc = req['cache-control'];
+
+ // unconditional request
+ if (!modifiedSince && !noneMatch) return false;
+
+ // check for no-cache cache request directive
+ if (cc && cc.indexOf('no-cache') !== -1) return false;
+
+ // parse if-none-match
+ if (noneMatch) noneMatch = noneMatch.split(/ *, */);
+
+ // if-none-match
+ if (noneMatch) etagMatches = ~noneMatch.indexOf(etag) || '*' == noneMatch[0];
+
+ // if-modified-since
+ if (modifiedSince) {
+ modifiedSince = new Date(modifiedSince);
+ lastModified = new Date(lastModified);
+ notModified = lastModified <= modifiedSince;
+ }
+
+ return !! (etagMatches && notModified);
+}
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/fresh/package.json b/server/node_modules/express/node_modules/fresh/package.json
new file mode 100755
index 00000000..a1535225
--- /dev/null
+++ b/server/node_modules/express/node_modules/fresh/package.json
@@ -0,0 +1,77 @@
+{
+ "name": "fresh",
+ "description": "HTTP response freshness testing",
+ "version": "0.2.4",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca",
+ "url": "http://tjholowaychuk.com"
+ },
+ "license": "MIT",
+ "keywords": [
+ "fresh",
+ "http",
+ "conditional",
+ "cache"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/fresh"
+ },
+ "devDependencies": {
+ "istanbul": "0",
+ "mocha": "1",
+ "should": "3"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --require should",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --require should",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot --require should"
+ },
+ "gitHead": "8440a4ca75fb091dec06e88654b3b1c31d7e7164",
+ "bugs": {
+ "url": "https://github.com/jshttp/fresh/issues"
+ },
+ "homepage": "https://github.com/jshttp/fresh",
+ "_id": "fresh@0.2.4",
+ "_shasum": "3582499206c9723714190edd74b4604feb4a614c",
+ "_from": "fresh@0.2.4",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "jonathanong",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "3582499206c9723714190edd74b4604feb4a614c",
+ "tarball": "http://registry.npmjs.org/fresh/-/fresh-0.2.4.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/fresh/-/fresh-0.2.4.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/media-typer/HISTORY.md b/server/node_modules/express/node_modules/media-typer/HISTORY.md
new file mode 100755
index 00000000..62c20031
--- /dev/null
+++ b/server/node_modules/express/node_modules/media-typer/HISTORY.md
@@ -0,0 +1,22 @@
+0.3.0 / 2014-09-07
+==================
+
+ * Support Node.js 0.6
+ * Throw error when parameter format invalid on parse
+
+0.2.0 / 2014-06-18
+==================
+
+ * Add `typer.format()` to format media types
+
+0.1.0 / 2014-06-17
+==================
+
+ * Accept `req` as argument to `parse`
+ * Accept `res` as argument to `parse`
+ * Parse media type with extra LWS between type and first parameter
+
+0.0.0 / 2014-06-13
+==================
+
+ * Initial implementation
diff --git a/server/node_modules/express/node_modules/media-typer/LICENSE b/server/node_modules/express/node_modules/media-typer/LICENSE
new file mode 100755
index 00000000..b7dce6cf
--- /dev/null
+++ b/server/node_modules/express/node_modules/media-typer/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/media-typer/README.md b/server/node_modules/express/node_modules/media-typer/README.md
new file mode 100755
index 00000000..d8df6234
--- /dev/null
+++ b/server/node_modules/express/node_modules/media-typer/README.md
@@ -0,0 +1,81 @@
+# media-typer
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Simple RFC 6838 media type parser
+
+## Installation
+
+```sh
+$ npm install media-typer
+```
+
+## API
+
+```js
+var typer = require('media-typer')
+```
+
+### typer.parse(string)
+
+```js
+var obj = typer.parse('image/svg+xml; charset=utf-8')
+```
+
+Parse a media type string. This will return an object with the following
+properties (examples are shown for the string `'image/svg+xml; charset=utf-8'`):
+
+ - `type`: The type of the media type (always lower case). Example: `'image'`
+
+ - `subtype`: The subtype of the media type (always lower case). Example: `'svg'`
+
+ - `suffix`: The suffix of the media type (always lower case). Example: `'xml'`
+
+ - `parameters`: An object of the parameters in the media type (name of parameter always lower case). Example: `{charset: 'utf-8'}`
+
+### typer.parse(req)
+
+```js
+var obj = typer.parse(req)
+```
+
+Parse the `content-type` header from the given `req`. Short-cut for
+`typer.parse(req.headers['content-type'])`.
+
+### typer.parse(res)
+
+```js
+var obj = typer.parse(res)
+```
+
+Parse the `content-type` header set on the given `res`. Short-cut for
+`typer.parse(res.getHeader('content-type'))`.
+
+### typer.format(obj)
+
+```js
+var obj = typer.format({type: 'image', subtype: 'svg', suffix: 'xml'})
+```
+
+Format an object into a media type string. This will return a string of the
+mime type for the given object. For the properties of the object, see the
+documentation for `typer.parse(string)`.
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/media-typer.svg?style=flat
+[npm-url]: https://npmjs.org/package/media-typer
+[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/media-typer.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/media-typer
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/media-typer.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/media-typer
+[downloads-image]: https://img.shields.io/npm/dm/media-typer.svg?style=flat
+[downloads-url]: https://npmjs.org/package/media-typer
diff --git a/server/node_modules/express/node_modules/media-typer/index.js b/server/node_modules/express/node_modules/media-typer/index.js
new file mode 100755
index 00000000..07f7295e
--- /dev/null
+++ b/server/node_modules/express/node_modules/media-typer/index.js
@@ -0,0 +1,270 @@
+/*!
+ * media-typer
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * RegExp to match *( ";" parameter ) in RFC 2616 sec 3.7
+ *
+ * parameter = token "=" ( token | quoted-string )
+ * token = 1*
+ * separators = "(" | ")" | "<" | ">" | "@"
+ * | "," | ";" | ":" | "\" | <">
+ * | "/" | "[" | "]" | "?" | "="
+ * | "{" | "}" | SP | HT
+ * quoted-string = ( <"> *(qdtext | quoted-pair ) <"> )
+ * qdtext = >
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ * TEXT =
+ * LWS = [CRLF] 1*( SP | HT )
+ * CRLF = CR LF
+ * CR =
+ * LF =
+ * SP =
+ * SHT =
+ * CTL =
+ * OCTET =
+ */
+var paramRegExp = /; *([!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) *= *("(?:[ !\u0023-\u005b\u005d-\u007e\u0080-\u00ff]|\\[\u0020-\u007e])*"|[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+) */g;
+var textRegExp = /^[\u0020-\u007e\u0080-\u00ff]+$/
+var tokenRegExp = /^[!#$%&'\*\+\-\.0-9A-Z\^_`a-z\|~]+$/
+
+/**
+ * RegExp to match quoted-pair in RFC 2616
+ *
+ * quoted-pair = "\" CHAR
+ * CHAR =
+ */
+var qescRegExp = /\\([\u0000-\u007f])/g;
+
+/**
+ * RegExp to match chars that must be quoted-pair in RFC 2616
+ */
+var quoteRegExp = /([\\"])/g;
+
+/**
+ * RegExp to match type in RFC 6838
+ *
+ * type-name = restricted-name
+ * subtype-name = restricted-name
+ * restricted-name = restricted-name-first *126restricted-name-chars
+ * restricted-name-first = ALPHA / DIGIT
+ * restricted-name-chars = ALPHA / DIGIT / "!" / "#" /
+ * "$" / "&" / "-" / "^" / "_"
+ * restricted-name-chars =/ "." ; Characters before first dot always
+ * ; specify a facet name
+ * restricted-name-chars =/ "+" ; Characters after last plus always
+ * ; specify a structured syntax suffix
+ * ALPHA = %x41-5A / %x61-7A ; A-Z / a-z
+ * DIGIT = %x30-39 ; 0-9
+ */
+var subtypeNameRegExp = /^[A-Za-z0-9][A-Za-z0-9!#$&^_.-]{0,126}$/
+var typeNameRegExp = /^[A-Za-z0-9][A-Za-z0-9!#$&^_-]{0,126}$/
+var typeRegExp = /^ *([A-Za-z0-9][A-Za-z0-9!#$&^_-]{0,126})\/([A-Za-z0-9][A-Za-z0-9!#$&^_.+-]{0,126}) *$/;
+
+/**
+ * Module exports.
+ */
+
+exports.format = format
+exports.parse = parse
+
+/**
+ * Format object to media type.
+ *
+ * @param {object} obj
+ * @return {string}
+ * @api public
+ */
+
+function format(obj) {
+ if (!obj || typeof obj !== 'object') {
+ throw new TypeError('argument obj is required')
+ }
+
+ var parameters = obj.parameters
+ var subtype = obj.subtype
+ var suffix = obj.suffix
+ var type = obj.type
+
+ if (!type || !typeNameRegExp.test(type)) {
+ throw new TypeError('invalid type')
+ }
+
+ if (!subtype || !subtypeNameRegExp.test(subtype)) {
+ throw new TypeError('invalid subtype')
+ }
+
+ // format as type/subtype
+ var string = type + '/' + subtype
+
+ // append +suffix
+ if (suffix) {
+ if (!typeNameRegExp.test(suffix)) {
+ throw new TypeError('invalid suffix')
+ }
+
+ string += '+' + suffix
+ }
+
+ // append parameters
+ if (parameters && typeof parameters === 'object') {
+ var param
+ var params = Object.keys(parameters).sort()
+
+ for (var i = 0; i < params.length; i++) {
+ param = params[i]
+
+ if (!tokenRegExp.test(param)) {
+ throw new TypeError('invalid parameter name')
+ }
+
+ string += '; ' + param + '=' + qstring(parameters[param])
+ }
+ }
+
+ return string
+}
+
+/**
+ * Parse media type to object.
+ *
+ * @param {string|object} string
+ * @return {Object}
+ * @api public
+ */
+
+function parse(string) {
+ if (!string) {
+ throw new TypeError('argument string is required')
+ }
+
+ // support req/res-like objects as argument
+ if (typeof string === 'object') {
+ string = getcontenttype(string)
+ }
+
+ if (typeof string !== 'string') {
+ throw new TypeError('argument string is required to be a string')
+ }
+
+ var index = string.indexOf(';')
+ var type = index !== -1
+ ? string.substr(0, index)
+ : string
+
+ var key
+ var match
+ var obj = splitType(type)
+ var params = {}
+ var value
+
+ paramRegExp.lastIndex = index
+
+ while (match = paramRegExp.exec(string)) {
+ if (match.index !== index) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ index += match[0].length
+ key = match[1].toLowerCase()
+ value = match[2]
+
+ if (value[0] === '"') {
+ // remove quotes and escapes
+ value = value
+ .substr(1, value.length - 2)
+ .replace(qescRegExp, '$1')
+ }
+
+ params[key] = value
+ }
+
+ if (index !== -1 && index !== string.length) {
+ throw new TypeError('invalid parameter format')
+ }
+
+ obj.parameters = params
+
+ return obj
+}
+
+/**
+ * Get content-type from req/res objects.
+ *
+ * @param {object}
+ * @return {Object}
+ * @api private
+ */
+
+function getcontenttype(obj) {
+ if (typeof obj.getHeader === 'function') {
+ // res-like
+ return obj.getHeader('content-type')
+ }
+
+ if (typeof obj.headers === 'object') {
+ // req-like
+ return obj.headers && obj.headers['content-type']
+ }
+}
+
+/**
+ * Quote a string if necessary.
+ *
+ * @param {string} val
+ * @return {string}
+ * @api private
+ */
+
+function qstring(val) {
+ var str = String(val)
+
+ // no need to quote tokens
+ if (tokenRegExp.test(str)) {
+ return str
+ }
+
+ if (str.length > 0 && !textRegExp.test(str)) {
+ throw new TypeError('invalid parameter value')
+ }
+
+ return '"' + str.replace(quoteRegExp, '\\$1') + '"'
+}
+
+/**
+ * Simply "type/subtype+siffx" into parts.
+ *
+ * @param {string} string
+ * @return {Object}
+ * @api private
+ */
+
+function splitType(string) {
+ var match = typeRegExp.exec(string.toLowerCase())
+
+ if (!match) {
+ throw new TypeError('invalid media type')
+ }
+
+ var type = match[1]
+ var subtype = match[2]
+ var suffix
+
+ // suffix after last +
+ var index = subtype.lastIndexOf('+')
+ if (index !== -1) {
+ suffix = subtype.substr(index + 1)
+ subtype = subtype.substr(0, index)
+ }
+
+ var obj = {
+ type: type,
+ subtype: subtype,
+ suffix: suffix
+ }
+
+ return obj
+}
diff --git a/server/node_modules/express/node_modules/media-typer/package.json b/server/node_modules/express/node_modules/media-typer/package.json
new file mode 100755
index 00000000..4bd1a51b
--- /dev/null
+++ b/server/node_modules/express/node_modules/media-typer/package.json
@@ -0,0 +1,58 @@
+{
+ "name": "media-typer",
+ "description": "Simple RFC 6838 media type parser and formatter",
+ "version": "0.3.0",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/media-typer"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.2",
+ "mocha": "~1.21.4",
+ "should": "~4.0.4"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "d49d41ffd0bb5a0655fa44a59df2ec0bfc835b16",
+ "bugs": {
+ "url": "https://github.com/jshttp/media-typer/issues"
+ },
+ "homepage": "https://github.com/jshttp/media-typer",
+ "_id": "media-typer@0.3.0",
+ "_shasum": "8710d7af0aa626f8fffa1ce00168545263255748",
+ "_from": "media-typer@0.3.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "8710d7af0aa626f8fffa1ce00168545263255748",
+ "tarball": "http://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/media-typer/-/media-typer-0.3.0.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/merge-descriptors/.npmignore b/server/node_modules/express/node_modules/merge-descriptors/.npmignore
new file mode 100755
index 00000000..f62e6050
--- /dev/null
+++ b/server/node_modules/express/node_modules/merge-descriptors/.npmignore
@@ -0,0 +1,59 @@
+# Compiled source #
+###################
+*.com
+*.class
+*.dll
+*.exe
+*.o
+*.so
+
+# Packages #
+############
+# it's better to unpack these files and commit the raw source
+# git has its own built in compression methods
+*.7z
+*.dmg
+*.gz
+*.iso
+*.jar
+*.rar
+*.tar
+*.zip
+
+# Logs and databases #
+######################
+*.log
+*.sql
+*.sqlite
+
+# OS generated files #
+######################
+.DS_Store*
+ehthumbs.db
+Icon?
+Thumbs.db
+
+# Node.js #
+###########
+lib-cov
+*.seed
+*.log
+*.csv
+*.dat
+*.out
+*.pid
+*.gz
+
+pids
+logs
+results
+
+node_modules
+npm-debug.log
+
+# Components #
+##############
+
+/build
+/components
+/vendors
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/merge-descriptors/README.md b/server/node_modules/express/node_modules/merge-descriptors/README.md
new file mode 100755
index 00000000..50cf50c0
--- /dev/null
+++ b/server/node_modules/express/node_modules/merge-descriptors/README.md
@@ -0,0 +1,49 @@
+# Merge Descriptors [](https://travis-ci.org/component/merge-descriptors)
+
+Merge objects using descriptors.
+
+```js
+var thing = {
+ get name() {
+ return 'jon'
+ }
+}
+
+var animal = {
+
+}
+
+merge(animal, thing)
+
+animal.name === 'jon'
+```
+
+## API
+
+### merge(destination, source)
+
+Overwrites `destination`'s descriptors with `source`'s.
+
+## License
+
+The MIT License (MIT)
+
+Copyright (c) 2013 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/merge-descriptors/component.json b/server/node_modules/express/node_modules/merge-descriptors/component.json
new file mode 100755
index 00000000..7653906b
--- /dev/null
+++ b/server/node_modules/express/node_modules/merge-descriptors/component.json
@@ -0,0 +1,10 @@
+{
+ "name": "merge-descriptors",
+ "description": "Merge objects using descriptors",
+ "version": "0.0.2",
+ "scripts": [
+ "index.js"
+ ],
+ "repo": "component/merge-descriptors",
+ "license": "MIT"
+}
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/merge-descriptors/index.js b/server/node_modules/express/node_modules/merge-descriptors/index.js
new file mode 100755
index 00000000..e4e23793
--- /dev/null
+++ b/server/node_modules/express/node_modules/merge-descriptors/index.js
@@ -0,0 +1,8 @@
+module.exports = function (dest, src) {
+ Object.getOwnPropertyNames(src).forEach(function (name) {
+ var descriptor = Object.getOwnPropertyDescriptor(src, name)
+ Object.defineProperty(dest, name, descriptor)
+ })
+
+ return dest
+}
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/merge-descriptors/package.json b/server/node_modules/express/node_modules/merge-descriptors/package.json
new file mode 100755
index 00000000..b1b83d4f
--- /dev/null
+++ b/server/node_modules/express/node_modules/merge-descriptors/package.json
@@ -0,0 +1,43 @@
+{
+ "name": "merge-descriptors",
+ "description": "Merge objects using descriptors",
+ "version": "0.0.2",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/component/merge-descriptors.git"
+ },
+ "bugs": {
+ "url": "https://github.com/component/merge-descriptors/issues"
+ },
+ "scripts": {
+ "test": "make test;"
+ },
+ "homepage": "https://github.com/component/merge-descriptors",
+ "_id": "merge-descriptors@0.0.2",
+ "dist": {
+ "shasum": "c36a52a781437513c57275f39dd9d317514ac8c7",
+ "tarball": "http://registry.npmjs.org/merge-descriptors/-/merge-descriptors-0.0.2.tgz"
+ },
+ "_from": "merge-descriptors@0.0.2",
+ "_npmVersion": "1.3.17",
+ "_npmUser": {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ }
+ ],
+ "directories": {},
+ "_shasum": "c36a52a781437513c57275f39dd9d317514ac8c7",
+ "_resolved": "https://registry.npmjs.org/merge-descriptors/-/merge-descriptors-0.0.2.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/methods/.npmignore b/server/node_modules/express/node_modules/methods/.npmignore
new file mode 100755
index 00000000..c2658d7d
--- /dev/null
+++ b/server/node_modules/express/node_modules/methods/.npmignore
@@ -0,0 +1 @@
+node_modules/
diff --git a/server/node_modules/express/node_modules/methods/History.md b/server/node_modules/express/node_modules/methods/History.md
new file mode 100755
index 00000000..d3996c2e
--- /dev/null
+++ b/server/node_modules/express/node_modules/methods/History.md
@@ -0,0 +1,20 @@
+
+1.1.0 / 2014-07-05
+==================
+
+ * add CONNECT
+
+1.0.1 / 2014-06-02
+==================
+
+ * fix index.js to work with harmony transform
+
+1.0.0 / 2014-05-08
+==================
+
+ * add PURGE. Closes #9
+
+0.1.0 / 2013-10-28
+==================
+
+ * add http.METHODS support
diff --git a/server/node_modules/express/node_modules/methods/LICENSE b/server/node_modules/express/node_modules/methods/LICENSE
new file mode 100755
index 00000000..8bce401d
--- /dev/null
+++ b/server/node_modules/express/node_modules/methods/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2013-2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/server/node_modules/express/node_modules/methods/Readme.md b/server/node_modules/express/node_modules/methods/Readme.md
new file mode 100755
index 00000000..ac0658e2
--- /dev/null
+++ b/server/node_modules/express/node_modules/methods/Readme.md
@@ -0,0 +1,4 @@
+
+# Methods
+
+ HTTP verbs that node core's parser supports.
diff --git a/server/node_modules/express/node_modules/methods/index.js b/server/node_modules/express/node_modules/methods/index.js
new file mode 100755
index 00000000..f7e3c486
--- /dev/null
+++ b/server/node_modules/express/node_modules/methods/index.js
@@ -0,0 +1,41 @@
+
+var http = require('http');
+
+if (http.METHODS) {
+
+ module.exports = http.METHODS.map(function(method){
+ return method.toLowerCase();
+ });
+
+} else {
+
+ module.exports = [
+ 'get',
+ 'post',
+ 'put',
+ 'head',
+ 'delete',
+ 'options',
+ 'trace',
+ 'copy',
+ 'lock',
+ 'mkcol',
+ 'move',
+ 'purge',
+ 'propfind',
+ 'proppatch',
+ 'unlock',
+ 'report',
+ 'mkactivity',
+ 'checkout',
+ 'merge',
+ 'm-search',
+ 'notify',
+ 'subscribe',
+ 'unsubscribe',
+ 'patch',
+ 'search',
+ 'connect'
+ ];
+
+}
diff --git a/server/node_modules/express/node_modules/methods/package.json b/server/node_modules/express/node_modules/methods/package.json
new file mode 100755
index 00000000..8d1c1988
--- /dev/null
+++ b/server/node_modules/express/node_modules/methods/package.json
@@ -0,0 +1,58 @@
+{
+ "name": "methods",
+ "version": "1.1.0",
+ "description": "HTTP methods that node supports",
+ "main": "index.js",
+ "scripts": {
+ "test": "./node_modules/mocha/bin/mocha"
+ },
+ "keywords": [
+ "http",
+ "methods"
+ ],
+ "author": {
+ "name": "TJ Holowaychuk"
+ },
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/visionmedia/node-methods.git"
+ },
+ "devDependencies": {
+ "mocha": "1.17.x"
+ },
+ "gitHead": "2a4dd325d18436c33356e6be19e32e08a7c877ab",
+ "bugs": {
+ "url": "https://github.com/visionmedia/node-methods/issues"
+ },
+ "homepage": "https://github.com/visionmedia/node-methods",
+ "_id": "methods@1.1.0",
+ "_shasum": "5dca4ee12df52ff3b056145986a8f01cbc86436f",
+ "_from": "methods@1.1.0",
+ "_npmVersion": "1.4.16",
+ "_npmUser": {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "jonathanong",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "5dca4ee12df52ff3b056145986a8f01cbc86436f",
+ "tarball": "http://registry.npmjs.org/methods/-/methods-1.1.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/methods/-/methods-1.1.0.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/methods/test/methods.js b/server/node_modules/express/node_modules/methods/test/methods.js
new file mode 100755
index 00000000..527beaba
--- /dev/null
+++ b/server/node_modules/express/node_modules/methods/test/methods.js
@@ -0,0 +1,33 @@
+var http = require('http');
+var assert = require('assert');
+var methods = require('..');
+
+describe('methods', function() {
+
+ if (http.METHODS) {
+
+ it('is a lowercased http.METHODS', function() {
+ var lowercased = http.METHODS.map(function(method) {
+ return method.toLowerCase();
+ });
+ assert.deepEqual(lowercased, methods);
+ });
+
+ } else {
+
+ it('contains GET, POST, PUT, and DELETE', function() {
+ assert.notEqual(methods.indexOf('get'), -1);
+ assert.notEqual(methods.indexOf('post'), -1);
+ assert.notEqual(methods.indexOf('put'), -1);
+ assert.notEqual(methods.indexOf('delete'), -1);
+ });
+
+ it('is all lowercase', function() {
+ for (var i = 0; i < methods.length; i ++) {
+ assert(methods[i], methods[i].toLowerCase(), methods[i] + " isn't all lowercase");
+ }
+ });
+
+ }
+
+});
diff --git a/server/node_modules/express/node_modules/on-finished/HISTORY.md b/server/node_modules/express/node_modules/on-finished/HISTORY.md
new file mode 100755
index 00000000..1a4063dc
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/HISTORY.md
@@ -0,0 +1,71 @@
+2.1.1 / 2014-10-22
+==================
+
+ * Fix handling of pipelined requests
+
+2.1.0 / 2014-08-16
+==================
+
+ * Check if `socket` is detached
+ * Return `undefined` for `isFinished` if state unknown
+
+2.0.0 / 2014-08-16
+==================
+
+ * Add `isFinished` function
+ * Move to `jshttp` organization
+ * Remove support for plain socket argument
+ * Rename to `on-finished`
+ * Support both `req` and `res` as arguments
+ * deps: ee-first@1.0.5
+
+1.2.2 / 2014-06-10
+==================
+
+ * Reduce listeners added to emitters
+ - avoids "event emitter leak" warnings when used multiple times on same request
+
+1.2.1 / 2014-06-08
+==================
+
+ * Fix returned value when already finished
+
+1.2.0 / 2014-06-05
+==================
+
+ * Call callback when called on already-finished socket
+
+1.1.4 / 2014-05-27
+==================
+
+ * Support node.js 0.8
+
+1.1.3 / 2014-04-30
+==================
+
+ * Make sure errors passed as instanceof `Error`
+
+1.1.2 / 2014-04-18
+==================
+
+ * Default the `socket` to passed-in object
+
+1.1.1 / 2014-01-16
+==================
+
+ * Rename module to `finished`
+
+1.1.0 / 2013-12-25
+==================
+
+ * Call callback when called on already-errored socket
+
+1.0.1 / 2013-12-20
+==================
+
+ * Actually pass the error to the callback
+
+1.0.0 / 2013-12-20
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/on-finished/LICENSE b/server/node_modules/express/node_modules/on-finished/LICENSE
new file mode 100755
index 00000000..5931fd23
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2013 Jonathan Ong
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/on-finished/README.md b/server/node_modules/express/node_modules/on-finished/README.md
new file mode 100755
index 00000000..6fb0e4d4
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/README.md
@@ -0,0 +1,102 @@
+# on-finished
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Execute a callback when a request closes, finishes, or errors.
+
+## Install
+
+```sh
+$ npm install on-finished
+```
+
+## API
+
+```js
+var onFinished = require('on-finished')
+```
+
+### onFinished(res, listener)
+
+Attach a listener to listen for the response to finish. The listener will
+be invoked only once when the response finished. If the response finished
+to to an error, the first argument will contain the error.
+
+Listening to the end of a response would be used to close things associated
+with the response, like open files.
+
+```js
+onFinished(res, function (err) {
+ // clean up open fds, etc.
+})
+```
+
+### onFinished(req, listener)
+
+Attach a listener to listen for the request to finish. The listener will
+be invoked only once when the request finished. If the request finished
+to to an error, the first argument will contain the error.
+
+Listening to the end of a request would be used to know when to continue
+after reading the data.
+
+```js
+var data = ''
+
+req.setEncoding('utf8')
+res.on('data', function (str) {
+ data += str
+})
+
+onFinished(req, function (err) {
+ // data is read unless there is err
+})
+```
+
+### onFinished.isFinished(res)
+
+Determine if `res` is already finished. This would be useful to check and
+not even start certain operations if the response has already finished.
+
+### onFinished.isFinished(req)
+
+Determine if `req` is already finished. This would be useful to check and
+not even start certain operations if the request has already finished.
+
+### Example
+
+The following code ensures that file descriptors are always closed
+once the response finishes.
+
+```js
+var destroy = require('destroy')
+var http = require('http')
+var onFinished = require('on-finished')
+
+http.createServer(function onRequest(req, res) {
+ var stream = fs.createReadStream('package.json')
+ stream.pipe(res)
+ onFinished(res, function (err) {
+ destroy(stream)
+ })
+})
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/on-finished.svg?style=flat
+[npm-url]: https://npmjs.org/package/on-finished
+[node-version-image]: https://img.shields.io/node/v/on-finished.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/on-finished.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/on-finished
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/on-finished.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/on-finished?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/on-finished.svg?style=flat
+[downloads-url]: https://npmjs.org/package/on-finished
diff --git a/server/node_modules/express/node_modules/on-finished/index.js b/server/node_modules/express/node_modules/on-finished/index.js
new file mode 100755
index 00000000..e75a7e9b
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/index.js
@@ -0,0 +1,191 @@
+/*!
+ * on-finished
+ * Copyright(c) 2013 Jonathan Ong
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = onFinished;
+module.exports.isFinished = isFinished;
+
+/**
+* Module dependencies.
+*/
+
+var first = require('ee-first')
+
+/**
+* Variables.
+*/
+
+/* istanbul ignore next */
+var defer = typeof setImmediate === 'function'
+ ? setImmediate
+ : function(fn){ process.nextTick(fn.bind.apply(fn, arguments)) }
+
+/**
+ * Invoke callback when the response has finished, useful for
+ * cleaning up resources afterwards.
+ *
+ * @param {object} msg
+ * @param {function} listener
+ * @return {object}
+ * @api public
+ */
+
+function onFinished(msg, listener) {
+ if (isFinished(msg) !== false) {
+ defer(listener)
+ return msg
+ }
+
+ // attach the listener to the message
+ attachListener(msg, listener)
+
+ return msg
+}
+
+/**
+ * Determine if message is already finished.
+ *
+ * @param {object} msg
+ * @return {boolean}
+ * @api public
+ */
+
+function isFinished(msg) {
+ var socket = msg.socket
+
+ if (typeof msg.finished === 'boolean') {
+ // OutgoingMessage
+ return Boolean(msg.finished || (socket && !socket.writable))
+ }
+
+ if (typeof msg.complete === 'boolean') {
+ // IncomingMessage
+ return Boolean(!socket || msg.complete || !socket.readable)
+ }
+
+ // don't know
+ return undefined
+}
+
+/**
+ * Attach a finished listener to the message.
+ *
+ * @param {object} msg
+ * @param {function} callback
+ * @private
+ */
+
+function attachFinishedListener(msg, callback) {
+ var eeMsg
+ var eeSocket
+ var finished = false
+
+ function onFinish(error) {
+ eeMsg.cancel()
+ eeSocket.cancel()
+
+ finished = true
+ callback(error)
+ }
+
+ // finished on first message event
+ eeMsg = eeSocket = first([[msg, 'end', 'finish']], onFinish)
+
+ function onSocket(socket) {
+ // remove listener
+ msg.removeListener('socket', onSocket)
+
+ if (finished) return
+ if (eeMsg !== eeSocket) return
+
+ // finished on first socket event
+ eeSocket = first([[socket, 'error', 'close']], onFinish)
+ }
+
+ if (msg.socket) {
+ // socket already assigned
+ onSocket(msg.socket)
+ return
+ }
+
+ // wait for socket to be assigned
+ msg.on('socket', onSocket)
+
+ if (msg.socket === undefined) {
+ // node.js 0.8 patch
+ patchAssignSocket(msg, onSocket)
+ }
+}
+
+/**
+ * Attach the listener to the message.
+ *
+ * @param {object} msg
+ * @return {function}
+ * @api private
+ */
+
+function attachListener(msg, listener) {
+ var attached = msg.__onFinished
+
+ // create a private single listener with queue
+ if (!attached || !attached.queue) {
+ attached = msg.__onFinished = createListener(msg)
+ attachFinishedListener(msg, attached)
+ }
+
+ attached.queue.push(listener)
+}
+
+/**
+ * Create listener on message.
+ *
+ * @param {object} msg
+ * @return {function}
+ * @api private
+ */
+
+function createListener(msg) {
+ function listener(err) {
+ if (msg.__onFinished === listener) msg.__onFinished = null
+ if (!listener.queue) return
+
+ var queue = listener.queue
+ listener.queue = null
+
+ for (var i = 0; i < queue.length; i++) {
+ queue[i](err)
+ }
+ }
+
+ listener.queue = []
+
+ return listener
+}
+
+/**
+ * Patch ServerResponse.prototype.assignSocket for node.js 0.8.
+ *
+ * @param {ServerResponse} res
+ * @param {function} callback
+ * @private
+ */
+
+function patchAssignSocket(res, callback) {
+ var assignSocket = res.assignSocket
+
+ if (typeof assignSocket !== 'function') return
+
+ // res.on('socket', callback) is broken in 0.8
+ res.assignSocket = function _assignSocket(socket) {
+ assignSocket.call(this, socket)
+ callback(socket)
+ }
+}
diff --git a/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/LICENSE b/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/LICENSE
new file mode 100755
index 00000000..c1b15a1d
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/README.md b/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/README.md
new file mode 100755
index 00000000..bb16aabe
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/README.md
@@ -0,0 +1,80 @@
+# EE First
+
+[![NPM version][npm-image]][npm-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+[![Gittip][gittip-image]][gittip-url]
+
+Get the first event in a set of event emitters and event pairs,
+then clean up after itself.
+
+## Install
+
+```sh
+$ npm install ee-first
+```
+
+## API
+
+```js
+var first = require('ee-first')
+```
+
+### first(arr, listener)
+
+Invoke `listener` on the first event from the list specified in `arr`. `arr` is
+an array of arrays, with each array in the format `[ee, ...event]`. `listener`
+will be called only once, the first time any of the given events are emitted. If
+`error` is one of the listened events, then if that fires first, the `listener`
+will be given the `err` argument.
+
+The `listener` is invoked as `listener(err, ee, event, args)`, where `err` is the
+first argument emitted from an `error` event, if applicable; `ee` is the event
+emitter that fired; `event` is the string event name that fired; and `args` is an
+array of the arguments that were emitted on the event.
+
+```js
+var ee1 = new EventEmitter()
+var ee2 = new EventEmitter()
+
+first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+```
+
+#### .cancel()
+
+The group of listeners can be cancelled before being invoked and have all the event
+listeners removed from the underlying event emitters.
+
+```js
+var thunk = first([
+ [ee1, 'close', 'end', 'error'],
+ [ee2, 'error']
+], function (err, ee, event, args) {
+ // listener invoked
+})
+
+// cancel and clean up
+thunk.cancel()
+```
+
+[npm-image]: https://img.shields.io/npm/v/ee-first.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/ee-first
+[github-tag]: http://img.shields.io/github/tag/jonathanong/ee-first.svg?style=flat-square
+[github-url]: https://github.com/jonathanong/ee-first/tags
+[travis-image]: https://img.shields.io/travis/jonathanong/ee-first.svg?style=flat-square
+[travis-url]: https://travis-ci.org/jonathanong/ee-first
+[coveralls-image]: https://img.shields.io/coveralls/jonathanong/ee-first.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/jonathanong/ee-first?branch=master
+[license-image]: http://img.shields.io/npm/l/ee-first.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/ee-first.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/ee-first
+[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
+[gittip-url]: https://www.gittip.com/jonathanong/
diff --git a/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/index.js b/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/index.js
new file mode 100755
index 00000000..1d662039
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/index.js
@@ -0,0 +1,68 @@
+
+module.exports = function first(stuff, done) {
+ if (!Array.isArray(stuff))
+ throw new TypeError('arg must be an array of [ee, events...] arrays')
+
+ var cleanups = []
+
+ for (var i = 0; i < stuff.length; i++) {
+ var arr = stuff[i]
+
+ if (!Array.isArray(arr) || arr.length < 2)
+ throw new TypeError('each array member must be [ee, events...]')
+
+ var ee = arr[0]
+
+ for (var j = 1; j < arr.length; j++) {
+ var event = arr[j]
+ var fn = listener(event, callback)
+
+ // listen to the event
+ ee.on(event, fn)
+ // push this listener to the list of cleanups
+ cleanups.push({
+ ee: ee,
+ event: event,
+ fn: fn,
+ })
+ }
+ }
+
+ function callback() {
+ cleanup()
+ done.apply(null, arguments)
+ }
+
+ function cleanup() {
+ var x
+ for (var i = 0; i < cleanups.length; i++) {
+ x = cleanups[i]
+ x.ee.removeListener(x.event, x.fn)
+ }
+ }
+
+ function thunk(fn) {
+ done = fn
+ }
+
+ thunk.cancel = cleanup
+
+ return thunk
+}
+
+function listener(event, done) {
+ return function onevent(arg1) {
+ var args = new Array(arguments.length)
+ var ee = this
+ var err = event === 'error'
+ ? arg1
+ : null
+
+ // copy args to prevent arguments escaping scope
+ for (var i = 0; i < args.length; i++) {
+ args[i] = arguments[i]
+ }
+
+ done(err, ee, event, args)
+ }
+}
diff --git a/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/package.json b/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/package.json
new file mode 100755
index 00000000..af11b2ac
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/node_modules/ee-first/package.json
@@ -0,0 +1,63 @@
+{
+ "name": "ee-first",
+ "description": "return the first event in a set of ee/event pairs",
+ "version": "1.1.0",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jonathanong/ee-first"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.2",
+ "mocha": "1"
+ },
+ "files": [
+ "index.js",
+ "LICENSE"
+ ],
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "a6412004da4745941af2fc98ec30c8da570da7ea",
+ "bugs": {
+ "url": "https://github.com/jonathanong/ee-first/issues"
+ },
+ "homepage": "https://github.com/jonathanong/ee-first",
+ "_id": "ee-first@1.1.0",
+ "_shasum": "6a0d7c6221e490feefd92ec3f441c9ce8cd097f4",
+ "_from": "ee-first@1.1.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "6a0d7c6221e490feefd92ec3f441c9ce8cd097f4",
+ "tarball": "http://registry.npmjs.org/ee-first/-/ee-first-1.1.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/ee-first/-/ee-first-1.1.0.tgz"
+}
diff --git a/server/node_modules/express/node_modules/on-finished/package.json b/server/node_modules/express/node_modules/on-finished/package.json
new file mode 100755
index 00000000..85c11b31
--- /dev/null
+++ b/server/node_modules/express/node_modules/on-finished/package.json
@@ -0,0 +1,70 @@
+{
+ "name": "on-finished",
+ "description": "Execute a callback when a request closes, finishes, or errors",
+ "version": "2.1.1",
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ }
+ ],
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/on-finished"
+ },
+ "dependencies": {
+ "ee-first": "1.1.0"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.2",
+ "mocha": "~2.0.0"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "index.js"
+ ],
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "8ec5fa639ace400b543b5bc1821ce909b9acdc03",
+ "bugs": {
+ "url": "https://github.com/jshttp/on-finished/issues"
+ },
+ "homepage": "https://github.com/jshttp/on-finished",
+ "_id": "on-finished@2.1.1",
+ "_shasum": "f82ca1c9e3a4f3286b1b9938610e5b8636bd3cb2",
+ "_from": "on-finished@~2.1.1",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "f82ca1c9e3a4f3286b1b9938610e5b8636bd3cb2",
+ "tarball": "http://registry.npmjs.org/on-finished/-/on-finished-2.1.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/on-finished/-/on-finished-2.1.1.tgz"
+}
diff --git a/server/node_modules/express/node_modules/parseurl/.npmignore b/server/node_modules/express/node_modules/parseurl/.npmignore
new file mode 100755
index 00000000..85c82a56
--- /dev/null
+++ b/server/node_modules/express/node_modules/parseurl/.npmignore
@@ -0,0 +1,4 @@
+benchmark/
+coverage/
+test/
+.travis.yml
diff --git a/server/node_modules/express/node_modules/parseurl/HISTORY.md b/server/node_modules/express/node_modules/parseurl/HISTORY.md
new file mode 100755
index 00000000..65a08606
--- /dev/null
+++ b/server/node_modules/express/node_modules/parseurl/HISTORY.md
@@ -0,0 +1,42 @@
+1.3.0 / 2014-08-09
+==================
+
+ * Add `parseurl.original` for parsing `req.originalUrl` with fallback
+ * Return `undefined` if `req.url` is `undefined`
+
+1.2.0 / 2014-07-21
+==================
+
+ * Cache URLs based on original value
+ * Remove no-longer-needed URL mis-parse work-around
+ * Simplify the "fast-path" `RegExp`
+
+1.1.3 / 2014-07-08
+==================
+
+ * Fix typo
+
+1.1.2 / 2014-07-08
+==================
+
+ * Seriously fix Node.js 0.8 compatibility
+
+1.1.1 / 2014-07-08
+==================
+
+ * Fix Node.js 0.8 compatibility
+
+1.1.0 / 2014-07-08
+==================
+
+ * Incorporate URL href-only parse fast-path
+
+1.0.1 / 2014-03-08
+==================
+
+ * Add missing `require`
+
+1.0.0 / 2014-03-08
+==================
+
+ * Genesis from `connect`
diff --git a/server/node_modules/express/node_modules/parseurl/LICENSE b/server/node_modules/express/node_modules/parseurl/LICENSE
new file mode 100755
index 00000000..ec7dfe7b
--- /dev/null
+++ b/server/node_modules/express/node_modules/parseurl/LICENSE
@@ -0,0 +1,24 @@
+
+(The MIT License)
+
+Copyright (c) 2014 Jonathan Ong
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/parseurl/README.md b/server/node_modules/express/node_modules/parseurl/README.md
new file mode 100755
index 00000000..0db1d029
--- /dev/null
+++ b/server/node_modules/express/node_modules/parseurl/README.md
@@ -0,0 +1,107 @@
+# parseurl
+
+[](http://badge.fury.io/js/parseurl)
+[](https://travis-ci.org/expressjs/parseurl)
+[](https://coveralls.io/r/expressjs/parseurl)
+
+Parse a URL with memoization.
+
+## Install
+
+```bash
+$ npm install parseurl
+```
+
+## API
+
+```js
+var parseurl = require('parseurl')
+```
+
+### parseurl(req)
+
+Parse the URL of the given request object (looks at the `req.url` property)
+and return the result. The result is the same as `url.parse` in Node.js core.
+Calling this function multiple times on the same `req` where `req.url` does
+not change will return a cached parsed object, rather than parsing again.
+
+### parseurl.original(req)
+
+Parse the original URL of the given request object and return the result.
+This works by trying to parse `req.originalUrl` if it is a string, otherwise
+parses `req.url`. The result is the same as `url.parse` in Node.js core.
+Calling this function multiple times on the same `req` where `req.originalUrl`
+does not change will return a cached parsed object, rather than parsing again.
+
+## Benchmark
+
+```bash
+$ npm run-script bench
+
+> parseurl@1.3.0 bench nodejs-parseurl
+> node benchmark/index.js
+
+> node benchmark/fullurl.js
+
+ Parsing URL "http://localhost:8888/foo/bar?user=tj&pet=fluffy"
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ fasturl x 1,290,780 ops/sec ±0.46% (195 runs sampled)
+ nativeurl x 56,401 ops/sec ±0.22% (196 runs sampled)
+ parseurl x 55,231 ops/sec ±0.22% (194 runs sampled)
+
+> node benchmark/pathquery.js
+
+ Parsing URL "/foo/bar?user=tj&pet=fluffy"
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ fasturl x 1,986,668 ops/sec ±0.27% (190 runs sampled)
+ nativeurl x 98,740 ops/sec ±0.21% (195 runs sampled)
+ parseurl x 2,628,171 ops/sec ±0.36% (195 runs sampled)
+
+> node benchmark/samerequest.js
+
+ Parsing URL "/foo/bar?user=tj&pet=fluffy" on same request object
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ fasturl x 2,184,468 ops/sec ±0.40% (194 runs sampled)
+ nativeurl x 99,437 ops/sec ±0.71% (194 runs sampled)
+ parseurl x 10,498,005 ops/sec ±0.61% (186 runs sampled)
+
+> node benchmark/simplepath.js
+
+ Parsing URL "/foo/bar"
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ fasturl x 4,535,825 ops/sec ±0.27% (191 runs sampled)
+ nativeurl x 98,769 ops/sec ±0.54% (191 runs sampled)
+ parseurl x 4,164,865 ops/sec ±0.34% (192 runs sampled)
+
+> node benchmark/slash.js
+
+ Parsing URL "/"
+
+ 1 test completed.
+ 2 tests completed.
+ 3 tests completed.
+
+ fasturl x 4,908,405 ops/sec ±0.42% (191 runs sampled)
+ nativeurl x 100,945 ops/sec ±0.59% (188 runs sampled)
+ parseurl x 4,333,208 ops/sec ±0.27% (194 runs sampled)
+```
+
+## License
+
+ [MIT](LICENSE)
diff --git a/server/node_modules/express/node_modules/parseurl/index.js b/server/node_modules/express/node_modules/parseurl/index.js
new file mode 100755
index 00000000..86323472
--- /dev/null
+++ b/server/node_modules/express/node_modules/parseurl/index.js
@@ -0,0 +1,136 @@
+/*!
+ * parseurl
+ * Copyright(c) 2014 Jonathan Ong
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var url = require('url')
+var parse = url.parse
+var Url = url.Url
+
+/**
+ * Pattern for a simple path case.
+ * See: https://github.com/joyent/node/pull/7878
+ */
+
+var simplePathRegExp = /^(\/\/?(?!\/)[^\?#\s]*)(\?[^#\s]*)?$/
+
+/**
+ * Exports.
+ */
+
+module.exports = parseurl
+module.exports.original = originalurl
+
+/**
+ * Parse the `req` url with memoization.
+ *
+ * @param {ServerRequest} req
+ * @return {Object}
+ * @api public
+ */
+
+function parseurl(req) {
+ var url = req.url
+
+ if (url === undefined) {
+ // URL is undefined
+ return undefined
+ }
+
+ var parsed = req._parsedUrl
+
+ if (fresh(url, parsed)) {
+ // Return cached URL parse
+ return parsed
+ }
+
+ // Parse the URL
+ parsed = fastparse(url)
+ parsed._raw = url
+
+ return req._parsedUrl = parsed
+};
+
+/**
+ * Parse the `req` original url with fallback and memoization.
+ *
+ * @param {ServerRequest} req
+ * @return {Object}
+ * @api public
+ */
+
+function originalurl(req) {
+ var url = req.originalUrl
+
+ if (typeof url !== 'string') {
+ // Fallback
+ return parseurl(req)
+ }
+
+ var parsed = req._parsedOriginalUrl
+
+ if (fresh(url, parsed)) {
+ // Return cached URL parse
+ return parsed
+ }
+
+ // Parse the URL
+ parsed = fastparse(url)
+ parsed._raw = url
+
+ return req._parsedOriginalUrl = parsed
+};
+
+/**
+ * Parse the `str` url with fast-path short-cut.
+ *
+ * @param {string} str
+ * @return {Object}
+ * @api private
+ */
+
+function fastparse(str) {
+ // Try fast path regexp
+ // See: https://github.com/joyent/node/pull/7878
+ var simplePath = typeof str === 'string' && simplePathRegExp.exec(str)
+
+ // Construct simple URL
+ if (simplePath) {
+ var pathname = simplePath[1]
+ var search = simplePath[2] || null
+ var url = Url !== undefined
+ ? new Url()
+ : {}
+ url.path = str
+ url.href = str
+ url.pathname = pathname
+ url.search = search
+ url.query = search && search.substr(1)
+
+ return url
+ }
+
+ return parse(str)
+}
+
+/**
+ * Determine if parsed is still fresh for url.
+ *
+ * @param {string} url
+ * @param {object} parsedUrl
+ * @return {boolean}
+ * @api private
+ */
+
+function fresh(url, parsedUrl) {
+ return typeof parsedUrl === 'object'
+ && parsedUrl !== null
+ && (Url === undefined || parsedUrl instanceof Url)
+ && parsedUrl._raw === url
+}
diff --git a/server/node_modules/express/node_modules/parseurl/package.json b/server/node_modules/express/node_modules/parseurl/package.json
new file mode 100755
index 00000000..6fbd23e9
--- /dev/null
+++ b/server/node_modules/express/node_modules/parseurl/package.json
@@ -0,0 +1,80 @@
+{
+ "name": "parseurl",
+ "description": "parse a url with memoization",
+ "version": "1.3.0",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/expressjs/parseurl"
+ },
+ "license": "MIT",
+ "devDependencies": {
+ "benchmark": "1.0.0",
+ "beautify-benchmark": "0.2.4",
+ "fast-url-parser": "~1.0.0",
+ "istanbul": "0.3.0",
+ "mocha": "~1.21.4"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "test": "mocha --check-leaks --bail --reporter spec test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec test/"
+ },
+ "gitHead": "03b7ccca240e2bef5df6c25797e99175d28fb2cb",
+ "bugs": {
+ "url": "https://github.com/expressjs/parseurl/issues"
+ },
+ "homepage": "https://github.com/expressjs/parseurl",
+ "_id": "parseurl@1.3.0",
+ "_shasum": "b58046db4223e145afa76009e61bac87cc2281b3",
+ "_from": "parseurl@~1.3.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "mscdex",
+ "email": "mscdex@mscdex.net"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "b58046db4223e145afa76009e61bac87cc2281b3",
+ "tarball": "http://registry.npmjs.org/parseurl/-/parseurl-1.3.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/parseurl/-/parseurl-1.3.0.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/path-to-regexp/.npmignore b/server/node_modules/express/node_modules/path-to-regexp/.npmignore
new file mode 100755
index 00000000..ba2a97b5
--- /dev/null
+++ b/server/node_modules/express/node_modules/path-to-regexp/.npmignore
@@ -0,0 +1,2 @@
+node_modules
+coverage
diff --git a/server/node_modules/express/node_modules/path-to-regexp/History.md b/server/node_modules/express/node_modules/path-to-regexp/History.md
new file mode 100755
index 00000000..f962cfad
--- /dev/null
+++ b/server/node_modules/express/node_modules/path-to-regexp/History.md
@@ -0,0 +1,16 @@
+0.1.3 / 2014-07-06
+==================
+
+ * Better array support
+ * Improved support for trailing slash in non-ending mode
+
+0.1.0 / 2014-03-06
+==================
+
+ * add options.end
+
+0.0.2 / 2013-02-10
+==================
+
+ * Update to match current express
+ * add .license property to component.json
diff --git a/server/node_modules/express/node_modules/path-to-regexp/Readme.md b/server/node_modules/express/node_modules/path-to-regexp/Readme.md
new file mode 100755
index 00000000..9199e387
--- /dev/null
+++ b/server/node_modules/express/node_modules/path-to-regexp/Readme.md
@@ -0,0 +1,33 @@
+
+# Path-to-RegExp
+
+ Turn an Express-style path string such as `/user/:name` into a regular expression.
+
+## Usage
+
+```javascript
+var pathToRegexp = require('path-to-regexp');
+```
+### pathToRegexp(path, keys, options)
+
+ - **path** A string in the express format, an array of such strings, or a regular expression
+ - **keys** An array to be populated with the keys present in the url. Once the function completes, this will be an array of strings.
+ - **options**
+ - **options.sensitive** Defaults to false, set this to true to make routes case sensitive
+ - **options.strict** Defaults to false, set this to true to make the trailing slash matter.
+ - **options.end** Defaults to true, set this to false to only match the prefix of the URL.
+
+```javascript
+var keys = [];
+var exp = pathToRegexp('/foo/:bar', keys);
+//keys = ['bar']
+//exp = /^\/foo\/(?:([^\/]+?))\/?$/i
+```
+
+## Live Demo
+
+You can see a live demo of this library in use at [express-route-tester](http://forbeslindesay.github.com/express-route-tester/).
+
+## License
+
+ MIT
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/path-to-regexp/component.json b/server/node_modules/express/node_modules/path-to-regexp/component.json
new file mode 100755
index 00000000..6ab37d36
--- /dev/null
+++ b/server/node_modules/express/node_modules/path-to-regexp/component.json
@@ -0,0 +1,15 @@
+{
+ "name": "path-to-regexp",
+ "description": "Express style path to RegExp utility",
+ "version": "0.1.3",
+ "keywords": [
+ "express",
+ "regexp",
+ "route",
+ "routing"
+ ],
+ "scripts": [
+ "index.js"
+ ],
+ "license": "MIT"
+}
diff --git a/server/node_modules/express/node_modules/path-to-regexp/index.js b/server/node_modules/express/node_modules/path-to-regexp/index.js
new file mode 100755
index 00000000..2801f914
--- /dev/null
+++ b/server/node_modules/express/node_modules/path-to-regexp/index.js
@@ -0,0 +1,70 @@
+/**
+ * Expose `pathtoRegexp`.
+ */
+
+module.exports = pathtoRegexp;
+
+/**
+ * Normalize the given path string,
+ * returning a regular expression.
+ *
+ * An empty array should be passed,
+ * which will contain the placeholder
+ * key names. For example "/user/:id" will
+ * then contain ["id"].
+ *
+ * @param {String|RegExp|Array} path
+ * @param {Array} keys
+ * @param {Object} options
+ * @return {RegExp}
+ * @api private
+ */
+
+function pathtoRegexp(path, keys, options) {
+ options = options || {};
+ var strict = options.strict;
+ var end = options.end !== false;
+ var flags = options.sensitive ? '' : 'i';
+ keys = keys || [];
+
+ if (path instanceof RegExp) {
+ return path;
+ }
+
+ if (Array.isArray(path)) {
+ // Map array parts into regexps and return their source. We also pass
+ // the same keys and options instance into every generation to get
+ // consistent matching groups before we join the sources together.
+ path = path.map(function (value) {
+ return pathtoRegexp(value, keys, options).source;
+ });
+
+ return new RegExp('(?:' + path.join('|') + ')', flags);
+ }
+
+ path = ('^' + path + (strict ? '' : path[path.length - 1] === '/' ? '?' : '/?'))
+ .replace(/\/\(/g, '/(?:')
+ .replace(/([\/\.])/g, '\\$1')
+ .replace(/(\\\/)?(\\\.)?:(\w+)(\(.*?\))?(\*)?(\?)?/g, function (match, slash, format, key, capture, star, optional) {
+ slash = slash || '';
+ format = format || '';
+ capture = capture || '([^\\/' + format + ']+?)';
+ optional = optional || '';
+
+ keys.push({ name: key, optional: !!optional });
+
+ return ''
+ + (optional ? '' : slash)
+ + '(?:'
+ + format + (optional ? slash : '') + capture
+ + (star ? '((?:[\\/' + format + '].+?)?)' : '')
+ + ')'
+ + optional;
+ })
+ .replace(/\*/g, '(.*)');
+
+ // If the path is non-ending, match until the end or a slash.
+ path += (end ? '$' : (path[path.length - 1] === '/' ? '' : '(?=\\/|$)'));
+
+ return new RegExp(path, flags);
+};
diff --git a/server/node_modules/express/node_modules/path-to-regexp/package.json b/server/node_modules/express/node_modules/path-to-regexp/package.json
new file mode 100755
index 00000000..bccfe25f
--- /dev/null
+++ b/server/node_modules/express/node_modules/path-to-regexp/package.json
@@ -0,0 +1,162 @@
+{
+ "name": "path-to-regexp",
+ "description": "Express style path to RegExp utility",
+ "version": "0.1.3",
+ "scripts": {
+ "test": "istanbul cover _mocha -- -R spec"
+ },
+ "keywords": [
+ "express",
+ "regexp"
+ ],
+ "component": {
+ "scripts": {
+ "path-to-regexp": "index.js"
+ }
+ },
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/component/path-to-regexp.git"
+ },
+ "devDependencies": {
+ "mocha": "^1.17.1",
+ "istanbul": "^0.2.6"
+ },
+ "bugs": {
+ "url": "https://github.com/component/path-to-regexp/issues"
+ },
+ "homepage": "https://github.com/component/path-to-regexp",
+ "_id": "path-to-regexp@0.1.3",
+ "_shasum": "21b9ab82274279de25b156ea08fd12ca51b8aecb",
+ "_from": "path-to-regexp@0.1.3",
+ "_npmVersion": "1.4.9",
+ "_npmUser": {
+ "name": "blakeembrey",
+ "email": "hello@blakeembrey.com"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "dominicbarnes",
+ "email": "dominic@dbarnes.info"
+ },
+ {
+ "name": "tootallnate",
+ "email": "nathan@tootallnate.net"
+ },
+ {
+ "name": "rauchg",
+ "email": "rauchg@gmail.com"
+ },
+ {
+ "name": "retrofox",
+ "email": "rdsuarez@gmail.com"
+ },
+ {
+ "name": "coreh",
+ "email": "thecoreh@gmail.com"
+ },
+ {
+ "name": "forbeslindesay",
+ "email": "forbes@lindesay.co.uk"
+ },
+ {
+ "name": "kelonye",
+ "email": "kelonyemitchel@gmail.com"
+ },
+ {
+ "name": "mattmueller",
+ "email": "mattmuelle@gmail.com"
+ },
+ {
+ "name": "yields",
+ "email": "yields@icloud.com"
+ },
+ {
+ "name": "anthonyshort",
+ "email": "antshort@gmail.com"
+ },
+ {
+ "name": "ianstormtaylor",
+ "email": "ian@ianstormtaylor.com"
+ },
+ {
+ "name": "cristiandouce",
+ "email": "cristian@gravityonmars.com"
+ },
+ {
+ "name": "swatinem",
+ "email": "arpad.borsos@googlemail.com"
+ },
+ {
+ "name": "stagas",
+ "email": "gstagas@gmail.com"
+ },
+ {
+ "name": "amasad",
+ "email": "amjad.masad@gmail.com"
+ },
+ {
+ "name": "juliangruber",
+ "email": "julian@juliangruber.com"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ {
+ "name": "calvinfo",
+ "email": "calvin@calv.info"
+ },
+ {
+ "name": "blakeembrey",
+ "email": "hello@blakeembrey.com"
+ },
+ {
+ "name": "timoxley",
+ "email": "secoif@gmail.com"
+ },
+ {
+ "name": "jonathanong",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "queckezz",
+ "email": "fabian.eichenberger@gmail.com"
+ },
+ {
+ "name": "nami-doc",
+ "email": "vendethiel@hotmail.fr"
+ },
+ {
+ "name": "clintwood",
+ "email": "clint@anotherway.co.za"
+ },
+ {
+ "name": "thehydroimpulse",
+ "email": "dnfagnan@gmail.com"
+ },
+ {
+ "name": "stephenmathieson",
+ "email": "me@stephenmathieson.com"
+ },
+ {
+ "name": "trevorgerhardt",
+ "email": "trevorgerhardt@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "21b9ab82274279de25b156ea08fd12ca51b8aecb",
+ "tarball": "http://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.3.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/path-to-regexp/-/path-to-regexp-0.1.3.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/path-to-regexp/test.js b/server/node_modules/express/node_modules/path-to-regexp/test.js
new file mode 100755
index 00000000..4a0c2709
--- /dev/null
+++ b/server/node_modules/express/node_modules/path-to-regexp/test.js
@@ -0,0 +1,616 @@
+var pathToRegExp = require('./');
+var assert = require('assert');
+
+describe('path-to-regexp', function () {
+ describe('strings', function () {
+ it('should match simple paths', function () {
+ var params = [];
+ var m = pathToRegExp('/test', params).exec('/test');
+
+ assert.equal(params.length, 0);
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/test');
+ });
+
+ it('should match express format params', function () {
+ var params = [];
+ var m = pathToRegExp('/:test', params).exec('/pathname');
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/pathname');
+ assert.equal(m[1], 'pathname');
+ });
+
+ it('should do strict matches', function () {
+ var params = [];
+ var re = pathToRegExp('/:test', params, { strict: true });
+ var m;
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ m = re.exec('/route');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/route');
+ assert.equal(m[1], 'route');
+
+ m = re.exec('/route/');
+
+ assert.ok(!m);
+ });
+
+ it('should do strict matches with trailing slashes', function () {
+ var params = [];
+ var re = pathToRegExp('/:test/', params, { strict: true });
+ var m;
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ m = re.exec('/route');
+
+ assert.ok(!m);
+
+ m = re.exec('/route/');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/route/');
+ assert.equal(m[1], 'route');
+
+ m = re.exec('/route//');
+
+ assert.ok(!m);
+ });
+
+ it('should allow optional express format params', function () {
+ var params = [];
+ var re = pathToRegExp('/:test?', params);
+ var m;
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, true);
+
+ m = re.exec('/route');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/route');
+ assert.equal(m[1], 'route');
+
+ m = re.exec('/');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/');
+ assert.equal(m[1], undefined);
+ });
+
+ it('should allow express format param regexps', function () {
+ var params = [];
+ var m = pathToRegExp('/:page(\\d+)', params).exec('/56');
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'page');
+ assert.equal(params[0].optional, false);
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/56');
+ assert.equal(m[1], '56');
+ });
+
+ it('should match without a prefixed slash', function () {
+ var params = [];
+ var m = pathToRegExp(':test', params).exec('string');
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], 'string');
+ assert.equal(m[1], 'string');
+ });
+
+ it('should not match format parts', function () {
+ var params = [];
+ var m = pathToRegExp('/:test.json', params).exec('/route.json');
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/route.json');
+ assert.equal(m[1], 'route');
+ });
+
+ it('should match format parts', function () {
+ var params = [];
+ var re = pathToRegExp('/:test.:format', params);
+ var m;
+
+ assert.equal(params.length, 2);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+ assert.equal(params[1].name, 'format');
+ assert.equal(params[1].optional, false);
+
+ m = re.exec('/route.json');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/route.json');
+ assert.equal(m[1], 'route');
+ assert.equal(m[2], 'json');
+
+ m = re.exec('/route');
+
+ assert.ok(!m);
+ });
+
+ it('should match route parts with a trailing format', function () {
+ var params = [];
+ var m = pathToRegExp('/:test.json', params).exec('/route.json');
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/route.json');
+ assert.equal(m[1], 'route');
+ });
+
+ it('should match optional trailing routes', function () {
+ var params = [];
+ var m = pathToRegExp('/test*', params).exec('/test/route');
+
+ assert.equal(params.length, 0);
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/test/route');
+ assert.equal(m[1], '/route');
+ });
+
+ it('should match optional trailing routes after a param', function () {
+ var params = [];
+ var re = pathToRegExp('/:test*', params);
+ var m;
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ m = re.exec('/test/route');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/test/route');
+ assert.equal(m[1], 'test');
+ assert.equal(m[2], '/route');
+
+ m = re.exec('/testing');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/testing');
+ assert.equal(m[1], 'testing');
+ assert.equal(m[2], '');
+ });
+
+ it('should match optional trailing routes before a format', function () {
+ var params = [];
+ var re = pathToRegExp('/test*.json', params);
+ var m;
+
+ assert.equal(params.length, 0);
+
+ m = re.exec('/test.json');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/test.json');
+ assert.equal(m[1], '');
+
+ m = re.exec('/testing.json');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/testing.json');
+ assert.equal(m[1], 'ing');
+
+ m = re.exec('/test/route.json');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/test/route.json');
+ assert.equal(m[1], '/route');
+ });
+
+ it('should match optional trailing routes after a param and before a format', function () {
+ var params = [];
+ var re = pathToRegExp('/:test*.json', params);
+ var m;
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ m = re.exec('/testing.json');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/testing.json');
+ assert.equal(m[1], 'testing');
+ assert.equal(m[2], '');
+
+ m = re.exec('/test/route.json');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/test/route.json');
+ assert.equal(m[1], 'test');
+ assert.equal(m[2], '/route');
+
+ m = re.exec('.json');
+
+ assert.ok(!m);
+ });
+
+ it('should match optional trailing routes between a normal param and a format param', function () {
+ var params = [];
+ var re = pathToRegExp('/:test*.:format', params);
+ var m;
+
+ assert.equal(params.length, 2);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+ assert.equal(params[1].name, 'format');
+ assert.equal(params[1].optional, false);
+
+ m = re.exec('/testing.json');
+
+ assert.equal(m.length, 4);
+ assert.equal(m[0], '/testing.json');
+ assert.equal(m[1], 'testing');
+ assert.equal(m[2], '');
+ assert.equal(m[3], 'json');
+
+ m = re.exec('/test/route.json');
+
+ assert.equal(m.length, 4);
+ assert.equal(m[0], '/test/route.json');
+ assert.equal(m[1], 'test');
+ assert.equal(m[2], '/route');
+ assert.equal(m[3], 'json');
+
+ m = re.exec('/test');
+
+ assert.ok(!m);
+
+ m = re.exec('.json');
+
+ assert.ok(!m);
+ });
+
+ it('should match optional trailing routes after a param and before an optional format param', function () {
+ var params = [];
+ var re = pathToRegExp('/:test*.:format?', params);
+ var m;
+
+ assert.equal(params.length, 2);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+ assert.equal(params[1].name, 'format');
+ assert.equal(params[1].optional, true);
+
+ m = re.exec('/testing.json');
+
+ assert.equal(m.length, 4);
+ assert.equal(m[0], '/testing.json');
+ assert.equal(m[1], 'testing');
+ assert.equal(m[2], '');
+ assert.equal(m[3], 'json');
+
+ m = re.exec('/test/route.json');
+
+ assert.equal(m.length, 4);
+ assert.equal(m[0], '/test/route.json');
+ assert.equal(m[1], 'test');
+ assert.equal(m[2], '/route');
+ assert.equal(m[3], 'json');
+
+ m = re.exec('/test');
+
+ assert.equal(m.length, 4);
+ assert.equal(m[0], '/test');
+ assert.equal(m[1], 'test');
+ assert.equal(m[2], '');
+ assert.equal(m[3], undefined);
+
+ m = re.exec('.json');
+
+ assert.ok(!m);
+ });
+
+ it('should match optional trailing routes inside optional express param', function () {
+ var params = [];
+ var re = pathToRegExp('/:test*?', params);
+ var m;
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, true);
+
+ m = re.exec('/test/route');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/test/route');
+ assert.equal(m[1], 'test');
+ assert.equal(m[2], '/route');
+
+ m = re.exec('/test');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/test');
+ assert.equal(m[1], 'test');
+ assert.equal(m[2], '');
+
+ m = re.exec('/');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/');
+ assert.equal(m[1], undefined);
+ assert.equal(m[2], undefined);
+ });
+
+ it('should do case insensitive matches', function () {
+ var m = pathToRegExp('/test').exec('/TEST');
+
+ assert.equal(m[0], '/TEST');
+ });
+
+ it('should do case sensitive matches', function () {
+ var re = pathToRegExp('/test', null, { sensitive: true });
+ var m;
+
+ m = re.exec('/test');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/test');
+
+ m = re.exec('/TEST');
+
+ assert.ok(!m);
+ });
+
+ it('should do non-ending matches', function () {
+ var params = [];
+ var m = pathToRegExp('/:test', params, { end: false }).exec('/test/route');
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/test');
+ assert.equal(m[1], 'test');
+ });
+
+ it('should match trailing slashes in non-ending non-strict mode', function () {
+ var params = [];
+ var re = pathToRegExp('/:test', params, { end: false });
+ var m;
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ m = re.exec('/test/');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/test/');
+ assert.equal(m[1], 'test');
+ });
+
+ it('should match trailing slashes in non-ending non-strict mode', function () {
+ var params = [];
+ var re = pathToRegExp('/route/', params, { end: false });
+ var m;
+
+ assert.equal(params.length, 0);
+
+ m = re.exec('/route/');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/route/');
+
+ m = re.exec('/route/test');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/route');
+
+ m = re.exec('/route');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/route');
+
+ m = re.exec('/route//');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/route/');
+ });
+
+ it('should match trailing slashing in non-ending strict mode', function () {
+ var params = [];
+ var re = pathToRegExp('/route/', params, { end: false, strict: true });
+
+ assert.equal(params.length, 0);
+
+ m = re.exec('/route/');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/route/');
+
+ m = re.exec('/route/test');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/route/');
+
+ m = re.exec('/route');
+
+ assert.ok(!m);
+
+ m = re.exec('/route//');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/route/');
+ });
+
+ it('should not match trailing slashes in non-ending strict mode', function () {
+ var params = [];
+ var re = pathToRegExp('/route', params, { end: false, strict: true });
+
+ assert.equal(params.length, 0);
+
+ m = re.exec('/route');
+
+ assert.equal(m.length, 1);
+ assert.equal(m[0], '/route');
+
+ m = re.exec('/route/');
+
+ assert.ok(m.length, 1);
+ assert.equal(m[0], '/route');
+ });
+
+ it('should match text after an express param', function () {
+ var params = [];
+ var re = pathToRegExp('/(:test)route', params);
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ m = re.exec('/route');
+
+ assert.ok(!m);
+
+ m = re.exec('/testroute');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/testroute');
+ assert.equal(m[1], 'test');
+
+ m = re.exec('testroute');
+
+ assert.ok(!m);
+ });
+
+ it('should match text after an optional express param', function () {
+ var params = [];
+ var re = pathToRegExp('/(:test?)route', params);
+ var m;
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, true);
+
+ m = re.exec('/route');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/route');
+ assert.equal(m[1], undefined);
+
+ m = re.exec('/testroute');
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/testroute');
+ assert.equal(m[1], 'test');
+
+ m = re.exec('route');
+
+ assert.ok(!m);
+ });
+
+ it('should match optional formats', function () {
+ var params = [];
+ var re = pathToRegExp('/:test.:format?', params);
+ var m;
+
+ assert.equal(params.length, 2);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+ assert.equal(params[1].name, 'format');
+ assert.equal(params[1].optional, true);
+
+ m = re.exec('/route');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/route');
+ assert.equal(m[1], 'route');
+ assert.equal(m[2], undefined);
+
+ m = re.exec('/route.json');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/route.json');
+ assert.equal(m[1], 'route');
+ assert.equal(m[2], 'json');
+ });
+
+ it('should match full paths with format by default', function () {
+ var params = [];
+ var m = pathToRegExp('/:test', params).exec('/test.json');
+
+ assert.equal(params.length, 1);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+
+ assert.equal(m.length, 2);
+ assert.equal(m[0], '/test.json');
+ assert.equal(m[1], 'test.json');
+ });
+ });
+
+ describe('regexps', function () {
+ it('should return the regexp', function () {
+ assert.deepEqual(pathToRegExp(/.*/), /.*/);
+ });
+ });
+
+ describe('arrays', function () {
+ it('should join arrays parts', function () {
+ var re = pathToRegExp(['/test', '/route']);
+
+ assert.ok(re.test('/test'));
+ assert.ok(re.test('/route'));
+ assert.ok(!re.test('/else'));
+ });
+
+ it('should match parts properly', function () {
+ var params = [];
+ var re = pathToRegExp(['/:test', '/test/:route'], params);
+ var m;
+
+ assert.equal(params.length, 2);
+ assert.equal(params[0].name, 'test');
+ assert.equal(params[0].optional, false);
+ assert.equal(params[1].name, 'route');
+ assert.equal(params[1].optional, false);
+
+ m = re.exec('/route');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/route');
+ assert.equal(m[1], 'route');
+ assert.equal(m[2], undefined);
+
+ m = re.exec('/test/path');
+
+ assert.equal(m.length, 3);
+ assert.equal(m[0], '/test/path');
+ assert.equal(m[1], undefined);
+ assert.equal(m[2], 'path');
+ });
+ });
+});
diff --git a/server/node_modules/express/node_modules/proxy-addr/HISTORY.md b/server/node_modules/express/node_modules/proxy-addr/HISTORY.md
new file mode 100755
index 00000000..0a695fd0
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/HISTORY.md
@@ -0,0 +1,61 @@
+1.0.7 / 2015-03-16
+==================
+
+ * deps: ipaddr.js@0.1.9
+ - Fix OOM on certain inputs to `isValid`
+
+1.0.6 / 2015-02-01
+==================
+
+ * deps: ipaddr.js@0.1.8
+
+1.0.5 / 2015-01-08
+==================
+
+ * deps: ipaddr.js@0.1.6
+
+1.0.4 / 2014-11-23
+==================
+
+ * deps: ipaddr.js@0.1.5
+ - Fix edge cases with `isValid`
+
+1.0.3 / 2014-09-21
+==================
+
+ * Use `forwarded` npm module
+
+1.0.2 / 2014-09-18
+==================
+
+ * Fix a global leak when multiple subnets are trusted
+ * Support Node.js 0.6
+ * deps: ipaddr.js@0.1.3
+
+1.0.1 / 2014-06-03
+==================
+
+ * Fix links in npm package
+
+1.0.0 / 2014-05-08
+==================
+
+ * Add `trust` argument to determine proxy trust on
+ * Accepts custom function
+ * Accepts IPv4/IPv6 address(es)
+ * Accepts subnets
+ * Accepts pre-defined names
+ * Add optional `trust` argument to `proxyaddr.all` to
+ stop at first untrusted
+ * Add `proxyaddr.compile` to pre-compile `trust` function
+ to make subsequent calls faster
+
+0.0.1 / 2014-05-04
+==================
+
+ * Fix bad npm publish
+
+0.0.0 / 2014-05-04
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/proxy-addr/LICENSE b/server/node_modules/express/node_modules/proxy-addr/LICENSE
new file mode 100755
index 00000000..b7dce6cf
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/proxy-addr/README.md b/server/node_modules/express/node_modules/proxy-addr/README.md
new file mode 100755
index 00000000..57ec4cdb
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/README.md
@@ -0,0 +1,137 @@
+# proxy-addr
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Determine address of proxied request
+
+## Install
+
+```sh
+$ npm install proxy-addr
+```
+
+## API
+
+```js
+var proxyaddr = require('proxy-addr')
+```
+
+### proxyaddr(req, trust)
+
+Return the address of the request, using the given `trust` parameter.
+
+The `trust` argument is a function that returns `true` if you trust
+the address, `false` if you don't. The closest untrusted address is
+returned.
+
+```js
+proxyaddr(req, function(addr){ return addr === '127.0.0.1' })
+proxyaddr(req, function(addr, i){ return i < 1 })
+```
+
+The `trust` arugment may also be a single IP address string or an
+array of trusted addresses, as plain IP addresses, CIDR-formatted
+strings, or IP/netmask strings.
+
+```js
+proxyaddr(req, '127.0.0.1')
+proxyaddr(req, ['127.0.0.0/8', '10.0.0.0/8'])
+proxyaddr(req, ['127.0.0.0/255.0.0.0', '192.168.0.0/255.255.0.0'])
+```
+
+This module also supports IPv6. Your IPv6 addresses will be normalized
+automatically (i.e. `fe80::00ed:1` equals `fe80:0:0:0:0:0:ed:1`).
+
+```js
+proxyaddr(req, '::1')
+proxyaddr(req, ['::1/128', 'fe80::/10'])
+proxyaddr(req, ['fe80::/ffc0::'])
+```
+
+This module will automatically work with IPv4-mapped IPv6 addresses
+as well to support node.js in IPv6-only mode. This means that you do
+not have to specify both `::ffff:a00:1` and `10.0.0.1`.
+
+As a convenience, this module also takes certain pre-defined names
+in addition to IP addresses, which expand into IP addresses:
+
+```js
+proxyaddr(req, 'loopback')
+proxyaddr(req, ['loopback', 'fc00:ac:1ab5:fff::1/64'])
+```
+
+ * `loopback`: IPv4 and IPv6 loopback addresses (like `::1` and
+ `127.0.0.1`).
+ * `linklocal`: IPv4 and IPv6 link-local addresses (like
+ `fe80::1:1:1:1` and `169.254.0.1`).
+ * `uniquelocal`: IPv4 private addresses and IPv6 unique-local
+ addresses (like `fc00:ac:1ab5:fff::1` and `192.168.0.1`).
+
+When `trust` is specified as a function, it will be called for each
+address to determine if it is a trusted address. The function is
+given two arguments: `addr` and `i`, where `addr` is a string of
+the address to check and `i` is a number that represents the distance
+from the socket address.
+
+### proxyaddr.all(req, [trust])
+
+Return all the addresses of the request, optionally stopping at the
+first untrusted. This array is ordered from closest to furthest
+(i.e. `arr[0] === req.connection.remoteAddress`).
+
+```js
+proxyaddr.all(req)
+```
+
+The optional `trust` argument takes the same arguments as `trust`
+does in `proxyaddr(req, trust)`.
+
+```js
+proxyaddr.all(req, 'loopback')
+```
+
+### proxyaddr.compile(val)
+
+Compiles argument `val` into a `trust` function. This function takes
+the same arguments as `trust` does in `proxyaddr(req, trust)` and
+returns a function suitable for `proxyaddr(req, trust)`.
+
+```js
+var trust = proxyaddr.compile('localhost')
+var addr = proxyaddr(req, trust)
+```
+
+This function is meant to be optimized for use against every request.
+It is recommend to compile a trust function up-front for the trusted
+configuration and pass that to `proxyaddr(req, trust)` for each request.
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## Benchmarks
+
+```sh
+$ npm run-script bench
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/proxy-addr.svg?style=flat
+[npm-url]: https://npmjs.org/package/proxy-addr
+[node-version-image]: https://img.shields.io/node/v/proxy-addr.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/proxy-addr.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/proxy-addr
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/proxy-addr.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/proxy-addr?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/proxy-addr.svg?style=flat
+[downloads-url]: https://npmjs.org/package/proxy-addr
diff --git a/server/node_modules/express/node_modules/proxy-addr/index.js b/server/node_modules/express/node_modules/proxy-addr/index.js
new file mode 100755
index 00000000..d7395132
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/index.js
@@ -0,0 +1,345 @@
+/*!
+ * proxy-addr
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = proxyaddr;
+module.exports.all = alladdrs;
+module.exports.compile = compile;
+
+/**
+ * Module dependencies.
+ */
+
+var forwarded = require('forwarded');
+var ipaddr = require('ipaddr.js');
+
+/**
+ * Variables.
+ */
+
+var digitre = /^[0-9]+$/;
+var isip = ipaddr.isValid;
+var parseip = ipaddr.parse;
+
+/**
+ * Pre-defined IP ranges.
+ */
+
+var ipranges = {
+ linklocal: ['169.254.0.0/16', 'fe80::/10'],
+ loopback: ['127.0.0.1/8', '::1/128'],
+ uniquelocal: ['10.0.0.0/8', '172.16.0.0/12', '192.168.0.0/16', 'fc00::/7']
+};
+
+/**
+ * Get all addresses in the request, optionally stopping
+ * at the first untrusted.
+ *
+ * @param {Object} request
+ * @param {Function|Array|String} [trust]
+ * @api public
+ */
+
+function alladdrs(req, trust) {
+ // get addresses
+ var addrs = forwarded(req);
+
+ if (!trust) {
+ // Return all addresses
+ return addrs;
+ }
+
+ if (typeof trust !== 'function') {
+ trust = compile(trust);
+ }
+
+ for (var i = 0; i < addrs.length - 1; i++) {
+ if (trust(addrs[i], i)) continue;
+
+ addrs.length = i + 1;
+ }
+
+ return addrs;
+}
+
+/**
+ * Compile argument into trust function.
+ *
+ * @param {Array|String} val
+ * @api private
+ */
+
+function compile(val) {
+ if (!val) {
+ throw new TypeError('argument is required');
+ }
+
+ var trust = typeof val === 'string'
+ ? [val]
+ : val;
+
+ if (!Array.isArray(trust)) {
+ throw new TypeError('unsupported trust argument');
+ }
+
+ for (var i = 0; i < trust.length; i++) {
+ val = trust[i];
+
+ if (!ipranges.hasOwnProperty(val)) {
+ continue;
+ }
+
+ // Splice in pre-defined range
+ val = ipranges[val];
+ trust.splice.apply(trust, [i, 1].concat(val));
+ i += val.length - 1;
+ }
+
+ return compileTrust(compileRangeSubnets(trust));
+}
+
+/**
+ * Compile `arr` elements into range subnets.
+ *
+ * @param {Array} arr
+ * @api private
+ */
+
+function compileRangeSubnets(arr) {
+ var rangeSubnets = new Array(arr.length);
+
+ for (var i = 0; i < arr.length; i++) {
+ rangeSubnets[i] = parseipNotation(arr[i]);
+ }
+
+ return rangeSubnets;
+}
+
+/**
+ * Compile range subnet array into trust function.
+ *
+ * @param {Array} rangeSubnets
+ * @api private
+ */
+
+function compileTrust(rangeSubnets) {
+ // Return optimized function based on length
+ var len = rangeSubnets.length;
+ return len === 0
+ ? trustNone
+ : len === 1
+ ? trustSingle(rangeSubnets[0])
+ : trustMulti(rangeSubnets);
+}
+
+/**
+ * Parse IP notation string into range subnet.
+ *
+ * @param {String} note
+ * @api private
+ */
+
+function parseipNotation(note) {
+ var ip;
+ var kind;
+ var max;
+ var pos = note.lastIndexOf('/');
+ var range;
+
+ ip = pos !== -1
+ ? note.substring(0, pos)
+ : note;
+
+ if (!isip(ip)) {
+ throw new TypeError('invalid IP address: ' + ip);
+ }
+
+ ip = parseip(ip);
+
+ kind = ip.kind();
+ max = kind === 'ipv6'
+ ? 128
+ : 32;
+
+ range = pos !== -1
+ ? note.substring(pos + 1, note.length)
+ : max;
+
+ if (typeof range !== 'number') {
+ range = digitre.test(range)
+ ? parseInt(range, 10)
+ : isip(range)
+ ? parseNetmask(range)
+ : 0;
+ }
+
+ if (ip.kind() === 'ipv6' && ip.isIPv4MappedAddress()) {
+ // Store as IPv4
+ ip = ip.toIPv4Address();
+ range = range <= max
+ ? range - 96
+ : range;
+ }
+
+ if (range <= 0 || range > max) {
+ throw new TypeError('invalid range on address: ' + note);
+ }
+
+ return [ip, range];
+}
+
+/**
+ * Parse netmask string into CIDR range.
+ *
+ * @param {String} note
+ * @api private
+ */
+
+function parseNetmask(netmask) {
+ var ip = parseip(netmask);
+ var parts;
+ var size;
+
+ switch (ip.kind()) {
+ case 'ipv4':
+ parts = ip.octets;
+ size = 8;
+ break;
+ case 'ipv6':
+ parts = ip.parts;
+ size = 16;
+ break;
+ }
+
+ var max = Math.pow(2, size) - 1;
+ var part;
+ var range = 0;
+
+ for (var i = 0; i < parts.length; i++) {
+ part = parts[i] & max;
+
+ if (part === max) {
+ range += size;
+ continue;
+ }
+
+ while (part) {
+ part = (part << 1) & max;
+ range += 1;
+ }
+
+ break;
+ }
+
+ return range;
+}
+
+/**
+ * Determine address of proxied request.
+ *
+ * @param {Object} request
+ * @param {Function|Array|String} trust
+ * @api public
+ */
+
+function proxyaddr(req, trust) {
+ if (!req) {
+ throw new TypeError('req argument is required');
+ }
+
+ if (!trust) {
+ throw new TypeError('trust argument is required');
+ }
+
+ var addrs = alladdrs(req, trust);
+ var addr = addrs[addrs.length - 1];
+
+ return addr;
+}
+
+/**
+ * Static trust function to trust nothing.
+ *
+ * @api private
+ */
+
+function trustNone() {
+ return false;
+}
+
+/**
+ * Compile trust function for multiple subnets.
+ *
+ * @param {Array} subnets
+ * @api private
+ */
+
+function trustMulti(subnets) {
+ return function trust(addr) {
+ if (!isip(addr)) return false;
+
+ var ip = parseip(addr);
+ var ipv4;
+ var kind = ip.kind();
+ var subnet;
+ var subnetip;
+ var subnetkind;
+ var subnetrange;
+ var trusted;
+
+ for (var i = 0; i < subnets.length; i++) {
+ subnet = subnets[i];
+ subnetip = subnet[0];
+ subnetkind = subnetip.kind();
+ subnetrange = subnet[1];
+ trusted = ip;
+
+ if (kind !== subnetkind) {
+ if (kind !== 'ipv6' || subnetkind !== 'ipv4' || !ip.isIPv4MappedAddress()) {
+ continue;
+ }
+
+ // Store addr as IPv4
+ ipv4 = ipv4 || ip.toIPv4Address();
+ trusted = ipv4;
+ }
+
+ if (trusted.match(subnetip, subnetrange)) return true;
+ }
+
+ return false;
+ };
+}
+
+/**
+ * Compile trust function for single subnet.
+ *
+ * @param {Object} subnet
+ * @api private
+ */
+
+function trustSingle(subnet) {
+ var subnetip = subnet[0];
+ var subnetkind = subnetip.kind();
+ var subnetisipv4 = subnetkind === 'ipv4';
+ var subnetrange = subnet[1];
+
+ return function trust(addr) {
+ if (!isip(addr)) return false;
+
+ var ip = parseip(addr);
+ var kind = ip.kind();
+
+ return kind === subnetkind
+ ? ip.match(subnetip, subnetrange)
+ : subnetisipv4 && kind === 'ipv6' && ip.isIPv4MappedAddress()
+ ? ip.toIPv4Address().match(subnetip, subnetrange)
+ : false;
+ };
+}
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/HISTORY.md b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/HISTORY.md
new file mode 100755
index 00000000..97fa1d10
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/HISTORY.md
@@ -0,0 +1,4 @@
+0.1.0 / 2014-09-21
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/LICENSE b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/LICENSE
new file mode 100755
index 00000000..b7dce6cf
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/README.md b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/README.md
new file mode 100755
index 00000000..2b4988fa
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/README.md
@@ -0,0 +1,53 @@
+# forwarded
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Parse HTTP X-Forwarded-For header
+
+## Installation
+
+```sh
+$ npm install forwarded
+```
+
+## API
+
+```js
+var forwarded = require('forwarded')
+```
+
+### forwarded(req)
+
+```js
+var addresses = forwarded(req)
+```
+
+Parse the `X-Forwarded-For` header from the request. Returns an array
+of the addresses, including the socket address for the `req`. In reverse
+order (i.e. index `0` is the socket address and the last index is the
+furthest address, typically the end-user).
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/forwarded.svg?style=flat
+[npm-url]: https://npmjs.org/package/forwarded
+[node-version-image]: https://img.shields.io/node/v/forwarded.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/forwarded.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/forwarded
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/forwarded.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/forwarded?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/forwarded.svg?style=flat
+[downloads-url]: https://npmjs.org/package/forwarded
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/index.js b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/index.js
new file mode 100755
index 00000000..2f5c3408
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/index.js
@@ -0,0 +1,35 @@
+/*!
+ * forwarded
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = forwarded
+
+/**
+ * Get all addresses in the request, using the `X-Forwarded-For` header.
+ *
+ * @param {Object} req
+ * @api public
+ */
+
+function forwarded(req) {
+ if (!req) {
+ throw new TypeError('argument req is required')
+ }
+
+ // simple header parsing
+ var proxyAddrs = (req.headers['x-forwarded-for'] || '')
+ .split(/ *, */)
+ .filter(Boolean)
+ .reverse()
+ var socketAddr = req.connection.remoteAddress
+ var addrs = [socketAddr].concat(proxyAddrs)
+
+ // return all addresses
+ return addrs
+}
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/package.json b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/package.json
new file mode 100755
index 00000000..7cc4ed6b
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/forwarded/package.json
@@ -0,0 +1,64 @@
+{
+ "name": "forwarded",
+ "description": "Parse HTTP X-Forwarded-For header",
+ "version": "0.1.0",
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "license": "MIT",
+ "keywords": [
+ "x-forwarded-for",
+ "http",
+ "req"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/forwarded"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.2",
+ "mocha": "~1.21.4"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "e9a9faeb3cfaadf40eb57d144fff26bca9b818e8",
+ "bugs": {
+ "url": "https://github.com/jshttp/forwarded/issues"
+ },
+ "homepage": "https://github.com/jshttp/forwarded",
+ "_id": "forwarded@0.1.0",
+ "_shasum": "19ef9874c4ae1c297bcf078fde63a09b66a84363",
+ "_from": "forwarded@~0.1.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "19ef9874c4ae1c297bcf078fde63a09b66a84363",
+ "tarball": "http://registry.npmjs.org/forwarded/-/forwarded-0.1.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/forwarded/-/forwarded-0.1.0.tgz"
+}
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/.npmignore b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/.npmignore
new file mode 100755
index 00000000..7a1537ba
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/.npmignore
@@ -0,0 +1,2 @@
+.idea
+node_modules
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/Cakefile b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/Cakefile
new file mode 100755
index 00000000..7fd355a7
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/Cakefile
@@ -0,0 +1,18 @@
+fs = require 'fs'
+CoffeeScript = require 'coffee-script'
+nodeunit = require 'nodeunit'
+UglifyJS = require 'uglify-js'
+
+task 'build', 'build the JavaScript files from CoffeeScript source', build = (cb) ->
+ source = fs.readFileSync 'src/ipaddr.coffee'
+ fs.writeFileSync 'lib/ipaddr.js', CoffeeScript.compile source.toString()
+
+ invoke 'test'
+ invoke 'compress'
+
+task 'test', 'run the bundled tests', (cb) ->
+ nodeunit.reporters.default.run ['test']
+
+task 'compress', 'uglify the resulting javascript', (cb) ->
+ result = UglifyJS.minify('lib/ipaddr.js')
+ fs.writeFileSync('ipaddr.min.js', result.code)
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/LICENSE b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/LICENSE
new file mode 100755
index 00000000..3493f0df
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/LICENSE
@@ -0,0 +1,19 @@
+Copyright (C) 2011 Peter Zotov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/README.md b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/README.md
new file mode 100755
index 00000000..a8166729
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/README.md
@@ -0,0 +1,149 @@
+# ipaddr.js — an IPv6 and IPv4 address manipulation library
+
+ipaddr.js is a small (1.9K minified and gzipped) library for manipulating
+IP addresses in JavaScript environments. It runs on both CommonJS runtimes
+(e.g. [nodejs]) and in a web browser.
+
+ipaddr.js allows you to verify and parse string representation of an IP
+address, match it against a CIDR range or range list, determine if it falls
+into some reserved ranges (examples include loopback and private ranges),
+and convert between IPv4 and IPv4-mapped IPv6 addresses.
+
+[nodejs]: http://nodejs.org
+
+## Installation
+
+`npm install ipaddr.js`
+
+## API
+
+ipaddr.js defines one object in the global scope: `ipaddr`. In CommonJS,
+it is exported from the module:
+
+```js
+var ipaddr = require('ipaddr.js');
+```
+
+The API consists of several global methods and two classes: ipaddr.IPv6 and ipaddr.IPv4.
+
+### Global methods
+
+There are three global methods defined: `ipaddr.isValid`, `ipaddr.parse` and
+`ipaddr.process`. All of them receive a string as a single parameter.
+
+The `ipaddr.isValid` method returns `true` if the address is a valid IPv4 or
+IPv6 address, and `false` otherwise. It does not throw any exceptions.
+
+The `ipaddr.parse` method returns an object representing the IP address,
+or throws an `Error` if the passed string is not a valid representation of an
+IP address.
+
+The `ipaddr.process` method works just like the `ipaddr.parse` one, but it
+automatically converts IPv4-mapped IPv6 addresses to their IPv4 couterparts
+before returning. It is useful when you have a Node.js instance listening
+on an IPv6 socket, and the `net.ivp6.bindv6only` sysctl parameter (or its
+equivalent on non-Linux OS) is set to 0. In this case, you can accept IPv4
+connections on your IPv6-only socket, but the remote address will be mangled.
+Use `ipaddr.process` method to automatically demangle it.
+
+### Object representation
+
+Parsing methods return an object which descends from `ipaddr.IPv6` or
+`ipaddr.IPv4`. These objects share some properties, but most of them differ.
+
+#### Shared properties
+
+One can determine the type of address by calling `addr.kind()`. It will return
+either `"ipv6"` or `"ipv4"`.
+
+An address can be converted back to its string representation with `addr.toString()`.
+Note that this method:
+ * does not return the original string used to create the object (in fact, there is
+ no way of getting that string)
+ * returns a compact representation (when it is applicable)
+
+A `match(range, bits)` method can be used to check if the address falls into a
+certain CIDR range.
+Note that an address can be (obviously) matched only against an address of the same type.
+
+For example:
+
+```js
+var addr = ipaddr.parse("2001:db8:1234::1");
+var range = ipaddr.parse("2001:db8::");
+
+addr.match(range, 32); // => true
+```
+
+A `range()` method returns one of predefined names for several special ranges defined
+by IP protocols. The exact names (and their respective CIDR ranges) can be looked up
+in the source: [IPv6 ranges] and [IPv4 ranges]. Some common ones include `"unicast"`
+(the default one) and `"reserved"`.
+
+You can match against your own range list by using
+`ipaddr.subnetMatch(address, rangeList, defaultName)` method. It can work with both
+IPv6 and IPv4 addresses, and accepts a name-to-subnet map as the range list. For example:
+
+```js
+var rangeList = {
+ documentationOnly: [ ipaddr.parse('2001:db8::'), 32 ],
+ tunnelProviders: [
+ [ ipaddr.parse('2001:470::'), 32 ], // he.net
+ [ ipaddr.parse('2001:5c0::'), 32 ] // freenet6
+ ]
+};
+ipaddr.subnetMatch(ipaddr.parse('2001:470:8:66::1'), rangeList, 'unknown'); // => "he.net"
+```
+
+The addresses can be converted to their byte representation with `toByteArray()`.
+(Actually, JavaScript mostly does not know about byte buffers. They are emulated with
+arrays of numbers, each in range of 0..255.)
+
+```js
+var bytes = ipaddr.parse('2a00:1450:8007::68').toByteArray(); // ipv6.google.com
+bytes // => [42, 0x00, 0x14, 0x50, 0x80, 0x07, 0x00, , 0x00, 0x68 ]
+```
+
+The `ipaddr.IPv4` and `ipaddr.IPv6` objects have some methods defined, too. All of them
+have the same interface for both protocols, and are similar to global methods.
+
+`ipaddr.IPvX.isValid(string)` can be used to check if the string is a valid address
+for particular protocol, and `ipaddr.IPvX.parse(string)` is the error-throwing parser.
+
+[IPv6 ranges]: https://github.com/whitequark/ipaddr.js/blob/master/src/ipaddr.coffee#L186
+[IPv4 ranges]: https://github.com/whitequark/ipaddr.js/blob/master/src/ipaddr.coffee#L71
+
+#### IPv6 properties
+
+Sometimes you will want to convert IPv6 not to a compact string representation (with
+the `::` substitution); the `toNormalizedString()` method will return an address where
+all zeroes are explicit.
+
+For example:
+
+```js
+var addr = ipaddr.parse("2001:0db8::0001");
+addr.toString(); // => "2001:db8::1"
+addr.toNormalizedString(); // => "2001:db8:0:0:0:0:0:1"
+```
+
+The `isIPv4MappedAddress()` method will return `true` if this address is an IPv4-mapped
+one, and `toIPv4Address()` will return an IPv4 object address.
+
+To access the underlying binary representation of the address, use `addr.parts`.
+
+```js
+var addr = ipaddr.parse("2001:db8:10::1234:DEAD");
+addr.parts // => [0x2001, 0xdb8, 0x10, 0, 0, 0, 0x1234, 0xdead]
+```
+
+#### IPv4 properties
+
+`toIPv4MappedAddress()` will return a corresponding IPv4-mapped IPv6 address.
+
+To access the underlying representation of the address, use `addr.octets`.
+
+```js
+var addr = ipaddr.parse("192.168.1.1");
+addr.octets // => [192, 168, 1, 1]
+```
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/ipaddr.min.js b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/ipaddr.min.js
new file mode 100755
index 00000000..59634ff7
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/ipaddr.min.js
@@ -0,0 +1 @@
+(function(){var t,r,n,e,i,o,a,s;r={},s=this,"undefined"!=typeof module&&null!==module&&module.exports?module.exports=r:s.ipaddr=r,a=function(t,r,n,e){var i,o;if(t.length!==r.length)throw new Error("ipaddr: cannot match CIDR for objects with different lengths");for(i=0;e>0;){if(o=n-e,0>o&&(o=0),t[i]>>o!==r[i]>>o)return!1;e-=n,i+=1}return!0},r.subnetMatch=function(t,r,n){var e,i,o,a,s;null==n&&(n="unicast");for(e in r)for(i=r[e],"[object Array]"!==toString.call(i[0])&&(i=[i]),a=0,s=i.length;s>a;a++)if(o=i[a],t.match.apply(t,o))return e;return n},r.IPv4=function(){function t(t){var r,n,e;if(4!==t.length)throw new Error("ipaddr: ipv4 octet count should be 4");for(n=0,e=t.length;e>n;n++)if(r=t[n],!(r>=0&&255>=r))throw new Error("ipaddr: ipv4 octet is a byte");this.octets=t}return t.prototype.kind=function(){return"ipv4"},t.prototype.toString=function(){return this.octets.join(".")},t.prototype.toByteArray=function(){return this.octets.slice(0)},t.prototype.match=function(t,r){if("ipv4"!==t.kind())throw new Error("ipaddr: cannot match ipv4 address with non-ipv4 one");return a(this.octets,t.octets,8,r)},t.prototype.SpecialRanges={unspecified:[[new t([0,0,0,0]),8]],broadcast:[[new t([255,255,255,255]),32]],multicast:[[new t([224,0,0,0]),4]],linkLocal:[[new t([169,254,0,0]),16]],loopback:[[new t([127,0,0,0]),8]],"private":[[new t([10,0,0,0]),8],[new t([172,16,0,0]),12],[new t([192,168,0,0]),16]],reserved:[[new t([192,0,0,0]),24],[new t([192,0,2,0]),24],[new t([192,88,99,0]),24],[new t([198,51,100,0]),24],[new t([203,0,113,0]),24],[new t([240,0,0,0]),4]]},t.prototype.range=function(){return r.subnetMatch(this,this.SpecialRanges)},t.prototype.toIPv4MappedAddress=function(){return r.IPv6.parse("::ffff:"+this.toString())},t}(),n="(0?\\d+|0x[a-f0-9]+)",e={fourOctet:new RegExp("^"+n+"\\."+n+"\\."+n+"\\."+n+"$","i"),longValue:new RegExp("^"+n+"$","i")},r.IPv4.parser=function(t){var r,n,i,o,a;if(n=function(t){return"0"===t[0]&&"x"!==t[1]?parseInt(t,8):parseInt(t)},r=t.match(e.fourOctet))return function(){var t,e,o,a;for(o=r.slice(1,6),a=[],t=0,e=o.length;e>t;t++)i=o[t],a.push(n(i));return a}();if(r=t.match(e.longValue)){if(a=n(r[1]),a>4294967295||0>a)throw new Error("ipaddr: address outside defined range");return function(){var t,r;for(r=[],o=t=0;24>=t;o=t+=8)r.push(a>>o&255);return r}().reverse()}return null},r.IPv6=function(){function t(t){var r,n,e;if(8!==t.length)throw new Error("ipaddr: ipv6 part count should be 8");for(n=0,e=t.length;e>n;n++)if(r=t[n],!(r>=0&&65535>=r))throw new Error("ipaddr: ipv6 part should fit to two octets");this.parts=t}return t.prototype.kind=function(){return"ipv6"},t.prototype.toString=function(){var t,r,n,e,i,o,a;for(i=function(){var t,n,e,i;for(e=this.parts,i=[],t=0,n=e.length;n>t;t++)r=e[t],i.push(r.toString(16));return i}.call(this),t=[],n=function(r){return t.push(r)},e=0,o=0,a=i.length;a>o;o++)switch(r=i[o],e){case 0:n("0"===r?"":r),e=1;break;case 1:"0"===r?e=2:n(r);break;case 2:"0"!==r&&(n(""),n(r),e=3);break;case 3:n(r)}return 2===e&&(n(""),n("")),t.join(":")},t.prototype.toByteArray=function(){var t,r,n,e,i;for(t=[],i=this.parts,n=0,e=i.length;e>n;n++)r=i[n],t.push(r>>8),t.push(255&r);return t},t.prototype.toNormalizedString=function(){var t;return function(){var r,n,e,i;for(e=this.parts,i=[],r=0,n=e.length;n>r;r++)t=e[r],i.push(t.toString(16));return i}.call(this).join(":")},t.prototype.match=function(t,r){if("ipv6"!==t.kind())throw new Error("ipaddr: cannot match ipv6 address with non-ipv6 one");return a(this.parts,t.parts,16,r)},t.prototype.SpecialRanges={unspecified:[new t([0,0,0,0,0,0,0,0]),128],linkLocal:[new t([65152,0,0,0,0,0,0,0]),10],multicast:[new t([65280,0,0,0,0,0,0,0]),8],loopback:[new t([0,0,0,0,0,0,0,1]),128],uniqueLocal:[new t([64512,0,0,0,0,0,0,0]),7],ipv4Mapped:[new t([0,0,0,0,0,65535,0,0]),96],rfc6145:[new t([0,0,0,0,65535,0,0,0]),96],rfc6052:[new t([100,65435,0,0,0,0,0,0]),96],"6to4":[new t([8194,0,0,0,0,0,0,0]),16],teredo:[new t([8193,0,0,0,0,0,0,0]),32],reserved:[[new t([8193,3512,0,0,0,0,0,0]),32]]},t.prototype.range=function(){return r.subnetMatch(this,this.SpecialRanges)},t.prototype.isIPv4MappedAddress=function(){return"ipv4Mapped"===this.range()},t.prototype.toIPv4Address=function(){var t,n,e;if(!this.isIPv4MappedAddress())throw new Error("ipaddr: trying to convert a generic ipv6 address to ipv4");return e=this.parts.slice(-2),t=e[0],n=e[1],new r.IPv4([t>>8,255&t,n>>8,255&n])},t}(),i="(?:[0-9a-f]+::?)+",o={"native":new RegExp("^(::)?("+i+")?([0-9a-f]+)?(::)?$","i"),transitional:new RegExp("^((?:"+i+")|(?:::)(?:"+i+")?)"+(""+n+"\\."+n+"\\."+n+"\\."+n+"$"),"i")},t=function(t,r){var n,e,i,o,a;if(t.indexOf("::")!==t.lastIndexOf("::"))return null;for(n=0,e=-1;(e=t.indexOf(":",e+1))>=0;)n++;if(":"===t[0]&&n--,":"===t[t.length-1]&&n--,n>r)return null;for(a=r-n,o=":";a--;)o+="0:";return t=t.replace("::",o),":"===t[0]&&(t=t.slice(1)),":"===t[t.length-1]&&(t=t.slice(0,-1)),function(){var r,n,e,o;for(e=t.split(":"),o=[],r=0,n=e.length;n>r;r++)i=e[r],o.push(parseInt(i,16));return o}()},r.IPv6.parser=function(r){var n,e;return r.match(o["native"])?t(r,8):(n=r.match(o.transitional))&&(e=t(n[1].slice(0,-1),6))?(e.push(parseInt(n[2])<<8|parseInt(n[3])),e.push(parseInt(n[4])<<8|parseInt(n[5])),e):null},r.IPv4.isIPv4=r.IPv6.isIPv6=function(t){return null!==this.parser(t)},r.IPv4.isValid=r.IPv6.isValid=function(t){var r;try{return new this(this.parser(t)),!0}catch(n){return r=n,!1}},r.IPv4.parse=r.IPv6.parse=function(t){var r;if(r=this.parser(t),null===r)throw new Error("ipaddr: string is not formatted like ip address");return new this(r)},r.isValid=function(t){return r.IPv6.isValid(t)||r.IPv4.isValid(t)},r.parse=function(t){if(r.IPv6.isValid(t))return r.IPv6.parse(t);if(r.IPv4.isValid(t))return r.IPv4.parse(t);throw new Error("ipaddr: the address has neither IPv6 nor IPv4 format")},r.process=function(t){var r;return r=this.parse(t),"ipv6"===r.kind()&&r.isIPv4MappedAddress()?r.toIPv4Address():r}}).call(this);
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/lib/ipaddr.js b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/lib/ipaddr.js
new file mode 100755
index 00000000..00620a8e
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/lib/ipaddr.js
@@ -0,0 +1,408 @@
+(function() {
+ var expandIPv6, ipaddr, ipv4Part, ipv4Regexes, ipv6Part, ipv6Regexes, matchCIDR, root;
+
+ ipaddr = {};
+
+ root = this;
+
+ if ((typeof module !== "undefined" && module !== null) && module.exports) {
+ module.exports = ipaddr;
+ } else {
+ root['ipaddr'] = ipaddr;
+ }
+
+ matchCIDR = function(first, second, partSize, cidrBits) {
+ var part, shift;
+ if (first.length !== second.length) {
+ throw new Error("ipaddr: cannot match CIDR for objects with different lengths");
+ }
+ part = 0;
+ while (cidrBits > 0) {
+ shift = partSize - cidrBits;
+ if (shift < 0) {
+ shift = 0;
+ }
+ if (first[part] >> shift !== second[part] >> shift) {
+ return false;
+ }
+ cidrBits -= partSize;
+ part += 1;
+ }
+ return true;
+ };
+
+ ipaddr.subnetMatch = function(address, rangeList, defaultName) {
+ var rangeName, rangeSubnets, subnet, _i, _len;
+ if (defaultName == null) {
+ defaultName = 'unicast';
+ }
+ for (rangeName in rangeList) {
+ rangeSubnets = rangeList[rangeName];
+ if (toString.call(rangeSubnets[0]) !== '[object Array]') {
+ rangeSubnets = [rangeSubnets];
+ }
+ for (_i = 0, _len = rangeSubnets.length; _i < _len; _i++) {
+ subnet = rangeSubnets[_i];
+ if (address.match.apply(address, subnet)) {
+ return rangeName;
+ }
+ }
+ }
+ return defaultName;
+ };
+
+ ipaddr.IPv4 = (function() {
+ function IPv4(octets) {
+ var octet, _i, _len;
+ if (octets.length !== 4) {
+ throw new Error("ipaddr: ipv4 octet count should be 4");
+ }
+ for (_i = 0, _len = octets.length; _i < _len; _i++) {
+ octet = octets[_i];
+ if (!((0 <= octet && octet <= 255))) {
+ throw new Error("ipaddr: ipv4 octet is a byte");
+ }
+ }
+ this.octets = octets;
+ }
+
+ IPv4.prototype.kind = function() {
+ return 'ipv4';
+ };
+
+ IPv4.prototype.toString = function() {
+ return this.octets.join(".");
+ };
+
+ IPv4.prototype.toByteArray = function() {
+ return this.octets.slice(0);
+ };
+
+ IPv4.prototype.match = function(other, cidrRange) {
+ if (other.kind() !== 'ipv4') {
+ throw new Error("ipaddr: cannot match ipv4 address with non-ipv4 one");
+ }
+ return matchCIDR(this.octets, other.octets, 8, cidrRange);
+ };
+
+ IPv4.prototype.SpecialRanges = {
+ unspecified: [[new IPv4([0, 0, 0, 0]), 8]],
+ broadcast: [[new IPv4([255, 255, 255, 255]), 32]],
+ multicast: [[new IPv4([224, 0, 0, 0]), 4]],
+ linkLocal: [[new IPv4([169, 254, 0, 0]), 16]],
+ loopback: [[new IPv4([127, 0, 0, 0]), 8]],
+ "private": [[new IPv4([10, 0, 0, 0]), 8], [new IPv4([172, 16, 0, 0]), 12], [new IPv4([192, 168, 0, 0]), 16]],
+ reserved: [[new IPv4([192, 0, 0, 0]), 24], [new IPv4([192, 0, 2, 0]), 24], [new IPv4([192, 88, 99, 0]), 24], [new IPv4([198, 51, 100, 0]), 24], [new IPv4([203, 0, 113, 0]), 24], [new IPv4([240, 0, 0, 0]), 4]]
+ };
+
+ IPv4.prototype.range = function() {
+ return ipaddr.subnetMatch(this, this.SpecialRanges);
+ };
+
+ IPv4.prototype.toIPv4MappedAddress = function() {
+ return ipaddr.IPv6.parse("::ffff:" + (this.toString()));
+ };
+
+ return IPv4;
+
+ })();
+
+ ipv4Part = "(0?\\d+|0x[a-f0-9]+)";
+
+ ipv4Regexes = {
+ fourOctet: new RegExp("^" + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "$", 'i'),
+ longValue: new RegExp("^" + ipv4Part + "$", 'i')
+ };
+
+ ipaddr.IPv4.parser = function(string) {
+ var match, parseIntAuto, part, shift, value;
+ parseIntAuto = function(string) {
+ if (string[0] === "0" && string[1] !== "x") {
+ return parseInt(string, 8);
+ } else {
+ return parseInt(string);
+ }
+ };
+ if (match = string.match(ipv4Regexes.fourOctet)) {
+ return (function() {
+ var _i, _len, _ref, _results;
+ _ref = match.slice(1, 6);
+ _results = [];
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ part = _ref[_i];
+ _results.push(parseIntAuto(part));
+ }
+ return _results;
+ })();
+ } else if (match = string.match(ipv4Regexes.longValue)) {
+ value = parseIntAuto(match[1]);
+ if (value > 0xffffffff || value < 0) {
+ throw new Error("ipaddr: address outside defined range");
+ }
+ return ((function() {
+ var _i, _results;
+ _results = [];
+ for (shift = _i = 0; _i <= 24; shift = _i += 8) {
+ _results.push((value >> shift) & 0xff);
+ }
+ return _results;
+ })()).reverse();
+ } else {
+ return null;
+ }
+ };
+
+ ipaddr.IPv6 = (function() {
+ function IPv6(parts) {
+ var part, _i, _len;
+ if (parts.length !== 8) {
+ throw new Error("ipaddr: ipv6 part count should be 8");
+ }
+ for (_i = 0, _len = parts.length; _i < _len; _i++) {
+ part = parts[_i];
+ if (!((0 <= part && part <= 0xffff))) {
+ throw new Error("ipaddr: ipv6 part should fit to two octets");
+ }
+ }
+ this.parts = parts;
+ }
+
+ IPv6.prototype.kind = function() {
+ return 'ipv6';
+ };
+
+ IPv6.prototype.toString = function() {
+ var compactStringParts, part, pushPart, state, stringParts, _i, _len;
+ stringParts = (function() {
+ var _i, _len, _ref, _results;
+ _ref = this.parts;
+ _results = [];
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ part = _ref[_i];
+ _results.push(part.toString(16));
+ }
+ return _results;
+ }).call(this);
+ compactStringParts = [];
+ pushPart = function(part) {
+ return compactStringParts.push(part);
+ };
+ state = 0;
+ for (_i = 0, _len = stringParts.length; _i < _len; _i++) {
+ part = stringParts[_i];
+ switch (state) {
+ case 0:
+ if (part === '0') {
+ pushPart('');
+ } else {
+ pushPart(part);
+ }
+ state = 1;
+ break;
+ case 1:
+ if (part === '0') {
+ state = 2;
+ } else {
+ pushPart(part);
+ }
+ break;
+ case 2:
+ if (part !== '0') {
+ pushPart('');
+ pushPart(part);
+ state = 3;
+ }
+ break;
+ case 3:
+ pushPart(part);
+ }
+ }
+ if (state === 2) {
+ pushPart('');
+ pushPart('');
+ }
+ return compactStringParts.join(":");
+ };
+
+ IPv6.prototype.toByteArray = function() {
+ var bytes, part, _i, _len, _ref;
+ bytes = [];
+ _ref = this.parts;
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ part = _ref[_i];
+ bytes.push(part >> 8);
+ bytes.push(part & 0xff);
+ }
+ return bytes;
+ };
+
+ IPv6.prototype.toNormalizedString = function() {
+ var part;
+ return ((function() {
+ var _i, _len, _ref, _results;
+ _ref = this.parts;
+ _results = [];
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ part = _ref[_i];
+ _results.push(part.toString(16));
+ }
+ return _results;
+ }).call(this)).join(":");
+ };
+
+ IPv6.prototype.match = function(other, cidrRange) {
+ if (other.kind() !== 'ipv6') {
+ throw new Error("ipaddr: cannot match ipv6 address with non-ipv6 one");
+ }
+ return matchCIDR(this.parts, other.parts, 16, cidrRange);
+ };
+
+ IPv6.prototype.SpecialRanges = {
+ unspecified: [new IPv6([0, 0, 0, 0, 0, 0, 0, 0]), 128],
+ linkLocal: [new IPv6([0xfe80, 0, 0, 0, 0, 0, 0, 0]), 10],
+ multicast: [new IPv6([0xff00, 0, 0, 0, 0, 0, 0, 0]), 8],
+ loopback: [new IPv6([0, 0, 0, 0, 0, 0, 0, 1]), 128],
+ uniqueLocal: [new IPv6([0xfc00, 0, 0, 0, 0, 0, 0, 0]), 7],
+ ipv4Mapped: [new IPv6([0, 0, 0, 0, 0, 0xffff, 0, 0]), 96],
+ rfc6145: [new IPv6([0, 0, 0, 0, 0xffff, 0, 0, 0]), 96],
+ rfc6052: [new IPv6([0x64, 0xff9b, 0, 0, 0, 0, 0, 0]), 96],
+ '6to4': [new IPv6([0x2002, 0, 0, 0, 0, 0, 0, 0]), 16],
+ teredo: [new IPv6([0x2001, 0, 0, 0, 0, 0, 0, 0]), 32],
+ reserved: [[new IPv6([0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]), 32]]
+ };
+
+ IPv6.prototype.range = function() {
+ return ipaddr.subnetMatch(this, this.SpecialRanges);
+ };
+
+ IPv6.prototype.isIPv4MappedAddress = function() {
+ return this.range() === 'ipv4Mapped';
+ };
+
+ IPv6.prototype.toIPv4Address = function() {
+ var high, low, _ref;
+ if (!this.isIPv4MappedAddress()) {
+ throw new Error("ipaddr: trying to convert a generic ipv6 address to ipv4");
+ }
+ _ref = this.parts.slice(-2), high = _ref[0], low = _ref[1];
+ return new ipaddr.IPv4([high >> 8, high & 0xff, low >> 8, low & 0xff]);
+ };
+
+ return IPv6;
+
+ })();
+
+ ipv6Part = "(?:[0-9a-f]+::?)+";
+
+ ipv6Regexes = {
+ "native": new RegExp("^(::)?(" + ipv6Part + ")?([0-9a-f]+)?(::)?$", 'i'),
+ transitional: new RegExp(("^((?:" + ipv6Part + ")|(?:::)(?:" + ipv6Part + ")?)") + ("" + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "\\." + ipv4Part + "$"), 'i')
+ };
+
+ expandIPv6 = function(string, parts) {
+ var colonCount, lastColon, part, replacement, replacementCount;
+ if (string.indexOf('::') !== string.lastIndexOf('::')) {
+ return null;
+ }
+ colonCount = 0;
+ lastColon = -1;
+ while ((lastColon = string.indexOf(':', lastColon + 1)) >= 0) {
+ colonCount++;
+ }
+ if (string[0] === ':') {
+ colonCount--;
+ }
+ if (string[string.length - 1] === ':') {
+ colonCount--;
+ }
+ if (colonCount > parts) {
+ return null;
+ }
+ replacementCount = parts - colonCount;
+ replacement = ':';
+ while (replacementCount--) {
+ replacement += '0:';
+ }
+ string = string.replace('::', replacement);
+ if (string[0] === ':') {
+ string = string.slice(1);
+ }
+ if (string[string.length - 1] === ':') {
+ string = string.slice(0, -1);
+ }
+ return (function() {
+ var _i, _len, _ref, _results;
+ _ref = string.split(":");
+ _results = [];
+ for (_i = 0, _len = _ref.length; _i < _len; _i++) {
+ part = _ref[_i];
+ _results.push(parseInt(part, 16));
+ }
+ return _results;
+ })();
+ };
+
+ ipaddr.IPv6.parser = function(string) {
+ var match, parts;
+ if (string.match(ipv6Regexes['native'])) {
+ return expandIPv6(string, 8);
+ } else if (match = string.match(ipv6Regexes['transitional'])) {
+ parts = expandIPv6(match[1].slice(0, -1), 6);
+ if (parts) {
+ parts.push(parseInt(match[2]) << 8 | parseInt(match[3]));
+ parts.push(parseInt(match[4]) << 8 | parseInt(match[5]));
+ return parts;
+ }
+ }
+ return null;
+ };
+
+ ipaddr.IPv4.isIPv4 = ipaddr.IPv6.isIPv6 = function(string) {
+ return this.parser(string) !== null;
+ };
+
+ ipaddr.IPv4.isValid = ipaddr.IPv6.isValid = function(string) {
+ var e;
+ try {
+ new this(this.parser(string));
+ return true;
+ } catch (_error) {
+ e = _error;
+ return false;
+ }
+ };
+
+ ipaddr.IPv4.parse = ipaddr.IPv6.parse = function(string) {
+ var parts;
+ parts = this.parser(string);
+ if (parts === null) {
+ throw new Error("ipaddr: string is not formatted like ip address");
+ }
+ return new this(parts);
+ };
+
+ ipaddr.isValid = function(string) {
+ return ipaddr.IPv6.isValid(string) || ipaddr.IPv4.isValid(string);
+ };
+
+ ipaddr.parse = function(string) {
+ if (ipaddr.IPv6.isValid(string)) {
+ return ipaddr.IPv6.parse(string);
+ } else if (ipaddr.IPv4.isValid(string)) {
+ return ipaddr.IPv4.parse(string);
+ } else {
+ throw new Error("ipaddr: the address has neither IPv6 nor IPv4 format");
+ }
+ };
+
+ ipaddr.process = function(string) {
+ var addr;
+ addr = this.parse(string);
+ if (addr.kind() === 'ipv6' && addr.isIPv4MappedAddress()) {
+ return addr.toIPv4Address();
+ } else {
+ return addr;
+ }
+ };
+
+}).call(this);
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/package.json b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/package.json
new file mode 100755
index 00000000..99791170
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/package.json
@@ -0,0 +1,58 @@
+{
+ "name": "ipaddr.js",
+ "description": "A library for manipulating IPv4 and IPv6 addresses in JavaScript.",
+ "version": "0.1.9",
+ "author": {
+ "name": "Peter Zotov",
+ "email": "whitequark@whitequark.org"
+ },
+ "directories": {
+ "lib": "./lib"
+ },
+ "dependencies": {},
+ "devDependencies": {
+ "coffee-script": "~1.6",
+ "nodeunit": "~0.5.3",
+ "uglify-js": "latest"
+ },
+ "scripts": {
+ "test": "cake build test"
+ },
+ "keywords": [
+ "ip",
+ "ipv4",
+ "ipv6"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/whitequark/ipaddr.js"
+ },
+ "main": "./lib/ipaddr",
+ "engines": {
+ "node": ">= 0.2.5"
+ },
+ "license": "MIT",
+ "gitHead": "d51df7aa41ef1875215ae4ffbd324c486f8c2799",
+ "bugs": {
+ "url": "https://github.com/whitequark/ipaddr.js/issues"
+ },
+ "_id": "ipaddr.js@0.1.9",
+ "_shasum": "a9c78ccc12dc9010f296ab9aef2f61f432d69efa",
+ "_from": "ipaddr.js@0.1.9",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "whitequark",
+ "email": "whitequark@whitequark.org"
+ },
+ "maintainers": [
+ {
+ "name": "whitequark",
+ "email": "whitequark@whitequark.org"
+ }
+ ],
+ "dist": {
+ "shasum": "a9c78ccc12dc9010f296ab9aef2f61f432d69efa",
+ "tarball": "http://registry.npmjs.org/ipaddr.js/-/ipaddr.js-0.1.9.tgz"
+ },
+ "_resolved": "https://registry.npmjs.org/ipaddr.js/-/ipaddr.js-0.1.9.tgz"
+}
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/src/ipaddr.coffee b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/src/ipaddr.coffee
new file mode 100755
index 00000000..a6d358e3
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/src/ipaddr.coffee
@@ -0,0 +1,353 @@
+# Define the main object
+ipaddr = {}
+
+root = this
+
+# Export for both the CommonJS and browser-like environment
+if module? && module.exports
+ module.exports = ipaddr
+else
+ root['ipaddr'] = ipaddr
+
+# A generic CIDR (Classless Inter-Domain Routing) RFC1518 range matcher.
+matchCIDR = (first, second, partSize, cidrBits) ->
+ if first.length != second.length
+ throw new Error "ipaddr: cannot match CIDR for objects with different lengths"
+
+ part = 0
+ while cidrBits > 0
+ shift = partSize - cidrBits
+ shift = 0 if shift < 0
+
+ if first[part] >> shift != second[part] >> shift
+ return false
+
+ cidrBits -= partSize
+ part += 1
+
+ return true
+
+# An utility function to ease named range matching. See examples below.
+ipaddr.subnetMatch = (address, rangeList, defaultName='unicast') ->
+ for rangeName, rangeSubnets of rangeList
+ # ECMA5 Array.isArray isn't available everywhere
+ if toString.call(rangeSubnets[0]) != '[object Array]'
+ rangeSubnets = [ rangeSubnets ]
+
+ for subnet in rangeSubnets
+ return rangeName if address.match.apply(address, subnet)
+
+ return defaultName
+
+# An IPv4 address (RFC791).
+class ipaddr.IPv4
+ # Constructs a new IPv4 address from an array of four octets.
+ # Verifies the input.
+ constructor: (octets) ->
+ if octets.length != 4
+ throw new Error "ipaddr: ipv4 octet count should be 4"
+
+ for octet in octets
+ if !(0 <= octet <= 255)
+ throw new Error "ipaddr: ipv4 octet is a byte"
+
+ @octets = octets
+
+ # The 'kind' method exists on both IPv4 and IPv6 classes.
+ kind: ->
+ return 'ipv4'
+
+ # Returns the address in convenient, decimal-dotted format.
+ toString: ->
+ return @octets.join "."
+
+ # Returns an array of byte-sized values in network order
+ toByteArray: ->
+ return @octets.slice(0) # octets.clone
+
+ # Checks if this address matches other one within given CIDR range.
+ match: (other, cidrRange) ->
+ if other.kind() != 'ipv4'
+ throw new Error "ipaddr: cannot match ipv4 address with non-ipv4 one"
+
+ return matchCIDR(this.octets, other.octets, 8, cidrRange)
+
+ # Special IPv4 address ranges.
+ SpecialRanges:
+ unspecified: [
+ [ new IPv4([0, 0, 0, 0]), 8 ]
+ ]
+ broadcast: [
+ [ new IPv4([255, 255, 255, 255]), 32 ]
+ ]
+ multicast: [ # RFC3171
+ [ new IPv4([224, 0, 0, 0]), 4 ]
+ ]
+ linkLocal: [ # RFC3927
+ [ new IPv4([169, 254, 0, 0]), 16 ]
+ ]
+ loopback: [ # RFC5735
+ [ new IPv4([127, 0, 0, 0]), 8 ]
+ ]
+ private: [ # RFC1918
+ [ new IPv4([10, 0, 0, 0]), 8 ]
+ [ new IPv4([172, 16, 0, 0]), 12 ]
+ [ new IPv4([192, 168, 0, 0]), 16 ]
+ ]
+ reserved: [ # Reserved and testing-only ranges; RFCs 5735, 5737, 2544, 1700
+ [ new IPv4([192, 0, 0, 0]), 24 ]
+ [ new IPv4([192, 0, 2, 0]), 24 ]
+ [ new IPv4([192, 88, 99, 0]), 24 ]
+ [ new IPv4([198, 51, 100, 0]), 24 ]
+ [ new IPv4([203, 0, 113, 0]), 24 ]
+ [ new IPv4([240, 0, 0, 0]), 4 ]
+ ]
+
+ # Checks if the address corresponds to one of the special ranges.
+ range: ->
+ return ipaddr.subnetMatch(this, @SpecialRanges)
+
+ # Convrets this IPv4 address to an IPv4-mapped IPv6 address.
+ toIPv4MappedAddress: ->
+ return ipaddr.IPv6.parse "::ffff:#{@toString()}"
+
+# A list of regular expressions that match arbitrary IPv4 addresses,
+# for which a number of weird notations exist.
+# Note that an address like 0010.0xa5.1.1 is considered legal.
+ipv4Part = "(0?\\d+|0x[a-f0-9]+)"
+ipv4Regexes =
+ fourOctet: new RegExp "^#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}$", 'i'
+ longValue: new RegExp "^#{ipv4Part}$", 'i'
+
+# Classful variants (like a.b, where a is an octet, and b is a 24-bit
+# value representing last three octets; this corresponds to a class C
+# address) are omitted due to classless nature of modern Internet.
+ipaddr.IPv4.parser = (string) ->
+ parseIntAuto = (string) ->
+ if string[0] == "0" && string[1] != "x"
+ parseInt(string, 8)
+ else
+ parseInt(string)
+
+ # parseInt recognizes all that octal & hexadecimal weirdness for us
+ if match = string.match(ipv4Regexes.fourOctet)
+ return (parseIntAuto(part) for part in match[1..5])
+ else if match = string.match(ipv4Regexes.longValue)
+ value = parseIntAuto(match[1])
+ if value > 0xffffffff || value < 0
+ throw new Error "ipaddr: address outside defined range"
+ return ((value >> shift) & 0xff for shift in [0..24] by 8).reverse()
+ else
+ return null
+
+# An IPv6 address (RFC2460)
+class ipaddr.IPv6
+ # Constructs an IPv6 address from an array of eight 16-bit parts.
+ # Throws an error if the input is invalid.
+ constructor: (parts) ->
+ if parts.length != 8
+ throw new Error "ipaddr: ipv6 part count should be 8"
+
+ for part in parts
+ if !(0 <= part <= 0xffff)
+ throw new Error "ipaddr: ipv6 part should fit to two octets"
+
+ @parts = parts
+
+ # The 'kind' method exists on both IPv4 and IPv6 classes.
+ kind: ->
+ return 'ipv6'
+
+ # Returns the address in compact, human-readable format like
+ # 2001:db8:8:66::1
+ toString: ->
+ stringParts = (part.toString(16) for part in @parts)
+
+ compactStringParts = []
+ pushPart = (part) -> compactStringParts.push part
+
+ state = 0
+ for part in stringParts
+ switch state
+ when 0
+ if part == '0'
+ pushPart('')
+ else
+ pushPart(part)
+
+ state = 1
+ when 1
+ if part == '0'
+ state = 2
+ else
+ pushPart(part)
+ when 2
+ unless part == '0'
+ pushPart('')
+ pushPart(part)
+ state = 3
+ when 3
+ pushPart(part)
+
+ if state == 2
+ pushPart('')
+ pushPart('')
+
+ return compactStringParts.join ":"
+
+ # Returns an array of byte-sized values in network order
+ toByteArray: ->
+ bytes = []
+ for part in @parts
+ bytes.push(part >> 8)
+ bytes.push(part & 0xff)
+
+ return bytes
+
+ # Returns the address in expanded format with all zeroes included, like
+ # 2001:db8:8:66:0:0:0:1
+ toNormalizedString: ->
+ return (part.toString(16) for part in @parts).join ":"
+
+ # Checks if this address matches other one within given CIDR range.
+ match: (other, cidrRange) ->
+ if other.kind() != 'ipv6'
+ throw new Error "ipaddr: cannot match ipv6 address with non-ipv6 one"
+
+ return matchCIDR(this.parts, other.parts, 16, cidrRange)
+
+ # Special IPv6 ranges
+ SpecialRanges:
+ unspecified: [ new IPv6([0, 0, 0, 0, 0, 0, 0, 0]), 128 ] # RFC4291, here and after
+ linkLocal: [ new IPv6([0xfe80, 0, 0, 0, 0, 0, 0, 0]), 10 ]
+ multicast: [ new IPv6([0xff00, 0, 0, 0, 0, 0, 0, 0]), 8 ]
+ loopback: [ new IPv6([0, 0, 0, 0, 0, 0, 0, 1]), 128 ]
+ uniqueLocal: [ new IPv6([0xfc00, 0, 0, 0, 0, 0, 0, 0]), 7 ]
+ ipv4Mapped: [ new IPv6([0, 0, 0, 0, 0, 0xffff, 0, 0]), 96 ]
+ rfc6145: [ new IPv6([0, 0, 0, 0, 0xffff, 0, 0, 0]), 96 ] # RFC6145
+ rfc6052: [ new IPv6([0x64, 0xff9b, 0, 0, 0, 0, 0, 0]), 96 ] # RFC6052
+ '6to4': [ new IPv6([0x2002, 0, 0, 0, 0, 0, 0, 0]), 16 ] # RFC3056
+ teredo: [ new IPv6([0x2001, 0, 0, 0, 0, 0, 0, 0]), 32 ] # RFC6052, RFC6146
+ reserved: [
+ [ new IPv6([ 0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]), 32 ] # RFC4291
+ ]
+
+ # Checks if the address corresponds to one of the special ranges.
+ range: ->
+ return ipaddr.subnetMatch(this, @SpecialRanges)
+
+ # Checks if this address is an IPv4-mapped IPv6 address.
+ isIPv4MappedAddress: ->
+ return @range() == 'ipv4Mapped'
+
+ # Converts this address to IPv4 address if it is an IPv4-mapped IPv6 address.
+ # Throws an error otherwise.
+ toIPv4Address: ->
+ unless @isIPv4MappedAddress()
+ throw new Error "ipaddr: trying to convert a generic ipv6 address to ipv4"
+
+ [high, low] = @parts[-2..-1]
+
+ return new ipaddr.IPv4([high >> 8, high & 0xff, low >> 8, low & 0xff])
+
+# IPv6-matching regular expressions.
+# For IPv6, the task is simpler: it is enough to match the colon-delimited
+# hexadecimal IPv6 and a transitional variant with dotted-decimal IPv4 at
+# the end.
+ipv6Part = "(?:[0-9a-f]+::?)+"
+ipv6Regexes =
+ native: new RegExp "^(::)?(#{ipv6Part})?([0-9a-f]+)?(::)?$", 'i'
+ transitional: new RegExp "^((?:#{ipv6Part})|(?:::)(?:#{ipv6Part})?)" +
+ "#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}\\.#{ipv4Part}$", 'i'
+
+# Expand :: in an IPv6 address or address part consisting of `parts` groups.
+expandIPv6 = (string, parts) ->
+ # More than one '::' means invalid adddress
+ if string.indexOf('::') != string.lastIndexOf('::')
+ return null
+
+ # How many parts do we already have?
+ colonCount = 0
+ lastColon = -1
+ while (lastColon = string.indexOf(':', lastColon + 1)) >= 0
+ colonCount++
+
+ # 0::0 is two parts more than ::
+ colonCount-- if string[0] == ':'
+ colonCount-- if string[string.length-1] == ':'
+
+ # The following loop would hang if colonCount > parts
+ if colonCount > parts
+ return null
+
+ # replacement = ':' + '0:' * (parts - colonCount)
+ replacementCount = parts - colonCount
+ replacement = ':'
+ while replacementCount--
+ replacement += '0:'
+
+ # Insert the missing zeroes
+ string = string.replace('::', replacement)
+
+ # Trim any garbage which may be hanging around if :: was at the edge in
+ # the source string
+ string = string[1..-1] if string[0] == ':'
+ string = string[0..-2] if string[string.length-1] == ':'
+
+ return (parseInt(part, 16) for part in string.split(":"))
+
+# Parse an IPv6 address.
+ipaddr.IPv6.parser = (string) ->
+ if string.match(ipv6Regexes['native'])
+ return expandIPv6(string, 8)
+
+ else if match = string.match(ipv6Regexes['transitional'])
+ parts = expandIPv6(match[1][0..-2], 6)
+ if parts
+ parts.push(parseInt(match[2]) << 8 | parseInt(match[3]))
+ parts.push(parseInt(match[4]) << 8 | parseInt(match[5]))
+ return parts
+
+ return null
+
+# Checks if a given string is formatted like IPv4/IPv6 address.
+ipaddr.IPv4.isIPv4 = ipaddr.IPv6.isIPv6 = (string) ->
+ return @parser(string) != null
+
+# Checks if a given string is a valid IPv4/IPv6 address.
+ipaddr.IPv4.isValid = ipaddr.IPv6.isValid = (string) ->
+ try
+ new this(@parser(string))
+ return true
+ catch e
+ return false
+
+# Tries to parse and validate a string with IPv4/IPv6 address.
+# Throws an error if it fails.
+ipaddr.IPv4.parse = ipaddr.IPv6.parse = (string) ->
+ parts = @parser(string)
+ if parts == null
+ throw new Error "ipaddr: string is not formatted like ip address"
+
+ return new this(parts)
+
+# Checks if the address is valid IP address
+ipaddr.isValid = (string) ->
+ return ipaddr.IPv6.isValid(string) || ipaddr.IPv4.isValid(string)
+
+# Try to parse an address and throw an error if it is impossible
+ipaddr.parse = (string) ->
+ if ipaddr.IPv6.isValid(string)
+ return ipaddr.IPv6.parse(string)
+ else if ipaddr.IPv4.isValid(string)
+ return ipaddr.IPv4.parse(string)
+ else
+ throw new Error "ipaddr: the address has neither IPv6 nor IPv4 format"
+
+# Parse an address and return plain IPv4 address if it is an IPv4-mapped address
+ipaddr.process = (string) ->
+ addr = @parse(string)
+ if addr.kind() == 'ipv6' && addr.isIPv4MappedAddress()
+ return addr.toIPv4Address()
+ else
+ return addr
diff --git a/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/test/ipaddr.test.coffee b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/test/ipaddr.test.coffee
new file mode 100755
index 00000000..627503d6
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/node_modules/ipaddr.js/test/ipaddr.test.coffee
@@ -0,0 +1,226 @@
+ipaddr = require '../lib/ipaddr'
+
+module.exports =
+ 'should define main classes': (test) ->
+ test.ok(ipaddr.IPv4?, 'defines IPv4 class')
+ test.ok(ipaddr.IPv6?, 'defines IPv6 class')
+ test.done()
+
+ 'can construct IPv4 from octets': (test) ->
+ test.doesNotThrow ->
+ new ipaddr.IPv4([192, 168, 1, 2])
+ test.done()
+
+ 'refuses to construct invalid IPv4': (test) ->
+ test.throws ->
+ new ipaddr.IPv4([300, 1, 2, 3])
+ test.throws ->
+ new ipaddr.IPv4([8, 8, 8])
+ test.done()
+
+ 'converts IPv4 to string correctly': (test) ->
+ addr = new ipaddr.IPv4([192, 168, 1, 1])
+ test.equal(addr.toString(), '192.168.1.1')
+ test.done()
+
+ 'returns correct kind for IPv4': (test) ->
+ addr = new ipaddr.IPv4([1, 2, 3, 4])
+ test.equal(addr.kind(), 'ipv4')
+ test.done()
+
+ 'allows to access IPv4 octets': (test) ->
+ addr = new ipaddr.IPv4([42, 0, 0, 0])
+ test.equal(addr.octets[0], 42)
+ test.done()
+
+ 'checks IPv4 address format': (test) ->
+ test.equal(ipaddr.IPv4.isIPv4('192.168.007.0xa'), true)
+ test.equal(ipaddr.IPv4.isIPv4('1024.0.0.1'), true)
+ test.equal(ipaddr.IPv4.isIPv4('8.0xa.wtf.6'), false)
+ test.done()
+
+ 'validates IPv4 addresses': (test) ->
+ test.equal(ipaddr.IPv4.isValid('192.168.007.0xa'), true)
+ test.equal(ipaddr.IPv4.isValid('1024.0.0.1'), false)
+ test.equal(ipaddr.IPv4.isValid('8.0xa.wtf.6'), false)
+ test.done()
+
+ 'parses IPv4 in several weird formats': (test) ->
+ test.deepEqual(ipaddr.IPv4.parse('192.168.1.1').octets, [192, 168, 1, 1])
+ test.deepEqual(ipaddr.IPv4.parse('0xc0.168.1.1').octets, [192, 168, 1, 1])
+ test.deepEqual(ipaddr.IPv4.parse('192.0250.1.1').octets, [192, 168, 1, 1])
+ test.deepEqual(ipaddr.IPv4.parse('0xc0a80101').octets, [192, 168, 1, 1])
+ test.deepEqual(ipaddr.IPv4.parse('030052000401').octets, [192, 168, 1, 1])
+ test.deepEqual(ipaddr.IPv4.parse('3232235777').octets, [192, 168, 1, 1])
+ test.done()
+
+ 'barfs at invalid IPv4': (test) ->
+ test.throws ->
+ ipaddr.IPv4.parse('10.0.0.wtf')
+ test.done()
+
+ 'matches IPv4 CIDR correctly': (test) ->
+ addr = new ipaddr.IPv4([10, 5, 0, 1])
+ test.equal(addr.match(ipaddr.IPv4.parse('0.0.0.0'), 0), true)
+ test.equal(addr.match(ipaddr.IPv4.parse('11.0.0.0'), 8), false)
+ test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.0'), 8), true)
+ test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.1'), 8), true)
+ test.equal(addr.match(ipaddr.IPv4.parse('10.0.0.10'), 8), true)
+ test.equal(addr.match(ipaddr.IPv4.parse('10.5.5.0'), 16), true)
+ test.equal(addr.match(ipaddr.IPv4.parse('10.4.5.0'), 16), false)
+ test.equal(addr.match(ipaddr.IPv4.parse('10.4.5.0'), 15), true)
+ test.equal(addr.match(ipaddr.IPv4.parse('10.5.0.2'), 32), false)
+ test.equal(addr.match(addr, 32), true)
+ test.done()
+
+ 'detects reserved IPv4 networks': (test) ->
+ test.equal(ipaddr.IPv4.parse('0.0.0.0').range(), 'unspecified')
+ test.equal(ipaddr.IPv4.parse('0.1.0.0').range(), 'unspecified')
+ test.equal(ipaddr.IPv4.parse('10.1.0.1').range(), 'private')
+ test.equal(ipaddr.IPv4.parse('192.168.2.1').range(), 'private')
+ test.equal(ipaddr.IPv4.parse('224.100.0.1').range(), 'multicast')
+ test.equal(ipaddr.IPv4.parse('169.254.15.0').range(), 'linkLocal')
+ test.equal(ipaddr.IPv4.parse('127.1.1.1').range(), 'loopback')
+ test.equal(ipaddr.IPv4.parse('255.255.255.255').range(), 'broadcast')
+ test.equal(ipaddr.IPv4.parse('240.1.2.3').range(), 'reserved')
+ test.equal(ipaddr.IPv4.parse('8.8.8.8').range(), 'unicast')
+ test.done()
+
+ 'can construct IPv6 from parts': (test) ->
+ test.doesNotThrow ->
+ new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1])
+ test.done()
+
+ 'refuses to construct invalid IPv6': (test) ->
+ test.throws ->
+ new ipaddr.IPv6([0xfffff, 0, 0, 0, 0, 0, 0, 1])
+ test.throws ->
+ new ipaddr.IPv6([0xfffff, 0, 0, 0, 0, 0, 1])
+ test.done()
+
+ 'converts IPv6 to string correctly': (test) ->
+ addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1])
+ test.equal(addr.toNormalizedString(), '2001:db8:f53a:0:0:0:0:1')
+ test.equal(addr.toString(), '2001:db8:f53a::1')
+ test.equal(new ipaddr.IPv6([0, 0, 0, 0, 0, 0, 0, 1]).toString(), '::1')
+ test.equal(new ipaddr.IPv6([0x2001, 0xdb8, 0, 0, 0, 0, 0, 0]).toString(), '2001:db8::')
+ test.done()
+
+ 'returns correct kind for IPv6': (test) ->
+ addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1])
+ test.equal(addr.kind(), 'ipv6')
+ test.done()
+
+ 'allows to access IPv6 address parts': (test) ->
+ addr = new ipaddr.IPv6([0x2001, 0xdb8, 0xf53a, 0, 0, 42, 0, 1])
+ test.equal(addr.parts[5], 42)
+ test.done()
+
+ 'checks IPv6 address format': (test) ->
+ test.equal(ipaddr.IPv6.isIPv6('2001:db8:F53A::1'), true)
+ test.equal(ipaddr.IPv6.isIPv6('200001::1'), true)
+ test.equal(ipaddr.IPv6.isIPv6('::ffff:192.168.1.1'), true)
+ test.equal(ipaddr.IPv6.isIPv6('::ffff:300.168.1.1'), true)
+ test.equal(ipaddr.IPv6.isIPv6('::ffff:300.168.1.1:0'), false)
+ test.equal(ipaddr.IPv6.isIPv6('fe80::wtf'), false)
+ test.done()
+
+ 'validates IPv6 addresses': (test) ->
+ test.equal(ipaddr.IPv6.isValid('2001:db8:F53A::1'), true)
+ test.equal(ipaddr.IPv6.isValid('200001::1'), false)
+ test.equal(ipaddr.IPv6.isValid('::ffff:192.168.1.1'), true)
+ test.equal(ipaddr.IPv6.isValid('::ffff:300.168.1.1'), false)
+ test.equal(ipaddr.IPv6.isValid('::ffff:300.168.1.1:0'), false)
+ test.equal(ipaddr.IPv6.isValid('2001:db8::F53A::1'), false)
+ test.equal(ipaddr.IPv6.isValid('fe80::wtf'), false)
+ test.done()
+
+ 'parses IPv6 in different formats': (test) ->
+ test.deepEqual(ipaddr.IPv6.parse('2001:db8:F53A:0:0:0:0:1').parts, [0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 1])
+ test.deepEqual(ipaddr.IPv6.parse('fe80::10').parts, [0xfe80, 0, 0, 0, 0, 0, 0, 0x10])
+ test.deepEqual(ipaddr.IPv6.parse('2001:db8:F53A::').parts, [0x2001, 0xdb8, 0xf53a, 0, 0, 0, 0, 0])
+ test.deepEqual(ipaddr.IPv6.parse('::1').parts, [0, 0, 0, 0, 0, 0, 0, 1])
+ test.deepEqual(ipaddr.IPv6.parse('::').parts, [0, 0, 0, 0, 0, 0, 0, 0])
+ test.done()
+
+ 'barfs at invalid IPv6': (test) ->
+ test.throws ->
+ ipaddr.IPv6.parse('fe80::0::1')
+ test.done()
+
+ 'matches IPv6 CIDR correctly': (test) ->
+ addr = ipaddr.IPv6.parse('2001:db8:f53a::1')
+ test.equal(addr.match(ipaddr.IPv6.parse('::'), 0), true)
+ test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f53a::1:1'), 64), true)
+ test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f53b::1:1'), 48), false)
+ test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f531::1:1'), 44), true)
+ test.equal(addr.match(ipaddr.IPv6.parse('2001:db8:f500::1'), 40), true)
+ test.equal(addr.match(ipaddr.IPv6.parse('2001:db9:f500::1'), 40), false)
+ test.equal(addr.match(addr, 128), true)
+ test.done()
+
+ 'converts between IPv4-mapped IPv6 addresses and IPv4 addresses': (test) ->
+ addr = ipaddr.IPv4.parse('77.88.21.11')
+ mapped = addr.toIPv4MappedAddress()
+ test.deepEqual(mapped.parts, [0, 0, 0, 0, 0, 0xffff, 0x4d58, 0x150b])
+ test.deepEqual(mapped.toIPv4Address().octets, addr.octets)
+ test.done()
+
+ 'refuses to convert non-IPv4-mapped IPv6 address to IPv4 address': (test) ->
+ test.throws ->
+ ipaddr.IPv6.parse('2001:db8::1').toIPv4Address()
+ test.done()
+
+ 'detects reserved IPv6 networks': (test) ->
+ test.equal(ipaddr.IPv6.parse('::').range(), 'unspecified')
+ test.equal(ipaddr.IPv6.parse('fe80::1234:5678:abcd:0123').range(), 'linkLocal')
+ test.equal(ipaddr.IPv6.parse('ff00::1234').range(), 'multicast')
+ test.equal(ipaddr.IPv6.parse('::1').range(), 'loopback')
+ test.equal(ipaddr.IPv6.parse('fc00::').range(), 'uniqueLocal')
+ test.equal(ipaddr.IPv6.parse('::ffff:192.168.1.10').range(), 'ipv4Mapped')
+ test.equal(ipaddr.IPv6.parse('::ffff:0:192.168.1.10').range(), 'rfc6145')
+ test.equal(ipaddr.IPv6.parse('64:ff9b::1234').range(), 'rfc6052')
+ test.equal(ipaddr.IPv6.parse('2002:1f63:45e8::1').range(), '6to4')
+ test.equal(ipaddr.IPv6.parse('2001::4242').range(), 'teredo')
+ test.equal(ipaddr.IPv6.parse('2001:db8::3210').range(), 'reserved')
+ test.equal(ipaddr.IPv6.parse('2001:470:8:66::1').range(), 'unicast')
+ test.done()
+
+ 'is able to determine IP address type': (test) ->
+ test.equal(ipaddr.parse('8.8.8.8').kind(), 'ipv4')
+ test.equal(ipaddr.parse('2001:db8:3312::1').kind(), 'ipv6')
+ test.done()
+
+ 'throws an error if tried to parse an invalid address': (test) ->
+ test.throws ->
+ ipaddr.parse('::some.nonsense')
+ test.done()
+
+ 'correctly processes IPv4-mapped addresses': (test) ->
+ test.equal(ipaddr.process('8.8.8.8').kind(), 'ipv4')
+ test.equal(ipaddr.process('2001:db8:3312::1').kind(), 'ipv6')
+ test.equal(ipaddr.process('::ffff:192.168.1.1').kind(), 'ipv4')
+ test.done()
+
+ 'correctly converts IPv6 and IPv4 addresses to byte arrays': (test) ->
+ test.deepEqual(ipaddr.parse('1.2.3.4').toByteArray(),
+ [0x1, 0x2, 0x3, 0x4]);
+ # Fuck yeah. The first byte of Google's IPv6 address is 42. 42!
+ test.deepEqual(ipaddr.parse('2a00:1450:8007::68').toByteArray(),
+ [42, 0x00, 0x14, 0x50, 0x80, 0x07, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x68 ])
+ test.done()
+
+ 'correctly parses 1 as an IPv4 address': (test) ->
+ test.equal(ipaddr.IPv6.isValid('1'), false)
+ test.equal(ipaddr.IPv4.isValid('1'), true)
+ test.deepEqual(new ipaddr.IPv4([0, 0, 0, 1]), ipaddr.parse('1'))
+ test.done()
+
+ 'does not consider a very large or very small number a valid IP address': (test) ->
+ test.equal(ipaddr.isValid('4999999999'), false)
+ test.equal(ipaddr.isValid('-1'), false)
+ test.done()
+
+ 'does not hang on ::8:8:8:8:8:8:8:8:8': (test) ->
+ test.equal(ipaddr.IPv6.isValid('::8:8:8:8:8:8:8:8:8'), false)
+ test.done()
diff --git a/server/node_modules/express/node_modules/proxy-addr/package.json b/server/node_modules/express/node_modules/proxy-addr/package.json
new file mode 100755
index 00000000..4e1f3591
--- /dev/null
+++ b/server/node_modules/express/node_modules/proxy-addr/package.json
@@ -0,0 +1,90 @@
+{
+ "name": "proxy-addr",
+ "description": "Determine address of proxied request",
+ "version": "1.0.7",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "license": "MIT",
+ "keywords": [
+ "ip",
+ "proxy",
+ "x-forwarded-for"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/proxy-addr"
+ },
+ "dependencies": {
+ "forwarded": "~0.1.0",
+ "ipaddr.js": "0.1.9"
+ },
+ "devDependencies": {
+ "benchmark": "1.0.0",
+ "beautify-benchmark": "0.2.4",
+ "istanbul": "0.3.8",
+ "mocha": "~1.21.5"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "README.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "bench": "node benchmark/index.js",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "917fa69ae1a4c3e2962d89461b6945538b763b28",
+ "bugs": {
+ "url": "https://github.com/jshttp/proxy-addr/issues"
+ },
+ "homepage": "https://github.com/jshttp/proxy-addr",
+ "_id": "proxy-addr@1.0.7",
+ "_shasum": "6e2655aa9c56b014f09734a7e6d558cc77751939",
+ "_from": "proxy-addr@~1.0.3",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "mscdex",
+ "email": "mscdex@mscdex.net"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "6e2655aa9c56b014f09734a7e6d558cc77751939",
+ "tarball": "http://registry.npmjs.org/proxy-addr/-/proxy-addr-1.0.7.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/proxy-addr/-/proxy-addr-1.0.7.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/qs/.jshintignore b/server/node_modules/express/node_modules/qs/.jshintignore
new file mode 100755
index 00000000..3c3629e6
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/.jshintignore
@@ -0,0 +1 @@
+node_modules
diff --git a/server/node_modules/express/node_modules/qs/.jshintrc b/server/node_modules/express/node_modules/qs/.jshintrc
new file mode 100755
index 00000000..997b3f7d
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/.jshintrc
@@ -0,0 +1,10 @@
+{
+ "node": true,
+
+ "curly": true,
+ "latedef": true,
+ "quotmark": true,
+ "undef": true,
+ "unused": true,
+ "trailing": true
+}
diff --git a/server/node_modules/express/node_modules/qs/.npmignore b/server/node_modules/express/node_modules/qs/.npmignore
new file mode 100755
index 00000000..7e1574dc
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/.npmignore
@@ -0,0 +1,18 @@
+.idea
+*.iml
+npm-debug.log
+dump.rdb
+node_modules
+results.tap
+results.xml
+npm-shrinkwrap.json
+config.json
+.DS_Store
+*/.DS_Store
+*/*/.DS_Store
+._*
+*/._*
+*/*/._*
+coverage.*
+lib-cov
+complexity.md
diff --git a/server/node_modules/express/node_modules/qs/.travis.yml b/server/node_modules/express/node_modules/qs/.travis.yml
new file mode 100755
index 00000000..c891dd0e
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/.travis.yml
@@ -0,0 +1,4 @@
+language: node_js
+
+node_js:
+ - 0.10
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/qs/CHANGELOG.md b/server/node_modules/express/node_modules/qs/CHANGELOG.md
new file mode 100755
index 00000000..a6dd5a57
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/CHANGELOG.md
@@ -0,0 +1,61 @@
+
+## [**2.3.1**](https://github.com/hapijs/qs/issues?milestone=16&state=closed)
+- [**#52**](https://github.com/hapijs/qs/issues/52) Return "undefined" and "false" instead of throwing "TypeError".
+
+## [**2.3.0**](https://github.com/hapijs/qs/issues?milestone=15&state=closed)
+- [**#50**](https://github.com/hapijs/qs/issues/50) add option to omit array indices, closes #46
+
+## [**2.2.5**](https://github.com/hapijs/qs/issues?milestone=14&state=closed)
+- [**#39**](https://github.com/hapijs/qs/issues/39) Is there an alternative to Buffer.isBuffer?
+- [**#49**](https://github.com/hapijs/qs/issues/49) refactor utils.merge, fixes #45
+- [**#41**](https://github.com/hapijs/qs/issues/41) avoid browserifying Buffer, for #39
+
+## [**2.2.4**](https://github.com/hapijs/qs/issues?milestone=13&state=closed)
+- [**#38**](https://github.com/hapijs/qs/issues/38) how to handle object keys beginning with a number
+
+## [**2.2.3**](https://github.com/hapijs/qs/issues?milestone=12&state=closed)
+- [**#37**](https://github.com/hapijs/qs/issues/37) parser discards first empty value in array
+- [**#36**](https://github.com/hapijs/qs/issues/36) Update to lab 4.x
+
+## [**2.2.2**](https://github.com/hapijs/qs/issues?milestone=11&state=closed)
+- [**#33**](https://github.com/hapijs/qs/issues/33) Error when plain object in a value
+- [**#34**](https://github.com/hapijs/qs/issues/34) use Object.prototype.hasOwnProperty.call instead of obj.hasOwnProperty
+- [**#24**](https://github.com/hapijs/qs/issues/24) Changelog? Semver?
+
+## [**2.2.1**](https://github.com/hapijs/qs/issues?milestone=10&state=closed)
+- [**#32**](https://github.com/hapijs/qs/issues/32) account for circular references properly, closes #31
+- [**#31**](https://github.com/hapijs/qs/issues/31) qs.parse stackoverflow on circular objects
+
+## [**2.2.0**](https://github.com/hapijs/qs/issues?milestone=9&state=closed)
+- [**#26**](https://github.com/hapijs/qs/issues/26) Don't use Buffer global if it's not present
+- [**#30**](https://github.com/hapijs/qs/issues/30) Bug when merging non-object values into arrays
+- [**#29**](https://github.com/hapijs/qs/issues/29) Don't call Utils.clone at the top of Utils.merge
+- [**#23**](https://github.com/hapijs/qs/issues/23) Ability to not limit parameters?
+
+## [**2.1.0**](https://github.com/hapijs/qs/issues?milestone=8&state=closed)
+- [**#22**](https://github.com/hapijs/qs/issues/22) Enable using a RegExp as delimiter
+
+## [**2.0.0**](https://github.com/hapijs/qs/issues?milestone=7&state=closed)
+- [**#18**](https://github.com/hapijs/qs/issues/18) Why is there arrayLimit?
+- [**#20**](https://github.com/hapijs/qs/issues/20) Configurable parametersLimit
+- [**#21**](https://github.com/hapijs/qs/issues/21) make all limits optional, for #18, for #20
+
+## [**1.2.2**](https://github.com/hapijs/qs/issues?milestone=6&state=closed)
+- [**#19**](https://github.com/hapijs/qs/issues/19) Don't overwrite null values
+
+## [**1.2.1**](https://github.com/hapijs/qs/issues?milestone=5&state=closed)
+- [**#16**](https://github.com/hapijs/qs/issues/16) ignore non-string delimiters
+- [**#15**](https://github.com/hapijs/qs/issues/15) Close code block
+
+## [**1.2.0**](https://github.com/hapijs/qs/issues?milestone=4&state=closed)
+- [**#12**](https://github.com/hapijs/qs/issues/12) Add optional delim argument
+- [**#13**](https://github.com/hapijs/qs/issues/13) fix #11: flattened keys in array are now correctly parsed
+
+## [**1.1.0**](https://github.com/hapijs/qs/issues?milestone=3&state=closed)
+- [**#7**](https://github.com/hapijs/qs/issues/7) Empty values of a POST array disappear after being submitted
+- [**#9**](https://github.com/hapijs/qs/issues/9) Should not omit equals signs (=) when value is null
+- [**#6**](https://github.com/hapijs/qs/issues/6) Minor grammar fix in README
+
+## [**1.0.2**](https://github.com/hapijs/qs/issues?milestone=2&state=closed)
+- [**#5**](https://github.com/hapijs/qs/issues/5) array holes incorrectly copied into object on large index
+
diff --git a/server/node_modules/express/node_modules/qs/CONTRIBUTING.md b/server/node_modules/express/node_modules/qs/CONTRIBUTING.md
new file mode 100755
index 00000000..89283615
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/CONTRIBUTING.md
@@ -0,0 +1 @@
+Please view our [hapijs contributing guide](https://github.com/hapijs/hapi/blob/master/CONTRIBUTING.md).
diff --git a/server/node_modules/express/node_modules/qs/LICENSE b/server/node_modules/express/node_modules/qs/LICENSE
new file mode 100755
index 00000000..d4569487
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/LICENSE
@@ -0,0 +1,28 @@
+Copyright (c) 2014 Nathan LaFreniere and other contributors.
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+ * Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+ * Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+ * The names of any contributors may not be used to endorse or promote
+ products derived from this software without specific prior written
+ permission.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDERS AND CONTRIBUTORS BE LIABLE FOR ANY
+DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+ * * *
+
+The complete list of contributors can be found at: https://github.com/hapijs/qs/graphs/contributors
diff --git a/server/node_modules/express/node_modules/qs/Makefile b/server/node_modules/express/node_modules/qs/Makefile
new file mode 100755
index 00000000..600a700e
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/Makefile
@@ -0,0 +1,8 @@
+test:
+ @node node_modules/lab/bin/lab
+test-cov:
+ @node node_modules/lab/bin/lab -t 100
+test-cov-html:
+ @node node_modules/lab/bin/lab -r html -o coverage.html
+
+.PHONY: test test-cov test-cov-html
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/qs/README.md b/server/node_modules/express/node_modules/qs/README.md
new file mode 100755
index 00000000..4f4e743b
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/README.md
@@ -0,0 +1,220 @@
+# qs
+
+A querystring parsing and stringifying library with some added security.
+
+[](http://travis-ci.org/hapijs/qs)
+
+Lead Maintainer: [Nathan LaFreniere](https://github.com/nlf)
+
+The **qs** module was originally created and maintained by [TJ Holowaychuk](https://github.com/visionmedia/node-querystring).
+
+## Usage
+
+```javascript
+var Qs = require('qs');
+
+var obj = Qs.parse('a=c'); // { a: 'c' }
+var str = Qs.stringify(obj); // 'a=c'
+```
+
+### Parsing Objects
+
+```javascript
+Qs.parse(string, [options]);
+```
+
+**qs** allows you to create nested objects within your query strings, by surrounding the name of sub-keys with square brackets `[]`.
+For example, the string `'foo[bar]=baz'` converts to:
+
+```javascript
+{
+ foo: {
+ bar: 'baz'
+ }
+}
+```
+
+URI encoded strings work too:
+
+```javascript
+Qs.parse('a%5Bb%5D=c');
+// { a: { b: 'c' } }
+```
+
+You can also nest your objects, like `'foo[bar][baz]=foobarbaz'`:
+
+```javascript
+{
+ foo: {
+ bar: {
+ baz: 'foobarbaz'
+ }
+ }
+}
+```
+
+By default, when nesting objects **qs** will only parse up to 5 children deep. This means if you attempt to parse a string like
+`'a[b][c][d][e][f][g][h][i]=j'` your resulting object will be:
+
+```javascript
+{
+ a: {
+ b: {
+ c: {
+ d: {
+ e: {
+ f: {
+ '[g][h][i]': 'j'
+ }
+ }
+ }
+ }
+ }
+ }
+}
+```
+
+This depth can be overridden by passing a `depth` option to `Qs.parse(string, [options])`:
+
+```javascript
+Qs.parse('a[b][c][d][e][f][g][h][i]=j', { depth: 1 });
+// { a: { b: { '[c][d][e][f][g][h][i]': 'j' } } }
+```
+
+The depth limit helps mitigate abuse when **qs** is used to parse user input, and it is recommended to keep it a reasonably small number.
+
+For similar reasons, by default **qs** will only parse up to 1000 parameters. This can be overridden by passing a `parameterLimit` option:
+
+```javascript
+Qs.parse('a=b&c=d', { parameterLimit: 1 });
+// { a: 'b' }
+```
+
+An optional delimiter can also be passed:
+
+```javascript
+Qs.parse('a=b;c=d', { delimiter: ';' });
+// { a: 'b', c: 'd' }
+```
+
+Delimiters can be a regular expression too:
+
+```javascript
+Qs.parse('a=b;c=d,e=f', { delimiter: /[;,]/ });
+// { a: 'b', c: 'd', e: 'f' }
+```
+
+### Parsing Arrays
+
+**qs** can also parse arrays using a similar `[]` notation:
+
+```javascript
+Qs.parse('a[]=b&a[]=c');
+// { a: ['b', 'c'] }
+```
+
+You may specify an index as well:
+
+```javascript
+Qs.parse('a[1]=c&a[0]=b');
+// { a: ['b', 'c'] }
+```
+
+Note that the only difference between an index in an array and a key in an object is that the value between the brackets must be a number
+to create an array. When creating arrays with specific indices, **qs** will compact a sparse array to only the existing values preserving
+their order:
+
+```javascript
+Qs.parse('a[1]=b&a[15]=c');
+// { a: ['b', 'c'] }
+```
+
+Note that an empty string is also a value, and will be preserved:
+
+```javascript
+Qs.parse('a[]=&a[]=b');
+// { a: ['', 'b'] }
+Qs.parse('a[0]=b&a[1]=&a[2]=c');
+// { a: ['b', '', 'c'] }
+```
+
+**qs** will also limit specifying indices in an array to a maximum index of `20`. Any array members with an index of greater than `20` will
+instead be converted to an object with the index as the key:
+
+```javascript
+Qs.parse('a[100]=b');
+// { a: { '100': 'b' } }
+```
+
+This limit can be overridden by passing an `arrayLimit` option:
+
+```javascript
+Qs.parse('a[1]=b', { arrayLimit: 0 });
+// { a: { '1': 'b' } }
+```
+
+If you mix notations, **qs** will merge the two items into an object:
+
+```javascript
+Qs.parse('a[0]=b&a[b]=c');
+// { a: { '0': 'b', b: 'c' } }
+```
+
+You can also create arrays of objects:
+
+```javascript
+Qs.parse('a[][b]=c');
+// { a: [{ b: 'c' }] }
+```
+
+### Stringifying
+
+```javascript
+Qs.stringify(object, [options]);
+```
+
+When stringifying, **qs** always URI encodes output. Objects are stringified as you would expect:
+
+```javascript
+Qs.stringify({ a: 'b' });
+// 'a=b'
+Qs.stringify({ a: { b: 'c' } });
+// 'a%5Bb%5D=c'
+```
+
+Examples beyond this point will be shown as though the output is not URI encoded for clarity. Please note that the return values in these cases *will* be URI encoded during real usage.
+
+When arrays are stringified, by default they are given explicit indices:
+
+```javascript
+Qs.stringify({ a: ['b', 'c', 'd'] });
+// 'a[0]=b&a[1]=c&a[2]=d'
+```
+
+You may override this by setting the `indices` option to `false`:
+
+```javascript
+Qs.stringify({ a: ['b', 'c', 'd'] }, { indices: false });
+// 'a=b&a=c&a=d'
+```
+
+Empty strings and null values will omit the value, but the equals sign (=) remains in place:
+
+```javascript
+Qs.stringify({ a: '' });
+// 'a='
+```
+
+Properties that are set to `undefined` will be omitted entirely:
+
+```javascript
+Qs.stringify({ a: null, b: undefined });
+// 'a='
+```
+
+The delimiter may be overridden with stringify as well:
+
+```javascript
+Qs.stringify({ a: 'b', c: 'd' }, { delimiter: ';' });
+// 'a=b;c=d'
+```
diff --git a/server/node_modules/express/node_modules/qs/index.js b/server/node_modules/express/node_modules/qs/index.js
new file mode 100755
index 00000000..bb0a047c
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/index.js
@@ -0,0 +1 @@
+module.exports = require('./lib');
diff --git a/server/node_modules/express/node_modules/qs/lib/index.js b/server/node_modules/express/node_modules/qs/lib/index.js
new file mode 100755
index 00000000..0e094933
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/lib/index.js
@@ -0,0 +1,15 @@
+// Load modules
+
+var Stringify = require('./stringify');
+var Parse = require('./parse');
+
+
+// Declare internals
+
+var internals = {};
+
+
+module.exports = {
+ stringify: Stringify,
+ parse: Parse
+};
diff --git a/server/node_modules/express/node_modules/qs/lib/parse.js b/server/node_modules/express/node_modules/qs/lib/parse.js
new file mode 100755
index 00000000..36273978
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/lib/parse.js
@@ -0,0 +1,156 @@
+// Load modules
+
+var Utils = require('./utils');
+
+
+// Declare internals
+
+var internals = {
+ delimiter: '&',
+ depth: 5,
+ arrayLimit: 20,
+ parameterLimit: 1000
+};
+
+
+internals.parseValues = function (str, options) {
+
+ var obj = {};
+ var parts = str.split(options.delimiter, options.parameterLimit === Infinity ? undefined : options.parameterLimit);
+
+ for (var i = 0, il = parts.length; i < il; ++i) {
+ var part = parts[i];
+ var pos = part.indexOf(']=') === -1 ? part.indexOf('=') : part.indexOf(']=') + 1;
+
+ if (pos === -1) {
+ obj[Utils.decode(part)] = '';
+ }
+ else {
+ var key = Utils.decode(part.slice(0, pos));
+ var val = Utils.decode(part.slice(pos + 1));
+
+ if (!obj.hasOwnProperty(key)) {
+ obj[key] = val;
+ }
+ else {
+ obj[key] = [].concat(obj[key]).concat(val);
+ }
+ }
+ }
+
+ return obj;
+};
+
+
+internals.parseObject = function (chain, val, options) {
+
+ if (!chain.length) {
+ return val;
+ }
+
+ var root = chain.shift();
+
+ var obj = {};
+ if (root === '[]') {
+ obj = [];
+ obj = obj.concat(internals.parseObject(chain, val, options));
+ }
+ else {
+ var cleanRoot = root[0] === '[' && root[root.length - 1] === ']' ? root.slice(1, root.length - 1) : root;
+ var index = parseInt(cleanRoot, 10);
+ var indexString = '' + index;
+ if (!isNaN(index) &&
+ root !== cleanRoot &&
+ indexString === cleanRoot &&
+ index <= options.arrayLimit) {
+
+ obj = [];
+ obj[index] = internals.parseObject(chain, val, options);
+ }
+ else {
+ obj[cleanRoot] = internals.parseObject(chain, val, options);
+ }
+ }
+
+ return obj;
+};
+
+
+internals.parseKeys = function (key, val, options) {
+
+ if (!key) {
+ return;
+ }
+
+ // The regex chunks
+
+ var parent = /^([^\[\]]*)/;
+ var child = /(\[[^\[\]]*\])/g;
+
+ // Get the parent
+
+ var segment = parent.exec(key);
+
+ // Don't allow them to overwrite object prototype properties
+
+ if (Object.prototype.hasOwnProperty(segment[1])) {
+ return;
+ }
+
+ // Stash the parent if it exists
+
+ var keys = [];
+ if (segment[1]) {
+ keys.push(segment[1]);
+ }
+
+ // Loop through children appending to the array until we hit depth
+
+ var i = 0;
+ while ((segment = child.exec(key)) !== null && i < options.depth) {
+
+ ++i;
+ if (!Object.prototype.hasOwnProperty(segment[1].replace(/\[|\]/g, ''))) {
+ keys.push(segment[1]);
+ }
+ }
+
+ // If there's a remainder, just add whatever is left
+
+ if (segment) {
+ keys.push('[' + key.slice(segment.index) + ']');
+ }
+
+ return internals.parseObject(keys, val, options);
+};
+
+
+module.exports = function (str, options) {
+
+ if (str === '' ||
+ str === null ||
+ typeof str === 'undefined') {
+
+ return {};
+ }
+
+ options = options || {};
+ options.delimiter = typeof options.delimiter === 'string' || Utils.isRegExp(options.delimiter) ? options.delimiter : internals.delimiter;
+ options.depth = typeof options.depth === 'number' ? options.depth : internals.depth;
+ options.arrayLimit = typeof options.arrayLimit === 'number' ? options.arrayLimit : internals.arrayLimit;
+ options.parameterLimit = typeof options.parameterLimit === 'number' ? options.parameterLimit : internals.parameterLimit;
+
+ var tempObj = typeof str === 'string' ? internals.parseValues(str, options) : str;
+ var obj = {};
+
+ // Iterate over the keys and setup the new object
+
+ var keys = Object.keys(tempObj);
+ for (var i = 0, il = keys.length; i < il; ++i) {
+ var key = keys[i];
+ var newObj = internals.parseKeys(key, tempObj[key], options);
+ obj = Utils.merge(obj, newObj);
+ }
+
+ return Utils.compact(obj);
+};
diff --git a/server/node_modules/express/node_modules/qs/lib/stringify.js b/server/node_modules/express/node_modules/qs/lib/stringify.js
new file mode 100755
index 00000000..b4411047
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/lib/stringify.js
@@ -0,0 +1,77 @@
+// Load modules
+
+var Utils = require('./utils');
+
+
+// Declare internals
+
+var internals = {
+ delimiter: '&',
+ indices: true
+};
+
+
+internals.stringify = function (obj, prefix, options) {
+
+ if (Utils.isBuffer(obj)) {
+ obj = obj.toString();
+ }
+ else if (obj instanceof Date) {
+ obj = obj.toISOString();
+ }
+ else if (obj === null) {
+ obj = '';
+ }
+
+ if (typeof obj === 'string' ||
+ typeof obj === 'number' ||
+ typeof obj === 'boolean') {
+
+ return [encodeURIComponent(prefix) + '=' + encodeURIComponent(obj)];
+ }
+
+ var values = [];
+
+ if (typeof obj === 'undefined') {
+ return values;
+ }
+
+ var objKeys = Object.keys(obj);
+ for (var i = 0, il = objKeys.length; i < il; ++i) {
+ var key = objKeys[i];
+ if (!options.indices &&
+ Array.isArray(obj)) {
+
+ values = values.concat(internals.stringify(obj[key], prefix, options));
+ }
+ else {
+ values = values.concat(internals.stringify(obj[key], prefix + '[' + key + ']', options));
+ }
+ }
+
+ return values;
+};
+
+
+module.exports = function (obj, options) {
+
+ options = options || {};
+ var delimiter = typeof options.delimiter === 'undefined' ? internals.delimiter : options.delimiter;
+ options.indices = typeof options.indices === 'boolean' ? options.indices : internals.indices;
+
+ var keys = [];
+
+ if (typeof obj !== 'object' ||
+ obj === null) {
+
+ return '';
+ }
+
+ var objKeys = Object.keys(obj);
+ for (var i = 0, il = objKeys.length; i < il; ++i) {
+ var key = objKeys[i];
+ keys = keys.concat(internals.stringify(obj[key], key, options));
+ }
+
+ return keys.join(delimiter);
+};
diff --git a/server/node_modules/express/node_modules/qs/lib/utils.js b/server/node_modules/express/node_modules/qs/lib/utils.js
new file mode 100755
index 00000000..3184d071
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/lib/utils.js
@@ -0,0 +1,132 @@
+// Load modules
+
+
+// Declare internals
+
+var internals = {};
+
+
+exports.arrayToObject = function (source) {
+
+ var obj = {};
+ for (var i = 0, il = source.length; i < il; ++i) {
+ if (typeof source[i] !== 'undefined') {
+
+ obj[i] = source[i];
+ }
+ }
+
+ return obj;
+};
+
+
+exports.merge = function (target, source) {
+
+ if (!source) {
+ return target;
+ }
+
+ if (typeof source !== 'object') {
+ if (Array.isArray(target)) {
+ target.push(source);
+ }
+ else {
+ target[source] = true;
+ }
+
+ return target;
+ }
+
+ if (typeof target !== 'object') {
+ target = [target].concat(source);
+ return target;
+ }
+
+ if (Array.isArray(target) &&
+ !Array.isArray(source)) {
+
+ target = exports.arrayToObject(target);
+ }
+
+ var keys = Object.keys(source);
+ for (var k = 0, kl = keys.length; k < kl; ++k) {
+ var key = keys[k];
+ var value = source[key];
+
+ if (!target[key]) {
+ target[key] = value;
+ }
+ else {
+ target[key] = exports.merge(target[key], value);
+ }
+ }
+
+ return target;
+};
+
+
+exports.decode = function (str) {
+
+ try {
+ return decodeURIComponent(str.replace(/\+/g, ' '));
+ } catch (e) {
+ return str;
+ }
+};
+
+
+exports.compact = function (obj, refs) {
+
+ if (typeof obj !== 'object' ||
+ obj === null) {
+
+ return obj;
+ }
+
+ refs = refs || [];
+ var lookup = refs.indexOf(obj);
+ if (lookup !== -1) {
+ return refs[lookup];
+ }
+
+ refs.push(obj);
+
+ if (Array.isArray(obj)) {
+ var compacted = [];
+
+ for (var i = 0, l = obj.length; i < l; ++i) {
+ if (typeof obj[i] !== 'undefined') {
+ compacted.push(obj[i]);
+ }
+ }
+
+ return compacted;
+ }
+
+ var keys = Object.keys(obj);
+ for (var i = 0, il = keys.length; i < il; ++i) {
+ var key = keys[i];
+ obj[key] = exports.compact(obj[key], refs);
+ }
+
+ return obj;
+};
+
+
+exports.isRegExp = function (obj) {
+ return Object.prototype.toString.call(obj) === '[object RegExp]';
+};
+
+
+exports.isBuffer = function (obj) {
+
+ if (obj === null ||
+ typeof obj === 'undefined') {
+
+ return false;
+ }
+
+ return !!(obj.constructor &&
+ obj.constructor.isBuffer &&
+ obj.constructor.isBuffer(obj));
+};
diff --git a/server/node_modules/express/node_modules/qs/package.json b/server/node_modules/express/node_modules/qs/package.json
new file mode 100755
index 00000000..55c1a676
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/package.json
@@ -0,0 +1,56 @@
+{
+ "name": "qs",
+ "version": "2.3.2",
+ "description": "A querystring parser that supports nesting and arrays, with a depth limit",
+ "homepage": "https://github.com/hapijs/qs",
+ "main": "index.js",
+ "dependencies": {},
+ "devDependencies": {
+ "lab": "4.x.x"
+ },
+ "scripts": {
+ "test": "make test-cov"
+ },
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/hapijs/qs.git"
+ },
+ "keywords": [
+ "querystring",
+ "qs"
+ ],
+ "licenses": [
+ {
+ "type": "BSD",
+ "url": "http://github.com/hapijs/qs/raw/master/LICENSE"
+ }
+ ],
+ "gitHead": "58097c12559b4c5857af99927273b3141dff8529",
+ "bugs": {
+ "url": "https://github.com/hapijs/qs/issues"
+ },
+ "_id": "qs@2.3.2",
+ "_shasum": "d45ec249e4b9b029af008829a101d5ff7e972790",
+ "_from": "qs@2.3.2",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "nlf",
+ "email": "quitlahok@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "nlf",
+ "email": "quitlahok@gmail.com"
+ },
+ {
+ "name": "hueniverse",
+ "email": "eran@hueniverse.com"
+ }
+ ],
+ "dist": {
+ "shasum": "d45ec249e4b9b029af008829a101d5ff7e972790",
+ "tarball": "http://registry.npmjs.org/qs/-/qs-2.3.2.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/qs/-/qs-2.3.2.tgz"
+}
diff --git a/server/node_modules/express/node_modules/qs/test/parse.js b/server/node_modules/express/node_modules/qs/test/parse.js
new file mode 100755
index 00000000..2a3d1696
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/test/parse.js
@@ -0,0 +1,406 @@
+// Load modules
+
+var Lab = require('lab');
+var Qs = require('../');
+
+
+// Declare internals
+
+var internals = {};
+
+
+// Test shortcuts
+
+var lab = exports.lab = Lab.script();
+var expect = Lab.expect;
+var describe = lab.experiment;
+var it = lab.test;
+
+
+describe('parse()', function () {
+
+ it('parses a simple string', function (done) {
+
+ expect(Qs.parse('0=foo')).to.deep.equal({ '0': 'foo' });
+ expect(Qs.parse('foo=c++')).to.deep.equal({ foo: 'c ' });
+ expect(Qs.parse('a[>=]=23')).to.deep.equal({ a: { '>=': '23' } });
+ expect(Qs.parse('a[<=>]==23')).to.deep.equal({ a: { '<=>': '=23' } });
+ expect(Qs.parse('a[==]=23')).to.deep.equal({ a: { '==': '23' } });
+ expect(Qs.parse('foo')).to.deep.equal({ foo: '' });
+ expect(Qs.parse('foo=bar')).to.deep.equal({ foo: 'bar' });
+ expect(Qs.parse(' foo = bar = baz ')).to.deep.equal({ ' foo ': ' bar = baz ' });
+ expect(Qs.parse('foo=bar=baz')).to.deep.equal({ foo: 'bar=baz' });
+ expect(Qs.parse('foo=bar&bar=baz')).to.deep.equal({ foo: 'bar', bar: 'baz' });
+ expect(Qs.parse('foo=bar&baz')).to.deep.equal({ foo: 'bar', baz: '' });
+ expect(Qs.parse('cht=p3&chd=t:60,40&chs=250x100&chl=Hello|World')).to.deep.equal({
+ cht: 'p3',
+ chd: 't:60,40',
+ chs: '250x100',
+ chl: 'Hello|World'
+ });
+ done();
+ });
+
+ it('parses a single nested string', function (done) {
+
+ expect(Qs.parse('a[b]=c')).to.deep.equal({ a: { b: 'c' } });
+ done();
+ });
+
+ it('parses a double nested string', function (done) {
+
+ expect(Qs.parse('a[b][c]=d')).to.deep.equal({ a: { b: { c: 'd' } } });
+ done();
+ });
+
+ it('defaults to a depth of 5', function (done) {
+
+ expect(Qs.parse('a[b][c][d][e][f][g][h]=i')).to.deep.equal({ a: { b: { c: { d: { e: { f: { '[g][h]': 'i' } } } } } } });
+ done();
+ });
+
+ it('only parses one level when depth = 1', function (done) {
+
+ expect(Qs.parse('a[b][c]=d', { depth: 1 })).to.deep.equal({ a: { b: { '[c]': 'd' } } });
+ expect(Qs.parse('a[b][c][d]=e', { depth: 1 })).to.deep.equal({ a: { b: { '[c][d]': 'e' } } });
+ done();
+ });
+
+ it('parses a simple array', function (done) {
+
+ expect(Qs.parse('a=b&a=c')).to.deep.equal({ a: ['b', 'c'] });
+ done();
+ });
+
+ it('parses an explicit array', function (done) {
+
+ expect(Qs.parse('a[]=b')).to.deep.equal({ a: ['b'] });
+ expect(Qs.parse('a[]=b&a[]=c')).to.deep.equal({ a: ['b', 'c'] });
+ expect(Qs.parse('a[]=b&a[]=c&a[]=d')).to.deep.equal({ a: ['b', 'c', 'd'] });
+ done();
+ });
+
+ it('parses a mix of simple and explicit arrays', function (done) {
+
+ expect(Qs.parse('a=b&a[]=c')).to.deep.equal({ a: ['b', 'c'] });
+ expect(Qs.parse('a[]=b&a=c')).to.deep.equal({ a: ['b', 'c'] });
+ expect(Qs.parse('a[0]=b&a=c')).to.deep.equal({ a: ['b', 'c'] });
+ expect(Qs.parse('a=b&a[0]=c')).to.deep.equal({ a: ['b', 'c'] });
+ expect(Qs.parse('a[1]=b&a=c')).to.deep.equal({ a: ['b', 'c'] });
+ expect(Qs.parse('a=b&a[1]=c')).to.deep.equal({ a: ['b', 'c'] });
+ done();
+ });
+
+ it('parses a nested array', function (done) {
+
+ expect(Qs.parse('a[b][]=c&a[b][]=d')).to.deep.equal({ a: { b: ['c', 'd'] } });
+ expect(Qs.parse('a[>=]=25')).to.deep.equal({ a: { '>=': '25' } });
+ done();
+ });
+
+ it('allows to specify array indices', function (done) {
+
+ expect(Qs.parse('a[1]=c&a[0]=b&a[2]=d')).to.deep.equal({ a: ['b', 'c', 'd'] });
+ expect(Qs.parse('a[1]=c&a[0]=b')).to.deep.equal({ a: ['b', 'c'] });
+ expect(Qs.parse('a[1]=c')).to.deep.equal({ a: ['c'] });
+ done();
+ });
+
+ it('limits specific array indices to 20', function (done) {
+
+ expect(Qs.parse('a[20]=a')).to.deep.equal({ a: ['a'] });
+ expect(Qs.parse('a[21]=a')).to.deep.equal({ a: { '21': 'a' } });
+ done();
+ });
+
+ it('supports keys that begin with a number', function (done) {
+
+ expect(Qs.parse('a[12b]=c')).to.deep.equal({ a: { '12b': 'c' } });
+ done();
+ });
+
+ it('supports encoded = signs', function (done) {
+
+ expect(Qs.parse('he%3Dllo=th%3Dere')).to.deep.equal({ 'he=llo': 'th=ere' });
+ done();
+ });
+
+ it('is ok with url encoded strings', function (done) {
+
+ expect(Qs.parse('a[b%20c]=d')).to.deep.equal({ a: { 'b c': 'd' } });
+ expect(Qs.parse('a[b]=c%20d')).to.deep.equal({ a: { b: 'c d' } });
+ done();
+ });
+
+ it('allows brackets in the value', function (done) {
+
+ expect(Qs.parse('pets=["tobi"]')).to.deep.equal({ pets: '["tobi"]' });
+ expect(Qs.parse('operators=[">=", "<="]')).to.deep.equal({ operators: '[">=", "<="]' });
+ done();
+ });
+
+ it('allows empty values', function (done) {
+
+ expect(Qs.parse('')).to.deep.equal({});
+ expect(Qs.parse(null)).to.deep.equal({});
+ expect(Qs.parse(undefined)).to.deep.equal({});
+ done();
+ });
+
+ it('transforms arrays to objects', function (done) {
+
+ expect(Qs.parse('foo[0]=bar&foo[bad]=baz')).to.deep.equal({ foo: { '0': 'bar', bad: 'baz' } });
+ expect(Qs.parse('foo[bad]=baz&foo[0]=bar')).to.deep.equal({ foo: { bad: 'baz', '0': 'bar' } });
+ expect(Qs.parse('foo[bad]=baz&foo[]=bar')).to.deep.equal({ foo: { bad: 'baz', '0': 'bar' } });
+ expect(Qs.parse('foo[]=bar&foo[bad]=baz')).to.deep.equal({ foo: { '0': 'bar', bad: 'baz' } });
+ expect(Qs.parse('foo[bad]=baz&foo[]=bar&foo[]=foo')).to.deep.equal({ foo: { bad: 'baz', '0': 'bar', '1': 'foo' } });
+ expect(Qs.parse('foo[0][a]=a&foo[0][b]=b&foo[1][a]=aa&foo[1][b]=bb')).to.deep.equal({foo: [ {a: 'a', b: 'b'}, {a: 'aa', b: 'bb'} ]});
+ done();
+ });
+
+ it('can add keys to objects', function (done) {
+
+ expect(Qs.parse('a[b]=c&a=d')).to.deep.equal({ a: { b: 'c', d: true } });
+ done();
+ });
+
+ it('correctly prunes undefined values when converting an array to an object', function (done) {
+
+ expect(Qs.parse('a[2]=b&a[99999999]=c')).to.deep.equal({ a: { '2': 'b', '99999999': 'c' } });
+ done();
+ });
+
+ it('supports malformed uri characters', function (done) {
+
+ expect(Qs.parse('{%:%}')).to.deep.equal({ '{%:%}': '' });
+ expect(Qs.parse('foo=%:%}')).to.deep.equal({ foo: '%:%}' });
+ done();
+ });
+
+ it('doesn\'t produce empty keys', function (done) {
+
+ expect(Qs.parse('_r=1&')).to.deep.equal({ '_r': '1' });
+ done();
+ });
+
+ it('cannot override prototypes', function (done) {
+
+ var obj = Qs.parse('toString=bad&bad[toString]=bad&constructor=bad');
+ expect(typeof obj.toString).to.equal('function');
+ expect(typeof obj.bad.toString).to.equal('function');
+ expect(typeof obj.constructor).to.equal('function');
+ done();
+ });
+
+ it('cannot access Object prototype', function (done) {
+
+ Qs.parse('constructor[prototype][bad]=bad');
+ Qs.parse('bad[constructor][prototype][bad]=bad');
+ expect(typeof Object.prototype.bad).to.equal('undefined');
+ done();
+ });
+
+ it('parses arrays of objects', function (done) {
+
+ expect(Qs.parse('a[][b]=c')).to.deep.equal({ a: [{ b: 'c' }] });
+ expect(Qs.parse('a[0][b]=c')).to.deep.equal({ a: [{ b: 'c' }] });
+ done();
+ });
+
+ it('allows for empty strings in arrays', function (done) {
+
+ expect(Qs.parse('a[]=b&a[]=&a[]=c')).to.deep.equal({ a: ['b', '', 'c'] });
+ expect(Qs.parse('a[0]=b&a[1]=&a[2]=c&a[19]=')).to.deep.equal({ a: ['b', '', 'c', ''] });
+ expect(Qs.parse('a[]=&a[]=b&a[]=c')).to.deep.equal({ a: ['', 'b', 'c'] });
+ done();
+ });
+
+ it('compacts sparse arrays', function (done) {
+
+ expect(Qs.parse('a[10]=1&a[2]=2')).to.deep.equal({ a: ['2', '1'] });
+ done();
+ });
+
+ it('parses semi-parsed strings', function (done) {
+
+ expect(Qs.parse({ 'a[b]': 'c' })).to.deep.equal({ a: { b: 'c' } });
+ expect(Qs.parse({ 'a[b]': 'c', 'a[d]': 'e' })).to.deep.equal({ a: { b: 'c', d: 'e' } });
+ done();
+ });
+
+ it('parses buffers correctly', function (done) {
+
+ var b = new Buffer('test');
+ expect(Qs.parse({ a: b })).to.deep.equal({ a: b });
+ done();
+ });
+
+ it('continues parsing when no parent is found', function (done) {
+
+ expect(Qs.parse('[]&a=b')).to.deep.equal({ '0': '', a: 'b' });
+ expect(Qs.parse('[foo]=bar')).to.deep.equal({ foo: 'bar' });
+ done();
+ });
+
+ it('does not error when parsing a very long array', function (done) {
+
+ var str = 'a[]=a';
+ while (Buffer.byteLength(str) < 128 * 1024) {
+ str += '&' + str;
+ }
+
+ expect(function () {
+
+ Qs.parse(str);
+ }).to.not.throw();
+
+ done();
+ });
+
+ it('should not throw when a native prototype has an enumerable property', { parallel: false }, function (done) {
+
+ Object.prototype.crash = '';
+ Array.prototype.crash = '';
+ expect(Qs.parse.bind(null, 'a=b')).to.not.throw();
+ expect(Qs.parse('a=b')).to.deep.equal({ a: 'b' });
+ expect(Qs.parse.bind(null, 'a[][b]=c')).to.not.throw();
+ expect(Qs.parse('a[][b]=c')).to.deep.equal({ a: [{ b: 'c' }] });
+ delete Object.prototype.crash;
+ delete Array.prototype.crash;
+ done();
+ });
+
+ it('parses a string with an alternative string delimiter', function (done) {
+
+ expect(Qs.parse('a=b;c=d', { delimiter: ';' })).to.deep.equal({ a: 'b', c: 'd' });
+ done();
+ });
+
+ it('parses a string with an alternative RegExp delimiter', function (done) {
+
+ expect(Qs.parse('a=b; c=d', { delimiter: /[;,] */ })).to.deep.equal({ a: 'b', c: 'd' });
+ done();
+ });
+
+ it('does not use non-splittable objects as delimiters', function (done) {
+
+ expect(Qs.parse('a=b&c=d', { delimiter: true })).to.deep.equal({ a: 'b', c: 'd' });
+ done();
+ });
+
+ it('allows overriding parameter limit', function (done) {
+
+ expect(Qs.parse('a=b&c=d', { parameterLimit: 1 })).to.deep.equal({ a: 'b' });
+ done();
+ });
+
+ it('allows setting the parameter limit to Infinity', function (done) {
+
+ expect(Qs.parse('a=b&c=d', { parameterLimit: Infinity })).to.deep.equal({ a: 'b', c: 'd' });
+ done();
+ });
+
+ it('allows overriding array limit', function (done) {
+
+ expect(Qs.parse('a[0]=b&a[1]=c', { arrayLimit: 0 })).to.deep.equal({ a: { '0': 'b', '1': 'c' } });
+ done();
+ });
+
+ it('parses an object', function (done) {
+
+ var input = {
+ "user[name]": {"pop[bob]": 3},
+ "user[email]": null
+ };
+
+ var expected = {
+ "user": {
+ "name": {"pop[bob]": 3},
+ "email": null
+ }
+ };
+
+ var result = Qs.parse(input);
+
+ expect(result).to.deep.equal(expected);
+ done();
+ });
+
+ it('parses an object and not child values', function (done) {
+
+ var input = {
+ "user[name]": {"pop[bob]": { "test": 3 }},
+ "user[email]": null
+ };
+
+ var expected = {
+ "user": {
+ "name": {"pop[bob]": { "test": 3 }},
+ "email": null
+ }
+ };
+
+ var result = Qs.parse(input);
+
+ expect(result).to.deep.equal(expected);
+ done();
+ });
+
+ it('does not blow up when Buffer global is missing', function (done) {
+
+ var tempBuffer = global.Buffer;
+ delete global.Buffer;
+ expect(Qs.parse('a=b&c=d')).to.deep.equal({ a: 'b', c: 'd' });
+ global.Buffer = tempBuffer;
+ done();
+ });
+
+ it('does not crash when using invalid dot notation', function (done) {
+
+ expect(Qs.parse('roomInfoList[0].childrenAges[0]=15&roomInfoList[0].numberOfAdults=2')).to.deep.equal({ roomInfoList: [['15', '2']] });
+ done();
+ });
+
+ it('does not crash when parsing circular references', function (done) {
+
+ var a = {};
+ a.b = a;
+
+ var parsed;
+
+ expect(function () {
+
+ parsed = Qs.parse({ 'foo[bar]': 'baz', 'foo[baz]': a });
+ }).to.not.throw(Error);
+
+ expect(parsed).to.have.key('foo');
+ expect(parsed.foo).to.have.keys('bar', 'baz');
+ expect(parsed.foo.bar).to.equal('baz');
+ expect(parsed.foo.baz).to.deep.equal(a);
+ done();
+ });
+
+ it('parses plain objects correctly', function (done) {
+
+ var a = Object.create(null);
+ a.b = 'c';
+
+ expect(Qs.parse(a)).to.deep.equal({ b: 'c' });
+ expect(Qs.parse({ a: a })).to.deep.equal({ a: { b: 'c' } });
+ done();
+ });
+
+ it('parses dates correctly', function (done) {
+
+ var now = new Date();
+ expect(Qs.parse({ a: now })).to.deep.equal({ a: now });
+ done();
+ });
+
+ it('parses regular expressions correctly', function (done) {
+
+ var re = /^test$/;
+ expect(Qs.parse({ a: re })).to.deep.equal({ a: re });
+ done();
+ });
+});
diff --git a/server/node_modules/express/node_modules/qs/test/stringify.js b/server/node_modules/express/node_modules/qs/test/stringify.js
new file mode 100755
index 00000000..e8280041
--- /dev/null
+++ b/server/node_modules/express/node_modules/qs/test/stringify.js
@@ -0,0 +1,177 @@
+// Load modules
+
+var Lab = require('lab');
+var Qs = require('../');
+
+
+// Declare internals
+
+var internals = {};
+
+
+// Test shortcuts
+
+var lab = exports.lab = Lab.script();
+var expect = Lab.expect;
+var describe = lab.experiment;
+var it = lab.test;
+
+
+describe('stringify()', function () {
+
+ it('stringifies a querystring object', function (done) {
+
+ expect(Qs.stringify({ a: 'b' })).to.equal('a=b');
+ expect(Qs.stringify({ a: 1 })).to.equal('a=1');
+ expect(Qs.stringify({ a: 1, b: 2 })).to.equal('a=1&b=2');
+ done();
+ });
+
+ it('stringifies a nested object', function (done) {
+
+ expect(Qs.stringify({ a: { b: 'c' } })).to.equal('a%5Bb%5D=c');
+ expect(Qs.stringify({ a: { b: { c: { d: 'e' } } } })).to.equal('a%5Bb%5D%5Bc%5D%5Bd%5D=e');
+ done();
+ });
+
+ it('stringifies an array value', function (done) {
+
+ expect(Qs.stringify({ a: ['b', 'c', 'd'] })).to.equal('a%5B0%5D=b&a%5B1%5D=c&a%5B2%5D=d');
+ done();
+ });
+
+ it('omits array indices when asked', function (done) {
+
+ expect(Qs.stringify({ a: ['b', 'c', 'd'] }, { indices: false })).to.equal('a=b&a=c&a=d');
+ done();
+ });
+
+ it('stringifies a nested array value', function (done) {
+
+ expect(Qs.stringify({ a: { b: ['c', 'd'] } })).to.equal('a%5Bb%5D%5B0%5D=c&a%5Bb%5D%5B1%5D=d');
+ done();
+ });
+
+ it('stringifies an object inside an array', function (done) {
+
+ expect(Qs.stringify({ a: [{ b: 'c' }] })).to.equal('a%5B0%5D%5Bb%5D=c');
+ expect(Qs.stringify({ a: [{ b: { c: [1] } }] })).to.equal('a%5B0%5D%5Bb%5D%5Bc%5D%5B0%5D=1');
+ done();
+ });
+
+ it('does not omit object keys when indices = false', function (done) {
+
+ expect(Qs.stringify({ a: [{ b: 'c' }] }, { indices: false })).to.equal('a%5Bb%5D=c');
+ done();
+ });
+
+ it('stringifies a complicated object', function (done) {
+
+ expect(Qs.stringify({ a: { b: 'c', d: 'e' } })).to.equal('a%5Bb%5D=c&a%5Bd%5D=e');
+ done();
+ });
+
+ it('stringifies an empty value', function (done) {
+
+ expect(Qs.stringify({ a: '' })).to.equal('a=');
+ expect(Qs.stringify({ a: '', b: '' })).to.equal('a=&b=');
+ expect(Qs.stringify({ a: null })).to.equal('a=');
+ expect(Qs.stringify({ a: { b: null } })).to.equal('a%5Bb%5D=');
+ done();
+ });
+
+ it('stringifies an empty object', function (done) {
+
+ var obj = Object.create(null);
+ obj.a = 'b';
+ expect(Qs.stringify(obj)).to.equal('a=b');
+ done();
+ });
+
+ it('returns an empty string for invalid input', function (done) {
+
+ expect(Qs.stringify(undefined)).to.equal('');
+ expect(Qs.stringify(false)).to.equal('');
+ expect(Qs.stringify(null)).to.equal('');
+ expect(Qs.stringify('')).to.equal('');
+ done();
+ });
+
+ it('stringifies an object with an empty object as a child', function (done) {
+
+ var obj = {
+ a: Object.create(null)
+ };
+
+ obj.a.b = 'c';
+ expect(Qs.stringify(obj)).to.equal('a%5Bb%5D=c');
+ done();
+ });
+
+ it('drops keys with a value of undefined', function (done) {
+
+ expect(Qs.stringify({ a: undefined })).to.equal('');
+ expect(Qs.stringify({ a: { b: undefined, c: null } })).to.equal('a%5Bc%5D=');
+ done();
+ });
+
+ it('url encodes values', function (done) {
+
+ expect(Qs.stringify({ a: 'b c' })).to.equal('a=b%20c');
+ done();
+ });
+
+ it('stringifies a date', function (done) {
+
+ var now = new Date();
+ var str = 'a=' + encodeURIComponent(now.toISOString());
+ expect(Qs.stringify({ a: now })).to.equal(str);
+ done();
+ });
+
+ it('stringifies the weird object from qs', function (done) {
+
+ expect(Qs.stringify({ 'my weird field': 'q1!2"\'w$5&7/z8)?' })).to.equal('my%20weird%20field=q1!2%22\'w%245%267%2Fz8)%3F');
+ done();
+ });
+
+ it('skips properties that are part of the object prototype', function (done) {
+
+ Object.prototype.crash = 'test';
+ expect(Qs.stringify({ a: 'b'})).to.equal('a=b');
+ expect(Qs.stringify({ a: { b: 'c' } })).to.equal('a%5Bb%5D=c');
+ delete Object.prototype.crash;
+ done();
+ });
+
+ it('stringifies boolean values', function (done) {
+
+ expect(Qs.stringify({ a: true })).to.equal('a=true');
+ expect(Qs.stringify({ a: { b: true } })).to.equal('a%5Bb%5D=true');
+ expect(Qs.stringify({ b: false })).to.equal('b=false');
+ expect(Qs.stringify({ b: { c: false } })).to.equal('b%5Bc%5D=false');
+ done();
+ });
+
+ it('stringifies buffer values', function (done) {
+
+ expect(Qs.stringify({ a: new Buffer('test') })).to.equal('a=test');
+ expect(Qs.stringify({ a: { b: new Buffer('test') } })).to.equal('a%5Bb%5D=test');
+ done();
+ });
+
+ it('stringifies an object using an alternative delimiter', function (done) {
+
+ expect(Qs.stringify({ a: 'b', c: 'd' }, { delimiter: ';' })).to.equal('a=b;c=d');
+ done();
+ });
+
+ it('doesn\'t blow up when Buffer global is missing', function (done) {
+
+ var tempBuffer = global.Buffer;
+ delete global.Buffer;
+ expect(Qs.stringify({ a: 'b', c: 'd' })).to.equal('a=b&c=d');
+ global.Buffer = tempBuffer;
+ done();
+ });
+});
diff --git a/server/node_modules/express/node_modules/range-parser/HISTORY.md b/server/node_modules/express/node_modules/range-parser/HISTORY.md
new file mode 100755
index 00000000..1bb53bd1
--- /dev/null
+++ b/server/node_modules/express/node_modules/range-parser/HISTORY.md
@@ -0,0 +1,35 @@
+1.0.2 / 2014-09-08
+==================
+
+ * Support Node.js 0.6
+
+1.0.1 / 2014-09-07
+==================
+
+ * Move repository to jshttp
+
+1.0.0 / 2013-12-11
+==================
+
+ * Add repository to package.json
+ * Add MIT license
+
+0.0.4 / 2012-06-17
+==================
+
+ * Change ret -1 for unsatisfiable and -2 when invalid
+
+0.0.3 / 2012-06-17
+==================
+
+ * Fix last-byte-pos default to len - 1
+
+0.0.2 / 2012-06-14
+==================
+
+ * Add `.type`
+
+0.0.1 / 2012-06-11
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/range-parser/LICENSE b/server/node_modules/express/node_modules/range-parser/LICENSE
new file mode 100755
index 00000000..a491841b
--- /dev/null
+++ b/server/node_modules/express/node_modules/range-parser/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2012-2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/range-parser/README.md b/server/node_modules/express/node_modules/range-parser/README.md
new file mode 100755
index 00000000..6a2682f3
--- /dev/null
+++ b/server/node_modules/express/node_modules/range-parser/README.md
@@ -0,0 +1,48 @@
+# range-parser
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Range header field parser.
+
+## Installation
+
+```
+$ npm install range-parser
+```
+
+## Examples
+
+```js
+assert(-1 == parse(200, 'bytes=500-20'));
+assert(-2 == parse(200, 'bytes=malformed'));
+parse(200, 'bytes=0-499').should.eql(arr('bytes', [{ start: 0, end: 199 }]));
+parse(1000, 'bytes=0-499').should.eql(arr('bytes', [{ start: 0, end: 499 }]));
+parse(1000, 'bytes=40-80').should.eql(arr('bytes', [{ start: 40, end: 80 }]));
+parse(1000, 'bytes=-500').should.eql(arr('bytes', [{ start: 500, end: 999 }]));
+parse(1000, 'bytes=-400').should.eql(arr('bytes', [{ start: 600, end: 999 }]));
+parse(1000, 'bytes=500-').should.eql(arr('bytes', [{ start: 500, end: 999 }]));
+parse(1000, 'bytes=400-').should.eql(arr('bytes', [{ start: 400, end: 999 }]));
+parse(1000, 'bytes=0-0').should.eql(arr('bytes', [{ start: 0, end: 0 }]));
+parse(1000, 'bytes=-1').should.eql(arr('bytes', [{ start: 999, end: 999 }]));
+parse(1000, 'items=0-5').should.eql(arr('items', [{ start: 0, end: 5 }]));
+parse(1000, 'bytes=40-80,-1').should.eql(arr('bytes', [{ start: 40, end: 80 }, { start: 999, end: 999 }]));
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/range-parser.svg?style=flat
+[npm-url]: https://npmjs.org/package/range-parser
+[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/range-parser.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/range-parser
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/range-parser.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/range-parser
+[downloads-image]: https://img.shields.io/npm/dm/range-parser.svg?style=flat
+[downloads-url]: https://npmjs.org/package/range-parser
diff --git a/server/node_modules/express/node_modules/range-parser/index.js b/server/node_modules/express/node_modules/range-parser/index.js
new file mode 100755
index 00000000..09a6c40e
--- /dev/null
+++ b/server/node_modules/express/node_modules/range-parser/index.js
@@ -0,0 +1,49 @@
+
+/**
+ * Parse "Range" header `str` relative to the given file `size`.
+ *
+ * @param {Number} size
+ * @param {String} str
+ * @return {Array}
+ * @api public
+ */
+
+module.exports = function(size, str){
+ var valid = true;
+ var i = str.indexOf('=');
+
+ if (-1 == i) return -2;
+
+ var arr = str.slice(i + 1).split(',').map(function(range){
+ var range = range.split('-')
+ , start = parseInt(range[0], 10)
+ , end = parseInt(range[1], 10);
+
+ // -nnn
+ if (isNaN(start)) {
+ start = size - end;
+ end = size - 1;
+ // nnn-
+ } else if (isNaN(end)) {
+ end = size - 1;
+ }
+
+ // limit last-byte-pos to current length
+ if (end > size - 1) end = size - 1;
+
+ // invalid
+ if (isNaN(start)
+ || isNaN(end)
+ || start > end
+ || start < 0) valid = false;
+
+ return {
+ start: start,
+ end: end
+ };
+ });
+
+ arr.type = str.slice(0, i);
+
+ return valid ? arr : -1;
+};
diff --git a/server/node_modules/express/node_modules/range-parser/package.json b/server/node_modules/express/node_modules/range-parser/package.json
new file mode 100755
index 00000000..9fc243b3
--- /dev/null
+++ b/server/node_modules/express/node_modules/range-parser/package.json
@@ -0,0 +1,76 @@
+{
+ "name": "range-parser",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca",
+ "url": "http://tjholowaychuk.com"
+ },
+ "description": "Range header field string parser",
+ "version": "1.0.2",
+ "license": "MIT",
+ "keywords": [
+ "range",
+ "parser",
+ "http"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/range-parser"
+ },
+ "devDependencies": {
+ "istanbul": "0",
+ "mocha": "1",
+ "should": "2"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --require should",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --require should",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot --require should"
+ },
+ "gitHead": "ae23b02ce705b56e7f7c48e832d41fa710227ecc",
+ "bugs": {
+ "url": "https://github.com/jshttp/range-parser/issues"
+ },
+ "homepage": "https://github.com/jshttp/range-parser",
+ "_id": "range-parser@1.0.2",
+ "_shasum": "06a12a42e5131ba8e457cd892044867f2344e549",
+ "_from": "range-parser@~1.0.2",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "jonathanong",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "06a12a42e5131ba8e457cd892044867f2344e549",
+ "tarball": "http://registry.npmjs.org/range-parser/-/range-parser-1.0.2.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/range-parser/-/range-parser-1.0.2.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/node_modules/send/History.md b/server/node_modules/express/node_modules/send/History.md
new file mode 100755
index 00000000..ad5efc59
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/History.md
@@ -0,0 +1,221 @@
+0.10.1 / 2014-10-22
+===================
+
+ * deps: on-finished@~2.1.1
+ - Fix handling of pipelined requests
+
+0.10.0 / 2014-10-15
+===================
+
+ * deps: debug@~2.1.0
+ - Implement `DEBUG_FD` env variable support
+ * deps: depd@~1.0.0
+ * deps: etag@~1.5.0
+ - Improve string performance
+ - Slightly improve speed for weak ETags over 1KB
+
+0.9.3 / 2014-09-24
+==================
+
+ * deps: etag@~1.4.0
+ - Support "fake" stats objects
+
+0.9.2 / 2014-09-15
+==================
+
+ * deps: depd@0.4.5
+ * deps: etag@~1.3.1
+ * deps: range-parser@~1.0.2
+
+0.9.1 / 2014-09-07
+==================
+
+ * deps: fresh@0.2.4
+
+0.9.0 / 2014-09-07
+==================
+
+ * Add `lastModified` option
+ * Use `etag` to generate `ETag` header
+ * deps: debug@~2.0.0
+
+0.8.5 / 2014-09-04
+==================
+
+ * Fix malicious path detection for empty string path
+
+0.8.4 / 2014-09-04
+==================
+
+ * Fix a path traversal issue when using `root`
+
+0.8.3 / 2014-08-16
+==================
+
+ * deps: destroy@1.0.3
+ - renamed from dethroy
+ * deps: on-finished@2.1.0
+
+0.8.2 / 2014-08-14
+==================
+
+ * Work around `fd` leak in Node.js 0.10 for `fs.ReadStream`
+ * deps: dethroy@1.0.2
+
+0.8.1 / 2014-08-05
+==================
+
+ * Fix `extensions` behavior when file already has extension
+
+0.8.0 / 2014-08-05
+==================
+
+ * Add `extensions` option
+
+0.7.4 / 2014-08-04
+==================
+
+ * Fix serving index files without root dir
+
+0.7.3 / 2014-07-29
+==================
+
+ * Fix incorrect 403 on Windows and Node.js 0.11
+
+0.7.2 / 2014-07-27
+==================
+
+ * deps: depd@0.4.4
+ - Work-around v8 generating empty stack traces
+
+0.7.1 / 2014-07-26
+==================
+
+ * deps: depd@0.4.3
+ - Fix exception when global `Error.stackTraceLimit` is too low
+
+0.7.0 / 2014-07-20
+==================
+
+ * Deprecate `hidden` option; use `dotfiles` option
+ * Add `dotfiles` option
+ * deps: debug@1.0.4
+ * deps: depd@0.4.2
+ - Add `TRACE_DEPRECATION` environment variable
+ - Remove non-standard grey color from color output
+ - Support `--no-deprecation` argument
+ - Support `--trace-deprecation` argument
+
+0.6.0 / 2014-07-11
+==================
+
+ * Deprecate `from` option; use `root` option
+ * Deprecate `send.etag()` -- use `etag` in `options`
+ * Deprecate `send.hidden()` -- use `hidden` in `options`
+ * Deprecate `send.index()` -- use `index` in `options`
+ * Deprecate `send.maxage()` -- use `maxAge` in `options`
+ * Deprecate `send.root()` -- use `root` in `options`
+ * Cap `maxAge` value to 1 year
+ * deps: debug@1.0.3
+ - Add support for multiple wildcards in namespaces
+
+0.5.0 / 2014-06-28
+==================
+
+ * Accept string for `maxAge` (converted by `ms`)
+ * Add `headers` event
+ * Include link in default redirect response
+ * Use `EventEmitter.listenerCount` to count listeners
+
+0.4.3 / 2014-06-11
+==================
+
+ * Do not throw un-catchable error on file open race condition
+ * Use `escape-html` for HTML escaping
+ * deps: debug@1.0.2
+ - fix some debugging output colors on node.js 0.8
+ * deps: finished@1.2.2
+ * deps: fresh@0.2.2
+
+0.4.2 / 2014-06-09
+==================
+
+ * fix "event emitter leak" warnings
+ * deps: debug@1.0.1
+ * deps: finished@1.2.1
+
+0.4.1 / 2014-06-02
+==================
+
+ * Send `max-age` in `Cache-Control` in correct format
+
+0.4.0 / 2014-05-27
+==================
+
+ * Calculate ETag with md5 for reduced collisions
+ * Fix wrong behavior when index file matches directory
+ * Ignore stream errors after request ends
+ - Goodbye `EBADF, read`
+ * Skip directories in index file search
+ * deps: debug@0.8.1
+
+0.3.0 / 2014-04-24
+==================
+
+ * Fix sending files with dots without root set
+ * Coerce option types
+ * Accept API options in options object
+ * Set etags to "weak"
+ * Include file path in etag
+ * Make "Can't set headers after they are sent." catchable
+ * Send full entity-body for multi range requests
+ * Default directory access to 403 when index disabled
+ * Support multiple index paths
+ * Support "If-Range" header
+ * Control whether to generate etags
+ * deps: mime@1.2.11
+
+0.2.0 / 2014-01-29
+==================
+
+ * update range-parser and fresh
+
+0.1.4 / 2013-08-11
+==================
+
+ * update fresh
+
+0.1.3 / 2013-07-08
+==================
+
+ * Revert "Fix fd leak"
+
+0.1.2 / 2013-07-03
+==================
+
+ * Fix fd leak
+
+0.1.0 / 2012-08-25
+==================
+
+ * add options parameter to send() that is passed to fs.createReadStream() [kanongil]
+
+0.0.4 / 2012-08-16
+==================
+
+ * allow custom "Accept-Ranges" definition
+
+0.0.3 / 2012-07-16
+==================
+
+ * fix normalization of the root directory. Closes #3
+
+0.0.2 / 2012-07-09
+==================
+
+ * add passing of req explicitly for now (YUCK)
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/send/LICENSE b/server/node_modules/express/node_modules/send/LICENSE
new file mode 100755
index 00000000..3b87e2db
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/LICENSE
@@ -0,0 +1,23 @@
+(The MIT License)
+
+Copyright (c) 2012 TJ Holowaychuk
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/send/Readme.md b/server/node_modules/express/node_modules/send/Readme.md
new file mode 100755
index 00000000..78bd40da
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/Readme.md
@@ -0,0 +1,182 @@
+# send
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+[![Gittip][gittip-image]][gittip-url]
+
+ Send is Connect's `static()` extracted for generalized use, a streaming static file
+ server supporting partial responses (Ranges), conditional-GET negotiation, high test coverage, and granular events which may be leveraged to take appropriate actions in your application or framework.
+
+## Installation
+
+```bash
+$ npm install send
+```
+
+## API
+
+```js
+var send = require('send')
+```
+
+### send(req, path, [options])
+
+Create a new `SendStream` for the given path to send to a `res`. The `req` is
+the Node.js HTTP request and the `path` is a urlencoded path to send (urlencoded,
+not the actual file-system path).
+
+#### Options
+
+##### dotfiles
+
+ Set how "dotfiles" are treated when encountered. A dotfile is a file
+ or directory that begins with a dot ("."). Note this check is done on
+ the path itself without checking if the path actually exists on the
+ disk. If `root` is specified, only the dotfiles above the root are
+ checked (i.e. the root itself can be within a dotfile when when set
+ to "deny").
+
+ The default value is `'ignore'`.
+
+ - `'allow'` No special treatment for dotfiles.
+ - `'deny'` Send a 403 for any request for a dotfile.
+ - `'ignore'` Pretend like the dotfile does not exist and 404.
+
+##### etag
+
+ Enable or disable etag generation, defaults to true.
+
+##### extensions
+
+ If a given file doesn't exist, try appending one of the given extensions,
+ in the given order. By default, this is disabled (set to `false`). An
+ example value that will serve extension-less HTML files: `['html', 'htm']`.
+ This is skipped if the requested file already has an extension.
+
+##### index
+
+ By default send supports "index.html" files, to disable this
+ set `false` or to supply a new index pass a string or an array
+ in preferred order.
+
+##### lastModified
+
+ Enable or disable `Last-Modified` header, defaults to true. Uses the file
+ system's last modified value.
+
+##### maxAge
+
+ Provide a max-age in milliseconds for http caching, defaults to 0.
+ This can also be a string accepted by the
+ [ms](https://www.npmjs.org/package/ms#readme) module.
+
+##### root
+
+ Serve files relative to `path`.
+
+### Events
+
+The `SendStream` is an event emitter and will emit the following events:
+
+ - `error` an error occurred `(err)`
+ - `directory` a directory was requested
+ - `file` a file was requested `(path, stat)`
+ - `headers` the headers are about to be set on a file `(res, path, stat)`
+ - `stream` file streaming has started `(stream)`
+ - `end` streaming has completed
+
+### .pipe
+
+The `pipe` method is used to pipe the response into the Node.js HTTP response
+object, typically `send(req, path, options).pipe(res)`.
+
+## Error-handling
+
+ By default when no `error` listeners are present an automatic response will be made, otherwise you have full control over the response, aka you may show a 5xx page etc.
+
+## Caching
+
+ It does _not_ perform internal caching, you should use a reverse proxy cache such
+ as Varnish for this, or those fancy things called CDNs. If your application is small enough that it would benefit from single-node memory caching, it's small enough that it does not need caching at all ;).
+
+## Debugging
+
+ To enable `debug()` instrumentation output export __DEBUG__:
+
+```
+$ DEBUG=send node app
+```
+
+## Running tests
+
+```
+$ npm install
+$ npm test
+```
+
+## Examples
+
+ Small:
+
+```js
+var http = require('http');
+var send = require('send');
+
+var app = http.createServer(function(req, res){
+ send(req, req.url).pipe(res);
+}).listen(3000);
+```
+
+ Serving from a root directory with custom error-handling:
+
+```js
+var http = require('http');
+var send = require('send');
+var url = require('url');
+
+var app = http.createServer(function(req, res){
+ // your custom error-handling logic:
+ function error(err) {
+ res.statusCode = err.status || 500;
+ res.end(err.message);
+ }
+
+ // your custom headers
+ function headers(res, path, stat) {
+ // serve all files for download
+ res.setHeader('Content-Disposition', 'attachment');
+ }
+
+ // your custom directory handling logic:
+ function redirect() {
+ res.statusCode = 301;
+ res.setHeader('Location', req.url + '/');
+ res.end('Redirecting to ' + req.url + '/');
+ }
+
+ // transfer arbitrary files from within
+ // /www/example.com/public/*
+ send(req, url.parse(req.url).pathname, {root: '/www/example.com/public'})
+ .on('error', error)
+ .on('directory', redirect)
+ .on('headers', headers)
+ .pipe(res);
+}).listen(3000);
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/send.svg?style=flat
+[npm-url]: https://npmjs.org/package/send
+[travis-image]: https://img.shields.io/travis/tj/send.svg?style=flat
+[travis-url]: https://travis-ci.org/tj/send
+[coveralls-image]: https://img.shields.io/coveralls/tj/send.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/tj/send?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/send.svg?style=flat
+[downloads-url]: https://npmjs.org/package/send
+[gittip-image]: https://img.shields.io/gittip/dougwilson.svg?style=flat
+[gittip-url]: https://www.gittip.com/dougwilson/
diff --git a/server/node_modules/express/node_modules/send/index.js b/server/node_modules/express/node_modules/send/index.js
new file mode 100755
index 00000000..64b6d641
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/index.js
@@ -0,0 +1,773 @@
+
+/**
+ * Module dependencies.
+ */
+
+var debug = require('debug')('send')
+var deprecate = require('depd')('send')
+var destroy = require('destroy')
+var escapeHtml = require('escape-html')
+ , parseRange = require('range-parser')
+ , Stream = require('stream')
+ , mime = require('mime')
+ , fresh = require('fresh')
+ , path = require('path')
+ , http = require('http')
+ , fs = require('fs')
+ , normalize = path.normalize
+ , join = path.join
+var etag = require('etag')
+var EventEmitter = require('events').EventEmitter;
+var ms = require('ms');
+var onFinished = require('on-finished')
+
+/**
+ * Variables.
+ */
+var extname = path.extname
+var maxMaxAge = 60 * 60 * 24 * 365 * 1000; // 1 year
+var resolve = path.resolve
+var sep = path.sep
+var toString = Object.prototype.toString
+var upPathRegexp = /(?:^|[\\\/])\.\.(?:[\\\/]|$)/
+
+/**
+ * Expose `send`.
+ */
+
+exports = module.exports = send;
+
+/**
+ * Expose mime module.
+ */
+
+exports.mime = mime;
+
+/**
+ * Shim EventEmitter.listenerCount for node.js < 0.10
+ */
+
+/* istanbul ignore next */
+var listenerCount = EventEmitter.listenerCount
+ || function(emitter, type){ return emitter.listeners(type).length; };
+
+/**
+ * Return a `SendStream` for `req` and `path`.
+ *
+ * @param {Request} req
+ * @param {String} path
+ * @param {Object} options
+ * @return {SendStream}
+ * @api public
+ */
+
+function send(req, path, options) {
+ return new SendStream(req, path, options);
+}
+
+/**
+ * Initialize a `SendStream` with the given `path`.
+ *
+ * @param {Request} req
+ * @param {String} path
+ * @param {Object} options
+ * @api private
+ */
+
+function SendStream(req, path, options) {
+ var self = this;
+ options = options || {};
+ this.req = req;
+ this.path = path;
+ this.options = options;
+
+ this._etag = options.etag !== undefined
+ ? Boolean(options.etag)
+ : true
+
+ this._dotfiles = options.dotfiles !== undefined
+ ? options.dotfiles
+ : 'ignore'
+
+ if (['allow', 'deny', 'ignore'].indexOf(this._dotfiles) === -1) {
+ throw new TypeError('dotfiles option must be "allow", "deny", or "ignore"')
+ }
+
+ this._hidden = Boolean(options.hidden)
+
+ if ('hidden' in options) {
+ deprecate('hidden: use dotfiles: \'' + (this._hidden ? 'allow' : 'ignore') + '\' instead')
+ }
+
+ // legacy support
+ if (!('dotfiles' in options)) {
+ this._dotfiles = undefined
+ }
+
+ this._extensions = options.extensions !== undefined
+ ? normalizeList(options.extensions)
+ : []
+
+ this._index = options.index !== undefined
+ ? normalizeList(options.index)
+ : ['index.html']
+
+ this._lastModified = options.lastModified !== undefined
+ ? Boolean(options.lastModified)
+ : true
+
+ this._maxage = options.maxAge || options.maxage
+ this._maxage = typeof this._maxage === 'string'
+ ? ms(this._maxage)
+ : Number(this._maxage)
+ this._maxage = !isNaN(this._maxage)
+ ? Math.min(Math.max(0, this._maxage), maxMaxAge)
+ : 0
+
+ this._root = options.root
+ ? resolve(options.root)
+ : null
+
+ if (!this._root && options.from) {
+ this.from(options.from);
+ }
+}
+
+/**
+ * Inherits from `Stream.prototype`.
+ */
+
+SendStream.prototype.__proto__ = Stream.prototype;
+
+/**
+ * Enable or disable etag generation.
+ *
+ * @param {Boolean} val
+ * @return {SendStream}
+ * @api public
+ */
+
+SendStream.prototype.etag = deprecate.function(function etag(val) {
+ val = Boolean(val);
+ debug('etag %s', val);
+ this._etag = val;
+ return this;
+}, 'send.etag: pass etag as option');
+
+/**
+ * Enable or disable "hidden" (dot) files.
+ *
+ * @param {Boolean} path
+ * @return {SendStream}
+ * @api public
+ */
+
+SendStream.prototype.hidden = deprecate.function(function hidden(val) {
+ val = Boolean(val);
+ debug('hidden %s', val);
+ this._hidden = val;
+ this._dotfiles = undefined
+ return this;
+}, 'send.hidden: use dotfiles option');
+
+/**
+ * Set index `paths`, set to a falsy
+ * value to disable index support.
+ *
+ * @param {String|Boolean|Array} paths
+ * @return {SendStream}
+ * @api public
+ */
+
+SendStream.prototype.index = deprecate.function(function index(paths) {
+ var index = !paths ? [] : normalizeList(paths);
+ debug('index %o', paths);
+ this._index = index;
+ return this;
+}, 'send.index: pass index as option');
+
+/**
+ * Set root `path`.
+ *
+ * @param {String} path
+ * @return {SendStream}
+ * @api public
+ */
+
+SendStream.prototype.root = function(path){
+ path = String(path);
+ this._root = resolve(path)
+ return this;
+};
+
+SendStream.prototype.from = deprecate.function(SendStream.prototype.root,
+ 'send.from: pass root as option');
+
+SendStream.prototype.root = deprecate.function(SendStream.prototype.root,
+ 'send.root: pass root as option');
+
+/**
+ * Set max-age to `maxAge`.
+ *
+ * @param {Number} maxAge
+ * @return {SendStream}
+ * @api public
+ */
+
+SendStream.prototype.maxage = deprecate.function(function maxage(maxAge) {
+ maxAge = typeof maxAge === 'string'
+ ? ms(maxAge)
+ : Number(maxAge);
+ if (isNaN(maxAge)) maxAge = 0;
+ if (Infinity == maxAge) maxAge = 60 * 60 * 24 * 365 * 1000;
+ debug('max-age %d', maxAge);
+ this._maxage = maxAge;
+ return this;
+}, 'send.maxage: pass maxAge as option');
+
+/**
+ * Emit error with `status`.
+ *
+ * @param {Number} status
+ * @api private
+ */
+
+SendStream.prototype.error = function(status, err){
+ var res = this.res;
+ var msg = http.STATUS_CODES[status];
+
+ err = err || new Error(msg);
+ err.status = status;
+
+ // emit if listeners instead of responding
+ if (listenerCount(this, 'error') !== 0) {
+ return this.emit('error', err);
+ }
+
+ // wipe all existing headers
+ res._headers = undefined;
+
+ res.statusCode = err.status;
+ res.end(msg);
+};
+
+/**
+ * Check if the pathname ends with "/".
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+SendStream.prototype.hasTrailingSlash = function(){
+ return '/' == this.path[this.path.length - 1];
+};
+
+/**
+ * Check if this is a conditional GET request.
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+SendStream.prototype.isConditionalGET = function(){
+ return this.req.headers['if-none-match']
+ || this.req.headers['if-modified-since'];
+};
+
+/**
+ * Strip content-* header fields.
+ *
+ * @api private
+ */
+
+SendStream.prototype.removeContentHeaderFields = function(){
+ var res = this.res;
+ Object.keys(res._headers).forEach(function(field){
+ if (0 == field.indexOf('content')) {
+ res.removeHeader(field);
+ }
+ });
+};
+
+/**
+ * Respond with 304 not modified.
+ *
+ * @api private
+ */
+
+SendStream.prototype.notModified = function(){
+ var res = this.res;
+ debug('not modified');
+ this.removeContentHeaderFields();
+ res.statusCode = 304;
+ res.end();
+};
+
+/**
+ * Raise error that headers already sent.
+ *
+ * @api private
+ */
+
+SendStream.prototype.headersAlreadySent = function headersAlreadySent(){
+ var err = new Error('Can\'t set headers after they are sent.');
+ debug('headers already sent');
+ this.error(500, err);
+};
+
+/**
+ * Check if the request is cacheable, aka
+ * responded with 2xx or 304 (see RFC 2616 section 14.2{5,6}).
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+SendStream.prototype.isCachable = function(){
+ var res = this.res;
+ return (res.statusCode >= 200 && res.statusCode < 300) || 304 == res.statusCode;
+};
+
+/**
+ * Handle stat() error.
+ *
+ * @param {Error} err
+ * @api private
+ */
+
+SendStream.prototype.onStatError = function(err){
+ var notfound = ['ENOENT', 'ENAMETOOLONG', 'ENOTDIR'];
+ if (~notfound.indexOf(err.code)) return this.error(404, err);
+ this.error(500, err);
+};
+
+/**
+ * Check if the cache is fresh.
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+SendStream.prototype.isFresh = function(){
+ return fresh(this.req.headers, this.res._headers);
+};
+
+/**
+ * Check if the range is fresh.
+ *
+ * @return {Boolean}
+ * @api private
+ */
+
+SendStream.prototype.isRangeFresh = function isRangeFresh(){
+ var ifRange = this.req.headers['if-range'];
+
+ if (!ifRange) return true;
+
+ return ~ifRange.indexOf('"')
+ ? ~ifRange.indexOf(this.res._headers['etag'])
+ : Date.parse(this.res._headers['last-modified']) <= Date.parse(ifRange);
+};
+
+/**
+ * Redirect to `path`.
+ *
+ * @param {String} path
+ * @api private
+ */
+
+SendStream.prototype.redirect = function(path){
+ if (listenerCount(this, 'directory') !== 0) {
+ return this.emit('directory');
+ }
+
+ if (this.hasTrailingSlash()) return this.error(403);
+ var res = this.res;
+ path += '/';
+ res.statusCode = 301;
+ res.setHeader('Content-Type', 'text/html; charset=utf-8');
+ res.setHeader('Location', path);
+ res.end('Redirecting to ' + escapeHtml(path) + '\n');
+};
+
+/**
+ * Pipe to `res.
+ *
+ * @param {Stream} res
+ * @return {Stream} res
+ * @api public
+ */
+
+SendStream.prototype.pipe = function(res){
+ var self = this
+ , args = arguments
+ , root = this._root;
+
+ // references
+ this.res = res;
+
+ // decode the path
+ var path = decode(this.path)
+ if (path === -1) return this.error(400)
+
+ // null byte(s)
+ if (~path.indexOf('\0')) return this.error(400);
+
+ var parts
+ if (root !== null) {
+ // join / normalize from optional root dir
+ path = normalize(join(root, path))
+ root = normalize(root + sep)
+
+ // malicious path
+ if ((path + sep).substr(0, root.length) !== root) {
+ debug('malicious path "%s"', path)
+ return this.error(403)
+ }
+
+ // explode path parts
+ parts = path.substr(root.length).split(sep)
+ } else {
+ // ".." is malicious without "root"
+ if (upPathRegexp.test(path)) {
+ debug('malicious path "%s"', path)
+ return this.error(403)
+ }
+
+ // explode path parts
+ parts = normalize(path).split(sep)
+
+ // resolve the path
+ path = resolve(path)
+ }
+
+ // dotfile handling
+ if (containsDotFile(parts)) {
+ var access = this._dotfiles
+
+ // legacy support
+ if (access === undefined) {
+ access = parts[parts.length - 1][0] === '.'
+ ? (this._hidden ? 'allow' : 'ignore')
+ : 'allow'
+ }
+
+ debug('%s dotfile "%s"', access, path)
+ switch (access) {
+ case 'allow':
+ break
+ case 'deny':
+ return this.error(403)
+ case 'ignore':
+ default:
+ return this.error(404)
+ }
+ }
+
+ // index file support
+ if (this._index.length && this.path[this.path.length - 1] === '/') {
+ this.sendIndex(path);
+ return res;
+ }
+
+ this.sendFile(path);
+ return res;
+};
+
+/**
+ * Transfer `path`.
+ *
+ * @param {String} path
+ * @api public
+ */
+
+SendStream.prototype.send = function(path, stat){
+ var options = this.options;
+ var len = stat.size;
+ var res = this.res;
+ var req = this.req;
+ var ranges = req.headers.range;
+ var offset = options.start || 0;
+
+ if (res._header) {
+ // impossible to send now
+ return this.headersAlreadySent();
+ }
+
+ debug('pipe "%s"', path)
+
+ // set header fields
+ this.setHeader(path, stat);
+
+ // set content-type
+ this.type(path);
+
+ // conditional GET support
+ if (this.isConditionalGET()
+ && this.isCachable()
+ && this.isFresh()) {
+ return this.notModified();
+ }
+
+ // adjust len to start/end options
+ len = Math.max(0, len - offset);
+ if (options.end !== undefined) {
+ var bytes = options.end - offset + 1;
+ if (len > bytes) len = bytes;
+ }
+
+ // Range support
+ if (ranges) {
+ ranges = parseRange(len, ranges);
+
+ // If-Range support
+ if (!this.isRangeFresh()) {
+ debug('range stale');
+ ranges = -2;
+ }
+
+ // unsatisfiable
+ if (-1 == ranges) {
+ debug('range unsatisfiable');
+ res.setHeader('Content-Range', 'bytes */' + stat.size);
+ return this.error(416);
+ }
+
+ // valid (syntactically invalid/multiple ranges are treated as a regular response)
+ if (-2 != ranges && ranges.length === 1) {
+ debug('range %j', ranges);
+
+ options.start = offset + ranges[0].start;
+ options.end = offset + ranges[0].end;
+
+ // Content-Range
+ res.statusCode = 206;
+ res.setHeader('Content-Range', 'bytes '
+ + ranges[0].start
+ + '-'
+ + ranges[0].end
+ + '/'
+ + len);
+ len = options.end - options.start + 1;
+ }
+ }
+
+ // content-length
+ res.setHeader('Content-Length', len);
+
+ // HEAD support
+ if ('HEAD' == req.method) return res.end();
+
+ this.stream(path, options);
+};
+
+/**
+ * Transfer file for `path`.
+ *
+ * @param {String} path
+ * @api private
+ */
+SendStream.prototype.sendFile = function sendFile(path) {
+ var i = 0
+ var self = this
+
+ debug('stat "%s"', path);
+ fs.stat(path, function onstat(err, stat) {
+ if (err && err.code === 'ENOENT'
+ && !extname(path)
+ && path[path.length - 1] !== sep) {
+ // not found, check extensions
+ return next(err)
+ }
+ if (err) return self.onStatError(err)
+ if (stat.isDirectory()) return self.redirect(self.path)
+ self.emit('file', path, stat)
+ self.send(path, stat)
+ })
+
+ function next(err) {
+ if (self._extensions.length <= i) {
+ return err
+ ? self.onStatError(err)
+ : self.error(404)
+ }
+
+ var p = path + '.' + self._extensions[i++]
+
+ debug('stat "%s"', p)
+ fs.stat(p, function (err, stat) {
+ if (err) return next(err)
+ if (stat.isDirectory()) return next()
+ self.emit('file', p, stat)
+ self.send(p, stat)
+ })
+ }
+}
+
+/**
+ * Transfer index for `path`.
+ *
+ * @param {String} path
+ * @api private
+ */
+SendStream.prototype.sendIndex = function sendIndex(path){
+ var i = -1;
+ var self = this;
+
+ function next(err){
+ if (++i >= self._index.length) {
+ if (err) return self.onStatError(err);
+ return self.error(404);
+ }
+
+ var p = join(path, self._index[i]);
+
+ debug('stat "%s"', p);
+ fs.stat(p, function(err, stat){
+ if (err) return next(err);
+ if (stat.isDirectory()) return next();
+ self.emit('file', p, stat);
+ self.send(p, stat);
+ });
+ }
+
+ next();
+};
+
+/**
+ * Stream `path` to the response.
+ *
+ * @param {String} path
+ * @param {Object} options
+ * @api private
+ */
+
+SendStream.prototype.stream = function(path, options){
+ // TODO: this is all lame, refactor meeee
+ var finished = false;
+ var self = this;
+ var res = this.res;
+ var req = this.req;
+
+ // pipe
+ var stream = fs.createReadStream(path, options);
+ this.emit('stream', stream);
+ stream.pipe(res);
+
+ // response finished, done with the fd
+ onFinished(res, function onfinished(){
+ finished = true;
+ destroy(stream);
+ });
+
+ // error handling code-smell
+ stream.on('error', function onerror(err){
+ // request already finished
+ if (finished) return;
+
+ // clean up stream
+ finished = true;
+ destroy(stream);
+
+ // error
+ self.onStatError(err);
+ });
+
+ // end
+ stream.on('end', function onend(){
+ self.emit('end');
+ });
+};
+
+/**
+ * Set content-type based on `path`
+ * if it hasn't been explicitly set.
+ *
+ * @param {String} path
+ * @api private
+ */
+
+SendStream.prototype.type = function(path){
+ var res = this.res;
+ if (res.getHeader('Content-Type')) return;
+ var type = mime.lookup(path);
+ var charset = mime.charsets.lookup(type);
+ debug('content-type %s', type);
+ res.setHeader('Content-Type', type + (charset ? '; charset=' + charset : ''));
+};
+
+/**
+ * Set response header fields, most
+ * fields may be pre-defined.
+ *
+ * @param {String} path
+ * @param {Object} stat
+ * @api private
+ */
+
+SendStream.prototype.setHeader = function setHeader(path, stat){
+ var res = this.res;
+
+ this.emit('headers', res, path, stat);
+
+ if (!res.getHeader('Accept-Ranges')) res.setHeader('Accept-Ranges', 'bytes');
+ if (!res.getHeader('Date')) res.setHeader('Date', new Date().toUTCString());
+ if (!res.getHeader('Cache-Control')) res.setHeader('Cache-Control', 'public, max-age=' + Math.floor(this._maxage / 1000));
+
+ if (this._lastModified && !res.getHeader('Last-Modified')) {
+ var modified = stat.mtime.toUTCString()
+ debug('modified %s', modified)
+ res.setHeader('Last-Modified', modified)
+ }
+
+ if (this._etag && !res.getHeader('ETag')) {
+ var val = etag(stat)
+ debug('etag %s', val)
+ res.setHeader('ETag', val)
+ }
+};
+
+/**
+ * Determine if path parts contain a dotfile.
+ *
+ * @api private
+ */
+
+function containsDotFile(parts) {
+ for (var i = 0; i < parts.length; i++) {
+ if (parts[i][0] === '.') {
+ return true
+ }
+ }
+
+ return false
+}
+
+/**
+ * decodeURIComponent.
+ *
+ * Allows V8 to only deoptimize this fn instead of all
+ * of send().
+ *
+ * @param {String} path
+ * @api private
+ */
+
+function decode(path) {
+ try {
+ return decodeURIComponent(path)
+ } catch (err) {
+ return -1
+ }
+}
+
+/**
+ * Normalize the index option into an array.
+ *
+ * @param {boolean|string|array} val
+ * @api private
+ */
+
+function normalizeList(val){
+ return [].concat(val || [])
+}
diff --git a/server/node_modules/express/node_modules/send/node_modules/destroy/README.md b/server/node_modules/express/node_modules/send/node_modules/destroy/README.md
new file mode 100755
index 00000000..665acb7f
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/destroy/README.md
@@ -0,0 +1,38 @@
+# Destroy
+
+[![NPM version][npm-image]][npm-url]
+[![Build status][travis-image]][travis-url]
+[![Test coverage][coveralls-image]][coveralls-url]
+[![Dependency Status][david-image]][david-url]
+[![License][license-image]][license-url]
+[![Downloads][downloads-image]][downloads-url]
+[![Gittip][gittip-image]][gittip-url]
+
+Destroy a stream.
+
+## API
+
+```js
+var destroy = require('destroy')
+
+var fs = require('fs')
+var stream = fs.createReadStream('package.json')
+destroy(stream)
+```
+
+[npm-image]: https://img.shields.io/npm/v/destroy.svg?style=flat-square
+[npm-url]: https://npmjs.org/package/destroy
+[github-tag]: http://img.shields.io/github/tag/stream-utils/destroy.svg?style=flat-square
+[github-url]: https://github.com/stream-utils/destroy/tags
+[travis-image]: https://img.shields.io/travis/stream-utils/destroy.svg?style=flat-square
+[travis-url]: https://travis-ci.org/stream-utils/destroy
+[coveralls-image]: https://img.shields.io/coveralls/stream-utils/destroy.svg?style=flat-square
+[coveralls-url]: https://coveralls.io/r/stream-utils/destroy?branch=master
+[david-image]: http://img.shields.io/david/stream-utils/destroy.svg?style=flat-square
+[david-url]: https://david-dm.org/stream-utils/destroy
+[license-image]: http://img.shields.io/npm/l/destroy.svg?style=flat-square
+[license-url]: LICENSE.md
+[downloads-image]: http://img.shields.io/npm/dm/destroy.svg?style=flat-square
+[downloads-url]: https://npmjs.org/package/destroy
+[gittip-image]: https://img.shields.io/gittip/jonathanong.svg?style=flat-square
+[gittip-url]: https://www.gittip.com/jonathanong/
diff --git a/server/node_modules/express/node_modules/send/node_modules/destroy/index.js b/server/node_modules/express/node_modules/send/node_modules/destroy/index.js
new file mode 100755
index 00000000..b4552177
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/destroy/index.js
@@ -0,0 +1,36 @@
+var ReadStream = require('fs').ReadStream
+var Stream = require('stream')
+
+module.exports = function destroy(stream) {
+ if (stream instanceof ReadStream) {
+ return destroyReadStream(stream)
+ }
+
+ if (!(stream instanceof Stream)) {
+ return stream
+ }
+
+ if (typeof stream.destroy === 'function') {
+ stream.destroy()
+ }
+
+ return stream
+}
+
+function destroyReadStream(stream) {
+ stream.destroy()
+
+ if (typeof stream.close === 'function') {
+ // node.js core bug work-around
+ stream.on('open', onopenClose)
+ }
+
+ return stream
+}
+
+function onopenClose() {
+ if (typeof this.fd === 'number') {
+ // actually close down the fd
+ this.close()
+ }
+}
diff --git a/server/node_modules/express/node_modules/send/node_modules/destroy/package.json b/server/node_modules/express/node_modules/send/node_modules/destroy/package.json
new file mode 100755
index 00000000..8a58cada
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/destroy/package.json
@@ -0,0 +1,66 @@
+{
+ "name": "destroy",
+ "description": "destroy a stream if possible",
+ "version": "1.0.3",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/stream-utils/destroy"
+ },
+ "devDependencies": {
+ "istanbul": "0",
+ "mocha": "1"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot"
+ },
+ "files": [
+ "index.js"
+ ],
+ "keywords": [
+ "stream",
+ "streams",
+ "destroy",
+ "cleanup",
+ "leak",
+ "fd"
+ ],
+ "gitHead": "50af95ece4a70202f9301bc3edc8f9fdbbad0f26",
+ "bugs": {
+ "url": "https://github.com/stream-utils/destroy/issues"
+ },
+ "homepage": "https://github.com/stream-utils/destroy",
+ "_id": "destroy@1.0.3",
+ "_shasum": "b433b4724e71fd8551d9885174851c5fc377e2c9",
+ "_from": "destroy@1.0.3",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "b433b4724e71fd8551d9885174851c5fc377e2c9",
+ "tarball": "http://registry.npmjs.org/destroy/-/destroy-1.0.3.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/destroy/-/destroy-1.0.3.tgz"
+}
diff --git a/server/node_modules/express/node_modules/send/node_modules/mime/LICENSE b/server/node_modules/express/node_modules/send/node_modules/mime/LICENSE
new file mode 100755
index 00000000..451fc455
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/mime/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2010 Benjamin Thomas, Robert Kieffer
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/send/node_modules/mime/README.md b/server/node_modules/express/node_modules/send/node_modules/mime/README.md
new file mode 100755
index 00000000..6ca19bd1
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/mime/README.md
@@ -0,0 +1,66 @@
+# mime
+
+Comprehensive MIME type mapping API. Includes all 600+ types and 800+ extensions defined by the Apache project, plus additional types submitted by the node.js community.
+
+## Install
+
+Install with [npm](http://github.com/isaacs/npm):
+
+ npm install mime
+
+## API - Queries
+
+### mime.lookup(path)
+Get the mime type associated with a file, if no mime type is found `application/octet-stream` is returned. Performs a case-insensitive lookup using the extension in `path` (the substring after the last '/' or '.'). E.g.
+
+ var mime = require('mime');
+
+ mime.lookup('/path/to/file.txt'); // => 'text/plain'
+ mime.lookup('file.txt'); // => 'text/plain'
+ mime.lookup('.TXT'); // => 'text/plain'
+ mime.lookup('htm'); // => 'text/html'
+
+### mime.default_type
+Sets the mime type returned when `mime.lookup` fails to find the extension searched for. (Default is `application/octet-stream`.)
+
+### mime.extension(type)
+Get the default extension for `type`
+
+ mime.extension('text/html'); // => 'html'
+ mime.extension('application/octet-stream'); // => 'bin'
+
+### mime.charsets.lookup()
+
+Map mime-type to charset
+
+ mime.charsets.lookup('text/plain'); // => 'UTF-8'
+
+(The logic for charset lookups is pretty rudimentary. Feel free to suggest improvements.)
+
+## API - Defining Custom Types
+
+The following APIs allow you to add your own type mappings within your project. If you feel a type should be included as part of node-mime, see [requesting new types](https://github.com/broofa/node-mime/wiki/Requesting-New-Types).
+
+### mime.define()
+
+Add custom mime/extension mappings
+
+ mime.define({
+ 'text/x-some-format': ['x-sf', 'x-sft', 'x-sfml'],
+ 'application/x-my-type': ['x-mt', 'x-mtt'],
+ // etc ...
+ });
+
+ mime.lookup('x-sft'); // => 'text/x-some-format'
+
+The first entry in the extensions array is returned by `mime.extension()`. E.g.
+
+ mime.extension('text/x-some-format'); // => 'x-sf'
+
+### mime.load(filepath)
+
+Load mappings from an Apache ".types" format file
+
+ mime.load('./my_project.types');
+
+The .types file format is simple - See the `types` dir for examples.
diff --git a/server/node_modules/express/node_modules/send/node_modules/mime/mime.js b/server/node_modules/express/node_modules/send/node_modules/mime/mime.js
new file mode 100755
index 00000000..48be0c5e
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/mime/mime.js
@@ -0,0 +1,114 @@
+var path = require('path');
+var fs = require('fs');
+
+function Mime() {
+ // Map of extension -> mime type
+ this.types = Object.create(null);
+
+ // Map of mime type -> extension
+ this.extensions = Object.create(null);
+}
+
+/**
+ * Define mimetype -> extension mappings. Each key is a mime-type that maps
+ * to an array of extensions associated with the type. The first extension is
+ * used as the default extension for the type.
+ *
+ * e.g. mime.define({'audio/ogg', ['oga', 'ogg', 'spx']});
+ *
+ * @param map (Object) type definitions
+ */
+Mime.prototype.define = function (map) {
+ for (var type in map) {
+ var exts = map[type];
+
+ for (var i = 0; i < exts.length; i++) {
+ if (process.env.DEBUG_MIME && this.types[exts]) {
+ console.warn(this._loading.replace(/.*\//, ''), 'changes "' + exts[i] + '" extension type from ' +
+ this.types[exts] + ' to ' + type);
+ }
+
+ this.types[exts[i]] = type;
+ }
+
+ // Default extension is the first one we encounter
+ if (!this.extensions[type]) {
+ this.extensions[type] = exts[0];
+ }
+ }
+};
+
+/**
+ * Load an Apache2-style ".types" file
+ *
+ * This may be called multiple times (it's expected). Where files declare
+ * overlapping types/extensions, the last file wins.
+ *
+ * @param file (String) path of file to load.
+ */
+Mime.prototype.load = function(file) {
+
+ this._loading = file;
+ // Read file and split into lines
+ var map = {},
+ content = fs.readFileSync(file, 'ascii'),
+ lines = content.split(/[\r\n]+/);
+
+ lines.forEach(function(line) {
+ // Clean up whitespace/comments, and split into fields
+ var fields = line.replace(/\s*#.*|^\s*|\s*$/g, '').split(/\s+/);
+ map[fields.shift()] = fields;
+ });
+
+ this.define(map);
+
+ this._loading = null;
+};
+
+/**
+ * Lookup a mime type based on extension
+ */
+Mime.prototype.lookup = function(path, fallback) {
+ var ext = path.replace(/.*[\.\/\\]/, '').toLowerCase();
+
+ return this.types[ext] || fallback || this.default_type;
+};
+
+/**
+ * Return file extension associated with a mime type
+ */
+Mime.prototype.extension = function(mimeType) {
+ var type = mimeType.match(/^\s*([^;\s]*)(?:;|\s|$)/)[1].toLowerCase();
+ return this.extensions[type];
+};
+
+// Default instance
+var mime = new Mime();
+
+// Load local copy of
+// http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types
+mime.load(path.join(__dirname, 'types/mime.types'));
+
+// Load additional types from node.js community
+mime.load(path.join(__dirname, 'types/node.types'));
+
+// Default type
+mime.default_type = mime.lookup('bin');
+
+//
+// Additional API specific to the default instance
+//
+
+mime.Mime = Mime;
+
+/**
+ * Lookup a charset based on mime type.
+ */
+mime.charsets = {
+ lookup: function(mimeType, fallback) {
+ // Assume text types are utf8
+ return (/^text\//).test(mimeType) ? 'UTF-8' : fallback;
+ }
+};
+
+module.exports = mime;
diff --git a/server/node_modules/express/node_modules/send/node_modules/mime/package.json b/server/node_modules/express/node_modules/send/node_modules/mime/package.json
new file mode 100755
index 00000000..3ab7acc4
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/mime/package.json
@@ -0,0 +1,55 @@
+{
+ "author": {
+ "name": "Robert Kieffer",
+ "email": "robert@broofa.com",
+ "url": "http://github.com/broofa"
+ },
+ "contributors": [
+ {
+ "name": "Benjamin Thomas",
+ "email": "benjamin@benjaminthomas.org",
+ "url": "http://github.com/bentomas"
+ }
+ ],
+ "dependencies": {},
+ "description": "A comprehensive library for mime-type mapping",
+ "devDependencies": {},
+ "keywords": [
+ "util",
+ "mime"
+ ],
+ "main": "mime.js",
+ "name": "mime",
+ "repository": {
+ "url": "https://github.com/broofa/node-mime",
+ "type": "git"
+ },
+ "version": "1.2.11",
+ "bugs": {
+ "url": "https://github.com/broofa/node-mime/issues"
+ },
+ "_id": "mime@1.2.11",
+ "dist": {
+ "shasum": "58203eed86e3a5ef17aed2b7d9ebd47f0a60dd10",
+ "tarball": "http://registry.npmjs.org/mime/-/mime-1.2.11.tgz"
+ },
+ "_from": "mime@1.2.11",
+ "_npmVersion": "1.3.6",
+ "_npmUser": {
+ "name": "broofa",
+ "email": "robert@broofa.com"
+ },
+ "maintainers": [
+ {
+ "name": "broofa",
+ "email": "robert@broofa.com"
+ },
+ {
+ "name": "bentomas",
+ "email": "benjamin@benjaminthomas.org"
+ }
+ ],
+ "directories": {},
+ "_shasum": "58203eed86e3a5ef17aed2b7d9ebd47f0a60dd10",
+ "_resolved": "https://registry.npmjs.org/mime/-/mime-1.2.11.tgz"
+}
diff --git a/server/node_modules/express/node_modules/send/node_modules/mime/test.js b/server/node_modules/express/node_modules/send/node_modules/mime/test.js
new file mode 100755
index 00000000..2cda1c7a
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/mime/test.js
@@ -0,0 +1,84 @@
+/**
+ * Usage: node test.js
+ */
+
+var mime = require('./mime');
+var assert = require('assert');
+var path = require('path');
+
+function eq(a, b) {
+ console.log('Test: ' + a + ' === ' + b);
+ assert.strictEqual.apply(null, arguments);
+}
+
+console.log(Object.keys(mime.extensions).length + ' types');
+console.log(Object.keys(mime.types).length + ' extensions\n');
+
+//
+// Test mime lookups
+//
+
+eq('text/plain', mime.lookup('text.txt')); // normal file
+eq('text/plain', mime.lookup('TEXT.TXT')); // uppercase
+eq('text/plain', mime.lookup('dir/text.txt')); // dir + file
+eq('text/plain', mime.lookup('.text.txt')); // hidden file
+eq('text/plain', mime.lookup('.txt')); // nameless
+eq('text/plain', mime.lookup('txt')); // extension-only
+eq('text/plain', mime.lookup('/txt')); // extension-less ()
+eq('text/plain', mime.lookup('\\txt')); // Windows, extension-less
+eq('application/octet-stream', mime.lookup('text.nope')); // unrecognized
+eq('fallback', mime.lookup('text.fallback', 'fallback')); // alternate default
+
+//
+// Test extensions
+//
+
+eq('txt', mime.extension(mime.types.text));
+eq('html', mime.extension(mime.types.htm));
+eq('bin', mime.extension('application/octet-stream'));
+eq('bin', mime.extension('application/octet-stream '));
+eq('html', mime.extension(' text/html; charset=UTF-8'));
+eq('html', mime.extension('text/html; charset=UTF-8 '));
+eq('html', mime.extension('text/html; charset=UTF-8'));
+eq('html', mime.extension('text/html ; charset=UTF-8'));
+eq('html', mime.extension('text/html;charset=UTF-8'));
+eq('html', mime.extension('text/Html;charset=UTF-8'));
+eq(undefined, mime.extension('unrecognized'));
+
+//
+// Test node.types lookups
+//
+
+eq('application/font-woff', mime.lookup('file.woff'));
+eq('application/octet-stream', mime.lookup('file.buffer'));
+eq('audio/mp4', mime.lookup('file.m4a'));
+eq('font/opentype', mime.lookup('file.otf'));
+
+//
+// Test charsets
+//
+
+eq('UTF-8', mime.charsets.lookup('text/plain'));
+eq(undefined, mime.charsets.lookup(mime.types.js));
+eq('fallback', mime.charsets.lookup('application/octet-stream', 'fallback'));
+
+//
+// Test for overlaps between mime.types and node.types
+//
+
+var apacheTypes = new mime.Mime(), nodeTypes = new mime.Mime();
+apacheTypes.load(path.join(__dirname, 'types/mime.types'));
+nodeTypes.load(path.join(__dirname, 'types/node.types'));
+
+var keys = [].concat(Object.keys(apacheTypes.types))
+ .concat(Object.keys(nodeTypes.types));
+keys.sort();
+for (var i = 1; i < keys.length; i++) {
+ if (keys[i] == keys[i-1]) {
+ console.warn('Warning: ' +
+ 'node.types defines ' + keys[i] + '->' + nodeTypes.types[keys[i]] +
+ ', mime.types defines ' + keys[i] + '->' + apacheTypes.types[keys[i]]);
+ }
+}
+
+console.log('\nOK');
diff --git a/server/node_modules/express/node_modules/send/node_modules/mime/types/mime.types b/server/node_modules/express/node_modules/send/node_modules/mime/types/mime.types
new file mode 100755
index 00000000..da8cd691
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/mime/types/mime.types
@@ -0,0 +1,1588 @@
+# This file maps Internet media types to unique file extension(s).
+# Although created for httpd, this file is used by many software systems
+# and has been placed in the public domain for unlimited redisribution.
+#
+# The table below contains both registered and (common) unregistered types.
+# A type that has no unique extension can be ignored -- they are listed
+# here to guide configurations toward known types and to make it easier to
+# identify "new" types. File extensions are also commonly used to indicate
+# content languages and encodings, so choose them carefully.
+#
+# Internet media types should be registered as described in RFC 4288.
+# The registry is at .
+#
+# MIME type (lowercased) Extensions
+# ============================================ ==========
+# application/1d-interleaved-parityfec
+# application/3gpp-ims+xml
+# application/activemessage
+application/andrew-inset ez
+# application/applefile
+application/applixware aw
+application/atom+xml atom
+application/atomcat+xml atomcat
+# application/atomicmail
+application/atomsvc+xml atomsvc
+# application/auth-policy+xml
+# application/batch-smtp
+# application/beep+xml
+# application/calendar+xml
+# application/cals-1840
+# application/ccmp+xml
+application/ccxml+xml ccxml
+application/cdmi-capability cdmia
+application/cdmi-container cdmic
+application/cdmi-domain cdmid
+application/cdmi-object cdmio
+application/cdmi-queue cdmiq
+# application/cea-2018+xml
+# application/cellml+xml
+# application/cfw
+# application/cnrp+xml
+# application/commonground
+# application/conference-info+xml
+# application/cpl+xml
+# application/csta+xml
+# application/cstadata+xml
+application/cu-seeme cu
+# application/cybercash
+application/davmount+xml davmount
+# application/dca-rft
+# application/dec-dx
+# application/dialog-info+xml
+# application/dicom
+# application/dns
+application/docbook+xml dbk
+# application/dskpp+xml
+application/dssc+der dssc
+application/dssc+xml xdssc
+# application/dvcs
+application/ecmascript ecma
+# application/edi-consent
+# application/edi-x12
+# application/edifact
+application/emma+xml emma
+# application/epp+xml
+application/epub+zip epub
+# application/eshop
+# application/example
+application/exi exi
+# application/fastinfoset
+# application/fastsoap
+# application/fits
+application/font-tdpfr pfr
+# application/framework-attributes+xml
+application/gml+xml gml
+application/gpx+xml gpx
+application/gxf gxf
+# application/h224
+# application/held+xml
+# application/http
+application/hyperstudio stk
+# application/ibe-key-request+xml
+# application/ibe-pkg-reply+xml
+# application/ibe-pp-data
+# application/iges
+# application/im-iscomposing+xml
+# application/index
+# application/index.cmd
+# application/index.obj
+# application/index.response
+# application/index.vnd
+application/inkml+xml ink inkml
+# application/iotp
+application/ipfix ipfix
+# application/ipp
+# application/isup
+application/java-archive jar
+application/java-serialized-object ser
+application/java-vm class
+application/javascript js
+application/json json
+application/jsonml+json jsonml
+# application/kpml-request+xml
+# application/kpml-response+xml
+application/lost+xml lostxml
+application/mac-binhex40 hqx
+application/mac-compactpro cpt
+# application/macwriteii
+application/mads+xml mads
+application/marc mrc
+application/marcxml+xml mrcx
+application/mathematica ma nb mb
+# application/mathml-content+xml
+# application/mathml-presentation+xml
+application/mathml+xml mathml
+# application/mbms-associated-procedure-description+xml
+# application/mbms-deregister+xml
+# application/mbms-envelope+xml
+# application/mbms-msk+xml
+# application/mbms-msk-response+xml
+# application/mbms-protection-description+xml
+# application/mbms-reception-report+xml
+# application/mbms-register+xml
+# application/mbms-register-response+xml
+# application/mbms-user-service-description+xml
+application/mbox mbox
+# application/media_control+xml
+application/mediaservercontrol+xml mscml
+application/metalink+xml metalink
+application/metalink4+xml meta4
+application/mets+xml mets
+# application/mikey
+application/mods+xml mods
+# application/moss-keys
+# application/moss-signature
+# application/mosskey-data
+# application/mosskey-request
+application/mp21 m21 mp21
+application/mp4 mp4s
+# application/mpeg4-generic
+# application/mpeg4-iod
+# application/mpeg4-iod-xmt
+# application/msc-ivr+xml
+# application/msc-mixer+xml
+application/msword doc dot
+application/mxf mxf
+# application/nasdata
+# application/news-checkgroups
+# application/news-groupinfo
+# application/news-transmission
+# application/nss
+# application/ocsp-request
+# application/ocsp-response
+application/octet-stream bin dms lrf mar so dist distz pkg bpk dump elc deploy
+application/oda oda
+application/oebps-package+xml opf
+application/ogg ogx
+application/omdoc+xml omdoc
+application/onenote onetoc onetoc2 onetmp onepkg
+application/oxps oxps
+# application/parityfec
+application/patch-ops-error+xml xer
+application/pdf pdf
+application/pgp-encrypted pgp
+# application/pgp-keys
+application/pgp-signature asc sig
+application/pics-rules prf
+# application/pidf+xml
+# application/pidf-diff+xml
+application/pkcs10 p10
+application/pkcs7-mime p7m p7c
+application/pkcs7-signature p7s
+application/pkcs8 p8
+application/pkix-attr-cert ac
+application/pkix-cert cer
+application/pkix-crl crl
+application/pkix-pkipath pkipath
+application/pkixcmp pki
+application/pls+xml pls
+# application/poc-settings+xml
+application/postscript ai eps ps
+# application/prs.alvestrand.titrax-sheet
+application/prs.cww cww
+# application/prs.nprend
+# application/prs.plucker
+# application/prs.rdf-xml-crypt
+# application/prs.xsf+xml
+application/pskc+xml pskcxml
+# application/qsig
+application/rdf+xml rdf
+application/reginfo+xml rif
+application/relax-ng-compact-syntax rnc
+# application/remote-printing
+application/resource-lists+xml rl
+application/resource-lists-diff+xml rld
+# application/riscos
+# application/rlmi+xml
+application/rls-services+xml rs
+application/rpki-ghostbusters gbr
+application/rpki-manifest mft
+application/rpki-roa roa
+# application/rpki-updown
+application/rsd+xml rsd
+application/rss+xml rss
+application/rtf rtf
+# application/rtx
+# application/samlassertion+xml
+# application/samlmetadata+xml
+application/sbml+xml sbml
+application/scvp-cv-request scq
+application/scvp-cv-response scs
+application/scvp-vp-request spq
+application/scvp-vp-response spp
+application/sdp sdp
+# application/set-payment
+application/set-payment-initiation setpay
+# application/set-registration
+application/set-registration-initiation setreg
+# application/sgml
+# application/sgml-open-catalog
+application/shf+xml shf
+# application/sieve
+# application/simple-filter+xml
+# application/simple-message-summary
+# application/simplesymbolcontainer
+# application/slate
+# application/smil
+application/smil+xml smi smil
+# application/soap+fastinfoset
+# application/soap+xml
+application/sparql-query rq
+application/sparql-results+xml srx
+# application/spirits-event+xml
+application/srgs gram
+application/srgs+xml grxml
+application/sru+xml sru
+application/ssdl+xml ssdl
+application/ssml+xml ssml
+# application/tamp-apex-update
+# application/tamp-apex-update-confirm
+# application/tamp-community-update
+# application/tamp-community-update-confirm
+# application/tamp-error
+# application/tamp-sequence-adjust
+# application/tamp-sequence-adjust-confirm
+# application/tamp-status-query
+# application/tamp-status-response
+# application/tamp-update
+# application/tamp-update-confirm
+application/tei+xml tei teicorpus
+application/thraud+xml tfi
+# application/timestamp-query
+# application/timestamp-reply
+application/timestamped-data tsd
+# application/tve-trigger
+# application/ulpfec
+# application/vcard+xml
+# application/vemmi
+# application/vividence.scriptfile
+# application/vnd.3gpp.bsf+xml
+application/vnd.3gpp.pic-bw-large plb
+application/vnd.3gpp.pic-bw-small psb
+application/vnd.3gpp.pic-bw-var pvb
+# application/vnd.3gpp.sms
+# application/vnd.3gpp2.bcmcsinfo+xml
+# application/vnd.3gpp2.sms
+application/vnd.3gpp2.tcap tcap
+application/vnd.3m.post-it-notes pwn
+application/vnd.accpac.simply.aso aso
+application/vnd.accpac.simply.imp imp
+application/vnd.acucobol acu
+application/vnd.acucorp atc acutc
+application/vnd.adobe.air-application-installer-package+zip air
+application/vnd.adobe.formscentral.fcdt fcdt
+application/vnd.adobe.fxp fxp fxpl
+# application/vnd.adobe.partial-upload
+application/vnd.adobe.xdp+xml xdp
+application/vnd.adobe.xfdf xfdf
+# application/vnd.aether.imp
+# application/vnd.ah-barcode
+application/vnd.ahead.space ahead
+application/vnd.airzip.filesecure.azf azf
+application/vnd.airzip.filesecure.azs azs
+application/vnd.amazon.ebook azw
+application/vnd.americandynamics.acc acc
+application/vnd.amiga.ami ami
+# application/vnd.amundsen.maze+xml
+application/vnd.android.package-archive apk
+application/vnd.anser-web-certificate-issue-initiation cii
+application/vnd.anser-web-funds-transfer-initiation fti
+application/vnd.antix.game-component atx
+application/vnd.apple.installer+xml mpkg
+application/vnd.apple.mpegurl m3u8
+# application/vnd.arastra.swi
+application/vnd.aristanetworks.swi swi
+application/vnd.astraea-software.iota iota
+application/vnd.audiograph aep
+# application/vnd.autopackage
+# application/vnd.avistar+xml
+application/vnd.blueice.multipass mpm
+# application/vnd.bluetooth.ep.oob
+application/vnd.bmi bmi
+application/vnd.businessobjects rep
+# application/vnd.cab-jscript
+# application/vnd.canon-cpdl
+# application/vnd.canon-lips
+# application/vnd.cendio.thinlinc.clientconf
+application/vnd.chemdraw+xml cdxml
+application/vnd.chipnuts.karaoke-mmd mmd
+application/vnd.cinderella cdy
+# application/vnd.cirpack.isdn-ext
+application/vnd.claymore cla
+application/vnd.cloanto.rp9 rp9
+application/vnd.clonk.c4group c4g c4d c4f c4p c4u
+application/vnd.cluetrust.cartomobile-config c11amc
+application/vnd.cluetrust.cartomobile-config-pkg c11amz
+# application/vnd.collection+json
+# application/vnd.commerce-battelle
+application/vnd.commonspace csp
+application/vnd.contact.cmsg cdbcmsg
+application/vnd.cosmocaller cmc
+application/vnd.crick.clicker clkx
+application/vnd.crick.clicker.keyboard clkk
+application/vnd.crick.clicker.palette clkp
+application/vnd.crick.clicker.template clkt
+application/vnd.crick.clicker.wordbank clkw
+application/vnd.criticaltools.wbs+xml wbs
+application/vnd.ctc-posml pml
+# application/vnd.ctct.ws+xml
+# application/vnd.cups-pdf
+# application/vnd.cups-postscript
+application/vnd.cups-ppd ppd
+# application/vnd.cups-raster
+# application/vnd.cups-raw
+# application/vnd.curl
+application/vnd.curl.car car
+application/vnd.curl.pcurl pcurl
+# application/vnd.cybank
+application/vnd.dart dart
+application/vnd.data-vision.rdz rdz
+application/vnd.dece.data uvf uvvf uvd uvvd
+application/vnd.dece.ttml+xml uvt uvvt
+application/vnd.dece.unspecified uvx uvvx
+application/vnd.dece.zip uvz uvvz
+application/vnd.denovo.fcselayout-link fe_launch
+# application/vnd.dir-bi.plate-dl-nosuffix
+application/vnd.dna dna
+application/vnd.dolby.mlp mlp
+# application/vnd.dolby.mobile.1
+# application/vnd.dolby.mobile.2
+application/vnd.dpgraph dpg
+application/vnd.dreamfactory dfac
+application/vnd.ds-keypoint kpxx
+application/vnd.dvb.ait ait
+# application/vnd.dvb.dvbj
+# application/vnd.dvb.esgcontainer
+# application/vnd.dvb.ipdcdftnotifaccess
+# application/vnd.dvb.ipdcesgaccess
+# application/vnd.dvb.ipdcesgaccess2
+# application/vnd.dvb.ipdcesgpdd
+# application/vnd.dvb.ipdcroaming
+# application/vnd.dvb.iptv.alfec-base
+# application/vnd.dvb.iptv.alfec-enhancement
+# application/vnd.dvb.notif-aggregate-root+xml
+# application/vnd.dvb.notif-container+xml
+# application/vnd.dvb.notif-generic+xml
+# application/vnd.dvb.notif-ia-msglist+xml
+# application/vnd.dvb.notif-ia-registration-request+xml
+# application/vnd.dvb.notif-ia-registration-response+xml
+# application/vnd.dvb.notif-init+xml
+# application/vnd.dvb.pfr
+application/vnd.dvb.service svc
+# application/vnd.dxr
+application/vnd.dynageo geo
+# application/vnd.easykaraoke.cdgdownload
+# application/vnd.ecdis-update
+application/vnd.ecowin.chart mag
+# application/vnd.ecowin.filerequest
+# application/vnd.ecowin.fileupdate
+# application/vnd.ecowin.series
+# application/vnd.ecowin.seriesrequest
+# application/vnd.ecowin.seriesupdate
+# application/vnd.emclient.accessrequest+xml
+application/vnd.enliven nml
+# application/vnd.eprints.data+xml
+application/vnd.epson.esf esf
+application/vnd.epson.msf msf
+application/vnd.epson.quickanime qam
+application/vnd.epson.salt slt
+application/vnd.epson.ssf ssf
+# application/vnd.ericsson.quickcall
+application/vnd.eszigno3+xml es3 et3
+# application/vnd.etsi.aoc+xml
+# application/vnd.etsi.cug+xml
+# application/vnd.etsi.iptvcommand+xml
+# application/vnd.etsi.iptvdiscovery+xml
+# application/vnd.etsi.iptvprofile+xml
+# application/vnd.etsi.iptvsad-bc+xml
+# application/vnd.etsi.iptvsad-cod+xml
+# application/vnd.etsi.iptvsad-npvr+xml
+# application/vnd.etsi.iptvservice+xml
+# application/vnd.etsi.iptvsync+xml
+# application/vnd.etsi.iptvueprofile+xml
+# application/vnd.etsi.mcid+xml
+# application/vnd.etsi.overload-control-policy-dataset+xml
+# application/vnd.etsi.sci+xml
+# application/vnd.etsi.simservs+xml
+# application/vnd.etsi.tsl+xml
+# application/vnd.etsi.tsl.der
+# application/vnd.eudora.data
+application/vnd.ezpix-album ez2
+application/vnd.ezpix-package ez3
+# application/vnd.f-secure.mobile
+application/vnd.fdf fdf
+application/vnd.fdsn.mseed mseed
+application/vnd.fdsn.seed seed dataless
+# application/vnd.ffsns
+# application/vnd.fints
+application/vnd.flographit gph
+application/vnd.fluxtime.clip ftc
+# application/vnd.font-fontforge-sfd
+application/vnd.framemaker fm frame maker book
+application/vnd.frogans.fnc fnc
+application/vnd.frogans.ltf ltf
+application/vnd.fsc.weblaunch fsc
+application/vnd.fujitsu.oasys oas
+application/vnd.fujitsu.oasys2 oa2
+application/vnd.fujitsu.oasys3 oa3
+application/vnd.fujitsu.oasysgp fg5
+application/vnd.fujitsu.oasysprs bh2
+# application/vnd.fujixerox.art-ex
+# application/vnd.fujixerox.art4
+# application/vnd.fujixerox.hbpl
+application/vnd.fujixerox.ddd ddd
+application/vnd.fujixerox.docuworks xdw
+application/vnd.fujixerox.docuworks.binder xbd
+# application/vnd.fut-misnet
+application/vnd.fuzzysheet fzs
+application/vnd.genomatix.tuxedo txd
+# application/vnd.geocube+xml
+application/vnd.geogebra.file ggb
+application/vnd.geogebra.tool ggt
+application/vnd.geometry-explorer gex gre
+application/vnd.geonext gxt
+application/vnd.geoplan g2w
+application/vnd.geospace g3w
+# application/vnd.globalplatform.card-content-mgt
+# application/vnd.globalplatform.card-content-mgt-response
+application/vnd.gmx gmx
+application/vnd.google-earth.kml+xml kml
+application/vnd.google-earth.kmz kmz
+application/vnd.grafeq gqf gqs
+# application/vnd.gridmp
+application/vnd.groove-account gac
+application/vnd.groove-help ghf
+application/vnd.groove-identity-message gim
+application/vnd.groove-injector grv
+application/vnd.groove-tool-message gtm
+application/vnd.groove-tool-template tpl
+application/vnd.groove-vcard vcg
+# application/vnd.hal+json
+application/vnd.hal+xml hal
+application/vnd.handheld-entertainment+xml zmm
+application/vnd.hbci hbci
+# application/vnd.hcl-bireports
+application/vnd.hhe.lesson-player les
+application/vnd.hp-hpgl hpgl
+application/vnd.hp-hpid hpid
+application/vnd.hp-hps hps
+application/vnd.hp-jlyt jlt
+application/vnd.hp-pcl pcl
+application/vnd.hp-pclxl pclxl
+# application/vnd.httphone
+application/vnd.hydrostatix.sof-data sfd-hdstx
+# application/vnd.hzn-3d-crossword
+# application/vnd.ibm.afplinedata
+# application/vnd.ibm.electronic-media
+application/vnd.ibm.minipay mpy
+application/vnd.ibm.modcap afp listafp list3820
+application/vnd.ibm.rights-management irm
+application/vnd.ibm.secure-container sc
+application/vnd.iccprofile icc icm
+application/vnd.igloader igl
+application/vnd.immervision-ivp ivp
+application/vnd.immervision-ivu ivu
+# application/vnd.informedcontrol.rms+xml
+# application/vnd.informix-visionary
+# application/vnd.infotech.project
+# application/vnd.infotech.project+xml
+# application/vnd.innopath.wamp.notification
+application/vnd.insors.igm igm
+application/vnd.intercon.formnet xpw xpx
+application/vnd.intergeo i2g
+# application/vnd.intertrust.digibox
+# application/vnd.intertrust.nncp
+application/vnd.intu.qbo qbo
+application/vnd.intu.qfx qfx
+# application/vnd.iptc.g2.conceptitem+xml
+# application/vnd.iptc.g2.knowledgeitem+xml
+# application/vnd.iptc.g2.newsitem+xml
+# application/vnd.iptc.g2.newsmessage+xml
+# application/vnd.iptc.g2.packageitem+xml
+# application/vnd.iptc.g2.planningitem+xml
+application/vnd.ipunplugged.rcprofile rcprofile
+application/vnd.irepository.package+xml irp
+application/vnd.is-xpr xpr
+application/vnd.isac.fcs fcs
+application/vnd.jam jam
+# application/vnd.japannet-directory-service
+# application/vnd.japannet-jpnstore-wakeup
+# application/vnd.japannet-payment-wakeup
+# application/vnd.japannet-registration
+# application/vnd.japannet-registration-wakeup
+# application/vnd.japannet-setstore-wakeup
+# application/vnd.japannet-verification
+# application/vnd.japannet-verification-wakeup
+application/vnd.jcp.javame.midlet-rms rms
+application/vnd.jisp jisp
+application/vnd.joost.joda-archive joda
+application/vnd.kahootz ktz ktr
+application/vnd.kde.karbon karbon
+application/vnd.kde.kchart chrt
+application/vnd.kde.kformula kfo
+application/vnd.kde.kivio flw
+application/vnd.kde.kontour kon
+application/vnd.kde.kpresenter kpr kpt
+application/vnd.kde.kspread ksp
+application/vnd.kde.kword kwd kwt
+application/vnd.kenameaapp htke
+application/vnd.kidspiration kia
+application/vnd.kinar kne knp
+application/vnd.koan skp skd skt skm
+application/vnd.kodak-descriptor sse
+application/vnd.las.las+xml lasxml
+# application/vnd.liberty-request+xml
+application/vnd.llamagraphics.life-balance.desktop lbd
+application/vnd.llamagraphics.life-balance.exchange+xml lbe
+application/vnd.lotus-1-2-3 123
+application/vnd.lotus-approach apr
+application/vnd.lotus-freelance pre
+application/vnd.lotus-notes nsf
+application/vnd.lotus-organizer org
+application/vnd.lotus-screencam scm
+application/vnd.lotus-wordpro lwp
+application/vnd.macports.portpkg portpkg
+# application/vnd.marlin.drm.actiontoken+xml
+# application/vnd.marlin.drm.conftoken+xml
+# application/vnd.marlin.drm.license+xml
+# application/vnd.marlin.drm.mdcf
+application/vnd.mcd mcd
+application/vnd.medcalcdata mc1
+application/vnd.mediastation.cdkey cdkey
+# application/vnd.meridian-slingshot
+application/vnd.mfer mwf
+application/vnd.mfmp mfm
+application/vnd.micrografx.flo flo
+application/vnd.micrografx.igx igx
+application/vnd.mif mif
+# application/vnd.minisoft-hp3000-save
+# application/vnd.mitsubishi.misty-guard.trustweb
+application/vnd.mobius.daf daf
+application/vnd.mobius.dis dis
+application/vnd.mobius.mbk mbk
+application/vnd.mobius.mqy mqy
+application/vnd.mobius.msl msl
+application/vnd.mobius.plc plc
+application/vnd.mobius.txf txf
+application/vnd.mophun.application mpn
+application/vnd.mophun.certificate mpc
+# application/vnd.motorola.flexsuite
+# application/vnd.motorola.flexsuite.adsi
+# application/vnd.motorola.flexsuite.fis
+# application/vnd.motorola.flexsuite.gotap
+# application/vnd.motorola.flexsuite.kmr
+# application/vnd.motorola.flexsuite.ttc
+# application/vnd.motorola.flexsuite.wem
+# application/vnd.motorola.iprm
+application/vnd.mozilla.xul+xml xul
+application/vnd.ms-artgalry cil
+# application/vnd.ms-asf
+application/vnd.ms-cab-compressed cab
+# application/vnd.ms-color.iccprofile
+application/vnd.ms-excel xls xlm xla xlc xlt xlw
+application/vnd.ms-excel.addin.macroenabled.12 xlam
+application/vnd.ms-excel.sheet.binary.macroenabled.12 xlsb
+application/vnd.ms-excel.sheet.macroenabled.12 xlsm
+application/vnd.ms-excel.template.macroenabled.12 xltm
+application/vnd.ms-fontobject eot
+application/vnd.ms-htmlhelp chm
+application/vnd.ms-ims ims
+application/vnd.ms-lrm lrm
+# application/vnd.ms-office.activex+xml
+application/vnd.ms-officetheme thmx
+# application/vnd.ms-opentype
+# application/vnd.ms-package.obfuscated-opentype
+application/vnd.ms-pki.seccat cat
+application/vnd.ms-pki.stl stl
+# application/vnd.ms-playready.initiator+xml
+application/vnd.ms-powerpoint ppt pps pot
+application/vnd.ms-powerpoint.addin.macroenabled.12 ppam
+application/vnd.ms-powerpoint.presentation.macroenabled.12 pptm
+application/vnd.ms-powerpoint.slide.macroenabled.12 sldm
+application/vnd.ms-powerpoint.slideshow.macroenabled.12 ppsm
+application/vnd.ms-powerpoint.template.macroenabled.12 potm
+# application/vnd.ms-printing.printticket+xml
+application/vnd.ms-project mpp mpt
+# application/vnd.ms-tnef
+# application/vnd.ms-wmdrm.lic-chlg-req
+# application/vnd.ms-wmdrm.lic-resp
+# application/vnd.ms-wmdrm.meter-chlg-req
+# application/vnd.ms-wmdrm.meter-resp
+application/vnd.ms-word.document.macroenabled.12 docm
+application/vnd.ms-word.template.macroenabled.12 dotm
+application/vnd.ms-works wps wks wcm wdb
+application/vnd.ms-wpl wpl
+application/vnd.ms-xpsdocument xps
+application/vnd.mseq mseq
+# application/vnd.msign
+# application/vnd.multiad.creator
+# application/vnd.multiad.creator.cif
+# application/vnd.music-niff
+application/vnd.musician mus
+application/vnd.muvee.style msty
+application/vnd.mynfc taglet
+# application/vnd.ncd.control
+# application/vnd.ncd.reference
+# application/vnd.nervana
+# application/vnd.netfpx
+application/vnd.neurolanguage.nlu nlu
+application/vnd.nitf ntf nitf
+application/vnd.noblenet-directory nnd
+application/vnd.noblenet-sealer nns
+application/vnd.noblenet-web nnw
+# application/vnd.nokia.catalogs
+# application/vnd.nokia.conml+wbxml
+# application/vnd.nokia.conml+xml
+# application/vnd.nokia.isds-radio-presets
+# application/vnd.nokia.iptv.config+xml
+# application/vnd.nokia.landmark+wbxml
+# application/vnd.nokia.landmark+xml
+# application/vnd.nokia.landmarkcollection+xml
+# application/vnd.nokia.n-gage.ac+xml
+application/vnd.nokia.n-gage.data ngdat
+application/vnd.nokia.n-gage.symbian.install n-gage
+# application/vnd.nokia.ncd
+# application/vnd.nokia.pcd+wbxml
+# application/vnd.nokia.pcd+xml
+application/vnd.nokia.radio-preset rpst
+application/vnd.nokia.radio-presets rpss
+application/vnd.novadigm.edm edm
+application/vnd.novadigm.edx edx
+application/vnd.novadigm.ext ext
+# application/vnd.ntt-local.file-transfer
+# application/vnd.ntt-local.sip-ta_remote
+# application/vnd.ntt-local.sip-ta_tcp_stream
+application/vnd.oasis.opendocument.chart odc
+application/vnd.oasis.opendocument.chart-template otc
+application/vnd.oasis.opendocument.database odb
+application/vnd.oasis.opendocument.formula odf
+application/vnd.oasis.opendocument.formula-template odft
+application/vnd.oasis.opendocument.graphics odg
+application/vnd.oasis.opendocument.graphics-template otg
+application/vnd.oasis.opendocument.image odi
+application/vnd.oasis.opendocument.image-template oti
+application/vnd.oasis.opendocument.presentation odp
+application/vnd.oasis.opendocument.presentation-template otp
+application/vnd.oasis.opendocument.spreadsheet ods
+application/vnd.oasis.opendocument.spreadsheet-template ots
+application/vnd.oasis.opendocument.text odt
+application/vnd.oasis.opendocument.text-master odm
+application/vnd.oasis.opendocument.text-template ott
+application/vnd.oasis.opendocument.text-web oth
+# application/vnd.obn
+# application/vnd.oftn.l10n+json
+# application/vnd.oipf.contentaccessdownload+xml
+# application/vnd.oipf.contentaccessstreaming+xml
+# application/vnd.oipf.cspg-hexbinary
+# application/vnd.oipf.dae.svg+xml
+# application/vnd.oipf.dae.xhtml+xml
+# application/vnd.oipf.mippvcontrolmessage+xml
+# application/vnd.oipf.pae.gem
+# application/vnd.oipf.spdiscovery+xml
+# application/vnd.oipf.spdlist+xml
+# application/vnd.oipf.ueprofile+xml
+# application/vnd.oipf.userprofile+xml
+application/vnd.olpc-sugar xo
+# application/vnd.oma-scws-config
+# application/vnd.oma-scws-http-request
+# application/vnd.oma-scws-http-response
+# application/vnd.oma.bcast.associated-procedure-parameter+xml
+# application/vnd.oma.bcast.drm-trigger+xml
+# application/vnd.oma.bcast.imd+xml
+# application/vnd.oma.bcast.ltkm
+# application/vnd.oma.bcast.notification+xml
+# application/vnd.oma.bcast.provisioningtrigger
+# application/vnd.oma.bcast.sgboot
+# application/vnd.oma.bcast.sgdd+xml
+# application/vnd.oma.bcast.sgdu
+# application/vnd.oma.bcast.simple-symbol-container
+# application/vnd.oma.bcast.smartcard-trigger+xml
+# application/vnd.oma.bcast.sprov+xml
+# application/vnd.oma.bcast.stkm
+# application/vnd.oma.cab-address-book+xml
+# application/vnd.oma.cab-feature-handler+xml
+# application/vnd.oma.cab-pcc+xml
+# application/vnd.oma.cab-user-prefs+xml
+# application/vnd.oma.dcd
+# application/vnd.oma.dcdc
+application/vnd.oma.dd2+xml dd2
+# application/vnd.oma.drm.risd+xml
+# application/vnd.oma.group-usage-list+xml
+# application/vnd.oma.pal+xml
+# application/vnd.oma.poc.detailed-progress-report+xml
+# application/vnd.oma.poc.final-report+xml
+# application/vnd.oma.poc.groups+xml
+# application/vnd.oma.poc.invocation-descriptor+xml
+# application/vnd.oma.poc.optimized-progress-report+xml
+# application/vnd.oma.push
+# application/vnd.oma.scidm.messages+xml
+# application/vnd.oma.xcap-directory+xml
+# application/vnd.omads-email+xml
+# application/vnd.omads-file+xml
+# application/vnd.omads-folder+xml
+# application/vnd.omaloc-supl-init
+application/vnd.openofficeorg.extension oxt
+# application/vnd.openxmlformats-officedocument.custom-properties+xml
+# application/vnd.openxmlformats-officedocument.customxmlproperties+xml
+# application/vnd.openxmlformats-officedocument.drawing+xml
+# application/vnd.openxmlformats-officedocument.drawingml.chart+xml
+# application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml
+# application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml
+# application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml
+# application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml
+# application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml
+# application/vnd.openxmlformats-officedocument.extended-properties+xml
+# application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml
+# application/vnd.openxmlformats-officedocument.presentationml.comments+xml
+# application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml
+# application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml
+# application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml
+application/vnd.openxmlformats-officedocument.presentationml.presentation pptx
+# application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml
+# application/vnd.openxmlformats-officedocument.presentationml.presprops+xml
+application/vnd.openxmlformats-officedocument.presentationml.slide sldx
+# application/vnd.openxmlformats-officedocument.presentationml.slide+xml
+# application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml
+# application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml
+application/vnd.openxmlformats-officedocument.presentationml.slideshow ppsx
+# application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml
+# application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml
+# application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml
+# application/vnd.openxmlformats-officedocument.presentationml.tags+xml
+application/vnd.openxmlformats-officedocument.presentationml.template potx
+# application/vnd.openxmlformats-officedocument.presentationml.template.main+xml
+# application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml
+application/vnd.openxmlformats-officedocument.spreadsheetml.sheet xlsx
+# application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml
+application/vnd.openxmlformats-officedocument.spreadsheetml.template xltx
+# application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml
+# application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml
+# application/vnd.openxmlformats-officedocument.theme+xml
+# application/vnd.openxmlformats-officedocument.themeoverride+xml
+# application/vnd.openxmlformats-officedocument.vmldrawing
+# application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml
+application/vnd.openxmlformats-officedocument.wordprocessingml.document docx
+# application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml
+application/vnd.openxmlformats-officedocument.wordprocessingml.template dotx
+# application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml
+# application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml
+# application/vnd.openxmlformats-package.core-properties+xml
+# application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml
+# application/vnd.openxmlformats-package.relationships+xml
+# application/vnd.quobject-quoxdocument
+# application/vnd.osa.netdeploy
+application/vnd.osgeo.mapguide.package mgp
+# application/vnd.osgi.bundle
+application/vnd.osgi.dp dp
+application/vnd.osgi.subsystem esa
+# application/vnd.otps.ct-kip+xml
+application/vnd.palm pdb pqa oprc
+# application/vnd.paos.xml
+application/vnd.pawaafile paw
+application/vnd.pg.format str
+application/vnd.pg.osasli ei6
+# application/vnd.piaccess.application-licence
+application/vnd.picsel efif
+application/vnd.pmi.widget wg
+# application/vnd.poc.group-advertisement+xml
+application/vnd.pocketlearn plf
+application/vnd.powerbuilder6 pbd
+# application/vnd.powerbuilder6-s
+# application/vnd.powerbuilder7
+# application/vnd.powerbuilder7-s
+# application/vnd.powerbuilder75
+# application/vnd.powerbuilder75-s
+# application/vnd.preminet
+application/vnd.previewsystems.box box
+application/vnd.proteus.magazine mgz
+application/vnd.publishare-delta-tree qps
+application/vnd.pvi.ptid1 ptid
+# application/vnd.pwg-multiplexed
+# application/vnd.pwg-xhtml-print+xml
+# application/vnd.qualcomm.brew-app-res
+application/vnd.quark.quarkxpress qxd qxt qwd qwt qxl qxb
+# application/vnd.radisys.moml+xml
+# application/vnd.radisys.msml+xml
+# application/vnd.radisys.msml-audit+xml
+# application/vnd.radisys.msml-audit-conf+xml
+# application/vnd.radisys.msml-audit-conn+xml
+# application/vnd.radisys.msml-audit-dialog+xml
+# application/vnd.radisys.msml-audit-stream+xml
+# application/vnd.radisys.msml-conf+xml
+# application/vnd.radisys.msml-dialog+xml
+# application/vnd.radisys.msml-dialog-base+xml
+# application/vnd.radisys.msml-dialog-fax-detect+xml
+# application/vnd.radisys.msml-dialog-fax-sendrecv+xml
+# application/vnd.radisys.msml-dialog-group+xml
+# application/vnd.radisys.msml-dialog-speech+xml
+# application/vnd.radisys.msml-dialog-transform+xml
+# application/vnd.rainstor.data
+# application/vnd.rapid
+application/vnd.realvnc.bed bed
+application/vnd.recordare.musicxml mxl
+application/vnd.recordare.musicxml+xml musicxml
+# application/vnd.renlearn.rlprint
+application/vnd.rig.cryptonote cryptonote
+application/vnd.rim.cod cod
+application/vnd.rn-realmedia rm
+application/vnd.rn-realmedia-vbr rmvb
+application/vnd.route66.link66+xml link66
+# application/vnd.rs-274x
+# application/vnd.ruckus.download
+# application/vnd.s3sms
+application/vnd.sailingtracker.track st
+# application/vnd.sbm.cid
+# application/vnd.sbm.mid2
+# application/vnd.scribus
+# application/vnd.sealed.3df
+# application/vnd.sealed.csf
+# application/vnd.sealed.doc
+# application/vnd.sealed.eml
+# application/vnd.sealed.mht
+# application/vnd.sealed.net
+# application/vnd.sealed.ppt
+# application/vnd.sealed.tiff
+# application/vnd.sealed.xls
+# application/vnd.sealedmedia.softseal.html
+# application/vnd.sealedmedia.softseal.pdf
+application/vnd.seemail see
+application/vnd.sema sema
+application/vnd.semd semd
+application/vnd.semf semf
+application/vnd.shana.informed.formdata ifm
+application/vnd.shana.informed.formtemplate itp
+application/vnd.shana.informed.interchange iif
+application/vnd.shana.informed.package ipk
+application/vnd.simtech-mindmapper twd twds
+application/vnd.smaf mmf
+# application/vnd.smart.notebook
+application/vnd.smart.teacher teacher
+# application/vnd.software602.filler.form+xml
+# application/vnd.software602.filler.form-xml-zip
+application/vnd.solent.sdkm+xml sdkm sdkd
+application/vnd.spotfire.dxp dxp
+application/vnd.spotfire.sfs sfs
+# application/vnd.sss-cod
+# application/vnd.sss-dtf
+# application/vnd.sss-ntf
+application/vnd.stardivision.calc sdc
+application/vnd.stardivision.draw sda
+application/vnd.stardivision.impress sdd
+application/vnd.stardivision.math smf
+application/vnd.stardivision.writer sdw vor
+application/vnd.stardivision.writer-global sgl
+application/vnd.stepmania.package smzip
+application/vnd.stepmania.stepchart sm
+# application/vnd.street-stream
+application/vnd.sun.xml.calc sxc
+application/vnd.sun.xml.calc.template stc
+application/vnd.sun.xml.draw sxd
+application/vnd.sun.xml.draw.template std
+application/vnd.sun.xml.impress sxi
+application/vnd.sun.xml.impress.template sti
+application/vnd.sun.xml.math sxm
+application/vnd.sun.xml.writer sxw
+application/vnd.sun.xml.writer.global sxg
+application/vnd.sun.xml.writer.template stw
+# application/vnd.sun.wadl+xml
+application/vnd.sus-calendar sus susp
+application/vnd.svd svd
+# application/vnd.swiftview-ics
+application/vnd.symbian.install sis sisx
+application/vnd.syncml+xml xsm
+application/vnd.syncml.dm+wbxml bdm
+application/vnd.syncml.dm+xml xdm
+# application/vnd.syncml.dm.notification
+# application/vnd.syncml.ds.notification
+application/vnd.tao.intent-module-archive tao
+application/vnd.tcpdump.pcap pcap cap dmp
+application/vnd.tmobile-livetv tmo
+application/vnd.trid.tpt tpt
+application/vnd.triscape.mxs mxs
+application/vnd.trueapp tra
+# application/vnd.truedoc
+# application/vnd.ubisoft.webplayer
+application/vnd.ufdl ufd ufdl
+application/vnd.uiq.theme utz
+application/vnd.umajin umj
+application/vnd.unity unityweb
+application/vnd.uoml+xml uoml
+# application/vnd.uplanet.alert
+# application/vnd.uplanet.alert-wbxml
+# application/vnd.uplanet.bearer-choice
+# application/vnd.uplanet.bearer-choice-wbxml
+# application/vnd.uplanet.cacheop
+# application/vnd.uplanet.cacheop-wbxml
+# application/vnd.uplanet.channel
+# application/vnd.uplanet.channel-wbxml
+# application/vnd.uplanet.list
+# application/vnd.uplanet.list-wbxml
+# application/vnd.uplanet.listcmd
+# application/vnd.uplanet.listcmd-wbxml
+# application/vnd.uplanet.signal
+application/vnd.vcx vcx
+# application/vnd.vd-study
+# application/vnd.vectorworks
+# application/vnd.verimatrix.vcas
+# application/vnd.vidsoft.vidconference
+application/vnd.visio vsd vst vss vsw
+application/vnd.visionary vis
+# application/vnd.vividence.scriptfile
+application/vnd.vsf vsf
+# application/vnd.wap.sic
+# application/vnd.wap.slc
+application/vnd.wap.wbxml wbxml
+application/vnd.wap.wmlc wmlc
+application/vnd.wap.wmlscriptc wmlsc
+application/vnd.webturbo wtb
+# application/vnd.wfa.wsc
+# application/vnd.wmc
+# application/vnd.wmf.bootstrap
+# application/vnd.wolfram.mathematica
+# application/vnd.wolfram.mathematica.package
+application/vnd.wolfram.player nbp
+application/vnd.wordperfect wpd
+application/vnd.wqd wqd
+# application/vnd.wrq-hp3000-labelled
+application/vnd.wt.stf stf
+# application/vnd.wv.csp+wbxml
+# application/vnd.wv.csp+xml
+# application/vnd.wv.ssp+xml
+application/vnd.xara xar
+application/vnd.xfdl xfdl
+# application/vnd.xfdl.webform
+# application/vnd.xmi+xml
+# application/vnd.xmpie.cpkg
+# application/vnd.xmpie.dpkg
+# application/vnd.xmpie.plan
+# application/vnd.xmpie.ppkg
+# application/vnd.xmpie.xlim
+application/vnd.yamaha.hv-dic hvd
+application/vnd.yamaha.hv-script hvs
+application/vnd.yamaha.hv-voice hvp
+application/vnd.yamaha.openscoreformat osf
+application/vnd.yamaha.openscoreformat.osfpvg+xml osfpvg
+# application/vnd.yamaha.remote-setup
+application/vnd.yamaha.smaf-audio saf
+application/vnd.yamaha.smaf-phrase spf
+# application/vnd.yamaha.through-ngn
+# application/vnd.yamaha.tunnel-udpencap
+application/vnd.yellowriver-custom-menu cmp
+application/vnd.zul zir zirz
+application/vnd.zzazz.deck+xml zaz
+application/voicexml+xml vxml
+# application/vq-rtcpxr
+# application/watcherinfo+xml
+# application/whoispp-query
+# application/whoispp-response
+application/widget wgt
+application/winhlp hlp
+# application/wita
+# application/wordperfect5.1
+application/wsdl+xml wsdl
+application/wspolicy+xml wspolicy
+application/x-7z-compressed 7z
+application/x-abiword abw
+application/x-ace-compressed ace
+# application/x-amf
+application/x-apple-diskimage dmg
+application/x-authorware-bin aab x32 u32 vox
+application/x-authorware-map aam
+application/x-authorware-seg aas
+application/x-bcpio bcpio
+application/x-bittorrent torrent
+application/x-blorb blb blorb
+application/x-bzip bz
+application/x-bzip2 bz2 boz
+application/x-cbr cbr cba cbt cbz cb7
+application/x-cdlink vcd
+application/x-cfs-compressed cfs
+application/x-chat chat
+application/x-chess-pgn pgn
+application/x-conference nsc
+# application/x-compress
+application/x-cpio cpio
+application/x-csh csh
+application/x-debian-package deb udeb
+application/x-dgc-compressed dgc
+application/x-director dir dcr dxr cst cct cxt w3d fgd swa
+application/x-doom wad
+application/x-dtbncx+xml ncx
+application/x-dtbook+xml dtb
+application/x-dtbresource+xml res
+application/x-dvi dvi
+application/x-envoy evy
+application/x-eva eva
+application/x-font-bdf bdf
+# application/x-font-dos
+# application/x-font-framemaker
+application/x-font-ghostscript gsf
+# application/x-font-libgrx
+application/x-font-linux-psf psf
+application/x-font-otf otf
+application/x-font-pcf pcf
+application/x-font-snf snf
+# application/x-font-speedo
+# application/x-font-sunos-news
+application/x-font-ttf ttf ttc
+application/x-font-type1 pfa pfb pfm afm
+application/font-woff woff
+# application/x-font-vfont
+application/x-freearc arc
+application/x-futuresplash spl
+application/x-gca-compressed gca
+application/x-glulx ulx
+application/x-gnumeric gnumeric
+application/x-gramps-xml gramps
+application/x-gtar gtar
+# application/x-gzip
+application/x-hdf hdf
+application/x-install-instructions install
+application/x-iso9660-image iso
+application/x-java-jnlp-file jnlp
+application/x-latex latex
+application/x-lzh-compressed lzh lha
+application/x-mie mie
+application/x-mobipocket-ebook prc mobi
+application/x-ms-application application
+application/x-ms-shortcut lnk
+application/x-ms-wmd wmd
+application/x-ms-wmz wmz
+application/x-ms-xbap xbap
+application/x-msaccess mdb
+application/x-msbinder obd
+application/x-mscardfile crd
+application/x-msclip clp
+application/x-msdownload exe dll com bat msi
+application/x-msmediaview mvb m13 m14
+application/x-msmetafile wmf wmz emf emz
+application/x-msmoney mny
+application/x-mspublisher pub
+application/x-msschedule scd
+application/x-msterminal trm
+application/x-mswrite wri
+application/x-netcdf nc cdf
+application/x-nzb nzb
+application/x-pkcs12 p12 pfx
+application/x-pkcs7-certificates p7b spc
+application/x-pkcs7-certreqresp p7r
+application/x-rar-compressed rar
+application/x-research-info-systems ris
+application/x-sh sh
+application/x-shar shar
+application/x-shockwave-flash swf
+application/x-silverlight-app xap
+application/x-sql sql
+application/x-stuffit sit
+application/x-stuffitx sitx
+application/x-subrip srt
+application/x-sv4cpio sv4cpio
+application/x-sv4crc sv4crc
+application/x-t3vm-image t3
+application/x-tads gam
+application/x-tar tar
+application/x-tcl tcl
+application/x-tex tex
+application/x-tex-tfm tfm
+application/x-texinfo texinfo texi
+application/x-tgif obj
+application/x-ustar ustar
+application/x-wais-source src
+application/x-x509-ca-cert der crt
+application/x-xfig fig
+application/x-xliff+xml xlf
+application/x-xpinstall xpi
+application/x-xz xz
+application/x-zmachine z1 z2 z3 z4 z5 z6 z7 z8
+# application/x400-bp
+application/xaml+xml xaml
+# application/xcap-att+xml
+# application/xcap-caps+xml
+application/xcap-diff+xml xdf
+# application/xcap-el+xml
+# application/xcap-error+xml
+# application/xcap-ns+xml
+# application/xcon-conference-info-diff+xml
+# application/xcon-conference-info+xml
+application/xenc+xml xenc
+application/xhtml+xml xhtml xht
+# application/xhtml-voice+xml
+application/xml xml xsl
+application/xml-dtd dtd
+# application/xml-external-parsed-entity
+# application/xmpp+xml
+application/xop+xml xop
+application/xproc+xml xpl
+application/xslt+xml xslt
+application/xspf+xml xspf
+application/xv+xml mxml xhvml xvml xvm
+application/yang yang
+application/yin+xml yin
+application/zip zip
+# audio/1d-interleaved-parityfec
+# audio/32kadpcm
+# audio/3gpp
+# audio/3gpp2
+# audio/ac3
+audio/adpcm adp
+# audio/amr
+# audio/amr-wb
+# audio/amr-wb+
+# audio/asc
+# audio/atrac-advanced-lossless
+# audio/atrac-x
+# audio/atrac3
+audio/basic au snd
+# audio/bv16
+# audio/bv32
+# audio/clearmode
+# audio/cn
+# audio/dat12
+# audio/dls
+# audio/dsr-es201108
+# audio/dsr-es202050
+# audio/dsr-es202211
+# audio/dsr-es202212
+# audio/dv
+# audio/dvi4
+# audio/eac3
+# audio/evrc
+# audio/evrc-qcp
+# audio/evrc0
+# audio/evrc1
+# audio/evrcb
+# audio/evrcb0
+# audio/evrcb1
+# audio/evrcwb
+# audio/evrcwb0
+# audio/evrcwb1
+# audio/example
+# audio/fwdred
+# audio/g719
+# audio/g722
+# audio/g7221
+# audio/g723
+# audio/g726-16
+# audio/g726-24
+# audio/g726-32
+# audio/g726-40
+# audio/g728
+# audio/g729
+# audio/g7291
+# audio/g729d
+# audio/g729e
+# audio/gsm
+# audio/gsm-efr
+# audio/gsm-hr-08
+# audio/ilbc
+# audio/ip-mr_v2.5
+# audio/isac
+# audio/l16
+# audio/l20
+# audio/l24
+# audio/l8
+# audio/lpc
+audio/midi mid midi kar rmi
+# audio/mobile-xmf
+audio/mp4 mp4a
+# audio/mp4a-latm
+# audio/mpa
+# audio/mpa-robust
+audio/mpeg mpga mp2 mp2a mp3 m2a m3a
+# audio/mpeg4-generic
+# audio/musepack
+audio/ogg oga ogg spx
+# audio/opus
+# audio/parityfec
+# audio/pcma
+# audio/pcma-wb
+# audio/pcmu-wb
+# audio/pcmu
+# audio/prs.sid
+# audio/qcelp
+# audio/red
+# audio/rtp-enc-aescm128
+# audio/rtp-midi
+# audio/rtx
+audio/s3m s3m
+audio/silk sil
+# audio/smv
+# audio/smv0
+# audio/smv-qcp
+# audio/sp-midi
+# audio/speex
+# audio/t140c
+# audio/t38
+# audio/telephone-event
+# audio/tone
+# audio/uemclip
+# audio/ulpfec
+# audio/vdvi
+# audio/vmr-wb
+# audio/vnd.3gpp.iufp
+# audio/vnd.4sb
+# audio/vnd.audiokoz
+# audio/vnd.celp
+# audio/vnd.cisco.nse
+# audio/vnd.cmles.radio-events
+# audio/vnd.cns.anp1
+# audio/vnd.cns.inf1
+audio/vnd.dece.audio uva uvva
+audio/vnd.digital-winds eol
+# audio/vnd.dlna.adts
+# audio/vnd.dolby.heaac.1
+# audio/vnd.dolby.heaac.2
+# audio/vnd.dolby.mlp
+# audio/vnd.dolby.mps
+# audio/vnd.dolby.pl2
+# audio/vnd.dolby.pl2x
+# audio/vnd.dolby.pl2z
+# audio/vnd.dolby.pulse.1
+audio/vnd.dra dra
+audio/vnd.dts dts
+audio/vnd.dts.hd dtshd
+# audio/vnd.dvb.file
+# audio/vnd.everad.plj
+# audio/vnd.hns.audio
+audio/vnd.lucent.voice lvp
+audio/vnd.ms-playready.media.pya pya
+# audio/vnd.nokia.mobile-xmf
+# audio/vnd.nortel.vbk
+audio/vnd.nuera.ecelp4800 ecelp4800
+audio/vnd.nuera.ecelp7470 ecelp7470
+audio/vnd.nuera.ecelp9600 ecelp9600
+# audio/vnd.octel.sbc
+# audio/vnd.qcelp
+# audio/vnd.rhetorex.32kadpcm
+audio/vnd.rip rip
+# audio/vnd.sealedmedia.softseal.mpeg
+# audio/vnd.vmx.cvsd
+# audio/vorbis
+# audio/vorbis-config
+audio/webm weba
+audio/x-aac aac
+audio/x-aiff aif aiff aifc
+audio/x-caf caf
+audio/x-flac flac
+audio/x-matroska mka
+audio/x-mpegurl m3u
+audio/x-ms-wax wax
+audio/x-ms-wma wma
+audio/x-pn-realaudio ram ra
+audio/x-pn-realaudio-plugin rmp
+# audio/x-tta
+audio/x-wav wav
+audio/xm xm
+chemical/x-cdx cdx
+chemical/x-cif cif
+chemical/x-cmdf cmdf
+chemical/x-cml cml
+chemical/x-csml csml
+# chemical/x-pdb
+chemical/x-xyz xyz
+image/bmp bmp
+image/cgm cgm
+# image/example
+# image/fits
+image/g3fax g3
+image/gif gif
+image/ief ief
+# image/jp2
+image/jpeg jpeg jpg jpe
+# image/jpm
+# image/jpx
+image/ktx ktx
+# image/naplps
+image/png png
+image/prs.btif btif
+# image/prs.pti
+image/sgi sgi
+image/svg+xml svg svgz
+# image/t38
+image/tiff tiff tif
+# image/tiff-fx
+image/vnd.adobe.photoshop psd
+# image/vnd.cns.inf2
+image/vnd.dece.graphic uvi uvvi uvg uvvg
+image/vnd.dvb.subtitle sub
+image/vnd.djvu djvu djv
+image/vnd.dwg dwg
+image/vnd.dxf dxf
+image/vnd.fastbidsheet fbs
+image/vnd.fpx fpx
+image/vnd.fst fst
+image/vnd.fujixerox.edmics-mmr mmr
+image/vnd.fujixerox.edmics-rlc rlc
+# image/vnd.globalgraphics.pgb
+# image/vnd.microsoft.icon
+# image/vnd.mix
+image/vnd.ms-modi mdi
+image/vnd.ms-photo wdp
+image/vnd.net-fpx npx
+# image/vnd.radiance
+# image/vnd.sealed.png
+# image/vnd.sealedmedia.softseal.gif
+# image/vnd.sealedmedia.softseal.jpg
+# image/vnd.svf
+image/vnd.wap.wbmp wbmp
+image/vnd.xiff xif
+image/webp webp
+image/x-3ds 3ds
+image/x-cmu-raster ras
+image/x-cmx cmx
+image/x-freehand fh fhc fh4 fh5 fh7
+image/x-icon ico
+image/x-mrsid-image sid
+image/x-pcx pcx
+image/x-pict pic pct
+image/x-portable-anymap pnm
+image/x-portable-bitmap pbm
+image/x-portable-graymap pgm
+image/x-portable-pixmap ppm
+image/x-rgb rgb
+image/x-tga tga
+image/x-xbitmap xbm
+image/x-xpixmap xpm
+image/x-xwindowdump xwd
+# message/cpim
+# message/delivery-status
+# message/disposition-notification
+# message/example
+# message/external-body
+# message/feedback-report
+# message/global
+# message/global-delivery-status
+# message/global-disposition-notification
+# message/global-headers
+# message/http
+# message/imdn+xml
+# message/news
+# message/partial
+message/rfc822 eml mime
+# message/s-http
+# message/sip
+# message/sipfrag
+# message/tracking-status
+# message/vnd.si.simp
+# model/example
+model/iges igs iges
+model/mesh msh mesh silo
+model/vnd.collada+xml dae
+model/vnd.dwf dwf
+# model/vnd.flatland.3dml
+model/vnd.gdl gdl
+# model/vnd.gs-gdl
+# model/vnd.gs.gdl
+model/vnd.gtw gtw
+# model/vnd.moml+xml
+model/vnd.mts mts
+# model/vnd.parasolid.transmit.binary
+# model/vnd.parasolid.transmit.text
+model/vnd.vtu vtu
+model/vrml wrl vrml
+model/x3d+binary x3db x3dbz
+model/x3d+vrml x3dv x3dvz
+model/x3d+xml x3d x3dz
+# multipart/alternative
+# multipart/appledouble
+# multipart/byteranges
+# multipart/digest
+# multipart/encrypted
+# multipart/example
+# multipart/form-data
+# multipart/header-set
+# multipart/mixed
+# multipart/parallel
+# multipart/related
+# multipart/report
+# multipart/signed
+# multipart/voice-message
+# text/1d-interleaved-parityfec
+text/cache-manifest appcache
+text/calendar ics ifb
+text/css css
+text/csv csv
+# text/directory
+# text/dns
+# text/ecmascript
+# text/enriched
+# text/example
+# text/fwdred
+text/html html htm
+# text/javascript
+text/n3 n3
+# text/parityfec
+text/plain txt text conf def list log in
+# text/prs.fallenstein.rst
+text/prs.lines.tag dsc
+# text/vnd.radisys.msml-basic-layout
+# text/red
+# text/rfc822-headers
+text/richtext rtx
+# text/rtf
+# text/rtp-enc-aescm128
+# text/rtx
+text/sgml sgml sgm
+# text/t140
+text/tab-separated-values tsv
+text/troff t tr roff man me ms
+text/turtle ttl
+# text/ulpfec
+text/uri-list uri uris urls
+text/vcard vcard
+# text/vnd.abc
+text/vnd.curl curl
+text/vnd.curl.dcurl dcurl
+text/vnd.curl.scurl scurl
+text/vnd.curl.mcurl mcurl
+# text/vnd.dmclientscript
+text/vnd.dvb.subtitle sub
+# text/vnd.esmertec.theme-descriptor
+text/vnd.fly fly
+text/vnd.fmi.flexstor flx
+text/vnd.graphviz gv
+text/vnd.in3d.3dml 3dml
+text/vnd.in3d.spot spot
+# text/vnd.iptc.newsml
+# text/vnd.iptc.nitf
+# text/vnd.latex-z
+# text/vnd.motorola.reflex
+# text/vnd.ms-mediapackage
+# text/vnd.net2phone.commcenter.command
+# text/vnd.si.uricatalogue
+text/vnd.sun.j2me.app-descriptor jad
+# text/vnd.trolltech.linguist
+# text/vnd.wap.si
+# text/vnd.wap.sl
+text/vnd.wap.wml wml
+text/vnd.wap.wmlscript wmls
+text/x-asm s asm
+text/x-c c cc cxx cpp h hh dic
+text/x-fortran f for f77 f90
+text/x-java-source java
+text/x-opml opml
+text/x-pascal p pas
+text/x-nfo nfo
+text/x-setext etx
+text/x-sfv sfv
+text/x-uuencode uu
+text/x-vcalendar vcs
+text/x-vcard vcf
+# text/xml
+# text/xml-external-parsed-entity
+# video/1d-interleaved-parityfec
+video/3gpp 3gp
+# video/3gpp-tt
+video/3gpp2 3g2
+# video/bmpeg
+# video/bt656
+# video/celb
+# video/dv
+# video/example
+video/h261 h261
+video/h263 h263
+# video/h263-1998
+# video/h263-2000
+video/h264 h264
+# video/h264-rcdo
+# video/h264-svc
+video/jpeg jpgv
+# video/jpeg2000
+video/jpm jpm jpgm
+video/mj2 mj2 mjp2
+# video/mp1s
+# video/mp2p
+# video/mp2t
+video/mp4 mp4 mp4v mpg4
+# video/mp4v-es
+video/mpeg mpeg mpg mpe m1v m2v
+# video/mpeg4-generic
+# video/mpv
+# video/nv
+video/ogg ogv
+# video/parityfec
+# video/pointer
+video/quicktime qt mov
+# video/raw
+# video/rtp-enc-aescm128
+# video/rtx
+# video/smpte292m
+# video/ulpfec
+# video/vc1
+# video/vnd.cctv
+video/vnd.dece.hd uvh uvvh
+video/vnd.dece.mobile uvm uvvm
+# video/vnd.dece.mp4
+video/vnd.dece.pd uvp uvvp
+video/vnd.dece.sd uvs uvvs
+video/vnd.dece.video uvv uvvv
+# video/vnd.directv.mpeg
+# video/vnd.directv.mpeg-tts
+# video/vnd.dlna.mpeg-tts
+video/vnd.dvb.file dvb
+video/vnd.fvt fvt
+# video/vnd.hns.video
+# video/vnd.iptvforum.1dparityfec-1010
+# video/vnd.iptvforum.1dparityfec-2005
+# video/vnd.iptvforum.2dparityfec-1010
+# video/vnd.iptvforum.2dparityfec-2005
+# video/vnd.iptvforum.ttsavc
+# video/vnd.iptvforum.ttsmpeg2
+# video/vnd.motorola.video
+# video/vnd.motorola.videop
+video/vnd.mpegurl mxu m4u
+video/vnd.ms-playready.media.pyv pyv
+# video/vnd.nokia.interleaved-multimedia
+# video/vnd.nokia.videovoip
+# video/vnd.objectvideo
+# video/vnd.sealed.mpeg1
+# video/vnd.sealed.mpeg4
+# video/vnd.sealed.swf
+# video/vnd.sealedmedia.softseal.mov
+video/vnd.uvvu.mp4 uvu uvvu
+video/vnd.vivo viv
+video/webm webm
+video/x-f4v f4v
+video/x-fli fli
+video/x-flv flv
+video/x-m4v m4v
+video/x-matroska mkv mk3d mks
+video/x-mng mng
+video/x-ms-asf asf asx
+video/x-ms-vob vob
+video/x-ms-wm wm
+video/x-ms-wmv wmv
+video/x-ms-wmx wmx
+video/x-ms-wvx wvx
+video/x-msvideo avi
+video/x-sgi-movie movie
+video/x-smv smv
+x-conference/x-cooltalk ice
diff --git a/server/node_modules/express/node_modules/send/node_modules/mime/types/node.types b/server/node_modules/express/node_modules/send/node_modules/mime/types/node.types
new file mode 100755
index 00000000..55b2cf79
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/mime/types/node.types
@@ -0,0 +1,77 @@
+# What: WebVTT
+# Why: To allow formats intended for marking up external text track resources.
+# http://dev.w3.org/html5/webvtt/
+# Added by: niftylettuce
+text/vtt vtt
+
+# What: Google Chrome Extension
+# Why: To allow apps to (work) be served with the right content type header.
+# http://codereview.chromium.org/2830017
+# Added by: niftylettuce
+application/x-chrome-extension crx
+
+# What: HTC support
+# Why: To properly render .htc files such as CSS3PIE
+# Added by: niftylettuce
+text/x-component htc
+
+# What: HTML5 application cache manifes ('.manifest' extension)
+# Why: De-facto standard. Required by Mozilla browser when serving HTML5 apps
+# per https://developer.mozilla.org/en/offline_resources_in_firefox
+# Added by: louisremi
+text/cache-manifest manifest
+
+# What: node binary buffer format
+# Why: semi-standard extension w/in the node community
+# Added by: tootallnate
+application/octet-stream buffer
+
+# What: The "protected" MP-4 formats used by iTunes.
+# Why: Required for streaming music to browsers (?)
+# Added by: broofa
+application/mp4 m4p
+audio/mp4 m4a
+
+# What: Video format, Part of RFC1890
+# Why: See https://github.com/bentomas/node-mime/pull/6
+# Added by: mjrusso
+video/MP2T ts
+
+# What: EventSource mime type
+# Why: mime type of Server-Sent Events stream
+# http://www.w3.org/TR/eventsource/#text-event-stream
+# Added by: francois2metz
+text/event-stream event-stream
+
+# What: Mozilla App manifest mime type
+# Why: https://developer.mozilla.org/en/Apps/Manifest#Serving_manifests
+# Added by: ednapiranha
+application/x-web-app-manifest+json webapp
+
+# What: Lua file types
+# Why: Googling around shows de-facto consensus on these
+# Added by: creationix (Issue #45)
+text/x-lua lua
+application/x-lua-bytecode luac
+
+# What: Markdown files, as per http://daringfireball.net/projects/markdown/syntax
+# Why: http://stackoverflow.com/questions/10701983/what-is-the-mime-type-for-markdown
+# Added by: avoidwork
+text/x-markdown markdown md mkd
+
+# What: ini files
+# Why: because they're just text files
+# Added by: Matthew Kastor
+text/plain ini
+
+# What: DASH Adaptive Streaming manifest
+# Why: https://developer.mozilla.org/en-US/docs/DASH_Adaptive_Streaming_for_HTML_5_Video
+# Added by: eelcocramer
+application/dash+xml mdp
+
+# What: OpenType font files - http://www.microsoft.com/typography/otspec/
+# Why: Browsers usually ignore the font MIME types and sniff the content,
+# but Chrome, shows a warning if OpenType fonts aren't served with
+# the `font/opentype` MIME type: http://i.imgur.com/8c5RN8M.png.
+# Added by: alrra
+font/opentype otf
diff --git a/server/node_modules/express/node_modules/send/node_modules/ms/.npmignore b/server/node_modules/express/node_modules/send/node_modules/ms/.npmignore
new file mode 100755
index 00000000..d1aa0ce4
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/ms/.npmignore
@@ -0,0 +1,5 @@
+node_modules
+test
+History.md
+Makefile
+component.json
diff --git a/server/node_modules/express/node_modules/send/node_modules/ms/README.md b/server/node_modules/express/node_modules/send/node_modules/ms/README.md
new file mode 100755
index 00000000..d4ab12a7
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/ms/README.md
@@ -0,0 +1,33 @@
+# ms.js: miliseconds conversion utility
+
+```js
+ms('1d') // 86400000
+ms('10h') // 36000000
+ms('2h') // 7200000
+ms('1m') // 60000
+ms('5s') // 5000
+ms('100') // 100
+```
+
+```js
+ms(60000) // "1m"
+ms(2 * 60000) // "2m"
+ms(ms('10 hours')) // "10h"
+```
+
+```js
+ms(60000, { long: true }) // "1 minute"
+ms(2 * 60000, { long: true }) // "2 minutes"
+ms(ms('10 hours', { long: true })) // "10 hours"
+```
+
+- Node/Browser compatible. Published as `ms` in NPM.
+- If a number is supplied to `ms`, a string with a unit is returned.
+- If a string that contains the number is supplied, it returns it as
+a number (e.g: it returns `100` for `'100'`).
+- If you pass a string with a number and a valid unit, the number of
+equivalent ms is returned.
+
+## License
+
+MIT
\ No newline at end of file
diff --git a/server/node_modules/express/node_modules/send/node_modules/ms/index.js b/server/node_modules/express/node_modules/send/node_modules/ms/index.js
new file mode 100755
index 00000000..c5847f8d
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/ms/index.js
@@ -0,0 +1,111 @@
+/**
+ * Helpers.
+ */
+
+var s = 1000;
+var m = s * 60;
+var h = m * 60;
+var d = h * 24;
+var y = d * 365.25;
+
+/**
+ * Parse or format the given `val`.
+ *
+ * Options:
+ *
+ * - `long` verbose formatting [false]
+ *
+ * @param {String|Number} val
+ * @param {Object} options
+ * @return {String|Number}
+ * @api public
+ */
+
+module.exports = function(val, options){
+ options = options || {};
+ if ('string' == typeof val) return parse(val);
+ return options.long
+ ? long(val)
+ : short(val);
+};
+
+/**
+ * Parse the given `str` and return milliseconds.
+ *
+ * @param {String} str
+ * @return {Number}
+ * @api private
+ */
+
+function parse(str) {
+ var match = /^((?:\d+)?\.?\d+) *(ms|seconds?|s|minutes?|m|hours?|h|days?|d|years?|y)?$/i.exec(str);
+ if (!match) return;
+ var n = parseFloat(match[1]);
+ var type = (match[2] || 'ms').toLowerCase();
+ switch (type) {
+ case 'years':
+ case 'year':
+ case 'y':
+ return n * y;
+ case 'days':
+ case 'day':
+ case 'd':
+ return n * d;
+ case 'hours':
+ case 'hour':
+ case 'h':
+ return n * h;
+ case 'minutes':
+ case 'minute':
+ case 'm':
+ return n * m;
+ case 'seconds':
+ case 'second':
+ case 's':
+ return n * s;
+ case 'ms':
+ return n;
+ }
+}
+
+/**
+ * Short format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function short(ms) {
+ if (ms >= d) return Math.round(ms / d) + 'd';
+ if (ms >= h) return Math.round(ms / h) + 'h';
+ if (ms >= m) return Math.round(ms / m) + 'm';
+ if (ms >= s) return Math.round(ms / s) + 's';
+ return ms + 'ms';
+}
+
+/**
+ * Long format for `ms`.
+ *
+ * @param {Number} ms
+ * @return {String}
+ * @api private
+ */
+
+function long(ms) {
+ return plural(ms, d, 'day')
+ || plural(ms, h, 'hour')
+ || plural(ms, m, 'minute')
+ || plural(ms, s, 'second')
+ || ms + ' ms';
+}
+
+/**
+ * Pluralization helper.
+ */
+
+function plural(ms, n, name) {
+ if (ms < n) return;
+ if (ms < n * 1.5) return Math.floor(ms / n) + ' ' + name;
+ return Math.ceil(ms / n) + ' ' + name + 's';
+}
diff --git a/server/node_modules/express/node_modules/send/node_modules/ms/package.json b/server/node_modules/express/node_modules/send/node_modules/ms/package.json
new file mode 100755
index 00000000..83344111
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/node_modules/ms/package.json
@@ -0,0 +1,43 @@
+{
+ "name": "ms",
+ "version": "0.6.2",
+ "description": "Tiny ms conversion utility",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/guille/ms.js.git"
+ },
+ "main": "./index",
+ "devDependencies": {
+ "mocha": "*",
+ "expect.js": "*",
+ "serve": "*"
+ },
+ "component": {
+ "scripts": {
+ "ms/index.js": "index.js"
+ }
+ },
+ "bugs": {
+ "url": "https://github.com/guille/ms.js/issues"
+ },
+ "_id": "ms@0.6.2",
+ "dist": {
+ "shasum": "d89c2124c6fdc1353d65a8b77bf1aac4b193708c",
+ "tarball": "http://registry.npmjs.org/ms/-/ms-0.6.2.tgz"
+ },
+ "_from": "ms@0.6.2",
+ "_npmVersion": "1.2.30",
+ "_npmUser": {
+ "name": "rauchg",
+ "email": "rauchg@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "rauchg",
+ "email": "rauchg@gmail.com"
+ }
+ ],
+ "directories": {},
+ "_shasum": "d89c2124c6fdc1353d65a8b77bf1aac4b193708c",
+ "_resolved": "https://registry.npmjs.org/ms/-/ms-0.6.2.tgz"
+}
diff --git a/server/node_modules/express/node_modules/send/package.json b/server/node_modules/express/node_modules/send/package.json
new file mode 100755
index 00000000..de43e7df
--- /dev/null
+++ b/server/node_modules/express/node_modules/send/package.json
@@ -0,0 +1,85 @@
+{
+ "name": "send",
+ "description": "Better streaming static file server with Range and conditional-GET support",
+ "version": "0.10.1",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/tj/send"
+ },
+ "keywords": [
+ "static",
+ "file",
+ "server"
+ ],
+ "dependencies": {
+ "debug": "~2.1.0",
+ "depd": "~1.0.0",
+ "destroy": "1.0.3",
+ "escape-html": "1.0.1",
+ "etag": "~1.5.0",
+ "fresh": "0.2.4",
+ "mime": "1.2.11",
+ "ms": "0.6.2",
+ "on-finished": "~2.1.1",
+ "range-parser": "~1.0.2"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.2",
+ "mocha": "~2.0.0",
+ "should": "~4.1.0",
+ "supertest": "~0.14.0"
+ },
+ "files": [
+ "History.md",
+ "LICENSE",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8.0"
+ },
+ "scripts": {
+ "test": "mocha --check-leaks --reporter spec --bail",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --check-leaks --reporter dot",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --check-leaks --reporter spec"
+ },
+ "gitHead": "a5e6237f3e812a99d079e2100f6294251ef5f465",
+ "bugs": {
+ "url": "https://github.com/tj/send/issues"
+ },
+ "homepage": "https://github.com/tj/send",
+ "_id": "send@0.10.1",
+ "_shasum": "7745c50ec72f115115980e8fb179aec01900e08a",
+ "_from": "send@0.10.1",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "7745c50ec72f115115980e8fb179aec01900e08a",
+ "tarball": "http://registry.npmjs.org/send/-/send-0.10.1.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/send/-/send-0.10.1.tgz"
+}
diff --git a/server/node_modules/express/node_modules/serve-static/HISTORY.md b/server/node_modules/express/node_modules/serve-static/HISTORY.md
new file mode 100755
index 00000000..768d8f2c
--- /dev/null
+++ b/server/node_modules/express/node_modules/serve-static/HISTORY.md
@@ -0,0 +1,206 @@
+1.7.2 / 2015-01-02
+==================
+
+ * Fix potential open redirect when mounted at root
+
+1.7.1 / 2014-10-22
+==================
+
+ * deps: send@0.10.1
+ - deps: on-finished@~2.1.1
+
+1.7.0 / 2014-10-15
+==================
+
+ * deps: send@0.10.0
+ - deps: debug@~2.1.0
+ - deps: depd@~1.0.0
+ - deps: etag@~1.5.0
+
+1.6.4 / 2014-10-08
+==================
+
+ * Fix redirect loop when index file serving disabled
+
+1.6.3 / 2014-09-24
+==================
+
+ * deps: send@0.9.3
+ - deps: etag@~1.4.0
+
+1.6.2 / 2014-09-15
+==================
+
+ * deps: send@0.9.2
+ - deps: depd@0.4.5
+ - deps: etag@~1.3.1
+ - deps: range-parser@~1.0.2
+
+1.6.1 / 2014-09-07
+==================
+
+ * deps: send@0.9.1
+ - deps: fresh@0.2.4
+
+1.6.0 / 2014-09-07
+==================
+
+ * deps: send@0.9.0
+ - Add `lastModified` option
+ - Use `etag` to generate `ETag` header
+ - deps: debug@~2.0.0
+
+1.5.4 / 2014-09-04
+==================
+
+ * deps: send@0.8.5
+ - Fix a path traversal issue when using `root`
+ - Fix malicious path detection for empty string path
+
+1.5.3 / 2014-08-17
+==================
+
+ * deps: send@0.8.3
+
+1.5.2 / 2014-08-14
+==================
+
+ * deps: send@0.8.2
+ - Work around `fd` leak in Node.js 0.10 for `fs.ReadStream`
+
+1.5.1 / 2014-08-09
+==================
+
+ * Fix parsing of weird `req.originalUrl` values
+ * deps: parseurl@~1.3.0
+ * deps: utils-merge@1.0.0
+
+1.5.0 / 2014-08-05
+==================
+
+ * deps: send@0.8.1
+ - Add `extensions` option
+
+1.4.4 / 2014-08-04
+==================
+
+ * deps: send@0.7.4
+ - Fix serving index files without root dir
+
+1.4.3 / 2014-07-29
+==================
+
+ * deps: send@0.7.3
+ - Fix incorrect 403 on Windows and Node.js 0.11
+
+1.4.2 / 2014-07-27
+==================
+
+ * deps: send@0.7.2
+ - deps: depd@0.4.4
+
+1.4.1 / 2014-07-26
+==================
+
+ * deps: send@0.7.1
+ - deps: depd@0.4.3
+
+1.4.0 / 2014-07-21
+==================
+
+ * deps: parseurl@~1.2.0
+ - Cache URLs based on original value
+ - Remove no-longer-needed URL mis-parse work-around
+ - Simplify the "fast-path" `RegExp`
+ * deps: send@0.7.0
+ - Add `dotfiles` option
+ - deps: debug@1.0.4
+ - deps: depd@0.4.2
+
+1.3.2 / 2014-07-11
+==================
+
+ * deps: send@0.6.0
+ - Cap `maxAge` value to 1 year
+ - deps: debug@1.0.3
+
+1.3.1 / 2014-07-09
+==================
+
+ * deps: parseurl@~1.1.3
+ - faster parsing of href-only URLs
+
+1.3.0 / 2014-06-28
+==================
+
+ * Add `setHeaders` option
+ * Include HTML link in redirect response
+ * deps: send@0.5.0
+ - Accept string for `maxAge` (converted by `ms`)
+
+1.2.3 / 2014-06-11
+==================
+
+ * deps: send@0.4.3
+ - Do not throw un-catchable error on file open race condition
+ - Use `escape-html` for HTML escaping
+ - deps: debug@1.0.2
+ - deps: finished@1.2.2
+ - deps: fresh@0.2.2
+
+1.2.2 / 2014-06-09
+==================
+
+ * deps: send@0.4.2
+ - fix "event emitter leak" warnings
+ - deps: debug@1.0.1
+ - deps: finished@1.2.1
+
+1.2.1 / 2014-06-02
+==================
+
+ * use `escape-html` for escaping
+ * deps: send@0.4.1
+ - Send `max-age` in `Cache-Control` in correct format
+
+1.2.0 / 2014-05-29
+==================
+
+ * deps: send@0.4.0
+ - Calculate ETag with md5 for reduced collisions
+ - Fix wrong behavior when index file matches directory
+ - Ignore stream errors after request ends
+ - Skip directories in index file search
+ - deps: debug@0.8.1
+
+1.1.0 / 2014-04-24
+==================
+
+ * Accept options directly to `send` module
+ * deps: send@0.3.0
+
+1.0.4 / 2014-04-07
+==================
+
+ * Resolve relative paths at middleware setup
+ * Use parseurl to parse the URL from request
+
+1.0.3 / 2014-03-20
+==================
+
+ * Do not rely on connect-like environments
+
+1.0.2 / 2014-03-06
+==================
+
+ * deps: send@0.2.0
+
+1.0.1 / 2014-03-05
+==================
+
+ * Add mime export for back-compat
+
+1.0.0 / 2014-03-05
+==================
+
+ * Genesis from `connect`
diff --git a/server/node_modules/express/node_modules/serve-static/LICENSE b/server/node_modules/express/node_modules/serve-static/LICENSE
new file mode 100755
index 00000000..b7bc0852
--- /dev/null
+++ b/server/node_modules/express/node_modules/serve-static/LICENSE
@@ -0,0 +1,25 @@
+(The MIT License)
+
+Copyright (c) 2010 Sencha Inc.
+Copyright (c) 2011 LearnBoost
+Copyright (c) 2011 TJ Holowaychuk
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/serve-static/README.md b/server/node_modules/express/node_modules/serve-static/README.md
new file mode 100755
index 00000000..7d952310
--- /dev/null
+++ b/server/node_modules/express/node_modules/serve-static/README.md
@@ -0,0 +1,165 @@
+# serve-static
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+[![Gratipay][gratipay-image]][gratipay-url]
+
+## Install
+
+```sh
+$ npm install serve-static
+```
+
+## API
+
+```js
+var serveStatic = require('serve-static')
+```
+
+### serveStatic(root, options)
+
+Create a new middleware function to serve files from within a given root
+directory. The file to serve will be determined by combining `req.url`
+with the provided root directory. When a file is not found, instead of
+sending a 404 response, this module will instead call `next()` to move on
+to the next middleware, allowing for stacking and fall-backs.
+
+#### Options
+
+##### dotfiles
+
+ Set how "dotfiles" are treated when encountered. A dotfile is a file
+or directory that begins with a dot ("."). Note this check is done on
+the path itself without checking if the path actually exists on the
+disk. If `root` is specified, only the dotfiles above the root are
+checked (i.e. the root itself can be within a dotfile when when set
+to "deny").
+
+The default value is `'ignore'`.
+
+ - `'allow'` No special treatment for dotfiles.
+ - `'deny'` Send a 403 for any request for a dotfile.
+ - `'ignore'` Pretend like the dotfile does not exist and call `next()`.
+
+##### etag
+
+Enable or disable etag generation, defaults to true.
+
+##### extensions
+
+Set file extension fallbacks. When set, if a file is not found, the given
+extensions will be added to the file name and search for. The first that
+exists will be served. Example: `['html', 'htm']`.
+
+The default value is `false`.
+
+##### index
+
+By default this module will send "index.html" files in response to a request
+on a directory. To disable this set `false` or to supply a new index pass a
+string or an array in preferred order.
+
+##### lastModified
+
+Enable or disable `Last-Modified` header, defaults to true. Uses the file
+system's last modified value.
+
+##### maxAge
+
+Provide a max-age in milliseconds for http caching, defaults to 0. This
+can also be a string accepted by the [ms](https://www.npmjs.org/package/ms#readme)
+module.
+
+##### redirect
+
+Redirect to trailing "/" when the pathname is a dir. Defaults to `true`.
+
+##### setHeaders
+
+Function to set custom headers on response. Alterations to the headers need to
+occur synchronously. The function is called as `fn(res, path, stat)`, where
+the arguments are:
+
+ - `res` the response object
+ - `path` the file path that is being sent
+ - `stat` the stat object of the file that is being sent
+
+## Examples
+
+### Serve files with vanilla node.js http server
+
+```js
+var finalhandler = require('finalhandler')
+var http = require('http')
+var serveStatic = require('serve-static')
+
+// Serve up public/ftp folder
+var serve = serveStatic('public/ftp', {'index': ['index.html', 'index.htm']})
+
+// Create server
+var server = http.createServer(function(req, res){
+ var done = finalhandler(req, res)
+ serve(req, res, done)
+})
+
+// Listen
+server.listen(3000)
+```
+
+### Serve all files as downloads
+
+```js
+var contentDisposition = require('content-disposition')
+var finalhandler = require('finalhandler')
+var http = require('http')
+var serveStatic = require('serve-static')
+
+// Serve up public/ftp folder
+var serve = serveStatic('public/ftp', {
+ 'index': false,
+ 'setHeaders': setHeaders
+})
+
+// Set header to force download
+function setHeaders(res, path) {
+ res.setHeader('Content-Disposition', contentDisposition(path))
+}
+
+// Create server
+var server = http.createServer(function(req, res){
+ var done = finalhandler(req, res)
+ serve(req, res, done)
+})
+
+// Listen
+server.listen(3000)
+```
+
+### Serving using express
+
+```js
+var connect = require('connect')
+var serveStatic = require('serve-static')
+
+var app = connect()
+
+app.use(serveStatic('public/ftp', {'index': ['default.html', 'default.htm']}))
+app.listen(3000)
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/serve-static.svg?style=flat
+[npm-url]: https://npmjs.org/package/serve-static
+[travis-image]: https://img.shields.io/travis/expressjs/serve-static.svg?style=flat
+[travis-url]: https://travis-ci.org/expressjs/serve-static
+[coveralls-image]: https://img.shields.io/coveralls/expressjs/serve-static.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/expressjs/serve-static
+[downloads-image]: https://img.shields.io/npm/dm/serve-static.svg?style=flat
+[downloads-url]: https://npmjs.org/package/serve-static
+[gratipay-image]: https://img.shields.io/gratipay/dougwilson.svg?style=flat
+[gratipay-url]: https://gratipay.com/dougwilson/
diff --git a/server/node_modules/express/node_modules/serve-static/index.js b/server/node_modules/express/node_modules/serve-static/index.js
new file mode 100755
index 00000000..fbe044cf
--- /dev/null
+++ b/server/node_modules/express/node_modules/serve-static/index.js
@@ -0,0 +1,137 @@
+/*!
+ * serve-static
+ * Copyright(c) 2010 Sencha Inc.
+ * Copyright(c) 2011 TJ Holowaychuk
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var escapeHtml = require('escape-html');
+var merge = require('utils-merge');
+var parseurl = require('parseurl');
+var resolve = require('path').resolve;
+var send = require('send');
+var url = require('url');
+
+/**
+ * @param {String} root
+ * @param {Object} options
+ * @return {Function}
+ * @api public
+ */
+
+exports = module.exports = function serveStatic(root, options) {
+ if (!root) {
+ throw new TypeError('root path required')
+ }
+
+ if (typeof root !== 'string') {
+ throw new TypeError('root path must be a string')
+ }
+
+ // copy options object
+ options = merge({}, options)
+
+ // resolve root to absolute
+ root = resolve(root)
+
+ // default redirect
+ var redirect = options.redirect !== false
+
+ // headers listener
+ var setHeaders = options.setHeaders
+ delete options.setHeaders
+
+ if (setHeaders && typeof setHeaders !== 'function') {
+ throw new TypeError('option setHeaders must be function')
+ }
+
+ // setup options for send
+ options.maxage = options.maxage || options.maxAge || 0
+ options.root = root
+
+ return function serveStatic(req, res, next) {
+ if (req.method !== 'GET' && req.method !== 'HEAD') {
+ return next()
+ }
+
+ var opts = merge({}, options)
+ var originalUrl = parseurl.original(req)
+ var path = parseurl(req).pathname
+ var hasTrailingSlash = originalUrl.pathname[originalUrl.pathname.length - 1] === '/'
+
+ if (path === '/' && !hasTrailingSlash) {
+ // make sure redirect occurs at mount
+ path = ''
+ }
+
+ // create send stream
+ var stream = send(req, path, opts)
+
+ if (redirect) {
+ // redirect relative to originalUrl
+ stream.on('directory', function redirect() {
+ if (hasTrailingSlash) {
+ return next()
+ }
+
+ // append trailing slash
+ originalUrl.pathname = collapseLeadingSlashes(originalUrl.pathname + '/')
+
+ // reformat the URL
+ var target = url.format(originalUrl)
+
+ // send redirect response
+ res.statusCode = 303
+ res.setHeader('Content-Type', 'text/html; charset=utf-8')
+ res.setHeader('Location', target)
+ res.end('Redirecting to ' + escapeHtml(target) + '\n')
+ })
+ } else {
+ // forward to next middleware on directory
+ stream.on('directory', next)
+ }
+
+ // add headers listener
+ if (setHeaders) {
+ stream.on('headers', setHeaders)
+ }
+
+ // forward non-404 errors
+ stream.on('error', function error(err) {
+ next(err.status === 404 ? null : err)
+ })
+
+ // pipe
+ stream.pipe(res)
+ }
+}
+
+/**
+ * Expose mime module.
+ *
+ * If you wish to extend the mime table use this
+ * reference to the "mime" module in the npm registry.
+ */
+
+exports.mime = send.mime
+
+/**
+ * Collapse all leading slashes into a single slash
+ * @private
+ */
+function collapseLeadingSlashes(str) {
+ for (var i = 0; i < str.length; i++) {
+ if (str[i] !== '/') {
+ break
+ }
+ }
+
+ return i > 1
+ ? '/' + str.substr(i)
+ : str
+}
diff --git a/server/node_modules/express/node_modules/serve-static/package.json b/server/node_modules/express/node_modules/serve-static/package.json
new file mode 100755
index 00000000..ec2aabcb
--- /dev/null
+++ b/server/node_modules/express/node_modules/serve-static/package.json
@@ -0,0 +1,83 @@
+{
+ "name": "serve-static",
+ "description": "Serve static files",
+ "version": "1.7.2",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/expressjs/serve-static"
+ },
+ "dependencies": {
+ "escape-html": "1.0.1",
+ "parseurl": "~1.3.0",
+ "send": "0.10.1",
+ "utils-merge": "1.0.0"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.5",
+ "mocha": "~2.1.0",
+ "supertest": "~0.15.0"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.8.0"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "40f88bd0269cd4f4ffcb52bded570ad57e4b56ba",
+ "bugs": {
+ "url": "https://github.com/expressjs/serve-static/issues"
+ },
+ "homepage": "https://github.com/expressjs/serve-static",
+ "_id": "serve-static@1.7.2",
+ "_shasum": "3164ce06d4e6c3459bdcc9d6018fb4fb35e84b39",
+ "_from": "serve-static@~1.7.1",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "mscdex",
+ "email": "mscdex@mscdex.net"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "3164ce06d4e6c3459bdcc9d6018fb4fb35e84b39",
+ "tarball": "http://registry.npmjs.org/serve-static/-/serve-static-1.7.2.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/serve-static/-/serve-static-1.7.2.tgz"
+}
diff --git a/server/node_modules/express/node_modules/type-is/HISTORY.md b/server/node_modules/express/node_modules/type-is/HISTORY.md
new file mode 100755
index 00000000..e3cab75a
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/HISTORY.md
@@ -0,0 +1,115 @@
+1.5.7 / 2015-02-09
+==================
+
+ * fix argument reassignment
+ * deps: mime-types@~2.0.9
+ - Add new mime types
+
+1.5.6 / 2015-01-29
+==================
+
+ * deps: mime-types@~2.0.8
+ - Add new mime types
+
+1.5.5 / 2014-12-30
+==================
+
+ * deps: mime-types@~2.0.7
+ - Add new mime types
+ - Fix missing extensions
+ - Fix various invalid MIME type entries
+ - Remove example template MIME types
+ - deps: mime-db@~1.5.0
+
+1.5.4 / 2014-12-10
+==================
+
+ * deps: mime-types@~2.0.4
+ - Add new mime types
+ - deps: mime-db@~1.3.0
+
+1.5.3 / 2014-11-09
+==================
+
+ * deps: mime-types@~2.0.3
+ - Add new mime types
+ - deps: mime-db@~1.2.0
+
+1.5.2 / 2014-09-28
+==================
+
+ * deps: mime-types@~2.0.2
+ - Add new mime types
+ - deps: mime-db@~1.1.0
+
+1.5.1 / 2014-09-07
+==================
+
+ * Support Node.js 0.6
+ * deps: media-typer@0.3.0
+ * deps: mime-types@~2.0.1
+ - Support Node.js 0.6
+
+1.5.0 / 2014-09-05
+==================
+
+ * fix `hasbody` to be true for `content-length: 0`
+
+1.4.0 / 2014-09-02
+==================
+
+ * update mime-types
+
+1.3.2 / 2014-06-24
+==================
+
+ * use `~` range on mime-types
+
+1.3.1 / 2014-06-19
+==================
+
+ * fix global variable leak
+
+1.3.0 / 2014-06-19
+==================
+
+ * improve type parsing
+
+ - invalid media type never matches
+ - media type not case-sensitive
+ - extra LWS does not affect results
+
+1.2.2 / 2014-06-19
+==================
+
+ * fix behavior on unknown type argument
+
+1.2.1 / 2014-06-03
+==================
+
+ * switch dependency from `mime` to `mime-types@1.0.0`
+
+1.2.0 / 2014-05-11
+==================
+
+ * support suffix matching:
+
+ - `+json` matches `application/vnd+json`
+ - `*/vnd+json` matches `application/vnd+json`
+ - `application/*+json` matches `application/vnd+json`
+
+1.1.0 / 2014-04-12
+==================
+
+ * add non-array values support
+ * expose internal utilities:
+
+ - `.is()`
+ - `.hasBody()`
+ - `.normalize()`
+ - `.match()`
+
+1.0.1 / 2014-03-30
+==================
+
+ * add `multipart` as a shorthand
diff --git a/server/node_modules/express/node_modules/type-is/LICENSE b/server/node_modules/express/node_modules/type-is/LICENSE
new file mode 100755
index 00000000..4164d08a
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/type-is/README.md b/server/node_modules/express/node_modules/type-is/README.md
new file mode 100755
index 00000000..0beeed81
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/README.md
@@ -0,0 +1,117 @@
+# type-is
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+Infer the content-type of a request.
+
+### Install
+
+```sh
+$ npm install type-is
+```
+
+## API
+
+```js
+var http = require('http')
+var is = require('type-is')
+
+http.createServer(function (req, res) {
+ var istext = is(req, ['text/*'])
+ res.end('you ' + (istext ? 'sent' : 'did not send') + ' me text')
+})
+```
+
+### type = is(request, types)
+
+`request` is the node HTTP request. `types` is an array of types.
+
+```js
+// req.headers.content-type = 'application/json'
+
+is(req, ['json']) // 'json'
+is(req, ['html', 'json']) // 'json'
+is(req, ['application/*']) // 'application/json'
+is(req, ['application/json']) // 'application/json'
+
+is(req, ['html']) // false
+```
+
+### type = is.is(mediaType, types)
+
+`mediaType` is the [media type](https://tools.ietf.org/html/rfc6838) string. `types` is an array of types.
+
+```js
+var mediaType = 'application/json'
+
+is.is(mediaType, ['json']) // 'json'
+is.is(mediaType, ['html', 'json']) // 'json'
+is.is(mediaType, ['application/*']) // 'application/json'
+is.is(mediaType, ['application/json']) // 'application/json'
+
+is.is(mediaType, ['html']) // false
+```
+
+### Each type can be:
+
+- An extension name such as `json`. This name will be returned if matched.
+- A mime type such as `application/json`.
+- A mime type with a wildcard such as `*/json` or `application/*`. The full mime type will be returned if matched
+- A suffix such as `+json`. This can be combined with a wildcard such as `*/vnd+json` or `application/*+json`. The full mime type will be returned if matched.
+
+`false` will be returned if no type matches.
+
+`null` will be returned if the request does not have a body.
+
+## Examples
+
+#### Example body parser
+
+```js
+var is = require('type-is');
+
+function bodyParser(req, res, next) {
+ if (!is.hasBody(req)) {
+ return next()
+ }
+
+ switch (is(req, ['urlencoded', 'json', 'multipart'])) {
+ case 'urlencoded':
+ // parse urlencoded body
+ throw new Error('implement urlencoded body parsing')
+ break
+ case 'json':
+ // parse json body
+ throw new Error('implement json body parsing')
+ break
+ case 'multipart':
+ // parse multipart body
+ throw new Error('implement multipart body parsing')
+ break
+ default:
+ // 415 error code
+ res.statusCode = 415
+ res.end()
+ return
+ }
+}
+```
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/type-is.svg?style=flat
+[npm-url]: https://npmjs.org/package/type-is
+[node-version-image]: https://img.shields.io/node/v/type-is.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/type-is.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/type-is
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/type-is.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/type-is?branch=master
+[downloads-image]: https://img.shields.io/npm/dm/type-is.svg?style=flat
+[downloads-url]: https://npmjs.org/package/type-is
diff --git a/server/node_modules/express/node_modules/type-is/index.js b/server/node_modules/express/node_modules/type-is/index.js
new file mode 100755
index 00000000..73e885ae
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/index.js
@@ -0,0 +1,228 @@
+
+var typer = require('media-typer')
+var mime = require('mime-types')
+
+module.exports = typeofrequest;
+typeofrequest.is = typeis;
+typeofrequest.hasBody = hasbody;
+typeofrequest.normalize = normalize;
+typeofrequest.match = mimeMatch;
+
+/**
+ * Compare a `value` content-type with `types`.
+ * Each `type` can be an extension like `html`,
+ * a special shortcut like `multipart` or `urlencoded`,
+ * or a mime type.
+ *
+ * If no types match, `false` is returned.
+ * Otherwise, the first `type` that matches is returned.
+ *
+ * @param {String} value
+ * @param {Array} types
+ * @return String
+ */
+
+function typeis(value, types_) {
+ var i
+ var types = types_
+
+ // remove parameters and normalize
+ var val = typenormalize(value)
+
+ // no type or invalid
+ if (!val) {
+ return false
+ }
+
+ // support flattened arguments
+ if (types && !Array.isArray(types)) {
+ types = new Array(arguments.length - 1)
+ for (i = 0; i < types.length; i++) {
+ types[i] = arguments[i + 1]
+ }
+ }
+
+ // no types, return the content type
+ if (!types || !types.length) {
+ return val
+ }
+
+ var type
+ for (i = 0; i < types.length; i++) {
+ if (mimeMatch(normalize(type = types[i]), val)) {
+ return type[0] === '+' || ~type.indexOf('*')
+ ? val
+ : type
+ }
+ }
+
+ // no matches
+ return false;
+}
+
+/**
+ * Check if a request has a request body.
+ * A request with a body __must__ either have `transfer-encoding`
+ * or `content-length` headers set.
+ * http://www.w3.org/Protocols/rfc2616/rfc2616-sec4.html#sec4.3
+ *
+ * @param {Object} request
+ * @return {Boolean}
+ * @api public
+ */
+
+function hasbody(req) {
+ var headers = req.headers;
+ if ('transfer-encoding' in headers) return true;
+ return !isNaN(headers['content-length']);
+}
+
+/**
+ * Check if the incoming request contains the "Content-Type"
+ * header field, and it contains any of the give mime `type`s.
+ * If there is no request body, `null` is returned.
+ * If there is no content type, `false` is returned.
+ * Otherwise, it returns the first `type` that matches.
+ *
+ * Examples:
+ *
+ * // With Content-Type: text/html; charset=utf-8
+ * this.is('html'); // => 'html'
+ * this.is('text/html'); // => 'text/html'
+ * this.is('text/*', 'application/json'); // => 'text/html'
+ *
+ * // When Content-Type is application/json
+ * this.is('json', 'urlencoded'); // => 'json'
+ * this.is('application/json'); // => 'application/json'
+ * this.is('html', 'application/*'); // => 'application/json'
+ *
+ * this.is('html'); // => false
+ *
+ * @param {String|Array} types...
+ * @return {String|false|null}
+ * @api public
+ */
+
+function typeofrequest(req, types_) {
+ var types = types_
+
+ // no body
+ if (!hasbody(req)) {
+ return null
+ }
+
+ // support flattened arguments
+ if (arguments.length > 2) {
+ types = new Array(arguments.length - 1)
+ for (var i = 0; i < types.length; i++) {
+ types[i] = arguments[i + 1]
+ }
+ }
+
+ // request content type
+ var value = req.headers['content-type']
+
+ return typeis(value, types);
+}
+
+/**
+ * Normalize a mime type.
+ * If it's a shorthand, expand it to a valid mime type.
+ *
+ * In general, you probably want:
+ *
+ * var type = is(req, ['urlencoded', 'json', 'multipart']);
+ *
+ * Then use the appropriate body parsers.
+ * These three are the most common request body types
+ * and are thus ensured to work.
+ *
+ * @param {String} type
+ * @api private
+ */
+
+function normalize(type) {
+ switch (type) {
+ case 'urlencoded': return 'application/x-www-form-urlencoded';
+ case 'multipart':
+ type = 'multipart/*';
+ break;
+ }
+
+ return type[0] === '+' || ~type.indexOf('/')
+ ? type
+ : mime.lookup(type)
+}
+
+/**
+ * Check if `exected` mime type
+ * matches `actual` mime type with
+ * wildcard and +suffix support.
+ *
+ * @param {String} expected
+ * @param {String} actual
+ * @return {Boolean}
+ * @api private
+ */
+
+function mimeMatch(expected, actual) {
+ // invalid type
+ if (expected === false) {
+ return false
+ }
+
+ // exact match
+ if (expected === actual) {
+ return true
+ }
+
+ actual = actual.split('/');
+
+ if (expected[0] === '+') {
+ // support +suffix
+ return Boolean(actual[1])
+ && expected.length <= actual[1].length
+ && expected === actual[1].substr(0 - expected.length)
+ }
+
+ if (!~expected.indexOf('*')) return false;
+
+ expected = expected.split('/');
+
+ if (expected[0] === '*') {
+ // support */yyy
+ return expected[1] === actual[1]
+ }
+
+ if (expected[1] === '*') {
+ // support xxx/*
+ return expected[0] === actual[0]
+ }
+
+ if (expected[1][0] === '*' && expected[1][1] === '+') {
+ // support xxx/*+zzz
+ return expected[0] === actual[0]
+ && expected[1].length <= actual[1].length + 1
+ && expected[1].substr(1) === actual[1].substr(1 - expected[1].length)
+ }
+
+ return false
+}
+
+/**
+ * Normalize a type and remove parameters.
+ *
+ * @param {string} value
+ * @return {string}
+ * @api private
+ */
+
+function typenormalize(value) {
+ try {
+ var type = typer.parse(value)
+ delete type.parameters
+ return typer.format(type)
+ } catch (err) {
+ return null
+ }
+}
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/HISTORY.md b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/HISTORY.md
new file mode 100755
index 00000000..aa7cdf16
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/HISTORY.md
@@ -0,0 +1,91 @@
+2.0.10 / 2015-03-13
+===================
+
+ * deps: mime-db@~1.8.0
+ - Add new mime types
+
+2.0.9 / 2015-02-09
+==================
+
+ * deps: mime-db@~1.7.0
+ - Add new mime types
+ - Community extensions ownership transferred from `node-mime`
+
+2.0.8 / 2015-01-29
+==================
+
+ * deps: mime-db@~1.6.0
+ - Add new mime types
+
+2.0.7 / 2014-12-30
+==================
+
+ * deps: mime-db@~1.5.0
+ - Add new mime types
+ - Fix various invalid MIME type entries
+
+2.0.6 / 2014-12-30
+==================
+
+ * deps: mime-db@~1.4.0
+ - Add new mime types
+ - Fix various invalid MIME type entries
+ - Remove example template MIME types
+
+2.0.5 / 2014-12-29
+==================
+
+ * deps: mime-db@~1.3.1
+ - Fix missing extensions
+
+2.0.4 / 2014-12-10
+==================
+
+ * deps: mime-db@~1.3.0
+ - Add new mime types
+
+2.0.3 / 2014-11-09
+==================
+
+ * deps: mime-db@~1.2.0
+ - Add new mime types
+
+2.0.2 / 2014-09-28
+==================
+
+ * deps: mime-db@~1.1.0
+ - Add new mime types
+ - Add additional compressible
+ - Update charsets
+
+2.0.1 / 2014-09-07
+==================
+
+ * Support Node.js 0.6
+
+2.0.0 / 2014-09-02
+==================
+
+ * Use `mime-db`
+ * Remove `.define()`
+
+1.0.2 / 2014-08-04
+==================
+
+ * Set charset=utf-8 for `text/javascript`
+
+1.0.1 / 2014-06-24
+==================
+
+ * Add `text/jsx` type
+
+1.0.0 / 2014-05-12
+==================
+
+ * Return `false` for unknown types
+ * Set charset=utf-8 for `application/json`
+
+0.1.0 / 2014-05-02
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/LICENSE b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/LICENSE
new file mode 100755
index 00000000..a7ae8ee9
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/README.md b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/README.md
new file mode 100755
index 00000000..8fea7ff4
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/README.md
@@ -0,0 +1,102 @@
+# mime-types
+
+[![NPM Version][npm-image]][npm-url]
+[![NPM Downloads][downloads-image]][downloads-url]
+[![Node.js Version][node-version-image]][node-version-url]
+[![Build Status][travis-image]][travis-url]
+[![Test Coverage][coveralls-image]][coveralls-url]
+
+The ultimate javascript content-type utility.
+
+Similar to [node-mime](https://github.com/broofa/node-mime), except:
+
+- __No fallbacks.__ Instead of naively returning the first available type, `mime-types` simply returns `false`,
+ so do `var type = mime.lookup('unrecognized') || 'application/octet-stream'`.
+- No `new Mime()` business, so you could do `var lookup = require('mime-types').lookup`.
+- Additional mime types are added such as jade and stylus via [mime-db](https://github.com/jshttp/mime-db)
+- No `.define()` functionality
+
+Otherwise, the API is compatible.
+
+## Install
+
+```sh
+$ npm install mime-types
+```
+
+## Adding Types
+
+All mime types are based on [mime-db](https://github.com/jshttp/mime-db),
+so open a PR there if you'd like to add mime types.
+
+## API
+
+```js
+var mime = require('mime-types')
+```
+
+All functions return `false` if input is invalid or not found.
+
+### mime.lookup(path)
+
+Lookup the content-type associated with a file.
+
+```js
+mime.lookup('json') // 'application/json'
+mime.lookup('.md') // 'text/x-markdown'
+mime.lookup('file.html') // 'text/html'
+mime.lookup('folder/file.js') // 'application/javascript'
+
+mime.lookup('cats') // false
+```
+
+### mime.contentType(type)
+
+Create a full content-type header given a content-type or extension.
+
+```js
+mime.contentType('markdown') // 'text/x-markdown; charset=utf-8'
+mime.contentType('file.json') // 'application/json; charset=utf-8'
+
+// from a full path
+mime.contentType(path.extname('/path/to/file.json')) // 'application/json; charset=utf-8'
+```
+
+### mime.extension(type)
+
+Get the default extension for a content-type.
+
+```js
+mime.extension('application/octet-stream') // 'bin'
+```
+
+### mime.charset(type)
+
+Lookup the implied default charset of a content-type.
+
+```js
+mime.charset('text/x-markdown') // 'UTF-8'
+```
+
+### var type = mime.types[extension]
+
+A map of content-types by extension.
+
+### [extensions...] = mime.extensions[type]
+
+A map of extensions by content-type.
+
+## License
+
+[MIT](LICENSE)
+
+[npm-image]: https://img.shields.io/npm/v/mime-types.svg?style=flat
+[npm-url]: https://npmjs.org/package/mime-types
+[node-version-image]: https://img.shields.io/badge/node.js-%3E%3D_0.6-brightgreen.svg?style=flat
+[node-version-url]: http://nodejs.org/download/
+[travis-image]: https://img.shields.io/travis/jshttp/mime-types.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/mime-types
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-types.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/mime-types
+[downloads-image]: https://img.shields.io/npm/dm/mime-types.svg?style=flat
+[downloads-url]: https://npmjs.org/package/mime-types
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/index.js b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/index.js
new file mode 100755
index 00000000..b46a202f
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/index.js
@@ -0,0 +1,63 @@
+
+var db = require('mime-db')
+
+// types[extension] = type
+exports.types = Object.create(null)
+// extensions[type] = [extensions]
+exports.extensions = Object.create(null)
+
+Object.keys(db).forEach(function (name) {
+ var mime = db[name]
+ var exts = mime.extensions
+ if (!exts || !exts.length) return
+ exports.extensions[name] = exts
+ exts.forEach(function (ext) {
+ exports.types[ext] = name
+ })
+})
+
+exports.lookup = function (string) {
+ if (!string || typeof string !== "string") return false
+ // remove any leading paths, though we should just use path.basename
+ string = string.replace(/.*[\.\/\\]/, '').toLowerCase()
+ if (!string) return false
+ return exports.types[string] || false
+}
+
+exports.extension = function (type) {
+ if (!type || typeof type !== "string") return false
+ // to do: use media-typer
+ type = type.match(/^\s*([^;\s]*)(?:;|\s|$)/)
+ if (!type) return false
+ var exts = exports.extensions[type[1].toLowerCase()]
+ if (!exts || !exts.length) return false
+ return exts[0]
+}
+
+// type has to be an exact mime type
+exports.charset = function (type) {
+ var mime = db[type]
+ if (mime && mime.charset) return mime.charset
+
+ // default text/* to utf-8
+ if (/^text\//.test(type)) return 'UTF-8'
+
+ return false
+}
+
+// backwards compatibility
+exports.charsets = {
+ lookup: exports.charset
+}
+
+// to do: maybe use set-type module or something
+exports.contentType = function (type) {
+ if (!type || typeof type !== "string") return false
+ if (!~type.indexOf('/')) type = exports.lookup(type)
+ if (!type) return false
+ if (!~type.indexOf('charset')) {
+ var charset = exports.charset(type)
+ if (charset) type += '; charset=' + charset.toLowerCase()
+ }
+ return type
+}
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/HISTORY.md b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/HISTORY.md
new file mode 100755
index 00000000..3c667481
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/HISTORY.md
@@ -0,0 +1,174 @@
+1.8.0 / 2015-03-13
+==================
+
+ * Add `application/vnd.citationstyles.style+xml`
+ * Add `application/vnd.fastcopy-disk-image`
+ * Add `application/vnd.gov.sk.xmldatacontainer+xml`
+ * Add extension `.jsonld` to `application/ld+json`
+
+1.7.0 / 2015-02-08
+==================
+
+ * Add `application/vnd.gerber`
+ * Add `application/vnd.msa-disk-image`
+
+1.6.1 / 2015-02-05
+==================
+
+ * Community extensions ownership transferred from `node-mime`
+
+1.6.0 / 2015-01-29
+==================
+
+ * Add `application/jose`
+ * Add `application/jose+json`
+ * Add `application/json-seq`
+ * Add `application/jwk+json`
+ * Add `application/jwk-set+json`
+ * Add `application/jwt`
+ * Add `application/rdap+json`
+ * Add `application/vnd.gov.sk.e-form+xml`
+ * Add `application/vnd.ims.imsccv1p3`
+
+1.5.0 / 2014-12-30
+==================
+
+ * Add `application/vnd.oracle.resource+json`
+ * Fix various invalid MIME type entries
+ - `application/mbox+xml`
+ - `application/oscp-response`
+ - `application/vwg-multiplexed`
+ - `audio/g721`
+
+1.4.0 / 2014-12-21
+==================
+
+ * Add `application/vnd.ims.imsccv1p2`
+ * Fix various invalid MIME type entries
+ - `application/vnd-acucobol`
+ - `application/vnd-curl`
+ - `application/vnd-dart`
+ - `application/vnd-dxr`
+ - `application/vnd-fdf`
+ - `application/vnd-mif`
+ - `application/vnd-sema`
+ - `application/vnd-wap-wmlc`
+ - `application/vnd.adobe.flash-movie`
+ - `application/vnd.dece-zip`
+ - `application/vnd.dvb_service`
+ - `application/vnd.micrografx-igx`
+ - `application/vnd.sealed-doc`
+ - `application/vnd.sealed-eml`
+ - `application/vnd.sealed-mht`
+ - `application/vnd.sealed-ppt`
+ - `application/vnd.sealed-tiff`
+ - `application/vnd.sealed-xls`
+ - `application/vnd.sealedmedia.softseal-html`
+ - `application/vnd.sealedmedia.softseal-pdf`
+ - `application/vnd.wap-slc`
+ - `application/vnd.wap-wbxml`
+ - `audio/vnd.sealedmedia.softseal-mpeg`
+ - `image/vnd-djvu`
+ - `image/vnd-svf`
+ - `image/vnd-wap-wbmp`
+ - `image/vnd.sealed-png`
+ - `image/vnd.sealedmedia.softseal-gif`
+ - `image/vnd.sealedmedia.softseal-jpg`
+ - `model/vnd-dwf`
+ - `model/vnd.parasolid.transmit-binary`
+ - `model/vnd.parasolid.transmit-text`
+ - `text/vnd-a`
+ - `text/vnd-curl`
+ - `text/vnd.wap-wml`
+ * Remove example template MIME types
+ - `application/example`
+ - `audio/example`
+ - `image/example`
+ - `message/example`
+ - `model/example`
+ - `multipart/example`
+ - `text/example`
+ - `video/example`
+
+1.3.1 / 2014-12-16
+==================
+
+ * Fix missing extensions
+ - `application/json5`
+ - `text/hjson`
+
+1.3.0 / 2014-12-07
+==================
+
+ * Add `application/a2l`
+ * Add `application/aml`
+ * Add `application/atfx`
+ * Add `application/atxml`
+ * Add `application/cdfx+xml`
+ * Add `application/dii`
+ * Add `application/json5`
+ * Add `application/lxf`
+ * Add `application/mf4`
+ * Add `application/vnd.apache.thrift.compact`
+ * Add `application/vnd.apache.thrift.json`
+ * Add `application/vnd.coffeescript`
+ * Add `application/vnd.enphase.envoy`
+ * Add `application/vnd.ims.imsccv1p1`
+ * Add `text/csv-schema`
+ * Add `text/hjson`
+ * Add `text/markdown`
+ * Add `text/yaml`
+
+1.2.0 / 2014-11-09
+==================
+
+ * Add `application/cea`
+ * Add `application/dit`
+ * Add `application/vnd.gov.sk.e-form+zip`
+ * Add `application/vnd.tmd.mediaflex.api+xml`
+ * Type `application/epub+zip` is now IANA-registered
+
+1.1.2 / 2014-10-23
+==================
+
+ * Rebuild database for `application/x-www-form-urlencoded` change
+
+1.1.1 / 2014-10-20
+==================
+
+ * Mark `application/x-www-form-urlencoded` as compressible.
+
+1.1.0 / 2014-09-28
+==================
+
+ * Add `application/font-woff2`
+
+1.0.3 / 2014-09-25
+==================
+
+ * Fix engine requirement in package
+
+1.0.2 / 2014-09-25
+==================
+
+ * Add `application/coap-group+json`
+ * Add `application/dcd`
+ * Add `application/vnd.apache.thrift.binary`
+ * Add `image/vnd.tencent.tap`
+ * Mark all JSON-derived types as compressible
+ * Update `text/vtt` data
+
+1.0.1 / 2014-08-30
+==================
+
+ * Fix extension ordering
+
+1.0.0 / 2014-08-30
+==================
+
+ * Add `application/atf`
+ * Add `application/merge-patch+json`
+ * Add `multipart/x-mixed-replace`
+ * Add `source: 'apache'` metadata
+ * Add `source: 'iana'` metadata
+ * Remove badly-assumed charset data
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/LICENSE b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/LICENSE
new file mode 100755
index 00000000..a7ae8ee9
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/LICENSE
@@ -0,0 +1,22 @@
+
+The MIT License (MIT)
+
+Copyright (c) 2014 Jonathan Ong me@jongleberry.com
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/README.md b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/README.md
new file mode 100755
index 00000000..1dde2349
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/README.md
@@ -0,0 +1,76 @@
+# mime-db
+
+[![NPM Version][npm-version-image]][npm-url]
+[![NPM Downloads][npm-downloads-image]][npm-url]
+[![Node.js Version][node-image]][node-url]
+[![Build Status][travis-image]][travis-url]
+[![Coverage Status][coveralls-image]][coveralls-url]
+
+This is a database of all mime types.
+It consists of a single, public JSON file and does not include any logic,
+allowing it to remain as un-opinionated as possible with an API.
+It aggregates data from the following sources:
+
+- http://www.iana.org/assignments/media-types/media-types.xhtml
+- http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types
+
+## Installation
+
+```bash
+npm install mime-db
+```
+
+If you're crazy enough to use this in the browser,
+you can just grab the JSON file:
+
+```
+https://cdn.rawgit.com/jshttp/mime-db/master/db.json
+```
+
+## Usage
+
+```js
+var db = require('mime-db');
+
+// grab data on .js files
+var data = db['application/javascript'];
+```
+
+## Data Structure
+
+The JSON file is a map lookup for lowercased mime types.
+Each mime type has the following properties:
+
+- `.source` - where the mime type is defined.
+ If not set, it's probably a custom media type.
+ - `apache` - [Apache common media types](http://svn.apache.org/repos/asf/httpd/httpd/trunk/docs/conf/mime.types)
+ - `iana` - [IANA-defined media types](http://www.iana.org/assignments/media-types/media-types.xhtml)
+- `.extensions[]` - known extensions associated with this mime type.
+- `.compressible` - whether a file of this type is can be gzipped.
+- `.charset` - the default charset associated with this type, if any.
+
+If unknown, every property could be `undefined`.
+
+## Contributing
+
+To edit the database, only make PRs against `src/custom.json` or
+`src/custom-suffix.json`.
+
+To update the build, run `npm run update`.
+
+## Adding Custom Media Types
+
+The best way to get new media types included in this library is to register
+them with the IANA. The community registration procedure is outlined in
+[RFC 6838 section 5](http://tools.ietf.org/html/rfc6838#section-5). Types
+registered with the IANA are automatically pulled into this library.
+
+[npm-version-image]: https://img.shields.io/npm/v/mime-db.svg?style=flat
+[npm-downloads-image]: https://img.shields.io/npm/dm/mime-db.svg?style=flat
+[npm-url]: https://npmjs.org/package/mime-db
+[travis-image]: https://img.shields.io/travis/jshttp/mime-db.svg?style=flat
+[travis-url]: https://travis-ci.org/jshttp/mime-db
+[coveralls-image]: https://img.shields.io/coveralls/jshttp/mime-db.svg?style=flat
+[coveralls-url]: https://coveralls.io/r/jshttp/mime-db?branch=master
+[node-image]: https://img.shields.io/node/v/mime-db.svg?style=flat
+[node-url]: http://nodejs.org/download/
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/db.json b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/db.json
new file mode 100755
index 00000000..f9f3515b
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/db.json
@@ -0,0 +1,6309 @@
+{
+ "application/1d-interleaved-parityfec": {
+ "source": "iana"
+ },
+ "application/3gpdash-qoe-report+xml": {
+ "source": "iana"
+ },
+ "application/3gpp-ims+xml": {
+ "source": "iana"
+ },
+ "application/a2l": {
+ "source": "iana"
+ },
+ "application/activemessage": {
+ "source": "iana"
+ },
+ "application/alto-costmap+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-costmapfilter+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-directory+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-endpointcost+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-endpointcostparams+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-endpointprop+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-endpointpropparams+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-error+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-networkmap+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/alto-networkmapfilter+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/aml": {
+ "source": "iana"
+ },
+ "application/andrew-inset": {
+ "source": "iana",
+ "extensions": ["ez"]
+ },
+ "application/applefile": {
+ "source": "iana"
+ },
+ "application/applixware": {
+ "source": "apache",
+ "extensions": ["aw"]
+ },
+ "application/atf": {
+ "source": "iana"
+ },
+ "application/atfx": {
+ "source": "iana"
+ },
+ "application/atom+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["atom"]
+ },
+ "application/atomcat+xml": {
+ "source": "iana",
+ "extensions": ["atomcat"]
+ },
+ "application/atomdeleted+xml": {
+ "source": "iana"
+ },
+ "application/atomicmail": {
+ "source": "iana"
+ },
+ "application/atomsvc+xml": {
+ "source": "iana",
+ "extensions": ["atomsvc"]
+ },
+ "application/atxml": {
+ "source": "iana"
+ },
+ "application/auth-policy+xml": {
+ "source": "iana"
+ },
+ "application/bacnet-xdd+zip": {
+ "source": "iana"
+ },
+ "application/batch-smtp": {
+ "source": "iana"
+ },
+ "application/beep+xml": {
+ "source": "iana"
+ },
+ "application/calendar+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/calendar+xml": {
+ "source": "iana"
+ },
+ "application/call-completion": {
+ "source": "iana"
+ },
+ "application/cals-1840": {
+ "source": "iana"
+ },
+ "application/cbor": {
+ "source": "iana"
+ },
+ "application/ccmp+xml": {
+ "source": "iana"
+ },
+ "application/ccxml+xml": {
+ "source": "iana",
+ "extensions": ["ccxml"]
+ },
+ "application/cdfx+xml": {
+ "source": "iana"
+ },
+ "application/cdmi-capability": {
+ "source": "iana",
+ "extensions": ["cdmia"]
+ },
+ "application/cdmi-container": {
+ "source": "iana",
+ "extensions": ["cdmic"]
+ },
+ "application/cdmi-domain": {
+ "source": "iana",
+ "extensions": ["cdmid"]
+ },
+ "application/cdmi-object": {
+ "source": "iana",
+ "extensions": ["cdmio"]
+ },
+ "application/cdmi-queue": {
+ "source": "iana",
+ "extensions": ["cdmiq"]
+ },
+ "application/cea": {
+ "source": "iana"
+ },
+ "application/cea-2018+xml": {
+ "source": "iana"
+ },
+ "application/cellml+xml": {
+ "source": "iana"
+ },
+ "application/cfw": {
+ "source": "iana"
+ },
+ "application/cms": {
+ "source": "iana"
+ },
+ "application/cnrp+xml": {
+ "source": "iana"
+ },
+ "application/coap-group+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/commonground": {
+ "source": "iana"
+ },
+ "application/conference-info+xml": {
+ "source": "iana"
+ },
+ "application/cpl+xml": {
+ "source": "iana"
+ },
+ "application/csrattrs": {
+ "source": "iana"
+ },
+ "application/csta+xml": {
+ "source": "iana"
+ },
+ "application/cstadata+xml": {
+ "source": "iana"
+ },
+ "application/cu-seeme": {
+ "source": "apache",
+ "extensions": ["cu"]
+ },
+ "application/cybercash": {
+ "source": "iana"
+ },
+ "application/dart": {
+ "compressible": true
+ },
+ "application/dash+xml": {
+ "source": "iana",
+ "extensions": ["mdp"]
+ },
+ "application/dashdelta": {
+ "source": "iana"
+ },
+ "application/davmount+xml": {
+ "source": "iana",
+ "extensions": ["davmount"]
+ },
+ "application/dca-rft": {
+ "source": "iana"
+ },
+ "application/dcd": {
+ "source": "iana"
+ },
+ "application/dec-dx": {
+ "source": "iana"
+ },
+ "application/dialog-info+xml": {
+ "source": "iana"
+ },
+ "application/dicom": {
+ "source": "iana"
+ },
+ "application/dii": {
+ "source": "iana"
+ },
+ "application/dit": {
+ "source": "iana"
+ },
+ "application/dns": {
+ "source": "iana"
+ },
+ "application/docbook+xml": {
+ "source": "apache",
+ "extensions": ["dbk"]
+ },
+ "application/dskpp+xml": {
+ "source": "iana"
+ },
+ "application/dssc+der": {
+ "source": "iana",
+ "extensions": ["dssc"]
+ },
+ "application/dssc+xml": {
+ "source": "iana",
+ "extensions": ["xdssc"]
+ },
+ "application/dvcs": {
+ "source": "iana"
+ },
+ "application/ecmascript": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["ecma"]
+ },
+ "application/edi-consent": {
+ "source": "iana"
+ },
+ "application/edi-x12": {
+ "source": "iana",
+ "compressible": false
+ },
+ "application/edifact": {
+ "source": "iana",
+ "compressible": false
+ },
+ "application/emma+xml": {
+ "source": "iana",
+ "extensions": ["emma"]
+ },
+ "application/emotionml+xml": {
+ "source": "iana"
+ },
+ "application/encaprtp": {
+ "source": "iana"
+ },
+ "application/epp+xml": {
+ "source": "iana"
+ },
+ "application/epub+zip": {
+ "source": "iana",
+ "extensions": ["epub"]
+ },
+ "application/eshop": {
+ "source": "iana"
+ },
+ "application/exi": {
+ "source": "iana",
+ "extensions": ["exi"]
+ },
+ "application/fastinfoset": {
+ "source": "iana"
+ },
+ "application/fastsoap": {
+ "source": "iana"
+ },
+ "application/fdt+xml": {
+ "source": "iana"
+ },
+ "application/fits": {
+ "source": "iana"
+ },
+ "application/font-sfnt": {
+ "source": "iana"
+ },
+ "application/font-tdpfr": {
+ "source": "iana",
+ "extensions": ["pfr"]
+ },
+ "application/font-woff": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["woff"]
+ },
+ "application/font-woff2": {
+ "compressible": false,
+ "extensions": ["woff2"]
+ },
+ "application/framework-attributes+xml": {
+ "source": "iana"
+ },
+ "application/gml+xml": {
+ "source": "apache",
+ "extensions": ["gml"]
+ },
+ "application/gpx+xml": {
+ "source": "apache",
+ "extensions": ["gpx"]
+ },
+ "application/gxf": {
+ "source": "apache",
+ "extensions": ["gxf"]
+ },
+ "application/gzip": {
+ "source": "iana",
+ "compressible": false
+ },
+ "application/h224": {
+ "source": "iana"
+ },
+ "application/held+xml": {
+ "source": "iana"
+ },
+ "application/http": {
+ "source": "iana"
+ },
+ "application/hyperstudio": {
+ "source": "iana",
+ "extensions": ["stk"]
+ },
+ "application/ibe-key-request+xml": {
+ "source": "iana"
+ },
+ "application/ibe-pkg-reply+xml": {
+ "source": "iana"
+ },
+ "application/ibe-pp-data": {
+ "source": "iana"
+ },
+ "application/iges": {
+ "source": "iana"
+ },
+ "application/im-iscomposing+xml": {
+ "source": "iana"
+ },
+ "application/index": {
+ "source": "iana"
+ },
+ "application/index.cmd": {
+ "source": "iana"
+ },
+ "application/index.obj": {
+ "source": "iana"
+ },
+ "application/index.response": {
+ "source": "iana"
+ },
+ "application/index.vnd": {
+ "source": "iana"
+ },
+ "application/inkml+xml": {
+ "source": "iana",
+ "extensions": ["ink","inkml"]
+ },
+ "application/iotp": {
+ "source": "iana"
+ },
+ "application/ipfix": {
+ "source": "iana",
+ "extensions": ["ipfix"]
+ },
+ "application/ipp": {
+ "source": "iana"
+ },
+ "application/isup": {
+ "source": "iana"
+ },
+ "application/its+xml": {
+ "source": "iana"
+ },
+ "application/java-archive": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["jar"]
+ },
+ "application/java-serialized-object": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["ser"]
+ },
+ "application/java-vm": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["class"]
+ },
+ "application/javascript": {
+ "source": "iana",
+ "charset": "UTF-8",
+ "compressible": true,
+ "extensions": ["js"]
+ },
+ "application/jose": {
+ "source": "iana"
+ },
+ "application/jose+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/jrd+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/json": {
+ "source": "iana",
+ "charset": "UTF-8",
+ "compressible": true,
+ "extensions": ["json","map"]
+ },
+ "application/json-patch+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/json-seq": {
+ "source": "iana"
+ },
+ "application/json5": {
+ "extensions": ["json5"]
+ },
+ "application/jsonml+json": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["jsonml"]
+ },
+ "application/jwk+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/jwk-set+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/jwt": {
+ "source": "iana"
+ },
+ "application/kpml-request+xml": {
+ "source": "iana"
+ },
+ "application/kpml-response+xml": {
+ "source": "iana"
+ },
+ "application/ld+json": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["jsonld"]
+ },
+ "application/link-format": {
+ "source": "iana"
+ },
+ "application/load-control+xml": {
+ "source": "iana"
+ },
+ "application/lost+xml": {
+ "source": "iana",
+ "extensions": ["lostxml"]
+ },
+ "application/lostsync+xml": {
+ "source": "iana"
+ },
+ "application/lxf": {
+ "source": "iana"
+ },
+ "application/mac-binhex40": {
+ "source": "iana",
+ "extensions": ["hqx"]
+ },
+ "application/mac-compactpro": {
+ "source": "apache",
+ "extensions": ["cpt"]
+ },
+ "application/macwriteii": {
+ "source": "iana"
+ },
+ "application/mads+xml": {
+ "source": "iana",
+ "extensions": ["mads"]
+ },
+ "application/marc": {
+ "source": "iana",
+ "extensions": ["mrc"]
+ },
+ "application/marcxml+xml": {
+ "source": "iana",
+ "extensions": ["mrcx"]
+ },
+ "application/mathematica": {
+ "source": "iana",
+ "extensions": ["ma","nb","mb"]
+ },
+ "application/mathml+xml": {
+ "source": "iana",
+ "extensions": ["mathml"]
+ },
+ "application/mathml-content+xml": {
+ "source": "iana"
+ },
+ "application/mathml-presentation+xml": {
+ "source": "iana"
+ },
+ "application/mbms-associated-procedure-description+xml": {
+ "source": "iana"
+ },
+ "application/mbms-deregister+xml": {
+ "source": "iana"
+ },
+ "application/mbms-envelope+xml": {
+ "source": "iana"
+ },
+ "application/mbms-msk+xml": {
+ "source": "iana"
+ },
+ "application/mbms-msk-response+xml": {
+ "source": "iana"
+ },
+ "application/mbms-protection-description+xml": {
+ "source": "iana"
+ },
+ "application/mbms-reception-report+xml": {
+ "source": "iana"
+ },
+ "application/mbms-register+xml": {
+ "source": "iana"
+ },
+ "application/mbms-register-response+xml": {
+ "source": "iana"
+ },
+ "application/mbms-schedule+xml": {
+ "source": "iana"
+ },
+ "application/mbms-user-service-description+xml": {
+ "source": "iana"
+ },
+ "application/mbox": {
+ "source": "iana",
+ "extensions": ["mbox"]
+ },
+ "application/media-policy-dataset+xml": {
+ "source": "iana"
+ },
+ "application/media_control+xml": {
+ "source": "iana"
+ },
+ "application/mediaservercontrol+xml": {
+ "source": "iana",
+ "extensions": ["mscml"]
+ },
+ "application/merge-patch+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/metalink+xml": {
+ "source": "apache",
+ "extensions": ["metalink"]
+ },
+ "application/metalink4+xml": {
+ "source": "iana",
+ "extensions": ["meta4"]
+ },
+ "application/mets+xml": {
+ "source": "iana",
+ "extensions": ["mets"]
+ },
+ "application/mf4": {
+ "source": "iana"
+ },
+ "application/mikey": {
+ "source": "iana"
+ },
+ "application/mods+xml": {
+ "source": "iana",
+ "extensions": ["mods"]
+ },
+ "application/moss-keys": {
+ "source": "iana"
+ },
+ "application/moss-signature": {
+ "source": "iana"
+ },
+ "application/mosskey-data": {
+ "source": "iana"
+ },
+ "application/mosskey-request": {
+ "source": "iana"
+ },
+ "application/mp21": {
+ "source": "iana",
+ "extensions": ["m21","mp21"]
+ },
+ "application/mp4": {
+ "source": "iana",
+ "extensions": ["mp4s","m4p"]
+ },
+ "application/mpeg4-generic": {
+ "source": "iana"
+ },
+ "application/mpeg4-iod": {
+ "source": "iana"
+ },
+ "application/mpeg4-iod-xmt": {
+ "source": "iana"
+ },
+ "application/mrb-consumer+xml": {
+ "source": "iana"
+ },
+ "application/mrb-publish+xml": {
+ "source": "iana"
+ },
+ "application/msc-ivr+xml": {
+ "source": "iana"
+ },
+ "application/msc-mixer+xml": {
+ "source": "iana"
+ },
+ "application/msword": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["doc","dot"]
+ },
+ "application/mxf": {
+ "source": "iana",
+ "extensions": ["mxf"]
+ },
+ "application/nasdata": {
+ "source": "iana"
+ },
+ "application/news-checkgroups": {
+ "source": "iana"
+ },
+ "application/news-groupinfo": {
+ "source": "iana"
+ },
+ "application/news-transmission": {
+ "source": "iana"
+ },
+ "application/nlsml+xml": {
+ "source": "iana"
+ },
+ "application/nss": {
+ "source": "iana"
+ },
+ "application/ocsp-request": {
+ "source": "iana"
+ },
+ "application/ocsp-response": {
+ "source": "iana"
+ },
+ "application/octet-stream": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["bin","dms","lrf","mar","so","dist","distz","pkg","bpk","dump","elc","deploy","buffer"]
+ },
+ "application/oda": {
+ "source": "iana",
+ "extensions": ["oda"]
+ },
+ "application/odx": {
+ "source": "iana"
+ },
+ "application/oebps-package+xml": {
+ "source": "iana",
+ "extensions": ["opf"]
+ },
+ "application/ogg": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["ogx"]
+ },
+ "application/omdoc+xml": {
+ "source": "apache",
+ "extensions": ["omdoc"]
+ },
+ "application/onenote": {
+ "source": "apache",
+ "extensions": ["onetoc","onetoc2","onetmp","onepkg"]
+ },
+ "application/oxps": {
+ "source": "iana",
+ "extensions": ["oxps"]
+ },
+ "application/p2p-overlay+xml": {
+ "source": "iana"
+ },
+ "application/parityfec": {
+ "source": "iana"
+ },
+ "application/patch-ops-error+xml": {
+ "source": "iana",
+ "extensions": ["xer"]
+ },
+ "application/pdf": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["pdf"]
+ },
+ "application/pdx": {
+ "source": "iana"
+ },
+ "application/pgp-encrypted": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["pgp"]
+ },
+ "application/pgp-keys": {
+ "source": "iana"
+ },
+ "application/pgp-signature": {
+ "source": "iana",
+ "extensions": ["asc","sig"]
+ },
+ "application/pics-rules": {
+ "source": "apache",
+ "extensions": ["prf"]
+ },
+ "application/pidf+xml": {
+ "source": "iana"
+ },
+ "application/pidf-diff+xml": {
+ "source": "iana"
+ },
+ "application/pkcs10": {
+ "source": "iana",
+ "extensions": ["p10"]
+ },
+ "application/pkcs7-mime": {
+ "source": "iana",
+ "extensions": ["p7m","p7c"]
+ },
+ "application/pkcs7-signature": {
+ "source": "iana",
+ "extensions": ["p7s"]
+ },
+ "application/pkcs8": {
+ "source": "iana",
+ "extensions": ["p8"]
+ },
+ "application/pkix-attr-cert": {
+ "source": "iana",
+ "extensions": ["ac"]
+ },
+ "application/pkix-cert": {
+ "source": "iana",
+ "extensions": ["cer"]
+ },
+ "application/pkix-crl": {
+ "source": "iana",
+ "extensions": ["crl"]
+ },
+ "application/pkix-pkipath": {
+ "source": "iana",
+ "extensions": ["pkipath"]
+ },
+ "application/pkixcmp": {
+ "source": "iana",
+ "extensions": ["pki"]
+ },
+ "application/pls+xml": {
+ "source": "iana",
+ "extensions": ["pls"]
+ },
+ "application/poc-settings+xml": {
+ "source": "iana"
+ },
+ "application/postscript": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["ai","eps","ps"]
+ },
+ "application/provenance+xml": {
+ "source": "iana"
+ },
+ "application/prs.alvestrand.titrax-sheet": {
+ "source": "iana"
+ },
+ "application/prs.cww": {
+ "source": "iana",
+ "extensions": ["cww"]
+ },
+ "application/prs.hpub+zip": {
+ "source": "iana"
+ },
+ "application/prs.nprend": {
+ "source": "iana"
+ },
+ "application/prs.plucker": {
+ "source": "iana"
+ },
+ "application/prs.rdf-xml-crypt": {
+ "source": "iana"
+ },
+ "application/prs.xsf+xml": {
+ "source": "iana"
+ },
+ "application/pskc+xml": {
+ "source": "iana",
+ "extensions": ["pskcxml"]
+ },
+ "application/qsig": {
+ "source": "iana"
+ },
+ "application/raptorfec": {
+ "source": "iana"
+ },
+ "application/rdap+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/rdf+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["rdf"]
+ },
+ "application/reginfo+xml": {
+ "source": "iana",
+ "extensions": ["rif"]
+ },
+ "application/relax-ng-compact-syntax": {
+ "source": "iana",
+ "extensions": ["rnc"]
+ },
+ "application/remote-printing": {
+ "source": "iana"
+ },
+ "application/reputon+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/resource-lists+xml": {
+ "source": "iana",
+ "extensions": ["rl"]
+ },
+ "application/resource-lists-diff+xml": {
+ "source": "iana",
+ "extensions": ["rld"]
+ },
+ "application/riscos": {
+ "source": "iana"
+ },
+ "application/rlmi+xml": {
+ "source": "iana"
+ },
+ "application/rls-services+xml": {
+ "source": "iana",
+ "extensions": ["rs"]
+ },
+ "application/rpki-ghostbusters": {
+ "source": "iana",
+ "extensions": ["gbr"]
+ },
+ "application/rpki-manifest": {
+ "source": "iana",
+ "extensions": ["mft"]
+ },
+ "application/rpki-roa": {
+ "source": "iana",
+ "extensions": ["roa"]
+ },
+ "application/rpki-updown": {
+ "source": "iana"
+ },
+ "application/rsd+xml": {
+ "source": "apache",
+ "extensions": ["rsd"]
+ },
+ "application/rss+xml": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["rss"]
+ },
+ "application/rtf": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["rtf"]
+ },
+ "application/rtploopback": {
+ "source": "iana"
+ },
+ "application/rtx": {
+ "source": "iana"
+ },
+ "application/samlassertion+xml": {
+ "source": "iana"
+ },
+ "application/samlmetadata+xml": {
+ "source": "iana"
+ },
+ "application/sbml+xml": {
+ "source": "iana",
+ "extensions": ["sbml"]
+ },
+ "application/scaip+xml": {
+ "source": "iana"
+ },
+ "application/scvp-cv-request": {
+ "source": "iana",
+ "extensions": ["scq"]
+ },
+ "application/scvp-cv-response": {
+ "source": "iana",
+ "extensions": ["scs"]
+ },
+ "application/scvp-vp-request": {
+ "source": "iana",
+ "extensions": ["spq"]
+ },
+ "application/scvp-vp-response": {
+ "source": "iana",
+ "extensions": ["spp"]
+ },
+ "application/sdp": {
+ "source": "iana",
+ "extensions": ["sdp"]
+ },
+ "application/sep+xml": {
+ "source": "iana"
+ },
+ "application/sep-exi": {
+ "source": "iana"
+ },
+ "application/session-info": {
+ "source": "iana"
+ },
+ "application/set-payment": {
+ "source": "iana"
+ },
+ "application/set-payment-initiation": {
+ "source": "iana",
+ "extensions": ["setpay"]
+ },
+ "application/set-registration": {
+ "source": "iana"
+ },
+ "application/set-registration-initiation": {
+ "source": "iana",
+ "extensions": ["setreg"]
+ },
+ "application/sgml": {
+ "source": "iana"
+ },
+ "application/sgml-open-catalog": {
+ "source": "iana"
+ },
+ "application/shf+xml": {
+ "source": "iana",
+ "extensions": ["shf"]
+ },
+ "application/sieve": {
+ "source": "iana"
+ },
+ "application/simple-filter+xml": {
+ "source": "iana"
+ },
+ "application/simple-message-summary": {
+ "source": "iana"
+ },
+ "application/simplesymbolcontainer": {
+ "source": "iana"
+ },
+ "application/slate": {
+ "source": "iana"
+ },
+ "application/smil": {
+ "source": "iana"
+ },
+ "application/smil+xml": {
+ "source": "iana",
+ "extensions": ["smi","smil"]
+ },
+ "application/smpte336m": {
+ "source": "iana"
+ },
+ "application/soap+fastinfoset": {
+ "source": "iana"
+ },
+ "application/soap+xml": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/sparql-query": {
+ "source": "iana",
+ "extensions": ["rq"]
+ },
+ "application/sparql-results+xml": {
+ "source": "iana",
+ "extensions": ["srx"]
+ },
+ "application/spirits-event+xml": {
+ "source": "iana"
+ },
+ "application/sql": {
+ "source": "iana"
+ },
+ "application/srgs": {
+ "source": "iana",
+ "extensions": ["gram"]
+ },
+ "application/srgs+xml": {
+ "source": "iana",
+ "extensions": ["grxml"]
+ },
+ "application/sru+xml": {
+ "source": "iana",
+ "extensions": ["sru"]
+ },
+ "application/ssdl+xml": {
+ "source": "apache",
+ "extensions": ["ssdl"]
+ },
+ "application/ssml+xml": {
+ "source": "iana",
+ "extensions": ["ssml"]
+ },
+ "application/tamp-apex-update": {
+ "source": "iana"
+ },
+ "application/tamp-apex-update-confirm": {
+ "source": "iana"
+ },
+ "application/tamp-community-update": {
+ "source": "iana"
+ },
+ "application/tamp-community-update-confirm": {
+ "source": "iana"
+ },
+ "application/tamp-error": {
+ "source": "iana"
+ },
+ "application/tamp-sequence-adjust": {
+ "source": "iana"
+ },
+ "application/tamp-sequence-adjust-confirm": {
+ "source": "iana"
+ },
+ "application/tamp-status-query": {
+ "source": "iana"
+ },
+ "application/tamp-status-response": {
+ "source": "iana"
+ },
+ "application/tamp-update": {
+ "source": "iana"
+ },
+ "application/tamp-update-confirm": {
+ "source": "iana"
+ },
+ "application/tar": {
+ "compressible": true
+ },
+ "application/tei+xml": {
+ "source": "iana",
+ "extensions": ["tei","teicorpus"]
+ },
+ "application/thraud+xml": {
+ "source": "iana",
+ "extensions": ["tfi"]
+ },
+ "application/timestamp-query": {
+ "source": "iana"
+ },
+ "application/timestamp-reply": {
+ "source": "iana"
+ },
+ "application/timestamped-data": {
+ "source": "iana",
+ "extensions": ["tsd"]
+ },
+ "application/ttml+xml": {
+ "source": "iana"
+ },
+ "application/tve-trigger": {
+ "source": "iana"
+ },
+ "application/ulpfec": {
+ "source": "iana"
+ },
+ "application/urc-grpsheet+xml": {
+ "source": "iana"
+ },
+ "application/urc-ressheet+xml": {
+ "source": "iana"
+ },
+ "application/urc-targetdesc+xml": {
+ "source": "iana"
+ },
+ "application/urc-uisocketdesc+xml": {
+ "source": "iana"
+ },
+ "application/vcard+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vcard+xml": {
+ "source": "iana"
+ },
+ "application/vemmi": {
+ "source": "iana"
+ },
+ "application/vividence.scriptfile": {
+ "source": "apache"
+ },
+ "application/vnd.3gpp.bsf+xml": {
+ "source": "iana"
+ },
+ "application/vnd.3gpp.pic-bw-large": {
+ "source": "iana",
+ "extensions": ["plb"]
+ },
+ "application/vnd.3gpp.pic-bw-small": {
+ "source": "iana",
+ "extensions": ["psb"]
+ },
+ "application/vnd.3gpp.pic-bw-var": {
+ "source": "iana",
+ "extensions": ["pvb"]
+ },
+ "application/vnd.3gpp.sms": {
+ "source": "iana"
+ },
+ "application/vnd.3gpp2.bcmcsinfo+xml": {
+ "source": "iana"
+ },
+ "application/vnd.3gpp2.sms": {
+ "source": "iana"
+ },
+ "application/vnd.3gpp2.tcap": {
+ "source": "iana",
+ "extensions": ["tcap"]
+ },
+ "application/vnd.3m.post-it-notes": {
+ "source": "iana",
+ "extensions": ["pwn"]
+ },
+ "application/vnd.accpac.simply.aso": {
+ "source": "iana",
+ "extensions": ["aso"]
+ },
+ "application/vnd.accpac.simply.imp": {
+ "source": "iana",
+ "extensions": ["imp"]
+ },
+ "application/vnd.acucobol": {
+ "source": "iana",
+ "extensions": ["acu"]
+ },
+ "application/vnd.acucorp": {
+ "source": "iana",
+ "extensions": ["atc","acutc"]
+ },
+ "application/vnd.adobe.air-application-installer-package+zip": {
+ "source": "apache",
+ "extensions": ["air"]
+ },
+ "application/vnd.adobe.flash.movie": {
+ "source": "iana"
+ },
+ "application/vnd.adobe.formscentral.fcdt": {
+ "source": "iana",
+ "extensions": ["fcdt"]
+ },
+ "application/vnd.adobe.fxp": {
+ "source": "iana",
+ "extensions": ["fxp","fxpl"]
+ },
+ "application/vnd.adobe.partial-upload": {
+ "source": "iana"
+ },
+ "application/vnd.adobe.xdp+xml": {
+ "source": "iana",
+ "extensions": ["xdp"]
+ },
+ "application/vnd.adobe.xfdf": {
+ "source": "iana",
+ "extensions": ["xfdf"]
+ },
+ "application/vnd.aether.imp": {
+ "source": "iana"
+ },
+ "application/vnd.ah-barcode": {
+ "source": "iana"
+ },
+ "application/vnd.ahead.space": {
+ "source": "iana",
+ "extensions": ["ahead"]
+ },
+ "application/vnd.airzip.filesecure.azf": {
+ "source": "iana",
+ "extensions": ["azf"]
+ },
+ "application/vnd.airzip.filesecure.azs": {
+ "source": "iana",
+ "extensions": ["azs"]
+ },
+ "application/vnd.amazon.ebook": {
+ "source": "apache",
+ "extensions": ["azw"]
+ },
+ "application/vnd.americandynamics.acc": {
+ "source": "iana",
+ "extensions": ["acc"]
+ },
+ "application/vnd.amiga.ami": {
+ "source": "iana",
+ "extensions": ["ami"]
+ },
+ "application/vnd.amundsen.maze+xml": {
+ "source": "iana"
+ },
+ "application/vnd.android.package-archive": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["apk"]
+ },
+ "application/vnd.anser-web-certificate-issue-initiation": {
+ "source": "iana",
+ "extensions": ["cii"]
+ },
+ "application/vnd.anser-web-funds-transfer-initiation": {
+ "source": "apache",
+ "extensions": ["fti"]
+ },
+ "application/vnd.antix.game-component": {
+ "source": "iana",
+ "extensions": ["atx"]
+ },
+ "application/vnd.apache.thrift.binary": {
+ "source": "iana"
+ },
+ "application/vnd.apache.thrift.compact": {
+ "source": "iana"
+ },
+ "application/vnd.apache.thrift.json": {
+ "source": "iana"
+ },
+ "application/vnd.api+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.apple.installer+xml": {
+ "source": "iana",
+ "extensions": ["mpkg"]
+ },
+ "application/vnd.apple.mpegurl": {
+ "source": "iana",
+ "extensions": ["m3u8"]
+ },
+ "application/vnd.arastra.swi": {
+ "source": "iana"
+ },
+ "application/vnd.aristanetworks.swi": {
+ "source": "iana",
+ "extensions": ["swi"]
+ },
+ "application/vnd.artsquare": {
+ "source": "iana"
+ },
+ "application/vnd.astraea-software.iota": {
+ "source": "iana",
+ "extensions": ["iota"]
+ },
+ "application/vnd.audiograph": {
+ "source": "iana",
+ "extensions": ["aep"]
+ },
+ "application/vnd.autopackage": {
+ "source": "iana"
+ },
+ "application/vnd.avistar+xml": {
+ "source": "iana"
+ },
+ "application/vnd.balsamiq.bmml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.bekitzur-stech+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.blueice.multipass": {
+ "source": "iana",
+ "extensions": ["mpm"]
+ },
+ "application/vnd.bluetooth.ep.oob": {
+ "source": "iana"
+ },
+ "application/vnd.bluetooth.le.oob": {
+ "source": "iana"
+ },
+ "application/vnd.bmi": {
+ "source": "iana",
+ "extensions": ["bmi"]
+ },
+ "application/vnd.businessobjects": {
+ "source": "iana",
+ "extensions": ["rep"]
+ },
+ "application/vnd.cab-jscript": {
+ "source": "iana"
+ },
+ "application/vnd.canon-cpdl": {
+ "source": "iana"
+ },
+ "application/vnd.canon-lips": {
+ "source": "iana"
+ },
+ "application/vnd.cendio.thinlinc.clientconf": {
+ "source": "iana"
+ },
+ "application/vnd.century-systems.tcp_stream": {
+ "source": "iana"
+ },
+ "application/vnd.chemdraw+xml": {
+ "source": "iana",
+ "extensions": ["cdxml"]
+ },
+ "application/vnd.chipnuts.karaoke-mmd": {
+ "source": "iana",
+ "extensions": ["mmd"]
+ },
+ "application/vnd.cinderella": {
+ "source": "iana",
+ "extensions": ["cdy"]
+ },
+ "application/vnd.cirpack.isdn-ext": {
+ "source": "iana"
+ },
+ "application/vnd.citationstyles.style+xml": {
+ "source": "iana"
+ },
+ "application/vnd.claymore": {
+ "source": "iana",
+ "extensions": ["cla"]
+ },
+ "application/vnd.cloanto.rp9": {
+ "source": "iana",
+ "extensions": ["rp9"]
+ },
+ "application/vnd.clonk.c4group": {
+ "source": "iana",
+ "extensions": ["c4g","c4d","c4f","c4p","c4u"]
+ },
+ "application/vnd.cluetrust.cartomobile-config": {
+ "source": "iana",
+ "extensions": ["c11amc"]
+ },
+ "application/vnd.cluetrust.cartomobile-config-pkg": {
+ "source": "iana",
+ "extensions": ["c11amz"]
+ },
+ "application/vnd.coffeescript": {
+ "source": "iana"
+ },
+ "application/vnd.collection+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.collection.doc+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.collection.next+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.commerce-battelle": {
+ "source": "iana"
+ },
+ "application/vnd.commonspace": {
+ "source": "iana",
+ "extensions": ["csp"]
+ },
+ "application/vnd.contact.cmsg": {
+ "source": "iana",
+ "extensions": ["cdbcmsg"]
+ },
+ "application/vnd.cosmocaller": {
+ "source": "iana",
+ "extensions": ["cmc"]
+ },
+ "application/vnd.crick.clicker": {
+ "source": "iana",
+ "extensions": ["clkx"]
+ },
+ "application/vnd.crick.clicker.keyboard": {
+ "source": "iana",
+ "extensions": ["clkk"]
+ },
+ "application/vnd.crick.clicker.palette": {
+ "source": "iana",
+ "extensions": ["clkp"]
+ },
+ "application/vnd.crick.clicker.template": {
+ "source": "iana",
+ "extensions": ["clkt"]
+ },
+ "application/vnd.crick.clicker.wordbank": {
+ "source": "iana",
+ "extensions": ["clkw"]
+ },
+ "application/vnd.criticaltools.wbs+xml": {
+ "source": "iana",
+ "extensions": ["wbs"]
+ },
+ "application/vnd.ctc-posml": {
+ "source": "iana",
+ "extensions": ["pml"]
+ },
+ "application/vnd.ctct.ws+xml": {
+ "source": "iana"
+ },
+ "application/vnd.cups-pdf": {
+ "source": "iana"
+ },
+ "application/vnd.cups-postscript": {
+ "source": "iana"
+ },
+ "application/vnd.cups-ppd": {
+ "source": "iana",
+ "extensions": ["ppd"]
+ },
+ "application/vnd.cups-raster": {
+ "source": "iana"
+ },
+ "application/vnd.cups-raw": {
+ "source": "iana"
+ },
+ "application/vnd.curl": {
+ "source": "iana"
+ },
+ "application/vnd.curl.car": {
+ "source": "apache",
+ "extensions": ["car"]
+ },
+ "application/vnd.curl.pcurl": {
+ "source": "apache",
+ "extensions": ["pcurl"]
+ },
+ "application/vnd.cyan.dean.root+xml": {
+ "source": "iana"
+ },
+ "application/vnd.cybank": {
+ "source": "iana"
+ },
+ "application/vnd.dart": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["dart"]
+ },
+ "application/vnd.data-vision.rdz": {
+ "source": "iana",
+ "extensions": ["rdz"]
+ },
+ "application/vnd.debian.binary-package": {
+ "source": "iana"
+ },
+ "application/vnd.dece.data": {
+ "source": "iana",
+ "extensions": ["uvf","uvvf","uvd","uvvd"]
+ },
+ "application/vnd.dece.ttml+xml": {
+ "source": "iana",
+ "extensions": ["uvt","uvvt"]
+ },
+ "application/vnd.dece.unspecified": {
+ "source": "iana",
+ "extensions": ["uvx","uvvx"]
+ },
+ "application/vnd.dece.zip": {
+ "source": "iana",
+ "extensions": ["uvz","uvvz"]
+ },
+ "application/vnd.denovo.fcselayout-link": {
+ "source": "iana",
+ "extensions": ["fe_launch"]
+ },
+ "application/vnd.desmume-movie": {
+ "source": "iana"
+ },
+ "application/vnd.dir-bi.plate-dl-nosuffix": {
+ "source": "iana"
+ },
+ "application/vnd.dm.delegation+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dna": {
+ "source": "iana",
+ "extensions": ["dna"]
+ },
+ "application/vnd.document+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.dolby.mlp": {
+ "source": "apache",
+ "extensions": ["mlp"]
+ },
+ "application/vnd.dolby.mobile.1": {
+ "source": "iana"
+ },
+ "application/vnd.dolby.mobile.2": {
+ "source": "iana"
+ },
+ "application/vnd.doremir.scorecloud-binary-document": {
+ "source": "iana"
+ },
+ "application/vnd.dpgraph": {
+ "source": "iana",
+ "extensions": ["dpg"]
+ },
+ "application/vnd.dreamfactory": {
+ "source": "iana",
+ "extensions": ["dfac"]
+ },
+ "application/vnd.ds-keypoint": {
+ "source": "apache",
+ "extensions": ["kpxx"]
+ },
+ "application/vnd.dtg.local": {
+ "source": "iana"
+ },
+ "application/vnd.dtg.local.flash": {
+ "source": "iana"
+ },
+ "application/vnd.dtg.local.html": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ait": {
+ "source": "iana",
+ "extensions": ["ait"]
+ },
+ "application/vnd.dvb.dvbj": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.esgcontainer": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcdftnotifaccess": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcesgaccess": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcesgaccess2": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcesgpdd": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.ipdcroaming": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.iptv.alfec-base": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.iptv.alfec-enhancement": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-aggregate-root+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-container+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-generic+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-ia-msglist+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-ia-registration-request+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-ia-registration-response+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.notif-init+xml": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.pfr": {
+ "source": "iana"
+ },
+ "application/vnd.dvb.service": {
+ "source": "iana",
+ "extensions": ["svc"]
+ },
+ "application/vnd.dxr": {
+ "source": "iana"
+ },
+ "application/vnd.dynageo": {
+ "source": "iana",
+ "extensions": ["geo"]
+ },
+ "application/vnd.dzr": {
+ "source": "iana"
+ },
+ "application/vnd.easykaraoke.cdgdownload": {
+ "source": "iana"
+ },
+ "application/vnd.ecdis-update": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.chart": {
+ "source": "iana",
+ "extensions": ["mag"]
+ },
+ "application/vnd.ecowin.filerequest": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.fileupdate": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.series": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.seriesrequest": {
+ "source": "iana"
+ },
+ "application/vnd.ecowin.seriesupdate": {
+ "source": "iana"
+ },
+ "application/vnd.emclient.accessrequest+xml": {
+ "source": "iana"
+ },
+ "application/vnd.enliven": {
+ "source": "iana",
+ "extensions": ["nml"]
+ },
+ "application/vnd.enphase.envoy": {
+ "source": "iana"
+ },
+ "application/vnd.eprints.data+xml": {
+ "source": "iana"
+ },
+ "application/vnd.epson.esf": {
+ "source": "iana",
+ "extensions": ["esf"]
+ },
+ "application/vnd.epson.msf": {
+ "source": "iana",
+ "extensions": ["msf"]
+ },
+ "application/vnd.epson.quickanime": {
+ "source": "iana",
+ "extensions": ["qam"]
+ },
+ "application/vnd.epson.salt": {
+ "source": "iana",
+ "extensions": ["slt"]
+ },
+ "application/vnd.epson.ssf": {
+ "source": "iana",
+ "extensions": ["ssf"]
+ },
+ "application/vnd.ericsson.quickcall": {
+ "source": "iana"
+ },
+ "application/vnd.eszigno3+xml": {
+ "source": "iana",
+ "extensions": ["es3","et3"]
+ },
+ "application/vnd.etsi.aoc+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.asic-e+zip": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.asic-s+zip": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.cug+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvcommand+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvdiscovery+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvprofile+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvsad-bc+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvsad-cod+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvsad-npvr+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvservice+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvsync+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.iptvueprofile+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.mcid+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.mheg5": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.overload-control-policy-dataset+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.pstn+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.sci+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.simservs+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.timestamp-token": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.tsl+xml": {
+ "source": "iana"
+ },
+ "application/vnd.etsi.tsl.der": {
+ "source": "iana"
+ },
+ "application/vnd.eudora.data": {
+ "source": "iana"
+ },
+ "application/vnd.ezpix-album": {
+ "source": "iana",
+ "extensions": ["ez2"]
+ },
+ "application/vnd.ezpix-package": {
+ "source": "iana",
+ "extensions": ["ez3"]
+ },
+ "application/vnd.f-secure.mobile": {
+ "source": "iana"
+ },
+ "application/vnd.fastcopy-disk-image": {
+ "source": "iana"
+ },
+ "application/vnd.fdf": {
+ "source": "iana",
+ "extensions": ["fdf"]
+ },
+ "application/vnd.fdsn.mseed": {
+ "source": "iana",
+ "extensions": ["mseed"]
+ },
+ "application/vnd.fdsn.seed": {
+ "source": "iana",
+ "extensions": ["seed","dataless"]
+ },
+ "application/vnd.ffsns": {
+ "source": "iana"
+ },
+ "application/vnd.fints": {
+ "source": "iana"
+ },
+ "application/vnd.flographit": {
+ "source": "iana",
+ "extensions": ["gph"]
+ },
+ "application/vnd.fluxtime.clip": {
+ "source": "iana",
+ "extensions": ["ftc"]
+ },
+ "application/vnd.font-fontforge-sfd": {
+ "source": "iana"
+ },
+ "application/vnd.framemaker": {
+ "source": "iana",
+ "extensions": ["fm","frame","maker","book"]
+ },
+ "application/vnd.frogans.fnc": {
+ "source": "iana",
+ "extensions": ["fnc"]
+ },
+ "application/vnd.frogans.ltf": {
+ "source": "iana",
+ "extensions": ["ltf"]
+ },
+ "application/vnd.fsc.weblaunch": {
+ "source": "iana",
+ "extensions": ["fsc"]
+ },
+ "application/vnd.fujitsu.oasys": {
+ "source": "iana",
+ "extensions": ["oas"]
+ },
+ "application/vnd.fujitsu.oasys2": {
+ "source": "iana",
+ "extensions": ["oa2"]
+ },
+ "application/vnd.fujitsu.oasys3": {
+ "source": "iana",
+ "extensions": ["oa3"]
+ },
+ "application/vnd.fujitsu.oasysgp": {
+ "source": "iana",
+ "extensions": ["fg5"]
+ },
+ "application/vnd.fujitsu.oasysprs": {
+ "source": "iana",
+ "extensions": ["bh2"]
+ },
+ "application/vnd.fujixerox.art-ex": {
+ "source": "iana"
+ },
+ "application/vnd.fujixerox.art4": {
+ "source": "iana"
+ },
+ "application/vnd.fujixerox.ddd": {
+ "source": "iana",
+ "extensions": ["ddd"]
+ },
+ "application/vnd.fujixerox.docuworks": {
+ "source": "iana",
+ "extensions": ["xdw"]
+ },
+ "application/vnd.fujixerox.docuworks.binder": {
+ "source": "iana",
+ "extensions": ["xbd"]
+ },
+ "application/vnd.fujixerox.docuworks.container": {
+ "source": "iana"
+ },
+ "application/vnd.fujixerox.hbpl": {
+ "source": "iana"
+ },
+ "application/vnd.fut-misnet": {
+ "source": "iana"
+ },
+ "application/vnd.fuzzysheet": {
+ "source": "iana",
+ "extensions": ["fzs"]
+ },
+ "application/vnd.genomatix.tuxedo": {
+ "source": "iana",
+ "extensions": ["txd"]
+ },
+ "application/vnd.geo+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.geocube+xml": {
+ "source": "iana"
+ },
+ "application/vnd.geogebra.file": {
+ "source": "iana",
+ "extensions": ["ggb"]
+ },
+ "application/vnd.geogebra.tool": {
+ "source": "iana",
+ "extensions": ["ggt"]
+ },
+ "application/vnd.geometry-explorer": {
+ "source": "iana",
+ "extensions": ["gex","gre"]
+ },
+ "application/vnd.geonext": {
+ "source": "iana",
+ "extensions": ["gxt"]
+ },
+ "application/vnd.geoplan": {
+ "source": "iana",
+ "extensions": ["g2w"]
+ },
+ "application/vnd.geospace": {
+ "source": "iana",
+ "extensions": ["g3w"]
+ },
+ "application/vnd.gerber": {
+ "source": "iana"
+ },
+ "application/vnd.globalplatform.card-content-mgt": {
+ "source": "iana"
+ },
+ "application/vnd.globalplatform.card-content-mgt-response": {
+ "source": "iana"
+ },
+ "application/vnd.gmx": {
+ "source": "iana",
+ "extensions": ["gmx"]
+ },
+ "application/vnd.google-earth.kml+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["kml"]
+ },
+ "application/vnd.google-earth.kmz": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["kmz"]
+ },
+ "application/vnd.gov.sk.e-form+xml": {
+ "source": "iana"
+ },
+ "application/vnd.gov.sk.e-form+zip": {
+ "source": "iana"
+ },
+ "application/vnd.gov.sk.xmldatacontainer+xml": {
+ "source": "iana"
+ },
+ "application/vnd.grafeq": {
+ "source": "iana",
+ "extensions": ["gqf","gqs"]
+ },
+ "application/vnd.gridmp": {
+ "source": "iana"
+ },
+ "application/vnd.groove-account": {
+ "source": "iana",
+ "extensions": ["gac"]
+ },
+ "application/vnd.groove-help": {
+ "source": "iana",
+ "extensions": ["ghf"]
+ },
+ "application/vnd.groove-identity-message": {
+ "source": "iana",
+ "extensions": ["gim"]
+ },
+ "application/vnd.groove-injector": {
+ "source": "iana",
+ "extensions": ["grv"]
+ },
+ "application/vnd.groove-tool-message": {
+ "source": "iana",
+ "extensions": ["gtm"]
+ },
+ "application/vnd.groove-tool-template": {
+ "source": "iana",
+ "extensions": ["tpl"]
+ },
+ "application/vnd.groove-vcard": {
+ "source": "iana",
+ "extensions": ["vcg"]
+ },
+ "application/vnd.hal+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.hal+xml": {
+ "source": "iana",
+ "extensions": ["hal"]
+ },
+ "application/vnd.handheld-entertainment+xml": {
+ "source": "iana",
+ "extensions": ["zmm"]
+ },
+ "application/vnd.hbci": {
+ "source": "iana",
+ "extensions": ["hbci"]
+ },
+ "application/vnd.hcl-bireports": {
+ "source": "iana"
+ },
+ "application/vnd.heroku+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.hhe.lesson-player": {
+ "source": "iana",
+ "extensions": ["les"]
+ },
+ "application/vnd.hp-hpgl": {
+ "source": "iana",
+ "extensions": ["hpgl"]
+ },
+ "application/vnd.hp-hpid": {
+ "source": "iana",
+ "extensions": ["hpid"]
+ },
+ "application/vnd.hp-hps": {
+ "source": "iana",
+ "extensions": ["hps"]
+ },
+ "application/vnd.hp-jlyt": {
+ "source": "iana",
+ "extensions": ["jlt"]
+ },
+ "application/vnd.hp-pcl": {
+ "source": "iana",
+ "extensions": ["pcl"]
+ },
+ "application/vnd.hp-pclxl": {
+ "source": "iana",
+ "extensions": ["pclxl"]
+ },
+ "application/vnd.httphone": {
+ "source": "iana"
+ },
+ "application/vnd.hydrostatix.sof-data": {
+ "source": "iana"
+ },
+ "application/vnd.hzn-3d-crossword": {
+ "source": "iana"
+ },
+ "application/vnd.ibm.afplinedata": {
+ "source": "iana"
+ },
+ "application/vnd.ibm.electronic-media": {
+ "source": "iana"
+ },
+ "application/vnd.ibm.minipay": {
+ "source": "iana",
+ "extensions": ["mpy"]
+ },
+ "application/vnd.ibm.modcap": {
+ "source": "iana",
+ "extensions": ["afp","listafp","list3820"]
+ },
+ "application/vnd.ibm.rights-management": {
+ "source": "iana",
+ "extensions": ["irm"]
+ },
+ "application/vnd.ibm.secure-container": {
+ "source": "iana",
+ "extensions": ["sc"]
+ },
+ "application/vnd.iccprofile": {
+ "source": "iana",
+ "extensions": ["icc","icm"]
+ },
+ "application/vnd.ieee.1905": {
+ "source": "iana"
+ },
+ "application/vnd.igloader": {
+ "source": "iana",
+ "extensions": ["igl"]
+ },
+ "application/vnd.immervision-ivp": {
+ "source": "iana",
+ "extensions": ["ivp"]
+ },
+ "application/vnd.immervision-ivu": {
+ "source": "iana",
+ "extensions": ["ivu"]
+ },
+ "application/vnd.ims.imsccv1p1": {
+ "source": "iana"
+ },
+ "application/vnd.ims.imsccv1p2": {
+ "source": "iana"
+ },
+ "application/vnd.ims.imsccv1p3": {
+ "source": "iana"
+ },
+ "application/vnd.ims.lis.v2.result+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolconsumerprofile+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolproxy+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolproxy.id+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolsettings+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.ims.lti.v2.toolsettings.simple+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.informedcontrol.rms+xml": {
+ "source": "iana"
+ },
+ "application/vnd.informix-visionary": {
+ "source": "iana"
+ },
+ "application/vnd.infotech.project": {
+ "source": "iana"
+ },
+ "application/vnd.infotech.project+xml": {
+ "source": "iana"
+ },
+ "application/vnd.innopath.wamp.notification": {
+ "source": "iana"
+ },
+ "application/vnd.insors.igm": {
+ "source": "iana",
+ "extensions": ["igm"]
+ },
+ "application/vnd.intercon.formnet": {
+ "source": "iana",
+ "extensions": ["xpw","xpx"]
+ },
+ "application/vnd.intergeo": {
+ "source": "iana",
+ "extensions": ["i2g"]
+ },
+ "application/vnd.intertrust.digibox": {
+ "source": "iana"
+ },
+ "application/vnd.intertrust.nncp": {
+ "source": "iana"
+ },
+ "application/vnd.intu.qbo": {
+ "source": "iana",
+ "extensions": ["qbo"]
+ },
+ "application/vnd.intu.qfx": {
+ "source": "iana",
+ "extensions": ["qfx"]
+ },
+ "application/vnd.iptc.g2.catalogitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.conceptitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.knowledgeitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.newsitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.newsmessage+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.packageitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.iptc.g2.planningitem+xml": {
+ "source": "iana"
+ },
+ "application/vnd.ipunplugged.rcprofile": {
+ "source": "iana",
+ "extensions": ["rcprofile"]
+ },
+ "application/vnd.irepository.package+xml": {
+ "source": "iana",
+ "extensions": ["irp"]
+ },
+ "application/vnd.is-xpr": {
+ "source": "iana",
+ "extensions": ["xpr"]
+ },
+ "application/vnd.isac.fcs": {
+ "source": "iana",
+ "extensions": ["fcs"]
+ },
+ "application/vnd.jam": {
+ "source": "iana",
+ "extensions": ["jam"]
+ },
+ "application/vnd.japannet-directory-service": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-jpnstore-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-payment-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-registration": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-registration-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-setstore-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-verification": {
+ "source": "iana"
+ },
+ "application/vnd.japannet-verification-wakeup": {
+ "source": "iana"
+ },
+ "application/vnd.jcp.javame.midlet-rms": {
+ "source": "iana",
+ "extensions": ["rms"]
+ },
+ "application/vnd.jisp": {
+ "source": "iana",
+ "extensions": ["jisp"]
+ },
+ "application/vnd.joost.joda-archive": {
+ "source": "iana",
+ "extensions": ["joda"]
+ },
+ "application/vnd.jsk.isdn-ngn": {
+ "source": "iana"
+ },
+ "application/vnd.kahootz": {
+ "source": "iana",
+ "extensions": ["ktz","ktr"]
+ },
+ "application/vnd.kde.karbon": {
+ "source": "iana",
+ "extensions": ["karbon"]
+ },
+ "application/vnd.kde.kchart": {
+ "source": "iana",
+ "extensions": ["chrt"]
+ },
+ "application/vnd.kde.kformula": {
+ "source": "iana",
+ "extensions": ["kfo"]
+ },
+ "application/vnd.kde.kivio": {
+ "source": "iana",
+ "extensions": ["flw"]
+ },
+ "application/vnd.kde.kontour": {
+ "source": "iana",
+ "extensions": ["kon"]
+ },
+ "application/vnd.kde.kpresenter": {
+ "source": "iana",
+ "extensions": ["kpr","kpt"]
+ },
+ "application/vnd.kde.kspread": {
+ "source": "iana",
+ "extensions": ["ksp"]
+ },
+ "application/vnd.kde.kword": {
+ "source": "iana",
+ "extensions": ["kwd","kwt"]
+ },
+ "application/vnd.kenameaapp": {
+ "source": "iana",
+ "extensions": ["htke"]
+ },
+ "application/vnd.kidspiration": {
+ "source": "iana",
+ "extensions": ["kia"]
+ },
+ "application/vnd.kinar": {
+ "source": "iana",
+ "extensions": ["kne","knp"]
+ },
+ "application/vnd.koan": {
+ "source": "iana",
+ "extensions": ["skp","skd","skt","skm"]
+ },
+ "application/vnd.kodak-descriptor": {
+ "source": "iana",
+ "extensions": ["sse"]
+ },
+ "application/vnd.las.las+xml": {
+ "source": "iana",
+ "extensions": ["lasxml"]
+ },
+ "application/vnd.liberty-request+xml": {
+ "source": "iana"
+ },
+ "application/vnd.llamagraphics.life-balance.desktop": {
+ "source": "iana",
+ "extensions": ["lbd"]
+ },
+ "application/vnd.llamagraphics.life-balance.exchange+xml": {
+ "source": "iana",
+ "extensions": ["lbe"]
+ },
+ "application/vnd.lotus-1-2-3": {
+ "source": "iana",
+ "extensions": ["123"]
+ },
+ "application/vnd.lotus-approach": {
+ "source": "iana",
+ "extensions": ["apr"]
+ },
+ "application/vnd.lotus-freelance": {
+ "source": "iana",
+ "extensions": ["pre"]
+ },
+ "application/vnd.lotus-notes": {
+ "source": "iana",
+ "extensions": ["nsf"]
+ },
+ "application/vnd.lotus-organizer": {
+ "source": "iana",
+ "extensions": ["org"]
+ },
+ "application/vnd.lotus-screencam": {
+ "source": "iana",
+ "extensions": ["scm"]
+ },
+ "application/vnd.lotus-wordpro": {
+ "source": "iana",
+ "extensions": ["lwp"]
+ },
+ "application/vnd.macports.portpkg": {
+ "source": "iana",
+ "extensions": ["portpkg"]
+ },
+ "application/vnd.marlin.drm.actiontoken+xml": {
+ "source": "iana"
+ },
+ "application/vnd.marlin.drm.conftoken+xml": {
+ "source": "iana"
+ },
+ "application/vnd.marlin.drm.license+xml": {
+ "source": "iana"
+ },
+ "application/vnd.marlin.drm.mdcf": {
+ "source": "iana"
+ },
+ "application/vnd.mason+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.maxmind.maxmind-db": {
+ "source": "iana"
+ },
+ "application/vnd.mcd": {
+ "source": "iana",
+ "extensions": ["mcd"]
+ },
+ "application/vnd.medcalcdata": {
+ "source": "iana",
+ "extensions": ["mc1"]
+ },
+ "application/vnd.mediastation.cdkey": {
+ "source": "iana",
+ "extensions": ["cdkey"]
+ },
+ "application/vnd.meridian-slingshot": {
+ "source": "iana"
+ },
+ "application/vnd.mfer": {
+ "source": "iana",
+ "extensions": ["mwf"]
+ },
+ "application/vnd.mfmp": {
+ "source": "iana",
+ "extensions": ["mfm"]
+ },
+ "application/vnd.micrografx.flo": {
+ "source": "iana",
+ "extensions": ["flo"]
+ },
+ "application/vnd.micrografx.igx": {
+ "source": "iana",
+ "extensions": ["igx"]
+ },
+ "application/vnd.miele+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.mif": {
+ "source": "iana",
+ "extensions": ["mif"]
+ },
+ "application/vnd.minisoft-hp3000-save": {
+ "source": "iana"
+ },
+ "application/vnd.mitsubishi.misty-guard.trustweb": {
+ "source": "iana"
+ },
+ "application/vnd.mobius.daf": {
+ "source": "iana",
+ "extensions": ["daf"]
+ },
+ "application/vnd.mobius.dis": {
+ "source": "iana",
+ "extensions": ["dis"]
+ },
+ "application/vnd.mobius.mbk": {
+ "source": "iana",
+ "extensions": ["mbk"]
+ },
+ "application/vnd.mobius.mqy": {
+ "source": "iana",
+ "extensions": ["mqy"]
+ },
+ "application/vnd.mobius.msl": {
+ "source": "iana",
+ "extensions": ["msl"]
+ },
+ "application/vnd.mobius.plc": {
+ "source": "iana",
+ "extensions": ["plc"]
+ },
+ "application/vnd.mobius.txf": {
+ "source": "iana",
+ "extensions": ["txf"]
+ },
+ "application/vnd.mophun.application": {
+ "source": "iana",
+ "extensions": ["mpn"]
+ },
+ "application/vnd.mophun.certificate": {
+ "source": "iana",
+ "extensions": ["mpc"]
+ },
+ "application/vnd.motorola.flexsuite": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.adsi": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.fis": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.gotap": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.kmr": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.ttc": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.flexsuite.wem": {
+ "source": "iana"
+ },
+ "application/vnd.motorola.iprm": {
+ "source": "iana"
+ },
+ "application/vnd.mozilla.xul+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["xul"]
+ },
+ "application/vnd.ms-3mfdocument": {
+ "source": "iana"
+ },
+ "application/vnd.ms-artgalry": {
+ "source": "iana",
+ "extensions": ["cil"]
+ },
+ "application/vnd.ms-asf": {
+ "source": "iana"
+ },
+ "application/vnd.ms-cab-compressed": {
+ "source": "iana",
+ "extensions": ["cab"]
+ },
+ "application/vnd.ms-color.iccprofile": {
+ "source": "apache"
+ },
+ "application/vnd.ms-excel": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["xls","xlm","xla","xlc","xlt","xlw"]
+ },
+ "application/vnd.ms-excel.addin.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["xlam"]
+ },
+ "application/vnd.ms-excel.sheet.binary.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["xlsb"]
+ },
+ "application/vnd.ms-excel.sheet.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["xlsm"]
+ },
+ "application/vnd.ms-excel.template.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["xltm"]
+ },
+ "application/vnd.ms-fontobject": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["eot"]
+ },
+ "application/vnd.ms-htmlhelp": {
+ "source": "iana",
+ "extensions": ["chm"]
+ },
+ "application/vnd.ms-ims": {
+ "source": "iana",
+ "extensions": ["ims"]
+ },
+ "application/vnd.ms-lrm": {
+ "source": "iana",
+ "extensions": ["lrm"]
+ },
+ "application/vnd.ms-office.activex+xml": {
+ "source": "iana"
+ },
+ "application/vnd.ms-officetheme": {
+ "source": "iana",
+ "extensions": ["thmx"]
+ },
+ "application/vnd.ms-opentype": {
+ "source": "apache",
+ "compressible": true
+ },
+ "application/vnd.ms-package.obfuscated-opentype": {
+ "source": "apache"
+ },
+ "application/vnd.ms-pki.seccat": {
+ "source": "apache",
+ "extensions": ["cat"]
+ },
+ "application/vnd.ms-pki.stl": {
+ "source": "apache",
+ "extensions": ["stl"]
+ },
+ "application/vnd.ms-playready.initiator+xml": {
+ "source": "iana"
+ },
+ "application/vnd.ms-powerpoint": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["ppt","pps","pot"]
+ },
+ "application/vnd.ms-powerpoint.addin.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["ppam"]
+ },
+ "application/vnd.ms-powerpoint.presentation.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["pptm"]
+ },
+ "application/vnd.ms-powerpoint.slide.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["sldm"]
+ },
+ "application/vnd.ms-powerpoint.slideshow.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["ppsm"]
+ },
+ "application/vnd.ms-powerpoint.template.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["potm"]
+ },
+ "application/vnd.ms-printing.printticket+xml": {
+ "source": "apache"
+ },
+ "application/vnd.ms-project": {
+ "source": "iana",
+ "extensions": ["mpp","mpt"]
+ },
+ "application/vnd.ms-tnef": {
+ "source": "iana"
+ },
+ "application/vnd.ms-windows.printerpairing": {
+ "source": "iana"
+ },
+ "application/vnd.ms-wmdrm.lic-chlg-req": {
+ "source": "iana"
+ },
+ "application/vnd.ms-wmdrm.lic-resp": {
+ "source": "iana"
+ },
+ "application/vnd.ms-wmdrm.meter-chlg-req": {
+ "source": "iana"
+ },
+ "application/vnd.ms-wmdrm.meter-resp": {
+ "source": "iana"
+ },
+ "application/vnd.ms-word.document.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["docm"]
+ },
+ "application/vnd.ms-word.template.macroenabled.12": {
+ "source": "iana",
+ "extensions": ["dotm"]
+ },
+ "application/vnd.ms-works": {
+ "source": "iana",
+ "extensions": ["wps","wks","wcm","wdb"]
+ },
+ "application/vnd.ms-wpl": {
+ "source": "iana",
+ "extensions": ["wpl"]
+ },
+ "application/vnd.ms-xpsdocument": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["xps"]
+ },
+ "application/vnd.msa-disk-image": {
+ "source": "iana"
+ },
+ "application/vnd.mseq": {
+ "source": "iana",
+ "extensions": ["mseq"]
+ },
+ "application/vnd.msign": {
+ "source": "iana"
+ },
+ "application/vnd.multiad.creator": {
+ "source": "iana"
+ },
+ "application/vnd.multiad.creator.cif": {
+ "source": "iana"
+ },
+ "application/vnd.music-niff": {
+ "source": "iana"
+ },
+ "application/vnd.musician": {
+ "source": "iana",
+ "extensions": ["mus"]
+ },
+ "application/vnd.muvee.style": {
+ "source": "iana",
+ "extensions": ["msty"]
+ },
+ "application/vnd.mynfc": {
+ "source": "iana",
+ "extensions": ["taglet"]
+ },
+ "application/vnd.ncd.control": {
+ "source": "iana"
+ },
+ "application/vnd.ncd.reference": {
+ "source": "iana"
+ },
+ "application/vnd.nervana": {
+ "source": "iana"
+ },
+ "application/vnd.netfpx": {
+ "source": "iana"
+ },
+ "application/vnd.neurolanguage.nlu": {
+ "source": "iana",
+ "extensions": ["nlu"]
+ },
+ "application/vnd.nintendo.nitro.rom": {
+ "source": "iana"
+ },
+ "application/vnd.nintendo.snes.rom": {
+ "source": "iana"
+ },
+ "application/vnd.nitf": {
+ "source": "iana",
+ "extensions": ["ntf","nitf"]
+ },
+ "application/vnd.noblenet-directory": {
+ "source": "iana",
+ "extensions": ["nnd"]
+ },
+ "application/vnd.noblenet-sealer": {
+ "source": "iana",
+ "extensions": ["nns"]
+ },
+ "application/vnd.noblenet-web": {
+ "source": "iana",
+ "extensions": ["nnw"]
+ },
+ "application/vnd.nokia.catalogs": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.conml+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.conml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.iptv.config+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.isds-radio-presets": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.landmark+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.landmark+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.landmarkcollection+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.n-gage.ac+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.n-gage.data": {
+ "source": "iana",
+ "extensions": ["ngdat"]
+ },
+ "application/vnd.nokia.n-gage.symbian.install": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.ncd": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.pcd+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.pcd+xml": {
+ "source": "iana"
+ },
+ "application/vnd.nokia.radio-preset": {
+ "source": "iana",
+ "extensions": ["rpst"]
+ },
+ "application/vnd.nokia.radio-presets": {
+ "source": "iana",
+ "extensions": ["rpss"]
+ },
+ "application/vnd.novadigm.edm": {
+ "source": "iana",
+ "extensions": ["edm"]
+ },
+ "application/vnd.novadigm.edx": {
+ "source": "iana",
+ "extensions": ["edx"]
+ },
+ "application/vnd.novadigm.ext": {
+ "source": "iana",
+ "extensions": ["ext"]
+ },
+ "application/vnd.ntt-local.content-share": {
+ "source": "iana"
+ },
+ "application/vnd.ntt-local.file-transfer": {
+ "source": "iana"
+ },
+ "application/vnd.ntt-local.ogw_remote-access": {
+ "source": "iana"
+ },
+ "application/vnd.ntt-local.sip-ta_remote": {
+ "source": "iana"
+ },
+ "application/vnd.ntt-local.sip-ta_tcp_stream": {
+ "source": "iana"
+ },
+ "application/vnd.oasis.opendocument.chart": {
+ "source": "iana",
+ "extensions": ["odc"]
+ },
+ "application/vnd.oasis.opendocument.chart-template": {
+ "source": "iana",
+ "extensions": ["otc"]
+ },
+ "application/vnd.oasis.opendocument.database": {
+ "source": "iana",
+ "extensions": ["odb"]
+ },
+ "application/vnd.oasis.opendocument.formula": {
+ "source": "iana",
+ "extensions": ["odf"]
+ },
+ "application/vnd.oasis.opendocument.formula-template": {
+ "source": "iana",
+ "extensions": ["odft"]
+ },
+ "application/vnd.oasis.opendocument.graphics": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["odg"]
+ },
+ "application/vnd.oasis.opendocument.graphics-template": {
+ "source": "iana",
+ "extensions": ["otg"]
+ },
+ "application/vnd.oasis.opendocument.image": {
+ "source": "iana",
+ "extensions": ["odi"]
+ },
+ "application/vnd.oasis.opendocument.image-template": {
+ "source": "iana",
+ "extensions": ["oti"]
+ },
+ "application/vnd.oasis.opendocument.presentation": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["odp"]
+ },
+ "application/vnd.oasis.opendocument.presentation-template": {
+ "source": "iana",
+ "extensions": ["otp"]
+ },
+ "application/vnd.oasis.opendocument.spreadsheet": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["ods"]
+ },
+ "application/vnd.oasis.opendocument.spreadsheet-template": {
+ "source": "iana",
+ "extensions": ["ots"]
+ },
+ "application/vnd.oasis.opendocument.text": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["odt"]
+ },
+ "application/vnd.oasis.opendocument.text-master": {
+ "source": "iana",
+ "extensions": ["odm"]
+ },
+ "application/vnd.oasis.opendocument.text-template": {
+ "source": "iana",
+ "extensions": ["ott"]
+ },
+ "application/vnd.oasis.opendocument.text-web": {
+ "source": "iana",
+ "extensions": ["oth"]
+ },
+ "application/vnd.obn": {
+ "source": "iana"
+ },
+ "application/vnd.oftn.l10n+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.oipf.contentaccessdownload+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.contentaccessstreaming+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.cspg-hexbinary": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.dae.svg+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.dae.xhtml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.mippvcontrolmessage+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.pae.gem": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.spdiscovery+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.spdlist+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.ueprofile+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oipf.userprofile+xml": {
+ "source": "iana"
+ },
+ "application/vnd.olpc-sugar": {
+ "source": "iana",
+ "extensions": ["xo"]
+ },
+ "application/vnd.oma-scws-config": {
+ "source": "iana"
+ },
+ "application/vnd.oma-scws-http-request": {
+ "source": "iana"
+ },
+ "application/vnd.oma-scws-http-response": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.associated-procedure-parameter+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.drm-trigger+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.imd+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.ltkm": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.notification+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.provisioningtrigger": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.sgboot": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.sgdd+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.sgdu": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.simple-symbol-container": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.smartcard-trigger+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.sprov+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.bcast.stkm": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-address-book+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-feature-handler+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-pcc+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-subs-invite+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.cab-user-prefs+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.dcd": {
+ "source": "iana"
+ },
+ "application/vnd.oma.dcdc": {
+ "source": "iana"
+ },
+ "application/vnd.oma.dd2+xml": {
+ "source": "iana",
+ "extensions": ["dd2"]
+ },
+ "application/vnd.oma.drm.risd+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.group-usage-list+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.pal+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.detailed-progress-report+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.final-report+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.groups+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.invocation-descriptor+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.poc.optimized-progress-report+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.push": {
+ "source": "iana"
+ },
+ "application/vnd.oma.scidm.messages+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oma.xcap-directory+xml": {
+ "source": "iana"
+ },
+ "application/vnd.omads-email+xml": {
+ "source": "iana"
+ },
+ "application/vnd.omads-file+xml": {
+ "source": "iana"
+ },
+ "application/vnd.omads-folder+xml": {
+ "source": "iana"
+ },
+ "application/vnd.omaloc-supl-init": {
+ "source": "iana"
+ },
+ "application/vnd.openeye.oeb": {
+ "source": "iana"
+ },
+ "application/vnd.openofficeorg.extension": {
+ "source": "apache",
+ "extensions": ["oxt"]
+ },
+ "application/vnd.openxmlformats-officedocument.custom-properties+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.customxmlproperties+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawing+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.chart+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.chartshapes+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.diagramcolors+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.diagramdata+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.diagramlayout+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.drawingml.diagramstyle+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.extended-properties+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml-template": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.commentauthors+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.comments+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.handoutmaster+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.notesmaster+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.notesslide+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.presentation": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["pptx"]
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.presentation.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.presprops+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slide": {
+ "source": "iana",
+ "extensions": ["sldx"]
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slide+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slidelayout+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slidemaster+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slideshow": {
+ "source": "iana",
+ "extensions": ["ppsx"]
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slideshow.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.slideupdateinfo+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.tablestyles+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.tags+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.template": {
+ "source": "apache",
+ "extensions": ["potx"]
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.template.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.presentationml.viewprops+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml-template": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.calcchain+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.chartsheet+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.comments+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.connections+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.dialogsheet+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.externallink+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcachedefinition+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.pivotcacherecords+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.pivottable+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.querytable+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionheaders+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.revisionlog+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.sharedstrings+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["xlsx"]
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.sheet.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.sheetmetadata+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.styles+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.table+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.tablesinglecells+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.template": {
+ "source": "apache",
+ "extensions": ["xltx"]
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.template.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.usernames+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.volatiledependencies+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.spreadsheetml.worksheet+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.theme+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.themeoverride+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.vmldrawing": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml-template": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.comments+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.document": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["docx"]
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.document.glossary+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.document.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.endnotes+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.fonttable+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.footer+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.footnotes+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.numbering+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.settings+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.styles+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.template": {
+ "source": "apache",
+ "extensions": ["dotx"]
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.template.main+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-officedocument.wordprocessingml.websettings+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-package.core-properties+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-package.digital-signature-xmlsignature+xml": {
+ "source": "iana"
+ },
+ "application/vnd.openxmlformats-package.relationships+xml": {
+ "source": "iana"
+ },
+ "application/vnd.oracle.resource+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.orange.indata": {
+ "source": "iana"
+ },
+ "application/vnd.osa.netdeploy": {
+ "source": "iana"
+ },
+ "application/vnd.osgeo.mapguide.package": {
+ "source": "iana",
+ "extensions": ["mgp"]
+ },
+ "application/vnd.osgi.bundle": {
+ "source": "iana"
+ },
+ "application/vnd.osgi.dp": {
+ "source": "iana",
+ "extensions": ["dp"]
+ },
+ "application/vnd.osgi.subsystem": {
+ "source": "iana",
+ "extensions": ["esa"]
+ },
+ "application/vnd.otps.ct-kip+xml": {
+ "source": "iana"
+ },
+ "application/vnd.palm": {
+ "source": "iana",
+ "extensions": ["pdb","pqa","oprc"]
+ },
+ "application/vnd.panoply": {
+ "source": "iana"
+ },
+ "application/vnd.paos+xml": {
+ "source": "iana"
+ },
+ "application/vnd.paos.xml": {
+ "source": "apache"
+ },
+ "application/vnd.pawaafile": {
+ "source": "iana",
+ "extensions": ["paw"]
+ },
+ "application/vnd.pcos": {
+ "source": "iana"
+ },
+ "application/vnd.pg.format": {
+ "source": "iana",
+ "extensions": ["str"]
+ },
+ "application/vnd.pg.osasli": {
+ "source": "iana",
+ "extensions": ["ei6"]
+ },
+ "application/vnd.piaccess.application-licence": {
+ "source": "iana"
+ },
+ "application/vnd.picsel": {
+ "source": "iana",
+ "extensions": ["efif"]
+ },
+ "application/vnd.pmi.widget": {
+ "source": "iana",
+ "extensions": ["wg"]
+ },
+ "application/vnd.poc.group-advertisement+xml": {
+ "source": "iana"
+ },
+ "application/vnd.pocketlearn": {
+ "source": "iana",
+ "extensions": ["plf"]
+ },
+ "application/vnd.powerbuilder6": {
+ "source": "iana",
+ "extensions": ["pbd"]
+ },
+ "application/vnd.powerbuilder6-s": {
+ "source": "iana"
+ },
+ "application/vnd.powerbuilder7": {
+ "source": "iana"
+ },
+ "application/vnd.powerbuilder7-s": {
+ "source": "iana"
+ },
+ "application/vnd.powerbuilder75": {
+ "source": "iana"
+ },
+ "application/vnd.powerbuilder75-s": {
+ "source": "iana"
+ },
+ "application/vnd.preminet": {
+ "source": "iana"
+ },
+ "application/vnd.previewsystems.box": {
+ "source": "iana",
+ "extensions": ["box"]
+ },
+ "application/vnd.proteus.magazine": {
+ "source": "iana",
+ "extensions": ["mgz"]
+ },
+ "application/vnd.publishare-delta-tree": {
+ "source": "iana",
+ "extensions": ["qps"]
+ },
+ "application/vnd.pvi.ptid1": {
+ "source": "iana",
+ "extensions": ["ptid"]
+ },
+ "application/vnd.pwg-multiplexed": {
+ "source": "iana"
+ },
+ "application/vnd.pwg-xhtml-print+xml": {
+ "source": "iana"
+ },
+ "application/vnd.qualcomm.brew-app-res": {
+ "source": "iana"
+ },
+ "application/vnd.quark.quarkxpress": {
+ "source": "iana",
+ "extensions": ["qxd","qxt","qwd","qwt","qxl","qxb"]
+ },
+ "application/vnd.quobject-quoxdocument": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.moml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit-conf+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit-conn+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit-dialog+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-audit-stream+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-conf+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-base+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-fax-detect+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-fax-sendrecv+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-group+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-speech+xml": {
+ "source": "iana"
+ },
+ "application/vnd.radisys.msml-dialog-transform+xml": {
+ "source": "iana"
+ },
+ "application/vnd.rainstor.data": {
+ "source": "iana"
+ },
+ "application/vnd.rapid": {
+ "source": "iana"
+ },
+ "application/vnd.realvnc.bed": {
+ "source": "iana",
+ "extensions": ["bed"]
+ },
+ "application/vnd.recordare.musicxml": {
+ "source": "iana",
+ "extensions": ["mxl"]
+ },
+ "application/vnd.recordare.musicxml+xml": {
+ "source": "iana",
+ "extensions": ["musicxml"]
+ },
+ "application/vnd.renlearn.rlprint": {
+ "source": "iana"
+ },
+ "application/vnd.rig.cryptonote": {
+ "source": "iana",
+ "extensions": ["cryptonote"]
+ },
+ "application/vnd.rim.cod": {
+ "source": "apache",
+ "extensions": ["cod"]
+ },
+ "application/vnd.rn-realmedia": {
+ "source": "apache",
+ "extensions": ["rm"]
+ },
+ "application/vnd.rn-realmedia-vbr": {
+ "source": "apache",
+ "extensions": ["rmvb"]
+ },
+ "application/vnd.route66.link66+xml": {
+ "source": "iana",
+ "extensions": ["link66"]
+ },
+ "application/vnd.rs-274x": {
+ "source": "iana"
+ },
+ "application/vnd.ruckus.download": {
+ "source": "iana"
+ },
+ "application/vnd.s3sms": {
+ "source": "iana"
+ },
+ "application/vnd.sailingtracker.track": {
+ "source": "iana",
+ "extensions": ["st"]
+ },
+ "application/vnd.sbm.cid": {
+ "source": "iana"
+ },
+ "application/vnd.sbm.mid2": {
+ "source": "iana"
+ },
+ "application/vnd.scribus": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.3df": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.csf": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.doc": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.eml": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.mht": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.net": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.ppt": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.tiff": {
+ "source": "iana"
+ },
+ "application/vnd.sealed.xls": {
+ "source": "iana"
+ },
+ "application/vnd.sealedmedia.softseal.html": {
+ "source": "iana"
+ },
+ "application/vnd.sealedmedia.softseal.pdf": {
+ "source": "iana"
+ },
+ "application/vnd.seemail": {
+ "source": "iana",
+ "extensions": ["see"]
+ },
+ "application/vnd.sema": {
+ "source": "iana",
+ "extensions": ["sema"]
+ },
+ "application/vnd.semd": {
+ "source": "iana",
+ "extensions": ["semd"]
+ },
+ "application/vnd.semf": {
+ "source": "iana",
+ "extensions": ["semf"]
+ },
+ "application/vnd.shana.informed.formdata": {
+ "source": "iana",
+ "extensions": ["ifm"]
+ },
+ "application/vnd.shana.informed.formtemplate": {
+ "source": "iana",
+ "extensions": ["itp"]
+ },
+ "application/vnd.shana.informed.interchange": {
+ "source": "iana",
+ "extensions": ["iif"]
+ },
+ "application/vnd.shana.informed.package": {
+ "source": "iana",
+ "extensions": ["ipk"]
+ },
+ "application/vnd.simtech-mindmapper": {
+ "source": "iana",
+ "extensions": ["twd","twds"]
+ },
+ "application/vnd.siren+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.smaf": {
+ "source": "iana",
+ "extensions": ["mmf"]
+ },
+ "application/vnd.smart.notebook": {
+ "source": "iana"
+ },
+ "application/vnd.smart.teacher": {
+ "source": "iana",
+ "extensions": ["teacher"]
+ },
+ "application/vnd.software602.filler.form+xml": {
+ "source": "iana"
+ },
+ "application/vnd.software602.filler.form-xml-zip": {
+ "source": "iana"
+ },
+ "application/vnd.solent.sdkm+xml": {
+ "source": "iana",
+ "extensions": ["sdkm","sdkd"]
+ },
+ "application/vnd.spotfire.dxp": {
+ "source": "iana",
+ "extensions": ["dxp"]
+ },
+ "application/vnd.spotfire.sfs": {
+ "source": "iana",
+ "extensions": ["sfs"]
+ },
+ "application/vnd.sss-cod": {
+ "source": "iana"
+ },
+ "application/vnd.sss-dtf": {
+ "source": "iana"
+ },
+ "application/vnd.sss-ntf": {
+ "source": "iana"
+ },
+ "application/vnd.stardivision.calc": {
+ "source": "apache",
+ "extensions": ["sdc"]
+ },
+ "application/vnd.stardivision.draw": {
+ "source": "apache",
+ "extensions": ["sda"]
+ },
+ "application/vnd.stardivision.impress": {
+ "source": "apache",
+ "extensions": ["sdd"]
+ },
+ "application/vnd.stardivision.math": {
+ "source": "apache",
+ "extensions": ["smf"]
+ },
+ "application/vnd.stardivision.writer": {
+ "source": "apache",
+ "extensions": ["sdw","vor"]
+ },
+ "application/vnd.stardivision.writer-global": {
+ "source": "apache",
+ "extensions": ["sgl"]
+ },
+ "application/vnd.stepmania.package": {
+ "source": "iana",
+ "extensions": ["smzip"]
+ },
+ "application/vnd.stepmania.stepchart": {
+ "source": "iana",
+ "extensions": ["sm"]
+ },
+ "application/vnd.street-stream": {
+ "source": "iana"
+ },
+ "application/vnd.sun.wadl+xml": {
+ "source": "iana"
+ },
+ "application/vnd.sun.xml.calc": {
+ "source": "apache",
+ "extensions": ["sxc"]
+ },
+ "application/vnd.sun.xml.calc.template": {
+ "source": "apache",
+ "extensions": ["stc"]
+ },
+ "application/vnd.sun.xml.draw": {
+ "source": "apache",
+ "extensions": ["sxd"]
+ },
+ "application/vnd.sun.xml.draw.template": {
+ "source": "apache",
+ "extensions": ["std"]
+ },
+ "application/vnd.sun.xml.impress": {
+ "source": "apache",
+ "extensions": ["sxi"]
+ },
+ "application/vnd.sun.xml.impress.template": {
+ "source": "apache",
+ "extensions": ["sti"]
+ },
+ "application/vnd.sun.xml.math": {
+ "source": "apache",
+ "extensions": ["sxm"]
+ },
+ "application/vnd.sun.xml.writer": {
+ "source": "apache",
+ "extensions": ["sxw"]
+ },
+ "application/vnd.sun.xml.writer.global": {
+ "source": "apache",
+ "extensions": ["sxg"]
+ },
+ "application/vnd.sun.xml.writer.template": {
+ "source": "apache",
+ "extensions": ["stw"]
+ },
+ "application/vnd.sus-calendar": {
+ "source": "iana",
+ "extensions": ["sus","susp"]
+ },
+ "application/vnd.svd": {
+ "source": "iana",
+ "extensions": ["svd"]
+ },
+ "application/vnd.swiftview-ics": {
+ "source": "iana"
+ },
+ "application/vnd.symbian.install": {
+ "source": "apache",
+ "extensions": ["sis","sisx"]
+ },
+ "application/vnd.syncml+xml": {
+ "source": "iana",
+ "extensions": ["xsm"]
+ },
+ "application/vnd.syncml.dm+wbxml": {
+ "source": "iana",
+ "extensions": ["bdm"]
+ },
+ "application/vnd.syncml.dm+xml": {
+ "source": "iana",
+ "extensions": ["xdm"]
+ },
+ "application/vnd.syncml.dm.notification": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.dmddf+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.dmddf+xml": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.dmtnds+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.dmtnds+xml": {
+ "source": "iana"
+ },
+ "application/vnd.syncml.ds.notification": {
+ "source": "iana"
+ },
+ "application/vnd.tao.intent-module-archive": {
+ "source": "iana",
+ "extensions": ["tao"]
+ },
+ "application/vnd.tcpdump.pcap": {
+ "source": "iana",
+ "extensions": ["pcap","cap","dmp"]
+ },
+ "application/vnd.tmd.mediaflex.api+xml": {
+ "source": "iana"
+ },
+ "application/vnd.tmobile-livetv": {
+ "source": "iana",
+ "extensions": ["tmo"]
+ },
+ "application/vnd.trid.tpt": {
+ "source": "iana",
+ "extensions": ["tpt"]
+ },
+ "application/vnd.triscape.mxs": {
+ "source": "iana",
+ "extensions": ["mxs"]
+ },
+ "application/vnd.trueapp": {
+ "source": "iana",
+ "extensions": ["tra"]
+ },
+ "application/vnd.truedoc": {
+ "source": "iana"
+ },
+ "application/vnd.ubisoft.webplayer": {
+ "source": "iana"
+ },
+ "application/vnd.ufdl": {
+ "source": "iana",
+ "extensions": ["ufd","ufdl"]
+ },
+ "application/vnd.uiq.theme": {
+ "source": "iana",
+ "extensions": ["utz"]
+ },
+ "application/vnd.umajin": {
+ "source": "iana",
+ "extensions": ["umj"]
+ },
+ "application/vnd.unity": {
+ "source": "iana",
+ "extensions": ["unityweb"]
+ },
+ "application/vnd.uoml+xml": {
+ "source": "iana",
+ "extensions": ["uoml"]
+ },
+ "application/vnd.uplanet.alert": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.alert-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.bearer-choice": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.bearer-choice-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.cacheop": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.cacheop-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.channel": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.channel-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.list": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.list-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.listcmd": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.listcmd-wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.uplanet.signal": {
+ "source": "iana"
+ },
+ "application/vnd.valve.source.material": {
+ "source": "iana"
+ },
+ "application/vnd.vcx": {
+ "source": "iana",
+ "extensions": ["vcx"]
+ },
+ "application/vnd.vd-study": {
+ "source": "iana"
+ },
+ "application/vnd.vectorworks": {
+ "source": "iana"
+ },
+ "application/vnd.verimatrix.vcas": {
+ "source": "iana"
+ },
+ "application/vnd.vidsoft.vidconference": {
+ "source": "iana"
+ },
+ "application/vnd.visio": {
+ "source": "iana",
+ "extensions": ["vsd","vst","vss","vsw"]
+ },
+ "application/vnd.visionary": {
+ "source": "iana",
+ "extensions": ["vis"]
+ },
+ "application/vnd.vividence.scriptfile": {
+ "source": "iana"
+ },
+ "application/vnd.vsf": {
+ "source": "iana",
+ "extensions": ["vsf"]
+ },
+ "application/vnd.wap.sic": {
+ "source": "iana"
+ },
+ "application/vnd.wap.slc": {
+ "source": "iana"
+ },
+ "application/vnd.wap.wbxml": {
+ "source": "iana",
+ "extensions": ["wbxml"]
+ },
+ "application/vnd.wap.wmlc": {
+ "source": "iana",
+ "extensions": ["wmlc"]
+ },
+ "application/vnd.wap.wmlscriptc": {
+ "source": "iana",
+ "extensions": ["wmlsc"]
+ },
+ "application/vnd.webturbo": {
+ "source": "iana",
+ "extensions": ["wtb"]
+ },
+ "application/vnd.wfa.p2p": {
+ "source": "iana"
+ },
+ "application/vnd.wfa.wsc": {
+ "source": "iana"
+ },
+ "application/vnd.windows.devicepairing": {
+ "source": "iana"
+ },
+ "application/vnd.wmc": {
+ "source": "iana"
+ },
+ "application/vnd.wmf.bootstrap": {
+ "source": "iana"
+ },
+ "application/vnd.wolfram.mathematica": {
+ "source": "iana"
+ },
+ "application/vnd.wolfram.mathematica.package": {
+ "source": "iana"
+ },
+ "application/vnd.wolfram.player": {
+ "source": "iana",
+ "extensions": ["nbp"]
+ },
+ "application/vnd.wordperfect": {
+ "source": "iana",
+ "extensions": ["wpd"]
+ },
+ "application/vnd.wqd": {
+ "source": "iana",
+ "extensions": ["wqd"]
+ },
+ "application/vnd.wrq-hp3000-labelled": {
+ "source": "iana"
+ },
+ "application/vnd.wt.stf": {
+ "source": "iana",
+ "extensions": ["stf"]
+ },
+ "application/vnd.wv.csp+wbxml": {
+ "source": "iana"
+ },
+ "application/vnd.wv.csp+xml": {
+ "source": "iana"
+ },
+ "application/vnd.wv.ssp+xml": {
+ "source": "iana"
+ },
+ "application/vnd.xacml+json": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/vnd.xara": {
+ "source": "iana",
+ "extensions": ["xar"]
+ },
+ "application/vnd.xfdl": {
+ "source": "iana",
+ "extensions": ["xfdl"]
+ },
+ "application/vnd.xfdl.webform": {
+ "source": "iana"
+ },
+ "application/vnd.xmi+xml": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.cpkg": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.dpkg": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.plan": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.ppkg": {
+ "source": "iana"
+ },
+ "application/vnd.xmpie.xlim": {
+ "source": "iana"
+ },
+ "application/vnd.yamaha.hv-dic": {
+ "source": "iana",
+ "extensions": ["hvd"]
+ },
+ "application/vnd.yamaha.hv-script": {
+ "source": "iana",
+ "extensions": ["hvs"]
+ },
+ "application/vnd.yamaha.hv-voice": {
+ "source": "iana",
+ "extensions": ["hvp"]
+ },
+ "application/vnd.yamaha.openscoreformat": {
+ "source": "iana",
+ "extensions": ["osf"]
+ },
+ "application/vnd.yamaha.openscoreformat.osfpvg+xml": {
+ "source": "iana",
+ "extensions": ["osfpvg"]
+ },
+ "application/vnd.yamaha.remote-setup": {
+ "source": "iana"
+ },
+ "application/vnd.yamaha.smaf-audio": {
+ "source": "iana",
+ "extensions": ["saf"]
+ },
+ "application/vnd.yamaha.smaf-phrase": {
+ "source": "iana",
+ "extensions": ["spf"]
+ },
+ "application/vnd.yamaha.through-ngn": {
+ "source": "iana"
+ },
+ "application/vnd.yamaha.tunnel-udpencap": {
+ "source": "iana"
+ },
+ "application/vnd.yaoweme": {
+ "source": "iana"
+ },
+ "application/vnd.yellowriver-custom-menu": {
+ "source": "iana",
+ "extensions": ["cmp"]
+ },
+ "application/vnd.zul": {
+ "source": "iana",
+ "extensions": ["zir","zirz"]
+ },
+ "application/vnd.zzazz.deck+xml": {
+ "source": "iana",
+ "extensions": ["zaz"]
+ },
+ "application/voicexml+xml": {
+ "source": "iana",
+ "extensions": ["vxml"]
+ },
+ "application/vq-rtcpxr": {
+ "source": "iana"
+ },
+ "application/watcherinfo+xml": {
+ "source": "iana"
+ },
+ "application/whoispp-query": {
+ "source": "iana"
+ },
+ "application/whoispp-response": {
+ "source": "iana"
+ },
+ "application/widget": {
+ "source": "iana",
+ "extensions": ["wgt"]
+ },
+ "application/winhlp": {
+ "source": "apache",
+ "extensions": ["hlp"]
+ },
+ "application/wita": {
+ "source": "iana"
+ },
+ "application/wordperfect5.1": {
+ "source": "iana"
+ },
+ "application/wsdl+xml": {
+ "source": "iana",
+ "extensions": ["wsdl"]
+ },
+ "application/wspolicy+xml": {
+ "source": "iana",
+ "extensions": ["wspolicy"]
+ },
+ "application/x-7z-compressed": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["7z"]
+ },
+ "application/x-abiword": {
+ "source": "apache",
+ "extensions": ["abw"]
+ },
+ "application/x-ace-compressed": {
+ "source": "apache",
+ "extensions": ["ace"]
+ },
+ "application/x-amf": {
+ "source": "apache"
+ },
+ "application/x-apple-diskimage": {
+ "source": "apache",
+ "extensions": ["dmg"]
+ },
+ "application/x-authorware-bin": {
+ "source": "apache",
+ "extensions": ["aab","x32","u32","vox"]
+ },
+ "application/x-authorware-map": {
+ "source": "apache",
+ "extensions": ["aam"]
+ },
+ "application/x-authorware-seg": {
+ "source": "apache",
+ "extensions": ["aas"]
+ },
+ "application/x-bcpio": {
+ "source": "apache",
+ "extensions": ["bcpio"]
+ },
+ "application/x-bittorrent": {
+ "source": "apache",
+ "extensions": ["torrent"]
+ },
+ "application/x-blorb": {
+ "source": "apache",
+ "extensions": ["blb","blorb"]
+ },
+ "application/x-bzip": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["bz"]
+ },
+ "application/x-bzip2": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["bz2","boz"]
+ },
+ "application/x-cbr": {
+ "source": "apache",
+ "extensions": ["cbr","cba","cbt","cbz","cb7"]
+ },
+ "application/x-cdlink": {
+ "source": "apache",
+ "extensions": ["vcd"]
+ },
+ "application/x-cfs-compressed": {
+ "source": "apache",
+ "extensions": ["cfs"]
+ },
+ "application/x-chat": {
+ "source": "apache",
+ "extensions": ["chat"]
+ },
+ "application/x-chess-pgn": {
+ "source": "apache",
+ "extensions": ["pgn"]
+ },
+ "application/x-chrome-extension": {
+ "extensions": ["crx"]
+ },
+ "application/x-compress": {
+ "source": "apache"
+ },
+ "application/x-conference": {
+ "source": "apache",
+ "extensions": ["nsc"]
+ },
+ "application/x-cpio": {
+ "source": "apache",
+ "extensions": ["cpio"]
+ },
+ "application/x-csh": {
+ "source": "apache",
+ "extensions": ["csh"]
+ },
+ "application/x-deb": {
+ "compressible": false
+ },
+ "application/x-debian-package": {
+ "source": "apache",
+ "extensions": ["deb","udeb"]
+ },
+ "application/x-dgc-compressed": {
+ "source": "apache",
+ "extensions": ["dgc"]
+ },
+ "application/x-director": {
+ "source": "apache",
+ "extensions": ["dir","dcr","dxr","cst","cct","cxt","w3d","fgd","swa"]
+ },
+ "application/x-doom": {
+ "source": "apache",
+ "extensions": ["wad"]
+ },
+ "application/x-dtbncx+xml": {
+ "source": "apache",
+ "extensions": ["ncx"]
+ },
+ "application/x-dtbook+xml": {
+ "source": "apache",
+ "extensions": ["dtb"]
+ },
+ "application/x-dtbresource+xml": {
+ "source": "apache",
+ "extensions": ["res"]
+ },
+ "application/x-dvi": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["dvi"]
+ },
+ "application/x-envoy": {
+ "source": "apache",
+ "extensions": ["evy"]
+ },
+ "application/x-eva": {
+ "source": "apache",
+ "extensions": ["eva"]
+ },
+ "application/x-font-bdf": {
+ "source": "apache",
+ "extensions": ["bdf"]
+ },
+ "application/x-font-dos": {
+ "source": "apache"
+ },
+ "application/x-font-framemaker": {
+ "source": "apache"
+ },
+ "application/x-font-ghostscript": {
+ "source": "apache",
+ "extensions": ["gsf"]
+ },
+ "application/x-font-libgrx": {
+ "source": "apache"
+ },
+ "application/x-font-linux-psf": {
+ "source": "apache",
+ "extensions": ["psf"]
+ },
+ "application/x-font-otf": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["otf"]
+ },
+ "application/x-font-pcf": {
+ "source": "apache",
+ "extensions": ["pcf"]
+ },
+ "application/x-font-snf": {
+ "source": "apache",
+ "extensions": ["snf"]
+ },
+ "application/x-font-speedo": {
+ "source": "apache"
+ },
+ "application/x-font-sunos-news": {
+ "source": "apache"
+ },
+ "application/x-font-ttf": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["ttf","ttc"]
+ },
+ "application/x-font-type1": {
+ "source": "apache",
+ "extensions": ["pfa","pfb","pfm","afm"]
+ },
+ "application/x-font-vfont": {
+ "source": "apache"
+ },
+ "application/x-freearc": {
+ "source": "apache",
+ "extensions": ["arc"]
+ },
+ "application/x-futuresplash": {
+ "source": "apache",
+ "extensions": ["spl"]
+ },
+ "application/x-gca-compressed": {
+ "source": "apache",
+ "extensions": ["gca"]
+ },
+ "application/x-glulx": {
+ "source": "apache",
+ "extensions": ["ulx"]
+ },
+ "application/x-gnumeric": {
+ "source": "apache",
+ "extensions": ["gnumeric"]
+ },
+ "application/x-gramps-xml": {
+ "source": "apache",
+ "extensions": ["gramps"]
+ },
+ "application/x-gtar": {
+ "source": "apache",
+ "extensions": ["gtar"]
+ },
+ "application/x-gzip": {
+ "source": "apache"
+ },
+ "application/x-hdf": {
+ "source": "apache",
+ "extensions": ["hdf"]
+ },
+ "application/x-install-instructions": {
+ "source": "apache",
+ "extensions": ["install"]
+ },
+ "application/x-iso9660-image": {
+ "source": "apache",
+ "extensions": ["iso"]
+ },
+ "application/x-java-jnlp-file": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["jnlp"]
+ },
+ "application/x-javascript": {
+ "compressible": true
+ },
+ "application/x-latex": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["latex"]
+ },
+ "application/x-lua-bytecode": {
+ "extensions": ["luac"]
+ },
+ "application/x-lzh-compressed": {
+ "source": "apache",
+ "extensions": ["lzh","lha"]
+ },
+ "application/x-mie": {
+ "source": "apache",
+ "extensions": ["mie"]
+ },
+ "application/x-mobipocket-ebook": {
+ "source": "apache",
+ "extensions": ["prc","mobi"]
+ },
+ "application/x-mpegurl": {
+ "compressible": false
+ },
+ "application/x-ms-application": {
+ "source": "apache",
+ "extensions": ["application"]
+ },
+ "application/x-ms-shortcut": {
+ "source": "apache",
+ "extensions": ["lnk"]
+ },
+ "application/x-ms-wmd": {
+ "source": "apache",
+ "extensions": ["wmd"]
+ },
+ "application/x-ms-wmz": {
+ "source": "apache",
+ "extensions": ["wmz"]
+ },
+ "application/x-ms-xbap": {
+ "source": "apache",
+ "extensions": ["xbap"]
+ },
+ "application/x-msaccess": {
+ "source": "apache",
+ "extensions": ["mdb"]
+ },
+ "application/x-msbinder": {
+ "source": "apache",
+ "extensions": ["obd"]
+ },
+ "application/x-mscardfile": {
+ "source": "apache",
+ "extensions": ["crd"]
+ },
+ "application/x-msclip": {
+ "source": "apache",
+ "extensions": ["clp"]
+ },
+ "application/x-msdownload": {
+ "source": "apache",
+ "extensions": ["exe","dll","com","bat","msi"]
+ },
+ "application/x-msmediaview": {
+ "source": "apache",
+ "extensions": ["mvb","m13","m14"]
+ },
+ "application/x-msmetafile": {
+ "source": "apache",
+ "extensions": ["wmf","wmz","emf","emz"]
+ },
+ "application/x-msmoney": {
+ "source": "apache",
+ "extensions": ["mny"]
+ },
+ "application/x-mspublisher": {
+ "source": "apache",
+ "extensions": ["pub"]
+ },
+ "application/x-msschedule": {
+ "source": "apache",
+ "extensions": ["scd"]
+ },
+ "application/x-msterminal": {
+ "source": "apache",
+ "extensions": ["trm"]
+ },
+ "application/x-mswrite": {
+ "source": "apache",
+ "extensions": ["wri"]
+ },
+ "application/x-netcdf": {
+ "source": "apache",
+ "extensions": ["nc","cdf"]
+ },
+ "application/x-nzb": {
+ "source": "apache",
+ "extensions": ["nzb"]
+ },
+ "application/x-pkcs12": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["p12","pfx"]
+ },
+ "application/x-pkcs7-certificates": {
+ "source": "apache",
+ "extensions": ["p7b","spc"]
+ },
+ "application/x-pkcs7-certreqresp": {
+ "source": "apache",
+ "extensions": ["p7r"]
+ },
+ "application/x-rar-compressed": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["rar"]
+ },
+ "application/x-research-info-systems": {
+ "source": "apache",
+ "extensions": ["ris"]
+ },
+ "application/x-sh": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["sh"]
+ },
+ "application/x-shar": {
+ "source": "apache",
+ "extensions": ["shar"]
+ },
+ "application/x-shockwave-flash": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["swf"]
+ },
+ "application/x-silverlight-app": {
+ "source": "apache",
+ "extensions": ["xap"]
+ },
+ "application/x-sql": {
+ "source": "apache",
+ "extensions": ["sql"]
+ },
+ "application/x-stuffit": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["sit"]
+ },
+ "application/x-stuffitx": {
+ "source": "apache",
+ "extensions": ["sitx"]
+ },
+ "application/x-subrip": {
+ "source": "apache",
+ "extensions": ["srt"]
+ },
+ "application/x-sv4cpio": {
+ "source": "apache",
+ "extensions": ["sv4cpio"]
+ },
+ "application/x-sv4crc": {
+ "source": "apache",
+ "extensions": ["sv4crc"]
+ },
+ "application/x-t3vm-image": {
+ "source": "apache",
+ "extensions": ["t3"]
+ },
+ "application/x-tads": {
+ "source": "apache",
+ "extensions": ["gam"]
+ },
+ "application/x-tar": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["tar"]
+ },
+ "application/x-tcl": {
+ "source": "apache",
+ "extensions": ["tcl"]
+ },
+ "application/x-tex": {
+ "source": "apache",
+ "extensions": ["tex"]
+ },
+ "application/x-tex-tfm": {
+ "source": "apache",
+ "extensions": ["tfm"]
+ },
+ "application/x-texinfo": {
+ "source": "apache",
+ "extensions": ["texinfo","texi"]
+ },
+ "application/x-tgif": {
+ "source": "apache",
+ "extensions": ["obj"]
+ },
+ "application/x-ustar": {
+ "source": "apache",
+ "extensions": ["ustar"]
+ },
+ "application/x-wais-source": {
+ "source": "apache",
+ "extensions": ["src"]
+ },
+ "application/x-web-app-manifest+json": {
+ "compressible": true,
+ "extensions": ["webapp"]
+ },
+ "application/x-www-form-urlencoded": {
+ "source": "iana",
+ "compressible": true
+ },
+ "application/x-x509-ca-cert": {
+ "source": "apache",
+ "extensions": ["der","crt"]
+ },
+ "application/x-xfig": {
+ "source": "apache",
+ "extensions": ["fig"]
+ },
+ "application/x-xliff+xml": {
+ "source": "apache",
+ "extensions": ["xlf"]
+ },
+ "application/x-xpinstall": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["xpi"]
+ },
+ "application/x-xz": {
+ "source": "apache",
+ "extensions": ["xz"]
+ },
+ "application/x-zmachine": {
+ "source": "apache",
+ "extensions": ["z1","z2","z3","z4","z5","z6","z7","z8"]
+ },
+ "application/x400-bp": {
+ "source": "iana"
+ },
+ "application/xacml+xml": {
+ "source": "iana"
+ },
+ "application/xaml+xml": {
+ "source": "apache",
+ "extensions": ["xaml"]
+ },
+ "application/xcap-att+xml": {
+ "source": "iana"
+ },
+ "application/xcap-caps+xml": {
+ "source": "iana"
+ },
+ "application/xcap-diff+xml": {
+ "source": "iana",
+ "extensions": ["xdf"]
+ },
+ "application/xcap-el+xml": {
+ "source": "iana"
+ },
+ "application/xcap-error+xml": {
+ "source": "iana"
+ },
+ "application/xcap-ns+xml": {
+ "source": "iana"
+ },
+ "application/xcon-conference-info+xml": {
+ "source": "iana"
+ },
+ "application/xcon-conference-info-diff+xml": {
+ "source": "iana"
+ },
+ "application/xenc+xml": {
+ "source": "iana",
+ "extensions": ["xenc"]
+ },
+ "application/xhtml+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["xhtml","xht"]
+ },
+ "application/xhtml-voice+xml": {
+ "source": "iana"
+ },
+ "application/xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["xml","xsl","xsd"]
+ },
+ "application/xml-dtd": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["dtd"]
+ },
+ "application/xml-external-parsed-entity": {
+ "source": "iana"
+ },
+ "application/xml-patch+xml": {
+ "source": "iana"
+ },
+ "application/xmpp+xml": {
+ "source": "iana"
+ },
+ "application/xop+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["xop"]
+ },
+ "application/xproc+xml": {
+ "source": "apache",
+ "extensions": ["xpl"]
+ },
+ "application/xslt+xml": {
+ "source": "iana",
+ "extensions": ["xslt"]
+ },
+ "application/xspf+xml": {
+ "source": "apache",
+ "extensions": ["xspf"]
+ },
+ "application/xv+xml": {
+ "source": "iana",
+ "extensions": ["mxml","xhvml","xvml","xvm"]
+ },
+ "application/yang": {
+ "source": "iana",
+ "extensions": ["yang"]
+ },
+ "application/yin+xml": {
+ "source": "iana",
+ "extensions": ["yin"]
+ },
+ "application/zip": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["zip"]
+ },
+ "application/zlib": {
+ "source": "iana"
+ },
+ "audio/1d-interleaved-parityfec": {
+ "source": "iana"
+ },
+ "audio/32kadpcm": {
+ "source": "iana"
+ },
+ "audio/3gpp": {
+ "source": "iana"
+ },
+ "audio/3gpp2": {
+ "source": "iana"
+ },
+ "audio/ac3": {
+ "source": "iana"
+ },
+ "audio/adpcm": {
+ "source": "apache",
+ "extensions": ["adp"]
+ },
+ "audio/amr": {
+ "source": "iana"
+ },
+ "audio/amr-wb": {
+ "source": "iana"
+ },
+ "audio/amr-wb+": {
+ "source": "iana"
+ },
+ "audio/aptx": {
+ "source": "iana"
+ },
+ "audio/asc": {
+ "source": "iana"
+ },
+ "audio/atrac-advanced-lossless": {
+ "source": "iana"
+ },
+ "audio/atrac-x": {
+ "source": "iana"
+ },
+ "audio/atrac3": {
+ "source": "iana"
+ },
+ "audio/basic": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["au","snd"]
+ },
+ "audio/bv16": {
+ "source": "iana"
+ },
+ "audio/bv32": {
+ "source": "iana"
+ },
+ "audio/clearmode": {
+ "source": "iana"
+ },
+ "audio/cn": {
+ "source": "iana"
+ },
+ "audio/dat12": {
+ "source": "iana"
+ },
+ "audio/dls": {
+ "source": "iana"
+ },
+ "audio/dsr-es201108": {
+ "source": "iana"
+ },
+ "audio/dsr-es202050": {
+ "source": "iana"
+ },
+ "audio/dsr-es202211": {
+ "source": "iana"
+ },
+ "audio/dsr-es202212": {
+ "source": "iana"
+ },
+ "audio/dv": {
+ "source": "iana"
+ },
+ "audio/dvi4": {
+ "source": "iana"
+ },
+ "audio/eac3": {
+ "source": "iana"
+ },
+ "audio/encaprtp": {
+ "source": "iana"
+ },
+ "audio/evrc": {
+ "source": "iana"
+ },
+ "audio/evrc-qcp": {
+ "source": "iana"
+ },
+ "audio/evrc0": {
+ "source": "iana"
+ },
+ "audio/evrc1": {
+ "source": "iana"
+ },
+ "audio/evrcb": {
+ "source": "iana"
+ },
+ "audio/evrcb0": {
+ "source": "iana"
+ },
+ "audio/evrcb1": {
+ "source": "iana"
+ },
+ "audio/evrcnw": {
+ "source": "iana"
+ },
+ "audio/evrcnw0": {
+ "source": "iana"
+ },
+ "audio/evrcnw1": {
+ "source": "iana"
+ },
+ "audio/evrcwb": {
+ "source": "iana"
+ },
+ "audio/evrcwb0": {
+ "source": "iana"
+ },
+ "audio/evrcwb1": {
+ "source": "iana"
+ },
+ "audio/fwdred": {
+ "source": "iana"
+ },
+ "audio/g719": {
+ "source": "iana"
+ },
+ "audio/g722": {
+ "source": "iana"
+ },
+ "audio/g7221": {
+ "source": "iana"
+ },
+ "audio/g723": {
+ "source": "iana"
+ },
+ "audio/g726-16": {
+ "source": "iana"
+ },
+ "audio/g726-24": {
+ "source": "iana"
+ },
+ "audio/g726-32": {
+ "source": "iana"
+ },
+ "audio/g726-40": {
+ "source": "iana"
+ },
+ "audio/g728": {
+ "source": "iana"
+ },
+ "audio/g729": {
+ "source": "iana"
+ },
+ "audio/g7291": {
+ "source": "iana"
+ },
+ "audio/g729d": {
+ "source": "iana"
+ },
+ "audio/g729e": {
+ "source": "iana"
+ },
+ "audio/gsm": {
+ "source": "iana"
+ },
+ "audio/gsm-efr": {
+ "source": "iana"
+ },
+ "audio/gsm-hr-08": {
+ "source": "iana"
+ },
+ "audio/ilbc": {
+ "source": "iana"
+ },
+ "audio/ip-mr_v2.5": {
+ "source": "iana"
+ },
+ "audio/isac": {
+ "source": "apache"
+ },
+ "audio/l16": {
+ "source": "iana"
+ },
+ "audio/l20": {
+ "source": "iana"
+ },
+ "audio/l24": {
+ "source": "iana",
+ "compressible": false
+ },
+ "audio/l8": {
+ "source": "iana"
+ },
+ "audio/lpc": {
+ "source": "iana"
+ },
+ "audio/midi": {
+ "source": "apache",
+ "extensions": ["mid","midi","kar","rmi"]
+ },
+ "audio/mobile-xmf": {
+ "source": "iana"
+ },
+ "audio/mp4": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["mp4a","m4a"]
+ },
+ "audio/mp4a-latm": {
+ "source": "iana"
+ },
+ "audio/mpa": {
+ "source": "iana"
+ },
+ "audio/mpa-robust": {
+ "source": "iana"
+ },
+ "audio/mpeg": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["mpga","mp2","mp2a","mp3","m2a","m3a"]
+ },
+ "audio/mpeg4-generic": {
+ "source": "iana"
+ },
+ "audio/musepack": {
+ "source": "apache"
+ },
+ "audio/ogg": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["oga","ogg","spx"]
+ },
+ "audio/opus": {
+ "source": "apache"
+ },
+ "audio/parityfec": {
+ "source": "iana"
+ },
+ "audio/pcma": {
+ "source": "iana"
+ },
+ "audio/pcma-wb": {
+ "source": "iana"
+ },
+ "audio/pcmu": {
+ "source": "iana"
+ },
+ "audio/pcmu-wb": {
+ "source": "iana"
+ },
+ "audio/prs.sid": {
+ "source": "iana"
+ },
+ "audio/qcelp": {
+ "source": "iana"
+ },
+ "audio/raptorfec": {
+ "source": "iana"
+ },
+ "audio/red": {
+ "source": "iana"
+ },
+ "audio/rtp-enc-aescm128": {
+ "source": "iana"
+ },
+ "audio/rtp-midi": {
+ "source": "iana"
+ },
+ "audio/rtploopback": {
+ "source": "iana"
+ },
+ "audio/rtx": {
+ "source": "iana"
+ },
+ "audio/s3m": {
+ "source": "apache",
+ "extensions": ["s3m"]
+ },
+ "audio/silk": {
+ "source": "apache",
+ "extensions": ["sil"]
+ },
+ "audio/smv": {
+ "source": "iana"
+ },
+ "audio/smv-qcp": {
+ "source": "iana"
+ },
+ "audio/smv0": {
+ "source": "iana"
+ },
+ "audio/sp-midi": {
+ "source": "iana"
+ },
+ "audio/speex": {
+ "source": "iana"
+ },
+ "audio/t140c": {
+ "source": "iana"
+ },
+ "audio/t38": {
+ "source": "iana"
+ },
+ "audio/telephone-event": {
+ "source": "iana"
+ },
+ "audio/tone": {
+ "source": "iana"
+ },
+ "audio/uemclip": {
+ "source": "iana"
+ },
+ "audio/ulpfec": {
+ "source": "iana"
+ },
+ "audio/vdvi": {
+ "source": "iana"
+ },
+ "audio/vmr-wb": {
+ "source": "iana"
+ },
+ "audio/vnd.3gpp.iufp": {
+ "source": "iana"
+ },
+ "audio/vnd.4sb": {
+ "source": "iana"
+ },
+ "audio/vnd.audiokoz": {
+ "source": "iana"
+ },
+ "audio/vnd.celp": {
+ "source": "iana"
+ },
+ "audio/vnd.cisco.nse": {
+ "source": "iana"
+ },
+ "audio/vnd.cmles.radio-events": {
+ "source": "iana"
+ },
+ "audio/vnd.cns.anp1": {
+ "source": "iana"
+ },
+ "audio/vnd.cns.inf1": {
+ "source": "iana"
+ },
+ "audio/vnd.dece.audio": {
+ "source": "iana",
+ "extensions": ["uva","uvva"]
+ },
+ "audio/vnd.digital-winds": {
+ "source": "iana",
+ "extensions": ["eol"]
+ },
+ "audio/vnd.dlna.adts": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.heaac.1": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.heaac.2": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.mlp": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.mps": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.pl2": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.pl2x": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.pl2z": {
+ "source": "iana"
+ },
+ "audio/vnd.dolby.pulse.1": {
+ "source": "iana"
+ },
+ "audio/vnd.dra": {
+ "source": "iana",
+ "extensions": ["dra"]
+ },
+ "audio/vnd.dts": {
+ "source": "iana",
+ "extensions": ["dts"]
+ },
+ "audio/vnd.dts.hd": {
+ "source": "iana",
+ "extensions": ["dtshd"]
+ },
+ "audio/vnd.dvb.file": {
+ "source": "iana"
+ },
+ "audio/vnd.everad.plj": {
+ "source": "iana"
+ },
+ "audio/vnd.hns.audio": {
+ "source": "iana"
+ },
+ "audio/vnd.lucent.voice": {
+ "source": "iana",
+ "extensions": ["lvp"]
+ },
+ "audio/vnd.ms-playready.media.pya": {
+ "source": "iana",
+ "extensions": ["pya"]
+ },
+ "audio/vnd.nokia.mobile-xmf": {
+ "source": "iana"
+ },
+ "audio/vnd.nortel.vbk": {
+ "source": "iana"
+ },
+ "audio/vnd.nuera.ecelp4800": {
+ "source": "iana",
+ "extensions": ["ecelp4800"]
+ },
+ "audio/vnd.nuera.ecelp7470": {
+ "source": "iana",
+ "extensions": ["ecelp7470"]
+ },
+ "audio/vnd.nuera.ecelp9600": {
+ "source": "iana",
+ "extensions": ["ecelp9600"]
+ },
+ "audio/vnd.octel.sbc": {
+ "source": "iana"
+ },
+ "audio/vnd.qcelp": {
+ "source": "iana"
+ },
+ "audio/vnd.rhetorex.32kadpcm": {
+ "source": "iana"
+ },
+ "audio/vnd.rip": {
+ "source": "iana",
+ "extensions": ["rip"]
+ },
+ "audio/vnd.rn-realaudio": {
+ "compressible": false
+ },
+ "audio/vnd.sealedmedia.softseal.mpeg": {
+ "source": "iana"
+ },
+ "audio/vnd.vmx.cvsd": {
+ "source": "iana"
+ },
+ "audio/vnd.wave": {
+ "compressible": false
+ },
+ "audio/vorbis": {
+ "source": "iana",
+ "compressible": false
+ },
+ "audio/vorbis-config": {
+ "source": "iana"
+ },
+ "audio/webm": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["weba"]
+ },
+ "audio/x-aac": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["aac"]
+ },
+ "audio/x-aiff": {
+ "source": "apache",
+ "extensions": ["aif","aiff","aifc"]
+ },
+ "audio/x-caf": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["caf"]
+ },
+ "audio/x-flac": {
+ "source": "apache",
+ "extensions": ["flac"]
+ },
+ "audio/x-matroska": {
+ "source": "apache",
+ "extensions": ["mka"]
+ },
+ "audio/x-mpegurl": {
+ "source": "apache",
+ "extensions": ["m3u"]
+ },
+ "audio/x-ms-wax": {
+ "source": "apache",
+ "extensions": ["wax"]
+ },
+ "audio/x-ms-wma": {
+ "source": "apache",
+ "extensions": ["wma"]
+ },
+ "audio/x-pn-realaudio": {
+ "source": "apache",
+ "extensions": ["ram","ra"]
+ },
+ "audio/x-pn-realaudio-plugin": {
+ "source": "apache",
+ "extensions": ["rmp"]
+ },
+ "audio/x-tta": {
+ "source": "apache"
+ },
+ "audio/x-wav": {
+ "source": "apache",
+ "extensions": ["wav"]
+ },
+ "audio/xm": {
+ "source": "apache",
+ "extensions": ["xm"]
+ },
+ "chemical/x-cdx": {
+ "source": "apache",
+ "extensions": ["cdx"]
+ },
+ "chemical/x-cif": {
+ "source": "apache",
+ "extensions": ["cif"]
+ },
+ "chemical/x-cmdf": {
+ "source": "apache",
+ "extensions": ["cmdf"]
+ },
+ "chemical/x-cml": {
+ "source": "apache",
+ "extensions": ["cml"]
+ },
+ "chemical/x-csml": {
+ "source": "apache",
+ "extensions": ["csml"]
+ },
+ "chemical/x-pdb": {
+ "source": "apache"
+ },
+ "chemical/x-xyz": {
+ "source": "apache",
+ "extensions": ["xyz"]
+ },
+ "font/opentype": {
+ "compressible": true,
+ "extensions": ["otf"]
+ },
+ "image/bmp": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["bmp"]
+ },
+ "image/cgm": {
+ "source": "iana",
+ "extensions": ["cgm"]
+ },
+ "image/fits": {
+ "source": "iana"
+ },
+ "image/g3fax": {
+ "source": "iana",
+ "extensions": ["g3"]
+ },
+ "image/gif": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["gif"]
+ },
+ "image/ief": {
+ "source": "iana",
+ "extensions": ["ief"]
+ },
+ "image/jp2": {
+ "source": "iana"
+ },
+ "image/jpeg": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["jpeg","jpg","jpe"]
+ },
+ "image/jpm": {
+ "source": "iana"
+ },
+ "image/jpx": {
+ "source": "iana"
+ },
+ "image/ktx": {
+ "source": "iana",
+ "extensions": ["ktx"]
+ },
+ "image/naplps": {
+ "source": "iana"
+ },
+ "image/pjpeg": {
+ "compressible": false
+ },
+ "image/png": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["png"]
+ },
+ "image/prs.btif": {
+ "source": "iana",
+ "extensions": ["btif"]
+ },
+ "image/prs.pti": {
+ "source": "iana"
+ },
+ "image/pwg-raster": {
+ "source": "iana"
+ },
+ "image/sgi": {
+ "source": "apache",
+ "extensions": ["sgi"]
+ },
+ "image/svg+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["svg","svgz"]
+ },
+ "image/t38": {
+ "source": "iana"
+ },
+ "image/tiff": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["tiff","tif"]
+ },
+ "image/tiff-fx": {
+ "source": "iana"
+ },
+ "image/vnd.adobe.photoshop": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["psd"]
+ },
+ "image/vnd.airzip.accelerator.azv": {
+ "source": "iana"
+ },
+ "image/vnd.cns.inf2": {
+ "source": "iana"
+ },
+ "image/vnd.dece.graphic": {
+ "source": "iana",
+ "extensions": ["uvi","uvvi","uvg","uvvg"]
+ },
+ "image/vnd.djvu": {
+ "source": "iana",
+ "extensions": ["djvu","djv"]
+ },
+ "image/vnd.dvb.subtitle": {
+ "source": "iana",
+ "extensions": ["sub"]
+ },
+ "image/vnd.dwg": {
+ "source": "iana",
+ "extensions": ["dwg"]
+ },
+ "image/vnd.dxf": {
+ "source": "iana",
+ "extensions": ["dxf"]
+ },
+ "image/vnd.fastbidsheet": {
+ "source": "iana",
+ "extensions": ["fbs"]
+ },
+ "image/vnd.fpx": {
+ "source": "iana",
+ "extensions": ["fpx"]
+ },
+ "image/vnd.fst": {
+ "source": "iana",
+ "extensions": ["fst"]
+ },
+ "image/vnd.fujixerox.edmics-mmr": {
+ "source": "iana",
+ "extensions": ["mmr"]
+ },
+ "image/vnd.fujixerox.edmics-rlc": {
+ "source": "iana",
+ "extensions": ["rlc"]
+ },
+ "image/vnd.globalgraphics.pgb": {
+ "source": "iana"
+ },
+ "image/vnd.microsoft.icon": {
+ "source": "iana"
+ },
+ "image/vnd.mix": {
+ "source": "iana"
+ },
+ "image/vnd.ms-modi": {
+ "source": "iana",
+ "extensions": ["mdi"]
+ },
+ "image/vnd.ms-photo": {
+ "source": "apache",
+ "extensions": ["wdp"]
+ },
+ "image/vnd.net-fpx": {
+ "source": "iana",
+ "extensions": ["npx"]
+ },
+ "image/vnd.radiance": {
+ "source": "iana"
+ },
+ "image/vnd.sealed.png": {
+ "source": "iana"
+ },
+ "image/vnd.sealedmedia.softseal.gif": {
+ "source": "iana"
+ },
+ "image/vnd.sealedmedia.softseal.jpg": {
+ "source": "iana"
+ },
+ "image/vnd.svf": {
+ "source": "iana"
+ },
+ "image/vnd.tencent.tap": {
+ "source": "iana"
+ },
+ "image/vnd.valve.source.texture": {
+ "source": "iana"
+ },
+ "image/vnd.wap.wbmp": {
+ "source": "iana",
+ "extensions": ["wbmp"]
+ },
+ "image/vnd.xiff": {
+ "source": "iana",
+ "extensions": ["xif"]
+ },
+ "image/webp": {
+ "source": "apache",
+ "extensions": ["webp"]
+ },
+ "image/x-3ds": {
+ "source": "apache",
+ "extensions": ["3ds"]
+ },
+ "image/x-cmu-raster": {
+ "source": "apache",
+ "extensions": ["ras"]
+ },
+ "image/x-cmx": {
+ "source": "apache",
+ "extensions": ["cmx"]
+ },
+ "image/x-freehand": {
+ "source": "apache",
+ "extensions": ["fh","fhc","fh4","fh5","fh7"]
+ },
+ "image/x-icon": {
+ "source": "apache",
+ "compressible": true,
+ "extensions": ["ico"]
+ },
+ "image/x-mrsid-image": {
+ "source": "apache",
+ "extensions": ["sid"]
+ },
+ "image/x-pcx": {
+ "source": "apache",
+ "extensions": ["pcx"]
+ },
+ "image/x-pict": {
+ "source": "apache",
+ "extensions": ["pic","pct"]
+ },
+ "image/x-portable-anymap": {
+ "source": "apache",
+ "extensions": ["pnm"]
+ },
+ "image/x-portable-bitmap": {
+ "source": "apache",
+ "extensions": ["pbm"]
+ },
+ "image/x-portable-graymap": {
+ "source": "apache",
+ "extensions": ["pgm"]
+ },
+ "image/x-portable-pixmap": {
+ "source": "apache",
+ "extensions": ["ppm"]
+ },
+ "image/x-rgb": {
+ "source": "apache",
+ "extensions": ["rgb"]
+ },
+ "image/x-tga": {
+ "source": "apache",
+ "extensions": ["tga"]
+ },
+ "image/x-xbitmap": {
+ "source": "apache",
+ "extensions": ["xbm"]
+ },
+ "image/x-xcf": {
+ "compressible": false
+ },
+ "image/x-xpixmap": {
+ "source": "apache",
+ "extensions": ["xpm"]
+ },
+ "image/x-xwindowdump": {
+ "source": "apache",
+ "extensions": ["xwd"]
+ },
+ "message/cpim": {
+ "source": "iana"
+ },
+ "message/delivery-status": {
+ "source": "iana"
+ },
+ "message/disposition-notification": {
+ "source": "iana"
+ },
+ "message/external-body": {
+ "source": "iana"
+ },
+ "message/feedback-report": {
+ "source": "iana"
+ },
+ "message/global": {
+ "source": "iana"
+ },
+ "message/global-delivery-status": {
+ "source": "iana"
+ },
+ "message/global-disposition-notification": {
+ "source": "iana"
+ },
+ "message/global-headers": {
+ "source": "iana"
+ },
+ "message/http": {
+ "source": "iana",
+ "compressible": false
+ },
+ "message/imdn+xml": {
+ "source": "iana",
+ "compressible": true
+ },
+ "message/news": {
+ "source": "iana"
+ },
+ "message/partial": {
+ "source": "iana",
+ "compressible": false
+ },
+ "message/rfc822": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["eml","mime"]
+ },
+ "message/s-http": {
+ "source": "iana"
+ },
+ "message/sip": {
+ "source": "iana"
+ },
+ "message/sipfrag": {
+ "source": "iana"
+ },
+ "message/tracking-status": {
+ "source": "iana"
+ },
+ "message/vnd.si.simp": {
+ "source": "iana"
+ },
+ "message/vnd.wfa.wsc": {
+ "source": "iana"
+ },
+ "model/iges": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["igs","iges"]
+ },
+ "model/mesh": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["msh","mesh","silo"]
+ },
+ "model/vnd.collada+xml": {
+ "source": "iana",
+ "extensions": ["dae"]
+ },
+ "model/vnd.dwf": {
+ "source": "iana",
+ "extensions": ["dwf"]
+ },
+ "model/vnd.flatland.3dml": {
+ "source": "iana"
+ },
+ "model/vnd.gdl": {
+ "source": "iana",
+ "extensions": ["gdl"]
+ },
+ "model/vnd.gs-gdl": {
+ "source": "apache"
+ },
+ "model/vnd.gs.gdl": {
+ "source": "iana"
+ },
+ "model/vnd.gtw": {
+ "source": "iana",
+ "extensions": ["gtw"]
+ },
+ "model/vnd.moml+xml": {
+ "source": "iana"
+ },
+ "model/vnd.mts": {
+ "source": "iana",
+ "extensions": ["mts"]
+ },
+ "model/vnd.opengex": {
+ "source": "iana"
+ },
+ "model/vnd.parasolid.transmit.binary": {
+ "source": "iana"
+ },
+ "model/vnd.parasolid.transmit.text": {
+ "source": "iana"
+ },
+ "model/vnd.valve.source.compiled-map": {
+ "source": "iana"
+ },
+ "model/vnd.vtu": {
+ "source": "iana",
+ "extensions": ["vtu"]
+ },
+ "model/vrml": {
+ "source": "iana",
+ "compressible": false,
+ "extensions": ["wrl","vrml"]
+ },
+ "model/x3d+binary": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["x3db","x3dbz"]
+ },
+ "model/x3d+fastinfoset": {
+ "source": "iana"
+ },
+ "model/x3d+vrml": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["x3dv","x3dvz"]
+ },
+ "model/x3d+xml": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["x3d","x3dz"]
+ },
+ "model/x3d-vrml": {
+ "source": "iana"
+ },
+ "multipart/alternative": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/appledouble": {
+ "source": "iana"
+ },
+ "multipart/byteranges": {
+ "source": "iana"
+ },
+ "multipart/digest": {
+ "source": "iana"
+ },
+ "multipart/encrypted": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/form-data": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/header-set": {
+ "source": "iana"
+ },
+ "multipart/mixed": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/parallel": {
+ "source": "iana"
+ },
+ "multipart/related": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/report": {
+ "source": "iana"
+ },
+ "multipart/signed": {
+ "source": "iana",
+ "compressible": false
+ },
+ "multipart/voice-message": {
+ "source": "iana"
+ },
+ "multipart/x-mixed-replace": {
+ "source": "iana"
+ },
+ "text/1d-interleaved-parityfec": {
+ "source": "iana"
+ },
+ "text/cache-manifest": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["appcache","manifest"]
+ },
+ "text/calendar": {
+ "source": "iana",
+ "extensions": ["ics","ifb"]
+ },
+ "text/calender": {
+ "compressible": true
+ },
+ "text/cmd": {
+ "compressible": true
+ },
+ "text/coffeescript": {
+ "extensions": ["coffee"]
+ },
+ "text/css": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["css"]
+ },
+ "text/csv": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["csv"]
+ },
+ "text/csv-schema": {
+ "source": "iana"
+ },
+ "text/directory": {
+ "source": "iana"
+ },
+ "text/dns": {
+ "source": "iana"
+ },
+ "text/ecmascript": {
+ "source": "iana"
+ },
+ "text/encaprtp": {
+ "source": "iana"
+ },
+ "text/enriched": {
+ "source": "iana"
+ },
+ "text/fwdred": {
+ "source": "iana"
+ },
+ "text/grammar-ref-list": {
+ "source": "iana"
+ },
+ "text/hjson": {
+ "extensions": ["hjson"]
+ },
+ "text/html": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["html","htm"]
+ },
+ "text/jade": {
+ "extensions": ["jade"]
+ },
+ "text/javascript": {
+ "source": "iana",
+ "compressible": true
+ },
+ "text/jcr-cnd": {
+ "source": "iana"
+ },
+ "text/jsx": {
+ "compressible": true,
+ "extensions": ["jsx"]
+ },
+ "text/less": {
+ "extensions": ["less"]
+ },
+ "text/markdown": {
+ "source": "iana"
+ },
+ "text/mizar": {
+ "source": "iana"
+ },
+ "text/n3": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["n3"]
+ },
+ "text/parameters": {
+ "source": "iana"
+ },
+ "text/parityfec": {
+ "source": "iana"
+ },
+ "text/plain": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["txt","text","conf","def","list","log","in","ini"]
+ },
+ "text/provenance-notation": {
+ "source": "iana"
+ },
+ "text/prs.fallenstein.rst": {
+ "source": "iana"
+ },
+ "text/prs.lines.tag": {
+ "source": "iana",
+ "extensions": ["dsc"]
+ },
+ "text/raptorfec": {
+ "source": "iana"
+ },
+ "text/red": {
+ "source": "iana"
+ },
+ "text/rfc822-headers": {
+ "source": "iana"
+ },
+ "text/richtext": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["rtx"]
+ },
+ "text/rtf": {
+ "source": "iana"
+ },
+ "text/rtp-enc-aescm128": {
+ "source": "iana"
+ },
+ "text/rtploopback": {
+ "source": "iana"
+ },
+ "text/rtx": {
+ "source": "iana"
+ },
+ "text/sgml": {
+ "source": "iana",
+ "extensions": ["sgml","sgm"]
+ },
+ "text/stylus": {
+ "extensions": ["stylus","styl"]
+ },
+ "text/t140": {
+ "source": "iana"
+ },
+ "text/tab-separated-values": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["tsv"]
+ },
+ "text/troff": {
+ "source": "iana",
+ "extensions": ["t","tr","roff","man","me","ms"]
+ },
+ "text/turtle": {
+ "source": "iana",
+ "extensions": ["ttl"]
+ },
+ "text/ulpfec": {
+ "source": "iana"
+ },
+ "text/uri-list": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["uri","uris","urls"]
+ },
+ "text/vcard": {
+ "source": "iana",
+ "compressible": true,
+ "extensions": ["vcard"]
+ },
+ "text/vnd.a": {
+ "source": "iana"
+ },
+ "text/vnd.abc": {
+ "source": "iana"
+ },
+ "text/vnd.curl": {
+ "source": "iana",
+ "extensions": ["curl"]
+ },
+ "text/vnd.curl.dcurl": {
+ "source": "apache",
+ "extensions": ["dcurl"]
+ },
+ "text/vnd.curl.mcurl": {
+ "source": "apache",
+ "extensions": ["mcurl"]
+ },
+ "text/vnd.curl.scurl": {
+ "source": "apache",
+ "extensions": ["scurl"]
+ },
+ "text/vnd.debian.copyright": {
+ "source": "iana"
+ },
+ "text/vnd.dmclientscript": {
+ "source": "iana"
+ },
+ "text/vnd.dvb.subtitle": {
+ "source": "iana",
+ "extensions": ["sub"]
+ },
+ "text/vnd.esmertec.theme-descriptor": {
+ "source": "iana"
+ },
+ "text/vnd.fly": {
+ "source": "iana",
+ "extensions": ["fly"]
+ },
+ "text/vnd.fmi.flexstor": {
+ "source": "iana",
+ "extensions": ["flx"]
+ },
+ "text/vnd.graphviz": {
+ "source": "iana",
+ "extensions": ["gv"]
+ },
+ "text/vnd.in3d.3dml": {
+ "source": "iana",
+ "extensions": ["3dml"]
+ },
+ "text/vnd.in3d.spot": {
+ "source": "iana",
+ "extensions": ["spot"]
+ },
+ "text/vnd.iptc.newsml": {
+ "source": "iana"
+ },
+ "text/vnd.iptc.nitf": {
+ "source": "iana"
+ },
+ "text/vnd.latex-z": {
+ "source": "iana"
+ },
+ "text/vnd.motorola.reflex": {
+ "source": "iana"
+ },
+ "text/vnd.ms-mediapackage": {
+ "source": "iana"
+ },
+ "text/vnd.net2phone.commcenter.command": {
+ "source": "iana"
+ },
+ "text/vnd.radisys.msml-basic-layout": {
+ "source": "iana"
+ },
+ "text/vnd.si.uricatalogue": {
+ "source": "iana"
+ },
+ "text/vnd.sun.j2me.app-descriptor": {
+ "source": "iana",
+ "extensions": ["jad"]
+ },
+ "text/vnd.trolltech.linguist": {
+ "source": "iana"
+ },
+ "text/vnd.wap.si": {
+ "source": "iana"
+ },
+ "text/vnd.wap.sl": {
+ "source": "iana"
+ },
+ "text/vnd.wap.wml": {
+ "source": "iana",
+ "extensions": ["wml"]
+ },
+ "text/vnd.wap.wmlscript": {
+ "source": "iana",
+ "extensions": ["wmls"]
+ },
+ "text/vtt": {
+ "charset": "UTF-8",
+ "compressible": true,
+ "extensions": ["vtt"]
+ },
+ "text/x-asm": {
+ "source": "apache",
+ "extensions": ["s","asm"]
+ },
+ "text/x-c": {
+ "source": "apache",
+ "extensions": ["c","cc","cxx","cpp","h","hh","dic"]
+ },
+ "text/x-component": {
+ "extensions": ["htc"]
+ },
+ "text/x-fortran": {
+ "source": "apache",
+ "extensions": ["f","for","f77","f90"]
+ },
+ "text/x-gwt-rpc": {
+ "compressible": true
+ },
+ "text/x-handlebars-template": {
+ "extensions": ["hbs"]
+ },
+ "text/x-java-source": {
+ "source": "apache",
+ "extensions": ["java"]
+ },
+ "text/x-jquery-tmpl": {
+ "compressible": true
+ },
+ "text/x-lua": {
+ "extensions": ["lua"]
+ },
+ "text/x-markdown": {
+ "compressible": true,
+ "extensions": ["markdown","md","mkd"]
+ },
+ "text/x-nfo": {
+ "source": "apache",
+ "extensions": ["nfo"]
+ },
+ "text/x-opml": {
+ "source": "apache",
+ "extensions": ["opml"]
+ },
+ "text/x-pascal": {
+ "source": "apache",
+ "extensions": ["p","pas"]
+ },
+ "text/x-sass": {
+ "extensions": ["sass"]
+ },
+ "text/x-scss": {
+ "extensions": ["scss"]
+ },
+ "text/x-setext": {
+ "source": "apache",
+ "extensions": ["etx"]
+ },
+ "text/x-sfv": {
+ "source": "apache",
+ "extensions": ["sfv"]
+ },
+ "text/x-uuencode": {
+ "source": "apache",
+ "extensions": ["uu"]
+ },
+ "text/x-vcalendar": {
+ "source": "apache",
+ "extensions": ["vcs"]
+ },
+ "text/x-vcard": {
+ "source": "apache",
+ "extensions": ["vcf"]
+ },
+ "text/xml": {
+ "source": "iana",
+ "compressible": true
+ },
+ "text/xml-external-parsed-entity": {
+ "source": "iana"
+ },
+ "text/yaml": {
+ "extensions": ["yaml","yml"]
+ },
+ "video/1d-interleaved-parityfec": {
+ "source": "apache"
+ },
+ "video/3gpp": {
+ "source": "apache",
+ "extensions": ["3gp"]
+ },
+ "video/3gpp-tt": {
+ "source": "apache"
+ },
+ "video/3gpp2": {
+ "source": "apache",
+ "extensions": ["3g2"]
+ },
+ "video/bmpeg": {
+ "source": "apache"
+ },
+ "video/bt656": {
+ "source": "apache"
+ },
+ "video/celb": {
+ "source": "apache"
+ },
+ "video/dv": {
+ "source": "apache"
+ },
+ "video/h261": {
+ "source": "apache",
+ "extensions": ["h261"]
+ },
+ "video/h263": {
+ "source": "apache",
+ "extensions": ["h263"]
+ },
+ "video/h263-1998": {
+ "source": "apache"
+ },
+ "video/h263-2000": {
+ "source": "apache"
+ },
+ "video/h264": {
+ "source": "apache",
+ "extensions": ["h264"]
+ },
+ "video/h264-rcdo": {
+ "source": "apache"
+ },
+ "video/h264-svc": {
+ "source": "apache"
+ },
+ "video/jpeg": {
+ "source": "apache",
+ "extensions": ["jpgv"]
+ },
+ "video/jpeg2000": {
+ "source": "apache"
+ },
+ "video/jpm": {
+ "source": "apache",
+ "extensions": ["jpm","jpgm"]
+ },
+ "video/mj2": {
+ "source": "apache",
+ "extensions": ["mj2","mjp2"]
+ },
+ "video/mp1s": {
+ "source": "apache"
+ },
+ "video/mp2p": {
+ "source": "apache"
+ },
+ "video/mp2t": {
+ "source": "apache",
+ "extensions": ["ts"]
+ },
+ "video/mp4": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["mp4","mp4v","mpg4"]
+ },
+ "video/mp4v-es": {
+ "source": "apache"
+ },
+ "video/mpeg": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["mpeg","mpg","mpe","m1v","m2v"]
+ },
+ "video/mpeg4-generic": {
+ "source": "apache"
+ },
+ "video/mpv": {
+ "source": "apache"
+ },
+ "video/nv": {
+ "source": "apache"
+ },
+ "video/ogg": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["ogv"]
+ },
+ "video/parityfec": {
+ "source": "apache"
+ },
+ "video/pointer": {
+ "source": "apache"
+ },
+ "video/quicktime": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["qt","mov"]
+ },
+ "video/raw": {
+ "source": "apache"
+ },
+ "video/rtp-enc-aescm128": {
+ "source": "apache"
+ },
+ "video/rtx": {
+ "source": "apache"
+ },
+ "video/smpte292m": {
+ "source": "apache"
+ },
+ "video/ulpfec": {
+ "source": "apache"
+ },
+ "video/vc1": {
+ "source": "apache"
+ },
+ "video/vnd.cctv": {
+ "source": "apache"
+ },
+ "video/vnd.dece.hd": {
+ "source": "apache",
+ "extensions": ["uvh","uvvh"]
+ },
+ "video/vnd.dece.mobile": {
+ "source": "apache",
+ "extensions": ["uvm","uvvm"]
+ },
+ "video/vnd.dece.mp4": {
+ "source": "apache"
+ },
+ "video/vnd.dece.pd": {
+ "source": "apache",
+ "extensions": ["uvp","uvvp"]
+ },
+ "video/vnd.dece.sd": {
+ "source": "apache",
+ "extensions": ["uvs","uvvs"]
+ },
+ "video/vnd.dece.video": {
+ "source": "apache",
+ "extensions": ["uvv","uvvv"]
+ },
+ "video/vnd.directv.mpeg": {
+ "source": "apache"
+ },
+ "video/vnd.directv.mpeg-tts": {
+ "source": "apache"
+ },
+ "video/vnd.dlna.mpeg-tts": {
+ "source": "apache"
+ },
+ "video/vnd.dvb.file": {
+ "source": "apache",
+ "extensions": ["dvb"]
+ },
+ "video/vnd.fvt": {
+ "source": "apache",
+ "extensions": ["fvt"]
+ },
+ "video/vnd.hns.video": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.1dparityfec-1010": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.1dparityfec-2005": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.2dparityfec-1010": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.2dparityfec-2005": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.ttsavc": {
+ "source": "apache"
+ },
+ "video/vnd.iptvforum.ttsmpeg2": {
+ "source": "apache"
+ },
+ "video/vnd.motorola.video": {
+ "source": "apache"
+ },
+ "video/vnd.motorola.videop": {
+ "source": "apache"
+ },
+ "video/vnd.mpegurl": {
+ "source": "apache",
+ "extensions": ["mxu","m4u"]
+ },
+ "video/vnd.ms-playready.media.pyv": {
+ "source": "apache",
+ "extensions": ["pyv"]
+ },
+ "video/vnd.nokia.interleaved-multimedia": {
+ "source": "apache"
+ },
+ "video/vnd.nokia.videovoip": {
+ "source": "apache"
+ },
+ "video/vnd.objectvideo": {
+ "source": "apache"
+ },
+ "video/vnd.sealed.mpeg1": {
+ "source": "apache"
+ },
+ "video/vnd.sealed.mpeg4": {
+ "source": "apache"
+ },
+ "video/vnd.sealed.swf": {
+ "source": "apache"
+ },
+ "video/vnd.sealedmedia.softseal.mov": {
+ "source": "apache"
+ },
+ "video/vnd.uvvu.mp4": {
+ "source": "apache",
+ "extensions": ["uvu","uvvu"]
+ },
+ "video/vnd.vivo": {
+ "source": "apache",
+ "extensions": ["viv"]
+ },
+ "video/webm": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["webm"]
+ },
+ "video/x-f4v": {
+ "source": "apache",
+ "extensions": ["f4v"]
+ },
+ "video/x-fli": {
+ "source": "apache",
+ "extensions": ["fli"]
+ },
+ "video/x-flv": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["flv"]
+ },
+ "video/x-m4v": {
+ "source": "apache",
+ "extensions": ["m4v"]
+ },
+ "video/x-matroska": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["mkv","mk3d","mks"]
+ },
+ "video/x-mng": {
+ "source": "apache",
+ "extensions": ["mng"]
+ },
+ "video/x-ms-asf": {
+ "source": "apache",
+ "extensions": ["asf","asx"]
+ },
+ "video/x-ms-vob": {
+ "source": "apache",
+ "extensions": ["vob"]
+ },
+ "video/x-ms-wm": {
+ "source": "apache",
+ "extensions": ["wm"]
+ },
+ "video/x-ms-wmv": {
+ "source": "apache",
+ "compressible": false,
+ "extensions": ["wmv"]
+ },
+ "video/x-ms-wmx": {
+ "source": "apache",
+ "extensions": ["wmx"]
+ },
+ "video/x-ms-wvx": {
+ "source": "apache",
+ "extensions": ["wvx"]
+ },
+ "video/x-msvideo": {
+ "source": "apache",
+ "extensions": ["avi"]
+ },
+ "video/x-sgi-movie": {
+ "source": "apache",
+ "extensions": ["movie"]
+ },
+ "video/x-smv": {
+ "source": "apache",
+ "extensions": ["smv"]
+ },
+ "x-conference/x-cooltalk": {
+ "source": "apache",
+ "extensions": ["ice"]
+ },
+ "x-shader/x-fragment": {
+ "compressible": true
+ },
+ "x-shader/x-vertex": {
+ "compressible": true
+ }
+}
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/index.js b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/index.js
new file mode 100755
index 00000000..551031f6
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/index.js
@@ -0,0 +1,11 @@
+/*!
+ * mime-db
+ * Copyright(c) 2014 Jonathan Ong
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = require('./db.json')
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/package.json b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/package.json
new file mode 100755
index 00000000..70438aca
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/node_modules/mime-db/package.json
@@ -0,0 +1,93 @@
+{
+ "name": "mime-db",
+ "description": "Media Type Database",
+ "version": "1.8.0",
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ {
+ "name": "Robert Kieffer",
+ "email": "robert@broofa.com",
+ "url": "http://github.com/broofa"
+ }
+ ],
+ "license": "MIT",
+ "keywords": [
+ "mime",
+ "db",
+ "type",
+ "types",
+ "database",
+ "charset",
+ "charsets"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/mime-db"
+ },
+ "devDependencies": {
+ "bluebird": "~2.9.14",
+ "co": "~4.4.0",
+ "cogent": "1",
+ "csv-parse": "0.0.9",
+ "gnode": "0.1.1",
+ "istanbul": "0.3.7",
+ "mocha": "~1.21.4",
+ "raw-body": "~1.3.3",
+ "stream-to-array": "2"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "README.md",
+ "db.json",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "build": "node scripts/build",
+ "fetch": "gnode scripts/extensions && gnode scripts/types",
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/",
+ "update": "npm run fetch && npm run build"
+ },
+ "gitHead": "cd5730a475ff03d2ef49fc571d5510a548b63494",
+ "bugs": {
+ "url": "https://github.com/jshttp/mime-db/issues"
+ },
+ "homepage": "https://github.com/jshttp/mime-db",
+ "_id": "mime-db@1.8.0",
+ "_shasum": "82a9b385f22b0f5954dec4d445faba0722c4ad25",
+ "_from": "mime-db@~1.8.0",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "82a9b385f22b0f5954dec4d445faba0722c4ad25",
+ "tarball": "http://registry.npmjs.org/mime-db/-/mime-db-1.8.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/mime-db/-/mime-db-1.8.0.tgz"
+}
diff --git a/server/node_modules/express/node_modules/type-is/node_modules/mime-types/package.json b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/package.json
new file mode 100755
index 00000000..5fe0d5d1
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/node_modules/mime-types/package.json
@@ -0,0 +1,83 @@
+{
+ "name": "mime-types",
+ "description": "The ultimate javascript content-type utility.",
+ "version": "2.0.10",
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Jeremiah Senkpiel",
+ "email": "fishrock123@rocketmail.com",
+ "url": "https://searchbeam.jit.su"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ }
+ ],
+ "license": "MIT",
+ "keywords": [
+ "mime",
+ "types"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/mime-types"
+ },
+ "dependencies": {
+ "mime-db": "~1.8.0"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.7",
+ "mocha": "~1.21.5"
+ },
+ "files": [
+ "HISTORY.md",
+ "LICENSE",
+ "index.js"
+ ],
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec test/test.js",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot test/test.js",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter dot test/test.js"
+ },
+ "gitHead": "9d4533a2b3a68af48a7f3ded9f8f525648e7bcc1",
+ "bugs": {
+ "url": "https://github.com/jshttp/mime-types/issues"
+ },
+ "homepage": "https://github.com/jshttp/mime-types",
+ "_id": "mime-types@2.0.10",
+ "_shasum": "eacd81bb73cab2a77447549a078d4f2018c67b4d",
+ "_from": "mime-types@~2.0.4",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "dist": {
+ "shasum": "eacd81bb73cab2a77447549a078d4f2018c67b4d",
+ "tarball": "http://registry.npmjs.org/mime-types/-/mime-types-2.0.10.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/mime-types/-/mime-types-2.0.10.tgz"
+}
diff --git a/server/node_modules/express/node_modules/type-is/package.json b/server/node_modules/express/node_modules/type-is/package.json
new file mode 100755
index 00000000..2d140a38
--- /dev/null
+++ b/server/node_modules/express/node_modules/type-is/package.json
@@ -0,0 +1,92 @@
+{
+ "name": "type-is",
+ "description": "Infer the content-type of a request.",
+ "version": "1.5.7",
+ "author": {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com",
+ "url": "http://jongleberry.com"
+ },
+ "contributors": [
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ }
+ ],
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/type-is"
+ },
+ "dependencies": {
+ "media-typer": "0.3.0",
+ "mime-types": "~2.0.9"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.5",
+ "mocha": "~1.21.5"
+ },
+ "engines": {
+ "node": ">= 0.6"
+ },
+ "files": [
+ "LICENSE",
+ "HISTORY.md",
+ "index.js"
+ ],
+ "scripts": {
+ "test": "mocha --reporter spec --check-leaks --bail test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "keywords": [
+ "content",
+ "type",
+ "checking"
+ ],
+ "gitHead": "f4335cc563a98ee80366f04f67c50cef089ae803",
+ "bugs": {
+ "url": "https://github.com/jshttp/type-is/issues"
+ },
+ "homepage": "https://github.com/jshttp/type-is",
+ "_id": "type-is@1.5.7",
+ "_shasum": "b9368a593cc6ef7d0645e78b2f4c64cbecd05e90",
+ "_from": "type-is@~1.5.3",
+ "_npmVersion": "1.4.28",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ {
+ "name": "mscdex",
+ "email": "mscdex@mscdex.net"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "b9368a593cc6ef7d0645e78b2f4c64cbecd05e90",
+ "tarball": "http://registry.npmjs.org/type-is/-/type-is-1.5.7.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/type-is/-/type-is-1.5.7.tgz"
+}
diff --git a/server/node_modules/express/node_modules/utils-merge/.travis.yml b/server/node_modules/express/node_modules/utils-merge/.travis.yml
new file mode 100755
index 00000000..af92b021
--- /dev/null
+++ b/server/node_modules/express/node_modules/utils-merge/.travis.yml
@@ -0,0 +1,6 @@
+language: "node_js"
+node_js:
+ - "0.4"
+ - "0.6"
+ - "0.8"
+ - "0.10"
diff --git a/server/node_modules/express/node_modules/utils-merge/LICENSE b/server/node_modules/express/node_modules/utils-merge/LICENSE
new file mode 100755
index 00000000..e33bd10b
--- /dev/null
+++ b/server/node_modules/express/node_modules/utils-merge/LICENSE
@@ -0,0 +1,20 @@
+(The MIT License)
+
+Copyright (c) 2013 Jared Hanson
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS
+FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR
+COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER
+IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN
+CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/utils-merge/README.md b/server/node_modules/express/node_modules/utils-merge/README.md
new file mode 100755
index 00000000..2f94e9bd
--- /dev/null
+++ b/server/node_modules/express/node_modules/utils-merge/README.md
@@ -0,0 +1,34 @@
+# utils-merge
+
+Merges the properties from a source object into a destination object.
+
+## Install
+
+ $ npm install utils-merge
+
+## Usage
+
+```javascript
+var a = { foo: 'bar' }
+ , b = { bar: 'baz' };
+
+merge(a, b);
+// => { foo: 'bar', bar: 'baz' }
+```
+
+## Tests
+
+ $ npm install
+ $ npm test
+
+[](http://travis-ci.org/jaredhanson/utils-merge)
+
+## Credits
+
+ - [Jared Hanson](http://github.com/jaredhanson)
+
+## License
+
+[The MIT License](http://opensource.org/licenses/MIT)
+
+Copyright (c) 2013 Jared Hanson <[http://jaredhanson.net/](http://jaredhanson.net/)>
diff --git a/server/node_modules/express/node_modules/utils-merge/index.js b/server/node_modules/express/node_modules/utils-merge/index.js
new file mode 100755
index 00000000..4265c694
--- /dev/null
+++ b/server/node_modules/express/node_modules/utils-merge/index.js
@@ -0,0 +1,23 @@
+/**
+ * Merge object b with object a.
+ *
+ * var a = { foo: 'bar' }
+ * , b = { bar: 'baz' };
+ *
+ * merge(a, b);
+ * // => { foo: 'bar', bar: 'baz' }
+ *
+ * @param {Object} a
+ * @param {Object} b
+ * @return {Object}
+ * @api public
+ */
+
+exports = module.exports = function(a, b){
+ if (a && b) {
+ for (var key in b) {
+ a[key] = b[key];
+ }
+ }
+ return a;
+};
diff --git a/server/node_modules/express/node_modules/utils-merge/package.json b/server/node_modules/express/node_modules/utils-merge/package.json
new file mode 100755
index 00000000..305d5e10
--- /dev/null
+++ b/server/node_modules/express/node_modules/utils-merge/package.json
@@ -0,0 +1,60 @@
+{
+ "name": "utils-merge",
+ "version": "1.0.0",
+ "description": "merge() utility function",
+ "keywords": [
+ "util"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/jaredhanson/utils-merge.git"
+ },
+ "bugs": {
+ "url": "http://github.com/jaredhanson/utils-merge/issues"
+ },
+ "author": {
+ "name": "Jared Hanson",
+ "email": "jaredhanson@gmail.com",
+ "url": "http://www.jaredhanson.net/"
+ },
+ "licenses": [
+ {
+ "type": "MIT",
+ "url": "http://www.opensource.org/licenses/MIT"
+ }
+ ],
+ "main": "./index",
+ "dependencies": {},
+ "devDependencies": {
+ "mocha": "1.x.x",
+ "chai": "1.x.x"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --require test/bootstrap/node test/*.test.js"
+ },
+ "engines": {
+ "node": ">= 0.4.0"
+ },
+ "_id": "utils-merge@1.0.0",
+ "dist": {
+ "shasum": "0294fb922bb9375153541c4f7096231f287c8af8",
+ "tarball": "http://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz"
+ },
+ "_from": "utils-merge@1.0.0",
+ "_npmVersion": "1.2.25",
+ "_npmUser": {
+ "name": "jaredhanson",
+ "email": "jaredhanson@gmail.com"
+ },
+ "maintainers": [
+ {
+ "name": "jaredhanson",
+ "email": "jaredhanson@gmail.com"
+ }
+ ],
+ "directories": {},
+ "_shasum": "0294fb922bb9375153541c4f7096231f287c8af8",
+ "_resolved": "https://registry.npmjs.org/utils-merge/-/utils-merge-1.0.0.tgz",
+ "readme": "ERROR: No README data found!",
+ "homepage": "https://github.com/jaredhanson/utils-merge"
+}
diff --git a/server/node_modules/express/node_modules/vary/.npmignore b/server/node_modules/express/node_modules/vary/.npmignore
new file mode 100755
index 00000000..cd39b772
--- /dev/null
+++ b/server/node_modules/express/node_modules/vary/.npmignore
@@ -0,0 +1,3 @@
+coverage/
+test/
+.travis.yml
diff --git a/server/node_modules/express/node_modules/vary/History.md b/server/node_modules/express/node_modules/vary/History.md
new file mode 100755
index 00000000..e5d8e694
--- /dev/null
+++ b/server/node_modules/express/node_modules/vary/History.md
@@ -0,0 +1,16 @@
+1.0.0 / 2014-08-10
+==================
+
+ * Accept valid `Vary` header string as `field`
+ * Add `vary.append` for low-level string manipulation
+ * Move to `jshttp` orgainzation
+
+0.1.0 / 2014-06-05
+==================
+
+ * Support array of fields to set
+
+0.0.0 / 2014-06-04
+==================
+
+ * Initial release
diff --git a/server/node_modules/express/node_modules/vary/LICENSE b/server/node_modules/express/node_modules/vary/LICENSE
new file mode 100755
index 00000000..b7dce6cf
--- /dev/null
+++ b/server/node_modules/express/node_modules/vary/LICENSE
@@ -0,0 +1,22 @@
+(The MIT License)
+
+Copyright (c) 2014 Douglas Christopher Wilson
+
+Permission is hereby granted, free of charge, to any person obtaining
+a copy of this software and associated documentation files (the
+'Software'), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be
+included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/server/node_modules/express/node_modules/vary/README.md b/server/node_modules/express/node_modules/vary/README.md
new file mode 100755
index 00000000..82392d08
--- /dev/null
+++ b/server/node_modules/express/node_modules/vary/README.md
@@ -0,0 +1,59 @@
+# vary
+
+[](https://www.npmjs.org/package/vary)
+[](http://nodejs.org/download/)
+[](https://travis-ci.org/jshttp/vary)
+[](https://coveralls.io/r/jshttp/vary)
+[](https://www.gittip.com/dougwilson/)
+
+Manipulate the HTTP Vary header
+
+## Install
+
+```sh
+$ npm install vary
+```
+
+## API
+
+```js
+var vary = require('vary')
+```
+
+### vary(res, field)
+
+Adds the given header `field` to the `Vary` response header of `res`.
+This can be a string of a single field, a string of a valid `Vary`
+header, or an array of multiple fields.
+
+This will append the header if not already listed, otherwise leaves
+it listed in the current location.
+
+```js
+// Append "Origin" to the Vary header of the response
+vary(res, 'Origin')
+```
+
+### vary.append(header, field)
+
+Adds the given header `field` to the `Vary` response header string `header`.
+This can be a string of a single field, a string of a valid `Vary` header,
+or an array of multiple fields.
+
+This will append the header if not already listed, otherwise leaves
+it listed in the current location. The new header string is returned.
+
+```js
+// Get header string appending "Origin" to "Accept, User-Agent"
+vary.append('Accept, User-Agent', 'Origin')
+```
+
+## Testing
+
+```sh
+$ npm test
+```
+
+## License
+
+[MIT](LICENSE)
diff --git a/server/node_modules/express/node_modules/vary/index.js b/server/node_modules/express/node_modules/vary/index.js
new file mode 100755
index 00000000..1e544e81
--- /dev/null
+++ b/server/node_modules/express/node_modules/vary/index.js
@@ -0,0 +1,112 @@
+/*!
+ * vary
+ * Copyright(c) 2014 Douglas Christopher Wilson
+ * MIT Licensed
+ */
+
+/**
+ * Module exports.
+ */
+
+module.exports = vary;
+module.exports.append = append;
+
+/**
+ * Variables.
+ */
+
+var separators = /[\(\)<>@,;:\\"\/\[\]\?=\{\}\u0020\u0009]/;
+
+/**
+ * Append a field to a vary header.
+ *
+ * @param {String} header
+ * @param {String|Array} field
+ * @return {String}
+ * @api public
+ */
+
+function append(header, field) {
+ if (typeof header !== 'string') {
+ throw new TypeError('header argument is required');
+ }
+
+ if (!field) {
+ throw new TypeError('field argument is required');
+ }
+
+ // get fields array
+ var fields = !Array.isArray(field)
+ ? parse(String(field))
+ : field;
+
+ // assert on invalid fields
+ for (var i = 0; i < fields.length; i++) {
+ if (separators.test(fields[i])) {
+ throw new TypeError('field argument contains an invalid header');
+ }
+ }
+
+ // existing, unspecified vary
+ if (header === '*') {
+ return header;
+ }
+
+ // enumerate current values
+ var vals = parse(header.toLowerCase());
+
+ // unspecified vary
+ if (fields.indexOf('*') !== -1 || vals.indexOf('*') !== -1) {
+ return '*';
+ }
+
+ for (var i = 0; i < fields.length; i++) {
+ field = fields[i].toLowerCase();
+
+ // append value (case-preserving)
+ if (vals.indexOf(field) === -1) {
+ vals.push(field);
+ header = header
+ ? header + ', ' + fields[i]
+ : fields[i];
+ }
+ }
+
+ return header;
+}
+
+/**
+ * Parse a vary header into an array.
+ *
+ * @param {String} header
+ * @return {Array}
+ * @api private
+ */
+
+function parse(header) {
+ return header.trim().split(/ *, */);
+}
+
+/**
+ * Mark that a request is varied on a header field.
+ *
+ * @param {Object} res
+ * @param {String|Array} field
+ * @api public
+ */
+
+function vary(res, field) {
+ if (!res || !res.getHeader || !res.setHeader) {
+ // quack quack
+ throw new TypeError('res argument is required');
+ }
+
+ // get existing header
+ var val = res.getHeader('Vary') || ''
+ var header = Array.isArray(val)
+ ? val.join(', ')
+ : String(val);
+
+ // set new header
+ res.setHeader('Vary', append(header, field));
+}
diff --git a/server/node_modules/express/node_modules/vary/package.json b/server/node_modules/express/node_modules/vary/package.json
new file mode 100755
index 00000000..4c4bd623
--- /dev/null
+++ b/server/node_modules/express/node_modules/vary/package.json
@@ -0,0 +1,71 @@
+{
+ "name": "vary",
+ "description": "Manipulate the HTTP Vary header",
+ "version": "1.0.0",
+ "author": {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "license": "MIT",
+ "keywords": [
+ "http",
+ "res",
+ "vary"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/jshttp/vary"
+ },
+ "devDependencies": {
+ "istanbul": "0.3.0",
+ "mocha": "~1.21.4",
+ "should": "~4.0.4",
+ "supertest": "~0.13.0"
+ },
+ "engines": {
+ "node": ">= 0.8.0"
+ },
+ "scripts": {
+ "test": "mocha --reporter spec --bail --check-leaks test/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --reporter dot --check-leaks test/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --reporter spec --check-leaks test/"
+ },
+ "gitHead": "56acecd9fa20888132563b00576625ea02a69a35",
+ "bugs": {
+ "url": "https://github.com/jshttp/vary/issues"
+ },
+ "homepage": "https://github.com/jshttp/vary",
+ "_id": "vary@1.0.0",
+ "_shasum": "c5e76cec20d3820d8f2a96e7bee38731c34da1e7",
+ "_from": "vary@~1.0.0",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "fishrock123",
+ "email": "fishrock123@rocketmail.com"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "c5e76cec20d3820d8f2a96e7bee38731c34da1e7",
+ "tarball": "http://registry.npmjs.org/vary/-/vary-1.0.0.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/vary/-/vary-1.0.0.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/express/package.json b/server/node_modules/express/package.json
new file mode 100755
index 00000000..492eb28c
--- /dev/null
+++ b/server/node_modules/express/package.json
@@ -0,0 +1,166 @@
+{
+ "name": "express",
+ "description": "Fast, unopinionated, minimalist web framework",
+ "version": "4.10.2",
+ "author": {
+ "name": "TJ Holowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ "contributors": [
+ {
+ "name": "Aaron Heckmann",
+ "email": "aaron.heckmann+github@gmail.com"
+ },
+ {
+ "name": "Ciaran Jessup",
+ "email": "ciaranj@gmail.com"
+ },
+ {
+ "name": "Douglas Christopher Wilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "Guillermo Rauch",
+ "email": "rauchg@gmail.com"
+ },
+ {
+ "name": "Jonathan Ong",
+ "email": "me@jongleberry.com"
+ },
+ {
+ "name": "Roman Shtylman",
+ "email": "shtylman+expressjs@gmail.com"
+ },
+ {
+ "name": "Young Jae Sim",
+ "email": "hanul@hanul.me"
+ }
+ ],
+ "license": "MIT",
+ "repository": {
+ "type": "git",
+ "url": "https://github.com/strongloop/express"
+ },
+ "homepage": "http://expressjs.com/",
+ "keywords": [
+ "express",
+ "framework",
+ "sinatra",
+ "web",
+ "rest",
+ "restful",
+ "router",
+ "app",
+ "api"
+ ],
+ "dependencies": {
+ "accepts": "~1.1.3",
+ "content-disposition": "0.5.0",
+ "cookie-signature": "1.0.5",
+ "debug": "~2.1.0",
+ "depd": "~1.0.0",
+ "escape-html": "1.0.1",
+ "etag": "~1.5.0",
+ "finalhandler": "0.3.2",
+ "fresh": "0.2.4",
+ "media-typer": "0.3.0",
+ "methods": "1.1.0",
+ "on-finished": "~2.1.1",
+ "parseurl": "~1.3.0",
+ "path-to-regexp": "0.1.3",
+ "proxy-addr": "~1.0.3",
+ "qs": "2.3.2",
+ "range-parser": "~1.0.2",
+ "send": "0.10.1",
+ "serve-static": "~1.7.1",
+ "type-is": "~1.5.3",
+ "vary": "~1.0.0",
+ "cookie": "0.1.2",
+ "merge-descriptors": "0.0.2",
+ "utils-merge": "1.0.0"
+ },
+ "devDependencies": {
+ "after": "0.8.1",
+ "istanbul": "0.3.2",
+ "mocha": "~2.0.0",
+ "should": "~4.2.1",
+ "supertest": "~0.14.0",
+ "ejs": "~1.0.0",
+ "marked": "0.3.2",
+ "hjs": "~0.0.6",
+ "body-parser": "~1.9.1",
+ "connect-redis": "~2.1.0",
+ "cookie-parser": "~1.3.3",
+ "express-session": "~1.9.1",
+ "jade": "~1.7.0",
+ "method-override": "~2.3.0",
+ "morgan": "~1.4.1",
+ "multiparty": "~4.0.0",
+ "vhost": "~3.0.0"
+ },
+ "engines": {
+ "node": ">= 0.10.0"
+ },
+ "files": [
+ "LICENSE",
+ "History.md",
+ "Readme.md",
+ "index.js",
+ "lib/"
+ ],
+ "scripts": {
+ "test": "mocha --require test/support/env --reporter spec --bail --check-leaks test/ test/acceptance/",
+ "test-cov": "istanbul cover node_modules/mocha/bin/_mocha -- --require test/support/env --reporter dot --check-leaks test/ test/acceptance/",
+ "test-tap": "mocha --require test/support/env --reporter tap --check-leaks test/ test/acceptance/",
+ "test-travis": "istanbul cover node_modules/mocha/bin/_mocha --report lcovonly -- --require test/support/env --reporter spec --check-leaks test/ test/acceptance/"
+ },
+ "gitHead": "ac56cf46063e461fbaf53c2c869a1a657e8adbe1",
+ "bugs": {
+ "url": "https://github.com/strongloop/express/issues"
+ },
+ "_id": "express@4.10.2",
+ "_shasum": "df06dde94d968932829d440a2004c5efe64495b0",
+ "_from": "express@4.10.2",
+ "_npmVersion": "1.4.21",
+ "_npmUser": {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ "maintainers": [
+ {
+ "name": "tjholowaychuk",
+ "email": "tj@vision-media.ca"
+ },
+ {
+ "name": "jongleberry",
+ "email": "jonathanrichardong@gmail.com"
+ },
+ {
+ "name": "shtylman",
+ "email": "shtylman@gmail.com"
+ },
+ {
+ "name": "dougwilson",
+ "email": "doug@somethingdoug.com"
+ },
+ {
+ "name": "aredridel",
+ "email": "aredridel@nbtsc.org"
+ },
+ {
+ "name": "strongloop",
+ "email": "callback@strongloop.com"
+ },
+ {
+ "name": "rfeng",
+ "email": "enjoyjava@gmail.com"
+ }
+ ],
+ "dist": {
+ "shasum": "df06dde94d968932829d440a2004c5efe64495b0",
+ "tarball": "http://registry.npmjs.org/express/-/express-4.10.2.tgz"
+ },
+ "directories": {},
+ "_resolved": "https://registry.npmjs.org/express/-/express-4.10.2.tgz",
+ "readme": "ERROR: No README data found!"
+}
diff --git a/server/node_modules/mongodb/.travis.yml b/server/node_modules/mongodb/.travis.yml
new file mode 100755
index 00000000..1b47243d
--- /dev/null
+++ b/server/node_modules/mongodb/.travis.yml
@@ -0,0 +1,10 @@
+language: node_js
+node_js:
+ - 0.10
+ - 0.12
+sudo: false
+env:
+ - MONGODB_VERSION=2.2.x
+ - MONGODB_VERSION=2.4.x
+ - MONGODB_VERSION=2.6.x
+ - MONGODB_VERSION=3.0.x
diff --git a/server/node_modules/mongodb/HISTORY.md b/server/node_modules/mongodb/HISTORY.md
new file mode 100755
index 00000000..0d6b6ebe
--- /dev/null
+++ b/server/node_modules/mongodb/HISTORY.md
@@ -0,0 +1,1105 @@
+2.0.27 04-07-2015
+-----------------
+- NODE-410 Correctly handle issue with pause/resume in Node 0.10.x that causes exceptions when using the Node 0.12.0 style streams.
+
+2.0.26 04-07-2015
+-----------------
+- Implements the Common Index specification Standard API at https://github.com/mongodb/specifications/blob/master/source/index-management.rst.
+- NODE-408 Expose GridStore.currentChunk.chunkNumber.
+
+2.0.25 03-26-2015
+-----------------
+- Upgraded mongodb-core to 1.1.21, making the C++ bson code an optional dependency to the bson module.
+
+2.0.24 03-24-2015
+-----------------
+- NODE-395 Socket Not Closing, db.close called before full set finished initalizing leading to server connections in progress not being closed properly.
+- Upgraded mongodb-core to 1.1.20.
+
+2.0.23 2015-03-21
+-----------------
+- NODE-380 Correctly return MongoError from toError method.
+- Fixed issue where addCursorFlag was not correctly setting the flag on the command for mongodb-core.
+- NODE-388 Changed length from method to property on order.js/unordered.js bulk operations.
+- Upgraded mongodb-core to 1.1.19.
+
+2.0.22 2015-03-16
+-----------------
+- NODE-377, fixed issue where tags would correctly be checked on secondary and nearest to filter out eligible server candidates.
+- Upgraded mongodb-core to 1.1.17.
+
+2.0.21 2015-03-06
+-----------------
+- Upgraded mongodb-core to 1.1.16 making sslValidate default to true to force validation on connection unless overriden by the user.
+
+2.0.20 2015-03-04
+-----------------
+- Updated mongodb-core 1.1.15 to relax pickserver method.
+
+2.0.19 2015-03-03
+-----------------
+- NODE-376 Fixes issue - Unordered batch incorrectly tracks batch size when switching batch types (Issue #1261, https://github.com/meirgottlieb)
+- NODE-379 Fixes bug in cursor.count() that causes the result to always be zero for dotted collection names (Issue #1262, https://github.com/vsivsi)
+- Expose MongoError from mongodb-core (Issue #1260, https://github.com/tjconcept)
+
+2.0.18 2015-02-27
+-----------------
+- Bumped mongodb-core 1.1.14 to ensure passives are correctly added as secondaries.
+
+2.0.17 2015-02-27
+-----------------
+- NODE-336 Added length function to ordered and unordered bulk operations to be able know the amount of current operations in bulk.
+- Bumped mongodb-core 1.1.13 to ensure passives are correctly added as secondaries.
+
+2.0.16 2015-02-16
+-----------------
+- listCollection now returns filtered result correctly removing db name for 2.6 or earlier servers.
+- Bumped mongodb-core 1.1.12 to correctly work for node 0.12.0 and io.js.
+- Add ability to get collection name from cursor (Issue #1253, https://github.com/vkarpov15)
+
+2.0.15 2015-02-02
+-----------------
+- Unified behavior of listCollections results so 3.0 and pre 3.0 return same type of results.
+- Bumped mongodb-core to 1.1.11 to support per document tranforms in cursors as well as relaxing the setName requirement.
+- NODE-360 Aggregation cursor and command correctly passing down the maxTimeMS property.
+- Added ~1.0 mongodb-tools module for test running.
+- Remove the required setName for replicaset connections, if not set it will pick the first setName returned.
+
+2.0.14 2015-01-21
+-----------------
+- Fixed some MongoClient.connect options pass through issues and added test coverage.
+- Bumped mongodb-core to 1.1.9 including fixes for io.js
+
+2.0.13 2015-01-09
+-----------------
+- Bumped mongodb-core to 1.1.8.
+- Optimized query path for performance, moving Object.defineProperty outside of constructors.
+
+2.0.12 2014-12-22
+-----------------
+- Minor fixes to listCollections to ensure correct querying of a collection when using a string.
+
+2.0.11 2014-12-19
+-----------------
+- listCollections filters out index namespaces on < 2.8 correctly
+- Bumped mongo-client to 1.1.7
+
+2.0.10 2014-12-18
+-----------------
+- NODE-328 fixed db.open return when no callback available issue and added test.
+- NODE-327 Refactored listCollections to return cursor to support 2.8.
+- NODE-327 Added listIndexes method and refactored internal methods to use the new command helper.
+- NODE-335 Cannot create index for nested objects fixed by relaxing key checking for createIndex helper.
+- Enable setting of connectTimeoutMS (Issue #1235, https://github.com/vkarpov15)
+- Bumped mongo-client to 1.1.6
+
+2.0.9 2014-12-01
+----------------
+- Bumped mongodb-core to 1.1.3 fixing global leaked variables and introducing strict across all classes.
+- All classes are now strict (Issue #1233)
+- NODE-324 Refactored insert/update/remove and all other crud opts to rely on internal methods to avoid any recursion.
+- Fixed recursion issues in debug logging due to JSON.stringify()
+- Documentation fixes (Issue #1232, https://github.com/wsmoak)
+- Fix writeConcern in Db.prototype.ensureIndex (Issue #1231, https://github.com/Qard)
+
+2.0.8 2014-11-28
+----------------
+- NODE-322 Finished up prototype refactoring of Db class.
+- NODE-322 Exposed Cursor in index.js for New Relic.
+
+2.0.7 2014-11-20
+----------------
+- Bumped mongodb-core to 1.1.2 fixing a UTF8 encoding issue for collection names.
+- NODE-318 collection.update error while setting a function with serializeFunctions option.
+- Documentation fixes.
+
+2.0.6 2014-11-14
+----------------
+- Refactored code to be prototype based instead of privileged methods.
+- Bumped mongodb-core to 1.1.1 to take advantage of the prototype based refactorings.
+- Implemented missing aspects of the CRUD specification.
+- Fixed documentation issues.
+- Fixed global leak REFERENCE_BY_ID in gridfs grid_store (Issue #1225, https://github.com/j)
+- Fix LearnBoost/mongoose#2313: don't let user accidentally clobber geoNear params (Issue #1223, https://github.com/vkarpov15)
+
+2.0.5 2014-10-29
+----------------
+- Minor fixes to documentation and generation of documentation.
+- NODE-306 (No results in aggregation cursor when collection name contains a dot), Merged code for cursor and aggregation cursor.
+
+2.0.4 2014-10-23
+----------------
+- Allow for single replicaset seed list with no setName specified (Issue #1220, https://github.com/imaman)
+- Made each rewind on each call allowing for re-using the cursor.
+- Fixed issue where incorrect iterations would happen on each for extensive batchSizes.
+- NODE-301 specifying maxTimeMS on find causes all fields to be omitted from result.
+
+2.0.3 2014-10-14
+----------------
+- NODE-297 Aggregate Broken for case of pipeline with no options.
+
+2.0.2 2014-10-08
+----------------
+- Bumped mongodb-core to 1.0.2.
+- Fixed bson module dependency issue by relying on the mongodb-core one.
+- Use findOne instead of find followed by nextObject (Issue #1216, https://github.com/sergeyksv)
+
+2.0.1 2014-10-07
+----------------
+- Dependency fix
+
+2.0.0 2014-10-07
+----------------
+- First release of 2.0 driver
+
+2.0.0-alpha2 2014-10-02
+-----------------------
+- CRUD API (insertOne, insertMany, updateOne, updateMany, removeOne, removeMany, bulkWrite, findOneAndDelete, findOneAndUpdate, findOneAndReplace)
+- Cluster Management Spec compatible
+
+2.0.0-alpha1 2014-09-08
+-----------------------
+- Insert method allows only up 1000 pr batch for legacy as well as 2.6 mode
+- Streaming behavior is 0.10.x or higher with backwards compatibility using readable-stream npm package
+- Gridfs stream only available through .stream() method due to overlapping names on Gridstore object and streams in 0.10.x and higher of node
+- remove third result on update and remove and return the whole result document instead (getting rid of the weird 3 result parameters)
+ - Might break some application
+- Returns the actual mongodb-core result instead of just the number of records changed for insert/update/remove
+- MongoClient only has the connect method (no ability instantiate with Server, ReplSet or similar)
+- Removed Grid class
+- GridStore only supports w+ for metadata updates, no appending to file as it's not thread safe and can cause corruption of the data
+ + seek will fail if attempt to use with w or w+
+ + write will fail if attempted with w+ or r
+ + w+ only works for updating metadata on a file
+- Cursor toArray and each resets and re-runs the cursor
+- FindAndModify returns whole result document instead of just value
+- Extend cursor to allow for setting all the options via methods instead of dealing with the current messed up find
+- Removed db.dereference method
+- Removed db.cursorInfo method
+- Removed db.stats method
+- Removed db.collectionNames not needed anymore as it's just a specialized case of listCollections
+- Removed db.collectionInfo removed due to not being compatible with new storage engines in 2.8 as they need to use the listCollections command due to system collections not working for namespaces.
+- Added db.listCollections to replace several methods above
+
+1.4.10 2014-09-04
+-----------------
+- Fixed BSON and Kerberos compilation issues
+- Bumped BSON to ~0.2 always installing latest BSON 0.2.x series
+- Fixed Kerberos and bumped to 0.0.4
+
+1.4.9 2014-08-26
+----------------
+- Check _bsonType for Binary (Issue #1202, https://github.com/mchapman)
+- Remove duplicate Cursor constructor (Issue #1201, https://github.com/KenPowers)
+- Added missing parameter in the documentation (Issue #1199, https://github.com/wpjunior)
+- Documented third parameter on the update callback(Issue #1196, https://github.com/gabmontes)
+- NODE-240 Operations on SSL connection hang on node 0.11.x
+- NODE-235 writeResult is not being passed on when error occurs in insert
+- NODE-229 Allow count to work with query hints
+- NODE-233 collection.save() does not support fullResult
+- NODE-244 Should parseError also emit a `disconnected` event?
+- NODE-246 Cursors are inefficiently constructed and consequently cannot be promisified.
+- NODE-248 Crash with X509 auth
+- NODE-252 Uncaught Exception in Base.__executeAllServerSpecificErrorCallbacks
+- Bumped BSON parser to 0.2.12
+
+
+1.4.8 2014-08-01
+----------------
+- NODE-205 correctly emit authenticate event
+- NODE-210 ensure no undefined connection error when checking server state
+- NODE-212 correctly inherit socketTimeoutMS from replicaset when HA process adds new servers or reconnects to existing ones
+- NODE-220 don't throw error if ensureIndex errors out in Gridstore
+- Updated bson to 0.2.11 to ensure correct toBSON behavior when returning non object in nested classes
+- Fixed test running filters
+- Wrap debug log in a call to format (Issue #1187, https://github.com/andyroyle)
+- False option values should not trigger w:1 (Issue #1186, https://github.com/jsdevel)
+- Fix aggregatestream.close(Issue #1194, https://github.com/jonathanong)
+- Fixed parsing issue for w:0 in url parser when in connection string
+- Modified collection.geoNear to support a geoJSON point or legacy coordinate pair (Issue #1198, https://github.com/mmacmillan)
+
+1.4.7 2014-06-18
+----------------
+- Make callbacks to be executed in right domain when server comes back up (Issue #1184, https://github.com/anton-kotenko)
+- Fix issue where currentOp query against mongos would fail due to mongos passing through $readPreference field to mongod (CS-X)
+
+1.4.6 2014-06-12
+----------------
+- Added better support for MongoClient IP6 parsing (Issue #1181, https://github.com/micovery)
+- Remove options check on index creation (Issue #1179, Issue #1183, https://github.com/jdesboeufs, https://github.com/rubenvereecken)
+- Added missing type check before calling optional callback function (Issue #1180)
+
+1.4.5 2014-05-21
+----------------
+- Added fullResult flag to insert/update/remove which will pass raw result document back. Document contents will vary depending on the server version the driver is talking to. No attempt is made to coerce a joint response.
+- Fix to avoid MongoClient.connect hanging during auth when secondaries building indexes pre 2.6.
+- return the destination stream in GridStore.pipe (Issue #1176, https://github.com/iamdoron)
+
+1.4.4 2014-05-13
+----------------
+- Bumped BSON version to use the NaN 1.0 package, fixed strict comparison issue for ObjectID
+- Removed leaking global variable (Issue #1174, https://github.com/dainis)
+- MongoClient respects connectTimeoutMS for initial discovery process (NODE-185)
+- Fix bug with return messages larger than 16MB but smaller than max BSON Message Size (NODE-184)
+
+1.4.3 2014-05-01
+----------------
+- Clone options for commands to avoid polluting original options passed from Mongoose (Issue #1171, https://github.com/vkarpov15)
+- Made geoNear and geoHaystackSearch only clean out allowed options from command generation (Issue #1167)
+- Fixed typo for allowDiskUse (Issue #1168, https://github.com/joaofranca)
+- A 'mapReduce' function changed 'function' to instance '\